diff --git a/.classpath b/.classpath new file mode 100644 index 0000000..6acf3ee --- /dev/null +++ b/.classpath @@ -0,0 +1,37 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/.project b/.project new file mode 100644 index 0000000..e59cfdc --- /dev/null +++ b/.project @@ -0,0 +1,37 @@ + + + nlphub + + + + + + org.eclipse.jdt.core.javabuilder + + + + + org.eclipse.wst.common.project.facet.core.builder + + + + + org.eclipse.wst.validation.validationbuilder + + + + + org.eclipse.m2e.core.maven2Builder + + + + + + org.eclipse.jem.workbench.JavaEMFNature + org.eclipse.wst.common.modulecore.ModuleCoreNature + org.eclipse.jdt.core.javanature + org.eclipse.m2e.core.maven2Nature + org.eclipse.wst.common.project.facet.core.nature + org.eclipse.wst.jsdt.core.jsNature + + diff --git a/.settings/.jsdtscope b/.settings/.jsdtscope new file mode 100644 index 0000000..f179e11 --- /dev/null +++ b/.settings/.jsdtscope @@ -0,0 +1,13 @@ + + + + + + + + + + + + + diff --git a/.settings/org.eclipse.jdt.core.prefs b/.settings/org.eclipse.jdt.core.prefs new file mode 100644 index 0000000..13b3428 --- /dev/null +++ b/.settings/org.eclipse.jdt.core.prefs @@ -0,0 +1,13 @@ +eclipse.preferences.version=1 +org.eclipse.jdt.core.compiler.codegen.inlineJsrBytecode=enabled +org.eclipse.jdt.core.compiler.codegen.methodParameters=do not generate +org.eclipse.jdt.core.compiler.codegen.targetPlatform=1.8 +org.eclipse.jdt.core.compiler.codegen.unusedLocal=preserve +org.eclipse.jdt.core.compiler.compliance=1.8 +org.eclipse.jdt.core.compiler.debug.lineNumber=generate +org.eclipse.jdt.core.compiler.debug.localVariable=generate +org.eclipse.jdt.core.compiler.debug.sourceFile=generate +org.eclipse.jdt.core.compiler.problem.assertIdentifier=error +org.eclipse.jdt.core.compiler.problem.enumIdentifier=error +org.eclipse.jdt.core.compiler.problem.forbiddenReference=warning +org.eclipse.jdt.core.compiler.source=1.8 diff --git a/.settings/org.eclipse.m2e.core.prefs b/.settings/org.eclipse.m2e.core.prefs new file mode 100644 index 0000000..f897a7f --- /dev/null +++ b/.settings/org.eclipse.m2e.core.prefs @@ -0,0 +1,4 @@ +activeProfiles= +eclipse.preferences.version=1 +resolveWorkspaceProjects=true +version=1 diff --git a/.settings/org.eclipse.wst.common.component b/.settings/org.eclipse.wst.common.component new file mode 100644 index 0000000..28f0f16 --- /dev/null +++ b/.settings/org.eclipse.wst.common.component @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/.settings/org.eclipse.wst.common.project.facet.core.xml b/.settings/org.eclipse.wst.common.project.facet.core.xml new file mode 100644 index 0000000..6f9aa50 --- /dev/null +++ b/.settings/org.eclipse.wst.common.project.facet.core.xml @@ -0,0 +1,7 @@ + + + + + + + diff --git a/.settings/org.eclipse.wst.jsdt.ui.superType.container b/.settings/org.eclipse.wst.jsdt.ui.superType.container new file mode 100644 index 0000000..3bd5d0a --- /dev/null +++ b/.settings/org.eclipse.wst.jsdt.ui.superType.container @@ -0,0 +1 @@ +org.eclipse.wst.jsdt.launching.baseBrowserLibrary \ No newline at end of file diff --git a/.settings/org.eclipse.wst.jsdt.ui.superType.name b/.settings/org.eclipse.wst.jsdt.ui.superType.name new file mode 100644 index 0000000..05bd71b --- /dev/null +++ b/.settings/org.eclipse.wst.jsdt.ui.superType.name @@ -0,0 +1 @@ +Window \ No newline at end of file diff --git a/.settings/org.eclipse.wst.validation.prefs b/.settings/org.eclipse.wst.validation.prefs new file mode 100644 index 0000000..04cad8c --- /dev/null +++ b/.settings/org.eclipse.wst.validation.prefs @@ -0,0 +1,2 @@ +disabled=06target +eclipse.preferences.version=1 diff --git a/pom.xml b/pom.xml new file mode 100644 index 0000000..1994581 --- /dev/null +++ b/pom.xml @@ -0,0 +1,146 @@ + + 4.0.0 + org.gcube + nlphub + 0.0.1-SNAPSHOT + war + + 7.0.70 + 1.1 + + + + + org.gcube.distribution + maven-portal-bom + LATEST + pom + import + + + + + + + org.apache.httpcomponents + httpclient + 4.5.3 + + + + com.googlecode.json-simple + json-simple + 1.1 + compile + + + com.google.code.gson + gson + 2.8.2 + compile + + + + org.gcube.data.analysis + data-miner-manager-cl + [1.0.0-SNAPSHOT, 3.0.0-SNAPSHOT) + + compile + + + org.gcube.common + common-authorization + [2.0.0-SNAPSHOT,3.0.0-SNAPSHOT) + compile + + + org.gcube.common + authorization-client + [2.0.0-SNAPSHOT,3.0.0-SNAPSHOT) + compile + + + org.gcube.contentmanagement + storage-manager-wrapper + [2.1.0-SNAPSHOT,) + compile + + + org.gcube.resources.discovery + discovery-client + compile + + + org.gcube.core + common-configuration-scanner + [1.0.0-SNAPSHOT,) + compile + + + org.gcube.resources + registry-publisher + [1.2.1-SNAPSHOT,3.0.0-SNAPSHOT) + compile + + + org.gcube.core + common-scope + compile + + + + org.apache.tomcat + tomcat-servlet-api + ${tomcat.version} + provided + + + commons-lang + commons-lang + 2.6 + compile + + + + + org.slf4j + slf4j-api + 1.6.4 + compile + + + org.slf4j + slf4j-log4j12 + 1.6.4 + compile + + + log4j + log4j + 1.2.16 + compile + + + + junit + junit + 3.8.1 + test + + + + nlphub + + + maven-compiler-plugin + 3.5.1 + + 1.8 + 1.8 + + + + + + \ No newline at end of file diff --git a/src/main/java/org/gcube/nlphub/NLPHub.java b/src/main/java/org/gcube/nlphub/NLPHub.java new file mode 100644 index 0000000..782a5a0 --- /dev/null +++ b/src/main/java/org/gcube/nlphub/NLPHub.java @@ -0,0 +1,100 @@ +package org.gcube.nlphub; + +import java.io.IOException; +import java.io.PrintWriter; +import java.net.URL; +import java.util.ArrayList; +import java.util.List; +import java.util.Scanner; + +import javax.servlet.ServletException; +import javax.servlet.annotation.MultipartConfig; +import javax.servlet.annotation.WebServlet; +import javax.servlet.http.HttpServlet; +import javax.servlet.http.HttpServletRequest; +import javax.servlet.http.HttpServletResponse; + +import org.apache.log4j.Logger; +import org.gcube.data.analysis.dataminermanagercl.server.dmservice.SClient; +import org.gcube.data.analysis.dataminermanagercl.shared.data.OutputData; +import org.gcube.data.analysis.dataminermanagercl.shared.data.computations.ComputationId; +import org.gcube.data.analysis.dataminermanagercl.shared.data.output.MapResource; +import org.gcube.data.analysis.dataminermanagercl.shared.data.output.Resource; +import org.gcube.data.analysis.dataminermanagercl.shared.parameters.FileParameter; +import org.gcube.data.analysis.dataminermanagercl.shared.parameters.ObjectParameter; +import org.gcube.data.analysis.dataminermanagercl.shared.parameters.Parameter; +import org.gcube.nlphub.legacy.DataminerClient; +import org.gcube.nlphub.legacy.JsonManager; +//import org.gcube.dataminerclient.DataminerClient; +import org.gcube.nlphub.nlp.NlpNerRunner; + +/** + * Servlet implementation class NLPHub + */ +@WebServlet(asyncSupported = true, name = "NLPServlet", urlPatterns = { "/nlphub-servlet" }) +public class NLPHub extends HttpServlet { + private Logger logger = Logger.getLogger(NLPHub.class.getSimpleName()); + private static final long serialVersionUID = 1L; + private String service = "http://dataminer-prototypes.d4science.org/wps/"; + private String token = "df2cc5f5-63ee-48c1-b2a6-1210030c57b8-843339462"; + + /** + * @see HttpServlet#HttpServlet() + */ + public NLPHub() { + super(); + // TODO Auto-generated constructor stub + } + + /** + * @see HttpServlet#doGet(HttpServletRequest request, HttpServletResponse + * response) + */ + protected void doGet(HttpServletRequest request, HttpServletResponse response) + throws ServletException, IOException { + doWork(request, response); + } + + /** + * @see HttpServlet#doPost(HttpServletRequest request, HttpServletResponse + * response) + */ + protected void doPost(HttpServletRequest request, HttpServletResponse response) + throws ServletException, IOException { + doWork(request, response); + } + + private void doWork(HttpServletRequest request, HttpServletResponse response) throws ServletException, IOException { + try { + System.out.println("annotations: " + request.getParameter("annotations")); + System.out.println("lang: " + request.getParameter("lang")); + System.out.println("plink: " + request.getParameter("plink")); + System.out.println("algs: " + request.getParameter("algs")); + + String[] algs = request.getParameter("algs").split(","); + for(int i=0; i= 1) { + // single algorithm execution + System.out.println("algs[0]: " + algs[0]); + NlpNerRunner runner = new NlpNerRunner(service, algs, token, response); + runner.run(request.getParameter("plink"), request.getParameter("annotations"), + request.getParameter("lang")); + } else { + response.setContentType("application/json;charset=UTF-8"); + try { + PrintWriter writer = response.getWriter(); + writer.println(new JsonManager().getErrorJsonResponse("No algorithm identifiers given.")); + } catch (Exception ex) { + logger.error(ex.getLocalizedMessage()); + } + } + } catch (Exception x) { + x.printStackTrace(); + } + + } +} diff --git a/src/main/java/org/gcube/nlphub/NLPMapper.java b/src/main/java/org/gcube/nlphub/NLPMapper.java new file mode 100644 index 0000000..b422015 --- /dev/null +++ b/src/main/java/org/gcube/nlphub/NLPMapper.java @@ -0,0 +1,77 @@ +package org.gcube.nlphub; + +import java.io.IOException; +import java.util.ArrayList; +import java.util.HashMap; + +import javax.servlet.ServletException; +import javax.servlet.annotation.WebServlet; +import javax.servlet.http.HttpServlet; +import javax.servlet.http.HttpServletRequest; +import javax.servlet.http.HttpServletResponse; + +import org.apache.log4j.Logger; +import org.gcube.nlphub.nlp.NlpNerRunner; +import org.gcube.nlphub.mapper.JsonMapper; +import org.gcube.nlphub.mapper.DefaultMapper; + +/** + * Servlet implementation class NlpMapper + */ +@WebServlet("/nlphub-mapper-servlet") +public class NLPMapper extends HttpServlet { + private static final long serialVersionUID = 1L; + private Logger logger = Logger.getLogger(NLPMapper.class.getSimpleName()); + + /** + * @see HttpServlet#HttpServlet() + */ + public NLPMapper() { + super(); + } + + /** + * @see HttpServlet#doGet(HttpServletRequest request, HttpServletResponse + * response) + */ + protected void doGet(HttpServletRequest request, HttpServletResponse response) + throws ServletException, IOException { + doWork(request, response); + } + + /** + * @see HttpServlet#doPost(HttpServletRequest request, HttpServletResponse + * response) + */ + protected void doPost(HttpServletRequest request, HttpServletResponse response) + throws ServletException, IOException { + doWork(request, response); + } + + private void doWork(HttpServletRequest request, HttpServletResponse response) throws ServletException, IOException { + // response.getWriter().append("Served at: + // ").append(request.getContextPath()); + String documentLink = request.getParameter("dlink"); // link al testo (sul workspace) + String toBeMap = request.getParameter("tobemap"); + String[] tokens = toBeMap.split("|"); + String annotations = request.getParameter("annotations"); + String language = request.getParameter("language"); + + for (String token : tokens) { + String[] t = token.split(":::"); + try { + String json = ((JsonMapper)(getMapper(t[0]).newInstance())).getJson(t[0], t[1]); + + } catch (Exception e) { + logger.error(e.getLocalizedMessage()); + } + } + + //response.getWriter().write(json); + } + + private Class getMapper(String algId) throws Exception { + return Class.forName("org.gcube.nlphub.mapper.DefaultMapper"); + } + +} diff --git a/src/main/java/org/gcube/nlphub/NLPUploader.java b/src/main/java/org/gcube/nlphub/NLPUploader.java new file mode 100644 index 0000000..8c8f4fe --- /dev/null +++ b/src/main/java/org/gcube/nlphub/NLPUploader.java @@ -0,0 +1,293 @@ +package org.gcube.nlphub; + +import static org.gcube.common.authorization.client.Constants.authorizationService; + +import java.io.BufferedReader; +import java.io.IOException; +import java.io.InputStream; +import java.io.InputStreamReader; +import java.io.OutputStream; +import java.io.PrintWriter; +import java.net.HttpURLConnection; +import java.net.URL; +import java.net.URLEncoder; + +import javax.servlet.ServletException; +import javax.servlet.annotation.MultipartConfig; +import javax.servlet.annotation.WebServlet; +import javax.servlet.http.HttpServlet; +import javax.servlet.http.HttpServletRequest; +import javax.servlet.http.HttpServletResponse; +import javax.servlet.http.Part; + +import org.apache.log4j.Logger; +import org.gcube.nlphub.legacy.Constants; +import org.gcube.nlphub.legacy.JsonManager; +import org.gcube.nlphub.legacy.NlpHubException; + +/** + * Servlet implementation class NLPUploader + */ +// @WebServlet("/NLPUploader") +@WebServlet(asyncSupported = true, name = "NLPUploader", urlPatterns = { "/nlphub-uploader-servlet" }) +@MultipartConfig +public class NLPUploader extends HttpServlet { + private static final long serialVersionUID = 1L; + private Logger logger = Logger.getLogger(NLPUploader.class.getSimpleName()); + private boolean devMode = true; + private String token = "df2cc5f5-63ee-48c1-b2a6-1210030c57b8-843339462"; + + /** + * @see HttpServlet#HttpServlet() + */ + public NLPUploader() { + super(); + // TODO Auto-generated constructor stub + } + + /** + * @see HttpServlet#doGet(HttpServletRequest request, HttpServletResponse + * response) + */ + protected void doGet(HttpServletRequest request, HttpServletResponse response) + throws ServletException, IOException { + doWork(request, response); + } + + /** + * @see HttpServlet#doPost(HttpServletRequest request, HttpServletResponse + * response) + */ + protected void doPost(HttpServletRequest request, HttpServletResponse response) + throws ServletException, IOException { + doWork(request, response); + } + + private void doWork(HttpServletRequest request, HttpServletResponse response) throws ServletException, IOException { + response.setContentType("application/json;charset=UTF-8"); + if (request.getParameter("freetext") == null) + handleFileUpload(request, response); + else + handleFreeText(request, response); + } + + private void handleFreeText(HttpServletRequest request, HttpServletResponse response) + throws ServletException, IOException { + String freeText = request.getParameter("freetext"); + System.out.println(freeText); + byte[] content = freeText.getBytes("UTF-8"); + String fileName = generateFileName(); + PrintWriter writer = response.getWriter(); + try { + if (!uploadFile(content, fileName, Constants.DEFAULT_DESCRIPTION, token)) { + writer.println(new JsonManager().getErrorJsonResponse( + "Error uploading file. A file called '" + fileName + "' is already in the workspace?")); + return; + } + String link = getPublicLink(fileName, token); + writer.println(new JsonManager().getSuccessJsonResponse("" + link)); + } catch (Exception x) { + x.printStackTrace(); + logger.error(x.getClass().getName() + ": " + x.getLocalizedMessage()); + writer.println(new JsonManager().getErrorJsonResponse(x.getLocalizedMessage())); + } + } + + private void handleFileUpload(HttpServletRequest request, HttpServletResponse response) + throws ServletException, IOException { + int contentLength = request.getContentLength(); + + Part filePart = request.getPart("mytxtfile"); + + String fileName = getFileName(filePart); + + PrintWriter writer = response.getWriter(); + // allocate a buffer of request size + byte[] buffer = new byte[contentLength]; + byte[] bufferedContent; + try { + InputStream fileContent = filePart.getInputStream(); + int offset = 0, len = 100, byteRead = 0; + byte[] readBuffer = new byte[len]; + while (byteRead > -1) { + byteRead = fileContent.read(readBuffer, 0, len); + // System.out.println(byteRead); + if (byteRead > 0) { + System.arraycopy(readBuffer, 0, buffer, offset, byteRead); + offset += byteRead; + } + } + + if (offset < contentLength) { + bufferedContent = new byte[offset]; + System.arraycopy(buffer, 0, bufferedContent, 0, offset); + } else + bufferedContent = buffer; + + deleteFile(fileName, token); + + if (!uploadFile(bufferedContent, fileName, Constants.DEFAULT_DESCRIPTION, token)) { + writer.println(new JsonManager().getErrorJsonResponse( + "Error uploading file. A file called '" + fileName + "' is already in the workspace?")); + return; + } + + String link = getPublicLink(fileName, token); + writer.println(new JsonManager().getSuccessJsonResponse("" + link)); + } catch (Exception x) { + x.printStackTrace(); + logger.error(x.getClass().getName() + ": " + x.getLocalizedMessage()); + writer.println(new JsonManager().getErrorJsonResponse(x.getLocalizedMessage())); + } + + } + + private String getFileName(Part part) { + String partHeader = part.getHeader("content-disposition"); + logger.debug("Part Header: " + partHeader); + for (String content : part.getHeader("content-disposition").split(";")) { + if (content.trim().startsWith("filename")) { + return content.substring(content.indexOf('=') + 1).trim().replace("\"", ""); + } + } + return null; + } + + private String getPublicLink(String fileName, String token) throws NlpHubException { + try { + String link = ""; + String user = authorizationService().get(token).getClientInfo().getId(); + String wsRoot = "/Home/" + user + "/Workspace/"; + String webapp = "https://workspace-repository.d4science.org/home-library-webapp"; + String uri = webapp + "/rest/GetPublicLink?absPath=" + URLEncoder.encode(wsRoot + fileName, "UTF-8") + + "&shortUrl=false"; + URL url = new URL(uri); + + // System.out.println(uri); + + HttpURLConnection connection = (HttpURLConnection) url.openConnection(); + connection.setRequestProperty(Constants.TOKEN_PARAMETER, token); + connection.setDoInput(true); + connection.setDoOutput(true); + connection.setUseCaches(false); + connection.setRequestMethod("GET"); + + BufferedReader r = new BufferedReader(new InputStreamReader(connection.getInputStream())); + + StringBuffer response = new StringBuffer(); + String inputLine; + while ((inputLine = r.readLine()) != null) { + response.append(inputLine); + } + + String xmlOut = response.toString(); + // System.out.println("xmlOut: " + xmlOut); + + String begin = ""; + String end = ""; + int b = xmlOut.indexOf(begin); + int e = xmlOut.indexOf(end); + + if (xmlOut.contains("Exception") || (e < 0) || (b < 0)) { + String message = "Invalid link: " + URLEncoder.encode(xmlOut, "UTF-8"); + logger.error(message); + throw new NlpHubException(message, null); + } + + link = xmlOut.substring(b + begin.length(), e); + return link; + + } catch (Exception e) { + logger.error(e.getLocalizedMessage()); + throw new NlpHubException(e.getLocalizedMessage(), e); + } + } + + private void deleteFile(String fileName, String token) throws NlpHubException { + try { + String user = authorizationService().get(token).getClientInfo().getId(); + String wsRoot = "/Home/" + user + "/Workspace/"; + String webapp = "https://workspace-repository.d4science.org/home-library-webapp"; + String uri = webapp + "/rest/Delete?absPath=" + URLEncoder.encode(wsRoot + fileName, "UTF-8"); + URL url = new URL(uri); + + // System.out.println(uri); + + HttpURLConnection connection = (HttpURLConnection) url.openConnection(); + connection.setRequestProperty(Constants.TOKEN_PARAMETER, token); + connection.setDoInput(true); + connection.setDoOutput(true); + connection.setUseCaches(false); + connection.setRequestMethod("GET"); + + BufferedReader r = new BufferedReader(new InputStreamReader(connection.getInputStream())); + + StringBuffer response = new StringBuffer(); + String inputLine; + while ((inputLine = r.readLine()) != null) { + response.append(inputLine); + } + + String xmlOut = response.toString(); + // System.out.println(xmlOut); + } catch (Exception e) { + logger.error(e.getLocalizedMessage()); + throw new NlpHubException(e.getLocalizedMessage(), e); + } + } + + private boolean uploadFile(byte[] in, String name, String description, String token) throws NlpHubException { + OutputStream output = null; + try { + String user = authorizationService().get(token).getClientInfo().getId(); + String wsRoot = "/Home/" + user + "/Workspace/"; + String webapp = "https://workspace-repository.d4science.org/home-library-webapp"; + String uri = webapp + "/rest/Upload?name=" + URLEncoder.encode(name, "UTF-8") + "&description=" + + URLEncoder.encode(description, "UTF-8") + "&parentPath=" + URLEncoder.encode(wsRoot, "UTF-8"); + URL url = new URL(uri); + + // System.out.println(uri); + + HttpURLConnection connection = (HttpURLConnection) url.openConnection(); + connection.setRequestProperty(Constants.TOKEN_PARAMETER, token); + connection.setDoInput(true); + connection.setDoOutput(true); + connection.setUseCaches(false); + connection.setRequestProperty(Constants.CONTENT_TYPE, Constants.MIME_TEXT); + connection.setRequestMethod("POST"); + output = connection.getOutputStream(); + output.write(in); + + BufferedReader r = new BufferedReader(new InputStreamReader(connection.getInputStream())); + + StringBuffer response = new StringBuffer(); + String inputLine; + while ((inputLine = r.readLine()) != null) { + response.append(inputLine); + } + + String xmlOut = response.toString(); + // System.out.println(xmlOut); + if (xmlOut.contains("Exception")) + return false; + return true; + + } catch (Exception e) { + logger.error(e.getLocalizedMessage()); + throw new NlpHubException(e.getLocalizedMessage(), e); + } finally { + // output stream must be closed anyway... + if (output != null) + try { + output.close(); + } catch (IOException e) { + logger.error(e.getLocalizedMessage()); + } + } + } + + private String generateFileName() { + long now = System.currentTimeMillis(); + return "auto-nlp-" + now; + } +} diff --git a/src/main/java/org/gcube/nlphub/legacy/Constants.java b/src/main/java/org/gcube/nlphub/legacy/Constants.java new file mode 100644 index 0000000..0cc83fc --- /dev/null +++ b/src/main/java/org/gcube/nlphub/legacy/Constants.java @@ -0,0 +1,20 @@ +package org.gcube.nlphub.legacy; +import javax.servlet.http.HttpServletRequest; + +public class Constants { + public static String DEFAULT_DESCRIPTION = "NlpHub upload"; + public static String TOKEN_PARAMETER = "gcube-token"; + public static String TEST_TOKEN = "df2cc5f5-63ee-48c1-b2a6-1210030c57b8-843339462"; + public static String MIME_TEXT = "text/plain"; + public static String CONTENT_TYPE = "Content-Type"; + + + public static String getToken(HttpServletRequest request, boolean devMode) { + String token = request.getParameter(TOKEN_PARAMETER); + if(devMode) { + if(token == null) token = TEST_TOKEN; + } + return token; + } + +} diff --git a/src/main/java/org/gcube/nlphub/legacy/DataminerClient.java b/src/main/java/org/gcube/nlphub/legacy/DataminerClient.java new file mode 100644 index 0000000..f0d2b60 --- /dev/null +++ b/src/main/java/org/gcube/nlphub/legacy/DataminerClient.java @@ -0,0 +1,214 @@ +package org.gcube.nlphub.legacy; +//package dataminerclient; + +import java.util.List; + +import org.gcube.data.analysis.dataminermanagercl.server.DataMinerService; +import org.gcube.data.analysis.dataminermanagercl.server.dmservice.SClient; +import org.gcube.data.analysis.dataminermanagercl.server.monitor.DMMonitor; +import org.gcube.data.analysis.dataminermanagercl.server.monitor.DMMonitorListener; +import org.gcube.data.analysis.dataminermanagercl.shared.data.OutputData; +import org.gcube.data.analysis.dataminermanagercl.shared.data.computations.ComputationId; +import org.gcube.data.analysis.dataminermanagercl.shared.data.output.MapResource; +import org.gcube.data.analysis.dataminermanagercl.shared.data.output.Resource; +import org.gcube.data.analysis.dataminermanagercl.shared.parameters.Parameter; +import org.gcube.data.analysis.dataminermanagercl.shared.process.Operator; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; + +public class DataminerClient { + private String service, token; + protected String identifier; + private static Logger logger = LoggerFactory.getLogger(DataminerClient.class); + private DataMinerService dataMinerService = null; + private SClient sClient = null; + private Operator operator = null; + + public DataminerClient(String service, String identifier, String token) { + this.service = service; + this.identifier = identifier; + this.token = token; + dataMinerService = new DataMinerService(); + } + + public void init() throws DataminerClientException { + try { + sClient = dataMinerService.getClient(getToken(), getService()); + operator = sClient.getOperatorById(getIdentifier()); + } catch (Exception e) { + logger.error(e.getClass().getName() + ": " + e.getLocalizedMessage()); + throw new DataminerClientException(e.getLocalizedMessage(), e); + } + } + + public String getOperatorName() { + if (operator != null) { + return operator.getName(); + } + return ""; + } + + public String getOperatorDescription() { + if (operator != null) { + return operator.getDescription(); + } + return ""; + } + + public String getOperatorBriefDescription() { + if (operator != null) { + return operator.getBriefDescription(); + } + return ""; + } + + public List getOperatorInputParameters() throws DataminerClientException { + if (operator != null) { + try { + return sClient.getInputParameters(operator); + } + catch (Exception x) { + throw new DataminerClientException(x.getLocalizedMessage(), x); + } + } + return null; + } + + public ComputationId execute(List parameters) throws DataminerClientException { + try { + operator.setOperatorParameters(parameters); + ComputationId computationId = sClient.startComputation(operator); + monitoringComputation(computationId, sClient); + return computationId; + } catch (Exception e) { + logger.error(e.getClass().getName() + ": " + e.getLocalizedMessage()); + throw new DataminerClientException(e.getLocalizedMessage(), e); + } + } + + public String getService() { + return service; + } + + public String getIdentifier() { + return identifier; + } + + public String getToken() { + return token; + } + + public void setIdentifier(String indentifier) { + this.identifier = identifier; + } + + public void retrieveOutput(ComputationId computationId, SClient sClient) { + try { + OutputData output = sClient.getOutputDataByComputationId(computationId); + // logger.debug("Output: " + output); + Resource resource = output.getResource(); + if (resource.isMap()) { + MapResource mapResource = (MapResource) resource; + for (String key : mapResource.getMap().keySet()) { + logger.debug("Entry: " + key + " = " + mapResource.getMap().get(key)); + System.out.println("Entry: " + key + " = " + mapResource.getMap().get(key)); + } + } + + } catch (Exception e) { + logger.error(e.getLocalizedMessage()); + e.printStackTrace(); + } + } + + private void monitoringComputation(ComputationId computationId, SClient sClient) { + + DMMonitorListener listener = new DMMonitorListener() { + + @Override + public void running(double percentage) { + logger.debug("Operation Running: " + percentage); + } + + @Override + public void failed(String message, Exception exception) { + logger.error("Operation Failed"); + logger.error(message); + logger.error(exception.getStackTrace().toString()); + System.out.println(exception.getLocalizedMessage()); + } + + @Override + public void complete(double percentage) { + logger.debug("Operation Completed"); + logger.debug("Perc: " + percentage); + retrieveOutput(computationId, sClient); + + } + + @Override + public void cancelled() { + logger.debug("Operation Cancelled"); + } + + @Override + public void accepted() { + logger.debug("Operation Accepted"); + + } + }; + + DMMonitor dmMonitor = new DMMonitor(computationId, sClient); + dmMonitor.add(listener); + dmMonitor.start(); + } +/* + public static void main(String[] args) { + String service = "http://dataminer-prototypes.d4science.org/wps/"; + String identifier = ""; + identifier = "org.gcube.dataanalysis.wps.statisticalmanager.synchserver.mappedclasses.transducerers.ENGLISH_NAMED_ENTITY_RECOGNIZER"; + identifier = "org.gcube.dataanalysis.wps.statisticalmanager.synchserver.mappedclasses.transducerers.NEWSTANBOLWRAPPER"; + //identifier = "org.gcube.dataanalysis.wps.statisticalmanager.synchserver.mappedclasses.transducerers.GENERIC_OPINION_MINING_ENGLISH"; + String token = "df2cc5f5-63ee-48c1-b2a6-1210030c57b8-843339462"; + + DataminerClient dmc = new DataminerClient(service, identifier, token); + try { + dmc.init(); + System.out.println(dmc.getOperatorBriefDescription()); + System.out.println(dmc.getOperatorDescription()); + System.out.println(dmc.getOperatorName()); + List parameters = dmc.getOperatorInputParameters(); + if (parameters != null) { + System.out.println("Parameter number: " + parameters.size()); + for (Parameter p : parameters) { + System.out.println("name : " + p.getName()); + System.out.println("value: " + p.getValue()); + System.out.println("type : " + p.getTypology()); + System.out.println("desc : " + p.getDescription()); + System.out.println("toString: " + p.toString()); + System.out.println(); + } + } + + // List parameters = new ArrayList<>(); + // + // FileParameter fileName = new FileParameter(); + // fileName.setName("inputTextFile"); + // fileName.setValue("http://data.d4science.org/cWRQbHNjRVR4YjdkQXdDUnlSS0JkZVlmLzk2WnJIb1ZHbWJQNStIS0N6Yz0"); + // parameters.add(fileName); + // + // ObjectParameter options = new ObjectParameter(); + // options.setName("annotationsList"); + // //options.setValue("Address|Date|Location|Organization|Person|Money|Percent|SpaceToken"); + // options.setValue("SpaceToken"); + // parameters.add(options); + // + // ComputationId cid = dmc.execute(parameters); + // System.out.println("urlId: " + cid.getUrlId()); + } catch (Exception e) { + System.out.println("-" + e.getClass().getName() + "-\n" + e.getLocalizedMessage()); + e.printStackTrace(); + } + } +*/ +} diff --git a/src/main/java/org/gcube/nlphub/legacy/DataminerException.java b/src/main/java/org/gcube/nlphub/legacy/DataminerException.java new file mode 100644 index 0000000..0373c11 --- /dev/null +++ b/src/main/java/org/gcube/nlphub/legacy/DataminerException.java @@ -0,0 +1,7 @@ +package org.gcube.nlphub.legacy; + +class DataminerClientException extends Exception { + public DataminerClientException(String message, Throwable throwable) { + super(message, throwable); + } +}; \ No newline at end of file diff --git a/src/main/java/org/gcube/nlphub/legacy/JsonManager.java b/src/main/java/org/gcube/nlphub/legacy/JsonManager.java new file mode 100644 index 0000000..30f6126 --- /dev/null +++ b/src/main/java/org/gcube/nlphub/legacy/JsonManager.java @@ -0,0 +1,130 @@ +package org.gcube.nlphub.legacy; + + +import java.io.Reader; +import java.util.ArrayList; + +import com.google.gson.JsonArray; +import com.google.gson.JsonElement; +import com.google.gson.JsonObject; +import com.google.gson.JsonParser; + +public class JsonManager { + public static String TEXT = "text"; + public static String ANNOTATIONS = "annotations"; + public static String LANGUAGE = "language"; + public static String ALGORITHM = "algorithm"; + public static String ENTITIES = "entities"; + public static String INDICES = "indices"; + public static String RESULT = "result"; + public static String RESPONSE = "response"; + public static String OK = "Ok"; + public static String ERROR = "Error"; + public static String MESSAGE = "message"; + + private JsonObject jsonObjectRoot = null; + private JsonParser jsonParser = null; + + public JsonManager() { + jsonObjectRoot = new JsonObject(); + } + + public JsonManager(String s) { + jsonObjectRoot = (JsonObject) new JsonParser().parse(s); + } + + public JsonManager(Reader r) { + jsonObjectRoot = (JsonObject) new JsonParser().parse(r); + } + + public String getJsonAsString() { + return jsonObjectRoot.toString(); + } + + public String getSuccessJsonResponse(String[] messages) { + jsonObjectRoot.addProperty(RESPONSE, OK); + JsonArray msgs = new JsonArray(); + for(String m : messages) { + msgs.add(m); + } + jsonObjectRoot.add(MESSAGE, msgs); + return jsonObjectRoot.toString(); + } + + public String getSuccessJsonResponse(String message) { + return getResponse(true, message); + } + + public String getErrorJsonResponse(String message) { + return getResponse(false, message); + } + + private String getResponse(boolean success, String message) { + jsonObjectRoot.addProperty(RESPONSE, (success ? OK : ERROR)); + jsonObjectRoot.addProperty(MESSAGE, message); + return jsonObjectRoot.toString(); + } + +/* + public void buildNerOutputJson(NerOutput nerOut) { + // build the root json object initial property fields + jsonObjectRoot.addProperty(TEXT, nerOut.getText()); + jsonObjectRoot.addProperty(ANNOTATIONS, nerOut.getAnnotations()); + jsonObjectRoot.addProperty(LANGUAGE, nerOut.getLanguage()); + + // set the result array (main array) + JsonArray jsonResults = new JsonArray(); + ArrayList results = nerOut.getResults(); + + for (NerAlgorithmResult result : results) { + JsonObject jsonResult = buildResult(result); + jsonResults.add(jsonResult); + } + + jsonObjectRoot.add(RESULT, jsonResults); + } + + private JsonObject buildResult(NerAlgorithmResult result) { + JsonObject jsonResult = new JsonObject(); + jsonResult.addProperty(ALGORITHM, result.getAlgorithmName()); + + JsonObject jsonEntities = new JsonObject(); + ArrayList entities = result.getEntities(); + if (entities != null) + for (NerEntity entity : entities) { + JsonArray jsonEntityValues = buildEntityValues(entity); + jsonEntities.add(entity.getEntityName(), jsonEntityValues); + } + + jsonResult.add(ENTITIES, jsonEntities); + return jsonResult; + } + + private JsonArray buildEntityValues(NerEntity entity) { + // JsonObject jsonEntity = new JsonObject(); + JsonArray values = new JsonArray(); + ArrayList entityData = entity.getEntities(); + if (entityData != null) + for (NerEntityData data : entityData) { + JsonObject jsonEntityData = buildEntityData(data); + values.add(jsonEntityData); + } + // jsonEntity.add(entity.getEntityName(), values); + return values; + } + + private JsonObject buildEntityData(NerEntityData data) { + JsonObject entityData = new JsonObject(); + JsonArray indices = new JsonArray(); + indices.add(data.getStart()); + indices.add(data.getEnd()); + entityData.add(INDICES, indices); + ArrayList fields = data.getAdditionalFields(); + if (fields != null) + for (NameValue field : fields) { + entityData.addProperty(field.getName(), field.getValue()); + } + return entityData; + } + */ +} diff --git a/src/main/java/org/gcube/nlphub/legacy/NerAlgorithm.java b/src/main/java/org/gcube/nlphub/legacy/NerAlgorithm.java new file mode 100644 index 0000000..ef1866c --- /dev/null +++ b/src/main/java/org/gcube/nlphub/legacy/NerAlgorithm.java @@ -0,0 +1,76 @@ +package org.gcube.nlphub.legacy; + +import java.util.ArrayList; +import com.google.gson.JsonArray; +import com.google.gson.JsonObject; + +public class NerAlgorithm { + private String name; + private ArrayList annotationsData; + + public NerAlgorithm(String name) { + this.name = name; + annotationsData = new ArrayList<>(); + } + + public void addAnnotationData(NerAnnotationData data) { + annotationsData.add(data); + } + + public JsonObject toJson() { + JsonObject json = new JsonObject(); + json.addProperty("algorithm", name); + JsonArray data = new JsonArray(); + for (NerAnnotationData d : annotationsData) { + data.add(d.toJson()); + } + json.add("entities", data); + return json; + } + + public String getName() { + return name; + } + + public void setName(String name) { + this.name = name; + } + + public ArrayList getAnnotationsData() { + return annotationsData; + } + + public void setAnnotationsData(ArrayList annotationsData) { + this.annotationsData = annotationsData; + } + + /* + public static void main(String[] args) { + NerAlgorithm alg = new NerAlgorithm("Algorithm-name"); + + NerEntity ne1 = new NerEntity(11, 22); + ne1.addProperty("type", "scalar"); + ne1.addProperty("unit", "hours"); + + NerEntity ne2 = new NerEntity(33, 44); + ne2.addProperty("type", "scalar"); + ne2.addProperty("unit", "minutes"); + + NerAnnotationData nad = new NerAnnotationData("Measure"); + nad.addNerEntity(ne1); + nad.addNerEntity(ne2); + + alg.addAnnotationData(nad); + + ne1 = new NerEntity(0, 10); + ne2 = new NerEntity(111, 114); + nad = new NerAnnotationData("Person"); + nad.addNerEntity(ne1); + nad.addNerEntity(ne2); + + alg.addAnnotationData(nad); + + + System.out.println(alg.toJson().toString()); + }*/ +} diff --git a/src/main/java/org/gcube/nlphub/legacy/NerAnnotationData.java b/src/main/java/org/gcube/nlphub/legacy/NerAnnotationData.java new file mode 100644 index 0000000..c8a3903 --- /dev/null +++ b/src/main/java/org/gcube/nlphub/legacy/NerAnnotationData.java @@ -0,0 +1,77 @@ +package org.gcube.nlphub.legacy; + +import java.util.ArrayList; +import com.google.gson.JsonArray; +import com.google.gson.JsonObject; + +public class NerAnnotationData { + private String name; + private ArrayList nerEntities; + + /** + * Class constructor; require the name of the annotation + * @param name + */ + public NerAnnotationData(String name) { + this.name = name; + nerEntities = new ArrayList<>(); + } + + /** + * add a new NerEntity to the collection + * @param entity + */ + public void addNerEntity(NerEntity entity) { + nerEntities.add(entity); + } + + /** + * build the proper Json object. + * @return JsonObject + */ + public JsonObject toJson() { + JsonObject json = new JsonObject(); + JsonArray entities = new JsonArray(); + for(NerEntity e : nerEntities) { + entities.add(e.toJson()); + } + json.add(name,entities); + return json; + } + + + public String getName() { + return name; + } + + public void setName(String name) { + this.name = name; + } + + public ArrayList getNerEntities() { + return nerEntities; + } + + public void setNerEntities(ArrayList nerEntities) { + this.nerEntities = nerEntities; + } + + /* + public static void main(String[] args) { + NerEntity ne1 = new NerEntity(11, 22); + ne1.addProperty("type", "scalar"); + ne1.addProperty("unit", "hours"); + + NerEntity ne2 = new NerEntity(33, 44); + ne2.addProperty("type", "scalar"); + ne2.addProperty("unit", "minutes"); + + NerAnnotationData nad = new NerAnnotationData("Measure"); + nad.addNerEntity(ne1); + nad.addNerEntity(ne2); + + System.out.println(nad.toJson().toString()); + }*/ + + +} diff --git a/src/main/java/org/gcube/nlphub/legacy/NerEntity.java b/src/main/java/org/gcube/nlphub/legacy/NerEntity.java new file mode 100644 index 0000000..06dd53d --- /dev/null +++ b/src/main/java/org/gcube/nlphub/legacy/NerEntity.java @@ -0,0 +1,87 @@ +package org.gcube.nlphub.legacy; + +import java.util.HashMap; +import java.util.Set; +import com.google.gson.JsonArray; +import com.google.gson.JsonObject; + + +public class NerEntity { + private int startIndex, endIndex; + private HashMap properties = null; + + /** + * Class constructor + * @param startIndex the start index of the matching annotation + * @param endIndex the end index of the matching annotation + */ + public NerEntity(int startIndex, int endIndex) { + this.startIndex = startIndex; + this.endIndex = endIndex; + properties = new HashMap<>(); + } + + /** + * Add an additional property (property is a couple {name, value}) + * @param name + * @param value + */ + public void addProperty(String name, String value) { + properties.put(name, value); + } + + /** + * Build a proper JsonObject + * @return JsonObject + */ + public JsonObject toJson() { + JsonObject json = new JsonObject(); + + // build the "indices" array + JsonArray indices = new JsonArray(); + indices.add(startIndex); + indices.add(endIndex); + json.add("indices", indices); + + // add additional properties (if any) + Set names = properties.keySet(); + for(String n : names) { + json.addProperty(n, properties.get(n)); + } + + return json; + } + + public int getStartIndex() { + return startIndex; + } + + public void setStartIndex(int startIndex) { + this.startIndex = startIndex; + } + + public int getEndIndex() { + return endIndex; + } + + public void setEndIndex(int endIndex) { + this.endIndex = endIndex; + } + + public HashMap getProperties() { + return properties; + } + + public void setProperties(HashMap properties) { + this.properties = properties; + } + + /* + public static void main(String[] args) { + NerEntity ne = new NerEntity(11, 22); + ne.addProperty("type", "scalar"); + ne.addProperty("unit", "hour"); + System.out.println(ne.toJson().toString()); + }*/ + +} diff --git a/src/main/java/org/gcube/nlphub/legacy/NerOutput.java b/src/main/java/org/gcube/nlphub/legacy/NerOutput.java new file mode 100644 index 0000000..09beb3e --- /dev/null +++ b/src/main/java/org/gcube/nlphub/legacy/NerOutput.java @@ -0,0 +1,114 @@ +package org.gcube.nlphub.legacy; + +import java.util.ArrayList; +import com.google.gson.JsonArray; +import com.google.gson.JsonObject; + +public class NerOutput { + private String text, annotations, language; + private ArrayList result; + + public NerOutput(String text, String annotations, String language) { + this.text = text; + this.annotations = annotations; + this.language = language; + result = new ArrayList<>(); + } + + public void addNerAlgorithm(NerAlgorithm alg) { + result.add(alg); + } + + public JsonObject toJson() { + JsonObject json = new JsonObject(); + json.addProperty("text", text); + json.addProperty("annotations", annotations); + json.addProperty("language", language); + + JsonArray jResult = new JsonArray(); + for(NerAlgorithm a : result) { + jResult.add(a.toJson()); + } + + json.add("result",jResult); + return json; + } + + public String getText() { + return text; + } + + public void setText(String text) { + this.text = text; + } + + public String getAnnotations() { + return annotations; + } + + public void setAnnotations(String annotations) { + this.annotations = annotations; + } + + public String getLanguage() { + return language; + } + + public void setLanguage(String language) { + this.language = language; + } + + public ArrayList getResult() { + return result; + } + + public void setResult(ArrayList result) { + this.result = result; + } + + public static void main(String[] args) { + NerAlgorithm alg = new NerAlgorithm("Algorithm-name"); + + NerEntity ne1 = new NerEntity(11, 22); + ne1.addProperty("type", "scalar"); + ne1.addProperty("unit", "hours"); + + NerEntity ne2 = new NerEntity(33, 44); + ne2.addProperty("type", "scalar"); + ne2.addProperty("unit", "minutes"); + + NerAnnotationData nad = new NerAnnotationData("Measure"); + nad.addNerEntity(ne1); + nad.addNerEntity(ne2); + + alg.addAnnotationData(nad); + + ne1 = new NerEntity(0, 10); + ne2 = new NerEntity(111, 114); + nad = new NerAnnotationData("Person"); + nad.addNerEntity(ne1); + nad.addNerEntity(ne2); + + alg.addAnnotationData(nad); + + NerAlgorithm alg2 = new NerAlgorithm("Algorithm-name-2"); + + ne1 = new NerEntity(1, 22); + ne2 = new NerEntity(30, 33); + + nad = new NerAnnotationData("Measure"); + nad.addNerEntity(ne1); + nad.addNerEntity(ne2); + + alg2.addAnnotationData(nad); + + + NerOutput no = new NerOutput("this is the text", "Measure,Person", "english"); + no.addNerAlgorithm(alg); + no.addNerAlgorithm(alg2); + + System.out.println(no.toJson().toString()); + + } + +} diff --git a/src/main/java/org/gcube/nlphub/legacy/NlpHubException.java b/src/main/java/org/gcube/nlphub/legacy/NlpHubException.java new file mode 100644 index 0000000..4696c1b --- /dev/null +++ b/src/main/java/org/gcube/nlphub/legacy/NlpHubException.java @@ -0,0 +1,7 @@ +package org.gcube.nlphub.legacy; + +public class NlpHubException extends Exception { + public NlpHubException(String message, Throwable throwable) { + super(message, throwable); + } +} diff --git a/src/main/java/org/gcube/nlphub/mapper/DefaultMapper.java b/src/main/java/org/gcube/nlphub/mapper/DefaultMapper.java new file mode 100644 index 0000000..9481f51 --- /dev/null +++ b/src/main/java/org/gcube/nlphub/mapper/DefaultMapper.java @@ -0,0 +1,73 @@ +package org.gcube.nlphub.mapper; + +import java.io.BufferedReader; +import java.io.InputStreamReader; +import java.net.HttpURLConnection; +import java.net.URL; +import java.util.Set; + +import com.google.gson.JsonObject; +import com.google.gson.JsonParser; +import com.google.gson.JsonArray; +import com.google.gson.JsonElement; +import org.apache.log4j.Logger; +import org.gcube.nlphub.legacy.NerAlgorithm; +import org.gcube.nlphub.legacy.NerAnnotationData; +import org.gcube.nlphub.legacy.NerEntity; +import org.gcube.nlphub.nlp.NlpNerRunner; + +public class DefaultMapper implements JsonMapper { + private Logger logger = Logger.getLogger(DefaultMapper.class.getSimpleName()); + + public String getJson(String alg, String link) { + NerAlgorithm algInfo = new NerAlgorithm(alg); + try { + HttpURLConnection connection = (HttpURLConnection) new URL(link).openConnection(); + connection.setRequestMethod("GET"); + System.out.println("Content-Type: " + connection.getContentType()); + BufferedReader reader = new BufferedReader(new InputStreamReader(connection.getInputStream())); + JsonObject jsonRoot = (JsonObject) new JsonParser().parse(reader); + JsonElement entities = jsonRoot.get("entities"); + if ((entities != null) && (entities.isJsonObject())) { + JsonObject e = (JsonObject) entities; + Set properties = e.keySet(); + for (String p : properties) { + JsonElement property = e.get(p); + if (!property.isJsonArray()) + continue; + NerAnnotationData data = new NerAnnotationData(p); + JsonArray jsonAnnotation = (JsonArray) property; + int size = jsonAnnotation.size(); + for (int i = 0; i < size; i++) { + JsonElement ann = jsonAnnotation.get(i); + if (ann.isJsonObject()) { + JsonObject annotation = (JsonObject) ann; + Set fields = annotation.keySet(); + JsonArray indices = (JsonArray) annotation.get("indices"); + NerEntity ne = new NerEntity(indices.get(0).getAsInt(), indices.get(1).getAsInt()); + + for (String f : fields) { + if (f.equals("indices")) + continue; + JsonElement je = annotation.get(f); + if (!je.isJsonArray() && !je.isJsonObject() && !je.isJsonNull()) { + ne.addProperty(f, je.getAsString()); + } + } + data.addNerEntity(ne); + } + algInfo.addAnnotationData(data); + } + } + } + return algInfo.toJson().toString(); + } catch (Exception x) { + logger.error(x.getLocalizedMessage()); + return null; + } + } + + public static void main(String[] args) { + + } +} diff --git a/src/main/java/org/gcube/nlphub/mapper/JsonMapper.java b/src/main/java/org/gcube/nlphub/mapper/JsonMapper.java new file mode 100644 index 0000000..08299b9 --- /dev/null +++ b/src/main/java/org/gcube/nlphub/mapper/JsonMapper.java @@ -0,0 +1,10 @@ +package org.gcube.nlphub.mapper; + +public interface JsonMapper { + + public String getJson(String algorithm, String link); +// public String JsonObject(HashMap algs, String language); +// public String JsonObject(HashMap algs, String language, String text); + +} + diff --git a/src/main/java/org/gcube/nlphub/nlp/NlpNerRunner.java b/src/main/java/org/gcube/nlphub/nlp/NlpNerRunner.java new file mode 100644 index 0000000..c10c82d --- /dev/null +++ b/src/main/java/org/gcube/nlphub/nlp/NlpNerRunner.java @@ -0,0 +1,209 @@ +package org.gcube.nlphub.nlp; + +import java.io.PrintWriter; +import java.util.ArrayList; +import java.util.List; + +import javax.servlet.http.HttpServletResponse; + +import org.gcube.data.analysis.dataminermanagercl.server.dmservice.SClient; +import org.gcube.data.analysis.dataminermanagercl.shared.data.OutputData; +import org.gcube.data.analysis.dataminermanagercl.shared.data.computations.ComputationId; +import org.gcube.data.analysis.dataminermanagercl.shared.data.output.FileResource; +import org.gcube.data.analysis.dataminermanagercl.shared.data.output.MapResource; +import org.gcube.data.analysis.dataminermanagercl.shared.data.output.Resource; +import org.gcube.data.analysis.dataminermanagercl.shared.data.output.Resource.ResourceType; +import org.gcube.data.analysis.dataminermanagercl.shared.parameters.FileParameter; +import org.gcube.data.analysis.dataminermanagercl.shared.parameters.ObjectParameter; +import org.gcube.data.analysis.dataminermanagercl.shared.parameters.ListParameter; +import org.gcube.data.analysis.dataminermanagercl.shared.parameters.Parameter; +import org.gcube.nlphub.NLPUploader; +import org.gcube.nlphub.legacy.Constants; +import org.gcube.nlphub.legacy.DataminerClient; +import org.gcube.nlphub.legacy.JsonManager; +import org.gcube.nlphub.legacy.NlpHubException; +import org.apache.log4j.Logger; + +public class NlpNerRunner extends DataminerClient { + private Logger logger = Logger.getLogger(NlpNerRunner.class.getSimpleName()); + private HttpServletResponse response = null; + private ArrayList outputLinks; + private String[] identifiers; + private String currentId; + + /** + * This constructor is useful for local test cases... + * + * @param service + * @param identifier + * @param token + */ + public NlpNerRunner(String service, String identifier, String token) { + super(service, identifier, token); + outputLinks = new ArrayList<>(); + } + + /** + * This constructor is the "canonical one" + * + * @param service + * @param identifier + * @param token + * @param response + */ + public NlpNerRunner(String service, String[] identifiers, String token) { + super(service, "", token); + outputLinks = new ArrayList<>(); + } + + /** + * This constructor is useful when multiple alogrithm identifiers are given + * + * @param service + * @param identifiers + * @param token + */ + public NlpNerRunner(String service, String[] identifiers, String token, HttpServletResponse response) { + super(service, "", token); + this.response = response; + this.identifiers = identifiers; + outputLinks = new ArrayList<>(); + } + + @Override + public void retrieveOutput(ComputationId computationId, SClient sClient) { + try { + OutputData output = sClient.getOutputDataByComputationId(computationId); + Resource resource = output.getResource(); + if (resource.isMap()) { + MapResource mapResource = (MapResource) resource; + for (String key : mapResource.getMap().keySet()) { + Resource r = mapResource.getMap().get(key); + if (r.isFile()) { + FileResource f = (FileResource) r; + String link = f.getUrl(); + System.out.println("url: " + link); + String op = computationId.getOperatorId(); + op = op.substring(op.lastIndexOf(".") + 1); + testEndOfProcess(op + ":::" + link); + } + } + } + } catch (Exception e) { + logger.error(e.getLocalizedMessage()); + writeResponse(e.getLocalizedMessage(), false); + } + } + + public void run(String filePublicLink, String annotations, String language) throws NlpHubException { + for (String id : identifiers) { + try { + super.identifier = id; + super.init(); + List parameters = mapParameters(filePublicLink, annotations); + super.execute(parameters); + } catch (Exception e) { + logger.error(e.getLocalizedMessage()); + throw new NlpHubException(e.getLocalizedMessage(), e); + } + } + } + + public ArrayList getOutputLinks() { + return outputLinks; + } + + private synchronized void testEndOfProcess(String link) { + outputLinks.add(link); + if (outputLinks.size() == identifiers.length) { + String[] links = new String[outputLinks.size()]; + links = outputLinks.toArray(links); + writeResponse(links); + } + } + + private void writeResponse(String[] content) { + if (response != null) { + response.setContentType("application/json;charset=UTF-8"); + try { + PrintWriter writer = response.getWriter(); + writer.println(new JsonManager().getSuccessJsonResponse(content)); + } catch (Exception ex) { + logger.error(ex.getLocalizedMessage()); + } + } + + } + + private void writeResponse(String content, boolean isOk) { + if (response != null) { + response.setContentType("application/json;charset=UTF-8"); + try { + PrintWriter writer = response.getWriter(); + if (isOk) { + writer.println(new JsonManager().getSuccessJsonResponse("" + content)); + } else { + writer.println(new JsonManager().getErrorJsonResponse("" + content)); + } + } catch (Exception ex) { + logger.error(ex.getLocalizedMessage()); + } + } + } + + private List mapParameters(String publicLink, String annotations) { + List parameters = new ArrayList<>(); + try { + List inputParameters = super.getOperatorInputParameters(); + System.out.println("n. " + inputParameters.size()); + for (Parameter p : inputParameters) { + switch (p.getTypology()) { + case FILE: + FileParameter fileName = new FileParameter(); + fileName.setName(p.getName()); + fileName.setValue(publicLink); + parameters.add(fileName); + System.out.println(fileName.toString()); + break; + case LIST: + ListParameter list = new ListParameter(); + list.setName(p.getName()); + list.setValue(annotations.replace(",", "|")); + parameters.add(list); + System.out.println(list.toString()); + break; + case ENUM: + // to be managed... + break; + } + } + } catch (Exception ex) { + logger.error(ex.getLocalizedMessage()); + } + return parameters; + + } + + /* + * public static void main(String[] args) { String service = + * "http://dataminer-prototypes.d4science.org/wps/"; String identifier = ""; + * identifier = + * "org.gcube.dataanalysis.wps.statisticalmanager.synchserver.mappedclasses.transducerers.ENGLISH_NAMED_ENTITY_RECOGNIZER"; + * // identifier = // + * "org.gcube.dataanalysis.wps.statisticalmanager.synchserver.mappedclasses.transducerers.NEWSTANBOLWRAPPER"; + * // identifier = // + * "org.gcube.dataanalysis.wps.statisticalmanager.synchserver.mappedclasses.transducerers.GENERIC_OPINION_MINING_ENGLISH"; + * String token = "df2cc5f5-63ee-48c1-b2a6-1210030c57b8-843339462"; String + * pLink = + * "http://data.d4science.org/RW9KZDJ0eU9ZZlRNWEhLYmtVa3ltL0Y1UWdhdmZvTlVHbWJQNStIS0N6Yz0"; + * + * ArrayList params = new ArrayList<>(); NlpParameter p = new + * NlpParameter(NlpParameter.ANNOTATION_LIST, "", "Person,Token", 0); + * params.add(p); + * + * NlpNerRunner runner = new NlpNerRunner(service, identifier, token); // + * try { // runner.run(pLink, service, identifier, params); // } catch + * (NlpHubException e) { // e.printStackTrace(); // } } + */ + +} diff --git a/src/main/java/org/gcube/nlphub/nlp/NlpParameter.java b/src/main/java/org/gcube/nlphub/nlp/NlpParameter.java new file mode 100644 index 0000000..d3d3612 --- /dev/null +++ b/src/main/java/org/gcube/nlphub/nlp/NlpParameter.java @@ -0,0 +1,34 @@ +package org.gcube.nlphub.nlp; + +public class NlpParameter { + public static String ANNOTATION_LIST = "annotations"; + private String name, description; + private Object value; + private int objectType; + + public NlpParameter(String name, String description, Object value, int objectType) { + super(); + this.name = name; + this.description = description; + this.value = value; + this.objectType = objectType; + } + + public String getName() { + return name; + } + + public String getDescription() { + return description; + } + + public Object getValue() { + return value; + } + + public int getObjectType() { + return objectType; + } + + +} diff --git a/src/main/resources/clientlog4j.properties b/src/main/resources/clientlog4j.properties new file mode 100644 index 0000000..4a2e1cd --- /dev/null +++ b/src/main/resources/clientlog4j.properties @@ -0,0 +1,12 @@ +log4j.rootLogger=DEBUG, A1 +log4j.appender.A1=org.apache.log4j.ConsoleAppender +log4j.appender.A1.layout=org.apache.log4j.PatternLayout + +# Print the date in ISO 8601 format +log4j.appender.A1.layout.ConversionPattern=%d [%t] %-5p %c - %m%n + +# Print only messages of level TRACE or above in the package org.gcube +log4j.logger.org.gcube=TRACE +log4j.logger.org.gcube.application.framework.core.session=INFO +log4j.logger.org.gcube.common.scope.impl.DefaultScopeProvider=ERROR +log4j.logger.com.netflix.astyanax.connectionpool.impl.CountingConnectionPoolMonitor=ERROR \ No newline at end of file diff --git a/src/main/resources/logback-test.xml b/src/main/resources/logback-test.xml new file mode 100644 index 0000000..93b1a59 --- /dev/null +++ b/src/main/resources/logback-test.xml @@ -0,0 +1,20 @@ + + + + + + + %d{HH:mm:ss.SSS} [%thread] %-5level %logger{0}: %msg%n + + + + + + + + + + + + + \ No newline at end of file diff --git a/src/main/webapp/WEB-INF/web.xml b/src/main/webapp/WEB-INF/web.xml new file mode 100644 index 0000000..7e834fb --- /dev/null +++ b/src/main/webapp/WEB-INF/web.xml @@ -0,0 +1,36 @@ + + + NLPHub + + index.html + index.htm + index.jsp + default.html + default.htm + default.jsp + + + NLPServlet + org.gcube.nlphub.NLPHub + + + NLPServlet + /nlphub-servlet + + + NLPUploader + org.gcube.nlphub.NLPUploader + + + NLPUploader + /nlphub-uploader-servlet + + + NLPMapper + org.gcube.nlphub.NLPMapper + + + NLPMapper + /nlphub-mapper-servlet + + \ No newline at end of file diff --git a/src/main/webapp/css/custom.css b/src/main/webapp/css/custom.css new file mode 100644 index 0000000..8b1886e --- /dev/null +++ b/src/main/webapp/css/custom.css @@ -0,0 +1,179 @@ +[type="checkbox"]+label { + margin-right: 15px !important; +} + +.my-textarea { + border: 1px solid #555; + -webkit-border-radius: 5px; + -moz-border-radius: 5px; + border-radius: 5px; + padding: 4px; + height: 100px; +} + +pre { + padding: 5px; + margin: 5px; +} + +.string { + color: green; +} + +.number { + color: darkorange; +} + +.boolean { + color: blue; +} + +.null { + color: magenta; +} + +.key { + color: red; +} + +.column { + margin-left: 1px; + float: left; +} + +.half-width { + width: 48%; +} + +.margin-left-10px { + margin-left: 10px; +} + +.margin-right-10px { + margin-right: 10px; +} + +.clearfix::after { + content: ""; + clear: both; + display: table; +} + +.fixed-height { + min-height: 200px; +} + +.margin-3 { + margin: 2px; +} + +.text-align-left { + text-align: left; +} + +.text-align-right { + text-align: right; +} + +.align-left { + float: left; + width: 80%; +} + +.align-left-33 { + float: right; + width: 33%; +} + +.centered { + margin-left: auto; + margin-right: auto; +} + +.full-width { + width: 100%; +} + +.vscrollable { + height: 220px; + overflow-y: auto; +} + +.ajax-file-upload { + float: left; + margin: 10px; + color: white; + background-color: #4CAF50 !important; + padding: 0.6rem; + text-transform: uppercase; + vertical-align: middle; + border-radius: 2px; + display: inline-block; + box-shadow: 0 2px 5px 0 rgba(0, 0, 0, 0.16), 0 2px 10px 0 rgba(0, 0, 0, 0.12); + cursor: pointer; +} + +#execute-button { + margin: 10px; + color: white; + /*background-color: #4CAF50 !important;*/ + padding: 0.6rem; + text-transform: uppercase; + vertical-align: middle; + border-radius: 2px; + display: inline-block; + box-shadow: 0 2px 5px 0 rgba(0, 0, 0, 0.16), 0 2px 10px 0 rgba(0, 0, 0, 0.12); + cursor: pointer; +} + +.ajax-file-upload-statusbar { + height: 1.3em; + width: 100% !important; + /*display: none !important;*/ +} + +.ajax-upload-dragdrop { + float: right; + border: solid 1px #dfdfdf; + width: 200px !important; +} + +#file-info { + float: right; + margin-left: 10px; +} + +.ajax-file-upload-progress { + height: 2em !important; +} + +.full-width-bar { + width: 100%; + border-bottom: solid 1px gray; +} + +.title-box { + width: 69%; + float: right; + padding-left: 3em; +} + +.logo { + width: 100%; +} + +#logo-image { + width: 200px; + height: auto; +} + +.ajax-file-upload-container { + display: none !important; + float: right; + margin-left: 10px; +} + +select { + display: block; + visibility: visible; +} \ No newline at end of file diff --git a/src/main/webapp/css/materialize.css b/src/main/webapp/css/materialize.css new file mode 100644 index 0000000..5d19b13 --- /dev/null +++ b/src/main/webapp/css/materialize.css @@ -0,0 +1,9389 @@ +/*! + * Materialize v0.100.2 (http://materializecss.com) + * Copyright 2014-2017 Materialize + * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE) + */ +.materialize-red { + background-color: #e51c23 !important; +} + +.materialize-red-text { + color: #e51c23 !important; +} + +.materialize-red.lighten-5 { + background-color: #fdeaeb !important; +} + +.materialize-red-text.text-lighten-5 { + color: #fdeaeb !important; +} + +.materialize-red.lighten-4 { + background-color: #f8c1c3 !important; +} + +.materialize-red-text.text-lighten-4 { + color: #f8c1c3 !important; +} + +.materialize-red.lighten-3 { + background-color: #f3989b !important; +} + +.materialize-red-text.text-lighten-3 { + color: #f3989b !important; +} + +.materialize-red.lighten-2 { + background-color: #ee6e73 !important; +} + +.materialize-red-text.text-lighten-2 { + color: #ee6e73 !important; +} + +.materialize-red.lighten-1 { + background-color: #ea454b !important; +} + +.materialize-red-text.text-lighten-1 { + color: #ea454b !important; +} + +.materialize-red.darken-1 { + background-color: #d0181e !important; +} + +.materialize-red-text.text-darken-1 { + color: #d0181e !important; +} + +.materialize-red.darken-2 { + background-color: #b9151b !important; +} + +.materialize-red-text.text-darken-2 { + color: #b9151b !important; +} + +.materialize-red.darken-3 { + background-color: #a21318 !important; +} + +.materialize-red-text.text-darken-3 { + color: #a21318 !important; +} + +.materialize-red.darken-4 { + background-color: #8b1014 !important; +} + +.materialize-red-text.text-darken-4 { + color: #8b1014 !important; +} + +.red { + background-color: #F44336 !important; +} + +.red-text { + color: #F44336 !important; +} + +.red.lighten-5 { + background-color: #FFEBEE !important; +} + +.red-text.text-lighten-5 { + color: #FFEBEE !important; +} + +.red.lighten-4 { + background-color: #FFCDD2 !important; +} + +.red-text.text-lighten-4 { + color: #FFCDD2 !important; +} + +.red.lighten-3 { + background-color: #EF9A9A !important; +} + +.red-text.text-lighten-3 { + color: #EF9A9A !important; +} + +.red.lighten-2 { + background-color: #E57373 !important; +} + +.red-text.text-lighten-2 { + color: #E57373 !important; +} + +.red.lighten-1 { + background-color: #EF5350 !important; +} + +.red-text.text-lighten-1 { + color: #EF5350 !important; +} + +.red.darken-1 { + background-color: #E53935 !important; +} + +.red-text.text-darken-1 { + color: #E53935 !important; +} + +.red.darken-2 { + background-color: #D32F2F !important; +} + +.red-text.text-darken-2 { + color: #D32F2F !important; +} + +.red.darken-3 { + background-color: #C62828 !important; +} + +.red-text.text-darken-3 { + color: #C62828 !important; +} + +.red.darken-4 { + background-color: #B71C1C !important; +} + +.red-text.text-darken-4 { + color: #B71C1C !important; +} + +.red.accent-1 { + background-color: #FF8A80 !important; +} + +.red-text.text-accent-1 { + color: #FF8A80 !important; +} + +.red.accent-2 { + background-color: #FF5252 !important; +} + +.red-text.text-accent-2 { + color: #FF5252 !important; +} + +.red.accent-3 { + background-color: #FF1744 !important; +} + +.red-text.text-accent-3 { + color: #FF1744 !important; +} + +.red.accent-4 { + background-color: #D50000 !important; +} + +.red-text.text-accent-4 { + color: #D50000 !important; +} + +.pink { + background-color: #e91e63 !important; +} + +.pink-text { + color: #e91e63 !important; +} + +.pink.lighten-5 { + background-color: #fce4ec !important; +} + +.pink-text.text-lighten-5 { + color: #fce4ec !important; +} + +.pink.lighten-4 { + background-color: #f8bbd0 !important; +} + +.pink-text.text-lighten-4 { + color: #f8bbd0 !important; +} + +.pink.lighten-3 { + background-color: #f48fb1 !important; +} + +.pink-text.text-lighten-3 { + color: #f48fb1 !important; +} + +.pink.lighten-2 { + background-color: #f06292 !important; +} + +.pink-text.text-lighten-2 { + color: #f06292 !important; +} + +.pink.lighten-1 { + background-color: #ec407a !important; +} + +.pink-text.text-lighten-1 { + color: #ec407a !important; +} + +.pink.darken-1 { + background-color: #d81b60 !important; +} + +.pink-text.text-darken-1 { + color: #d81b60 !important; +} + +.pink.darken-2 { + background-color: #c2185b !important; +} + +.pink-text.text-darken-2 { + color: #c2185b !important; +} + +.pink.darken-3 { + background-color: #ad1457 !important; +} + +.pink-text.text-darken-3 { + color: #ad1457 !important; +} + +.pink.darken-4 { + background-color: #880e4f !important; +} + +.pink-text.text-darken-4 { + color: #880e4f !important; +} + +.pink.accent-1 { + background-color: #ff80ab !important; +} + +.pink-text.text-accent-1 { + color: #ff80ab !important; +} + +.pink.accent-2 { + background-color: #ff4081 !important; +} + +.pink-text.text-accent-2 { + color: #ff4081 !important; +} + +.pink.accent-3 { + background-color: #f50057 !important; +} + +.pink-text.text-accent-3 { + color: #f50057 !important; +} + +.pink.accent-4 { + background-color: #c51162 !important; +} + +.pink-text.text-accent-4 { + color: #c51162 !important; +} + +.purple { + background-color: #9c27b0 !important; +} + +.purple-text { + color: #9c27b0 !important; +} + +.purple.lighten-5 { + background-color: #f3e5f5 !important; +} + +.purple-text.text-lighten-5 { + color: #f3e5f5 !important; +} + +.purple.lighten-4 { + background-color: #e1bee7 !important; +} + +.purple-text.text-lighten-4 { + color: #e1bee7 !important; +} + +.purple.lighten-3 { + background-color: #ce93d8 !important; +} + +.purple-text.text-lighten-3 { + color: #ce93d8 !important; +} + +.purple.lighten-2 { + background-color: #ba68c8 !important; +} + +.purple-text.text-lighten-2 { + color: #ba68c8 !important; +} + +.purple.lighten-1 { + background-color: #ab47bc !important; +} + +.purple-text.text-lighten-1 { + color: #ab47bc !important; +} + +.purple.darken-1 { + background-color: #8e24aa !important; +} + +.purple-text.text-darken-1 { + color: #8e24aa !important; +} + +.purple.darken-2 { + background-color: #7b1fa2 !important; +} + +.purple-text.text-darken-2 { + color: #7b1fa2 !important; +} + +.purple.darken-3 { + background-color: #6a1b9a !important; +} + +.purple-text.text-darken-3 { + color: #6a1b9a !important; +} + +.purple.darken-4 { + background-color: #4a148c !important; +} + +.purple-text.text-darken-4 { + color: #4a148c !important; +} + +.purple.accent-1 { + background-color: #ea80fc !important; +} + +.purple-text.text-accent-1 { + color: #ea80fc !important; +} + +.purple.accent-2 { + background-color: #e040fb !important; +} + +.purple-text.text-accent-2 { + color: #e040fb !important; +} + +.purple.accent-3 { + background-color: #d500f9 !important; +} + +.purple-text.text-accent-3 { + color: #d500f9 !important; +} + +.purple.accent-4 { + background-color: #aa00ff !important; +} + +.purple-text.text-accent-4 { + color: #aa00ff !important; +} + +.deep-purple { + background-color: #673ab7 !important; +} + +.deep-purple-text { + color: #673ab7 !important; +} + +.deep-purple.lighten-5 { + background-color: #ede7f6 !important; +} + +.deep-purple-text.text-lighten-5 { + color: #ede7f6 !important; +} + +.deep-purple.lighten-4 { + background-color: #d1c4e9 !important; +} + +.deep-purple-text.text-lighten-4 { + color: #d1c4e9 !important; +} + +.deep-purple.lighten-3 { + background-color: #b39ddb !important; +} + +.deep-purple-text.text-lighten-3 { + color: #b39ddb !important; +} + +.deep-purple.lighten-2 { + background-color: #9575cd !important; +} + +.deep-purple-text.text-lighten-2 { + color: #9575cd !important; +} + +.deep-purple.lighten-1 { + background-color: #7e57c2 !important; +} + +.deep-purple-text.text-lighten-1 { + color: #7e57c2 !important; +} + +.deep-purple.darken-1 { + background-color: #5e35b1 !important; +} + +.deep-purple-text.text-darken-1 { + color: #5e35b1 !important; +} + +.deep-purple.darken-2 { + background-color: #512da8 !important; +} + +.deep-purple-text.text-darken-2 { + color: #512da8 !important; +} + +.deep-purple.darken-3 { + background-color: #4527a0 !important; +} + +.deep-purple-text.text-darken-3 { + color: #4527a0 !important; +} + +.deep-purple.darken-4 { + background-color: #311b92 !important; +} + +.deep-purple-text.text-darken-4 { + color: #311b92 !important; +} + +.deep-purple.accent-1 { + background-color: #b388ff !important; +} + +.deep-purple-text.text-accent-1 { + color: #b388ff !important; +} + +.deep-purple.accent-2 { + background-color: #7c4dff !important; +} + +.deep-purple-text.text-accent-2 { + color: #7c4dff !important; +} + +.deep-purple.accent-3 { + background-color: #651fff !important; +} + +.deep-purple-text.text-accent-3 { + color: #651fff !important; +} + +.deep-purple.accent-4 { + background-color: #6200ea !important; +} + +.deep-purple-text.text-accent-4 { + color: #6200ea !important; +} + +.indigo { + background-color: #3f51b5 !important; +} + +.indigo-text { + color: #3f51b5 !important; +} + +.indigo.lighten-5 { + background-color: #e8eaf6 !important; +} + +.indigo-text.text-lighten-5 { + color: #e8eaf6 !important; +} + +.indigo.lighten-4 { + background-color: #c5cae9 !important; +} + +.indigo-text.text-lighten-4 { + color: #c5cae9 !important; +} + +.indigo.lighten-3 { + background-color: #9fa8da !important; +} + +.indigo-text.text-lighten-3 { + color: #9fa8da !important; +} + +.indigo.lighten-2 { + background-color: #7986cb !important; +} + +.indigo-text.text-lighten-2 { + color: #7986cb !important; +} + +.indigo.lighten-1 { + background-color: #5c6bc0 !important; +} + +.indigo-text.text-lighten-1 { + color: #5c6bc0 !important; +} + +.indigo.darken-1 { + background-color: #3949ab !important; +} + +.indigo-text.text-darken-1 { + color: #3949ab !important; +} + +.indigo.darken-2 { + background-color: #303f9f !important; +} + +.indigo-text.text-darken-2 { + color: #303f9f !important; +} + +.indigo.darken-3 { + background-color: #283593 !important; +} + +.indigo-text.text-darken-3 { + color: #283593 !important; +} + +.indigo.darken-4 { + background-color: #1a237e !important; +} + +.indigo-text.text-darken-4 { + color: #1a237e !important; +} + +.indigo.accent-1 { + background-color: #8c9eff !important; +} + +.indigo-text.text-accent-1 { + color: #8c9eff !important; +} + +.indigo.accent-2 { + background-color: #536dfe !important; +} + +.indigo-text.text-accent-2 { + color: #536dfe !important; +} + +.indigo.accent-3 { + background-color: #3d5afe !important; +} + +.indigo-text.text-accent-3 { + color: #3d5afe !important; +} + +.indigo.accent-4 { + background-color: #304ffe !important; +} + +.indigo-text.text-accent-4 { + color: #304ffe !important; +} + +.blue { + background-color: #2196F3 !important; +} + +.blue-text { + color: #2196F3 !important; +} + +.blue.lighten-5 { + background-color: #E3F2FD !important; +} + +.blue-text.text-lighten-5 { + color: #E3F2FD !important; +} + +.blue.lighten-4 { + background-color: #BBDEFB !important; +} + +.blue-text.text-lighten-4 { + color: #BBDEFB !important; +} + +.blue.lighten-3 { + background-color: #90CAF9 !important; +} + +.blue-text.text-lighten-3 { + color: #90CAF9 !important; +} + +.blue.lighten-2 { + background-color: #64B5F6 !important; +} + +.blue-text.text-lighten-2 { + color: #64B5F6 !important; +} + +.blue.lighten-1 { + background-color: #42A5F5 !important; +} + +.blue-text.text-lighten-1 { + color: #42A5F5 !important; +} + +.blue.darken-1 { + background-color: #1E88E5 !important; +} + +.blue-text.text-darken-1 { + color: #1E88E5 !important; +} + +.blue.darken-2 { + background-color: #1976D2 !important; +} + +.blue-text.text-darken-2 { + color: #1976D2 !important; +} + +.blue.darken-3 { + background-color: #1565C0 !important; +} + +.blue-text.text-darken-3 { + color: #1565C0 !important; +} + +.blue.darken-4 { + background-color: #0D47A1 !important; +} + +.blue-text.text-darken-4 { + color: #0D47A1 !important; +} + +.blue.accent-1 { + background-color: #82B1FF !important; +} + +.blue-text.text-accent-1 { + color: #82B1FF !important; +} + +.blue.accent-2 { + background-color: #448AFF !important; +} + +.blue-text.text-accent-2 { + color: #448AFF !important; +} + +.blue.accent-3 { + background-color: #2979FF !important; +} + +.blue-text.text-accent-3 { + color: #2979FF !important; +} + +.blue.accent-4 { + background-color: #2962FF !important; +} + +.blue-text.text-accent-4 { + color: #2962FF !important; +} + +.light-blue { + background-color: #03a9f4 !important; +} + +.light-blue-text { + color: #03a9f4 !important; +} + +.light-blue.lighten-5 { + background-color: #e1f5fe !important; +} + +.light-blue-text.text-lighten-5 { + color: #e1f5fe !important; +} + +.light-blue.lighten-4 { + background-color: #b3e5fc !important; +} + +.light-blue-text.text-lighten-4 { + color: #b3e5fc !important; +} + +.light-blue.lighten-3 { + background-color: #81d4fa !important; +} + +.light-blue-text.text-lighten-3 { + color: #81d4fa !important; +} + +.light-blue.lighten-2 { + background-color: #4fc3f7 !important; +} + +.light-blue-text.text-lighten-2 { + color: #4fc3f7 !important; +} + +.light-blue.lighten-1 { + background-color: #29b6f6 !important; +} + +.light-blue-text.text-lighten-1 { + color: #29b6f6 !important; +} + +.light-blue.darken-1 { + background-color: #039be5 !important; +} + +.light-blue-text.text-darken-1 { + color: #039be5 !important; +} + +.light-blue.darken-2 { + background-color: #0288d1 !important; +} + +.light-blue-text.text-darken-2 { + color: #0288d1 !important; +} + +.light-blue.darken-3 { + background-color: #0277bd !important; +} + +.light-blue-text.text-darken-3 { + color: #0277bd !important; +} + +.light-blue.darken-4 { + background-color: #01579b !important; +} + +.light-blue-text.text-darken-4 { + color: #01579b !important; +} + +.light-blue.accent-1 { + background-color: #80d8ff !important; +} + +.light-blue-text.text-accent-1 { + color: #80d8ff !important; +} + +.light-blue.accent-2 { + background-color: #40c4ff !important; +} + +.light-blue-text.text-accent-2 { + color: #40c4ff !important; +} + +.light-blue.accent-3 { + background-color: #00b0ff !important; +} + +.light-blue-text.text-accent-3 { + color: #00b0ff !important; +} + +.light-blue.accent-4 { + background-color: #0091ea !important; +} + +.light-blue-text.text-accent-4 { + color: #0091ea !important; +} + +.cyan { + background-color: #00bcd4 !important; +} + +.cyan-text { + color: #00bcd4 !important; +} + +.cyan.lighten-5 { + background-color: #e0f7fa !important; +} + +.cyan-text.text-lighten-5 { + color: #e0f7fa !important; +} + +.cyan.lighten-4 { + background-color: #b2ebf2 !important; +} + +.cyan-text.text-lighten-4 { + color: #b2ebf2 !important; +} + +.cyan.lighten-3 { + background-color: #80deea !important; +} + +.cyan-text.text-lighten-3 { + color: #80deea !important; +} + +.cyan.lighten-2 { + background-color: #4dd0e1 !important; +} + +.cyan-text.text-lighten-2 { + color: #4dd0e1 !important; +} + +.cyan.lighten-1 { + background-color: #26c6da !important; +} + +.cyan-text.text-lighten-1 { + color: #26c6da !important; +} + +.cyan.darken-1 { + background-color: #00acc1 !important; +} + +.cyan-text.text-darken-1 { + color: #00acc1 !important; +} + +.cyan.darken-2 { + background-color: #0097a7 !important; +} + +.cyan-text.text-darken-2 { + color: #0097a7 !important; +} + +.cyan.darken-3 { + background-color: #00838f !important; +} + +.cyan-text.text-darken-3 { + color: #00838f !important; +} + +.cyan.darken-4 { + background-color: #006064 !important; +} + +.cyan-text.text-darken-4 { + color: #006064 !important; +} + +.cyan.accent-1 { + background-color: #84ffff !important; +} + +.cyan-text.text-accent-1 { + color: #84ffff !important; +} + +.cyan.accent-2 { + background-color: #18ffff !important; +} + +.cyan-text.text-accent-2 { + color: #18ffff !important; +} + +.cyan.accent-3 { + background-color: #00e5ff !important; +} + +.cyan-text.text-accent-3 { + color: #00e5ff !important; +} + +.cyan.accent-4 { + background-color: #00b8d4 !important; +} + +.cyan-text.text-accent-4 { + color: #00b8d4 !important; +} + +.teal { + background-color: #009688 !important; +} + +.teal-text { + color: #009688 !important; +} + +.teal.lighten-5 { + background-color: #e0f2f1 !important; +} + +.teal-text.text-lighten-5 { + color: #e0f2f1 !important; +} + +.teal.lighten-4 { + background-color: #b2dfdb !important; +} + +.teal-text.text-lighten-4 { + color: #b2dfdb !important; +} + +.teal.lighten-3 { + background-color: #80cbc4 !important; +} + +.teal-text.text-lighten-3 { + color: #80cbc4 !important; +} + +.teal.lighten-2 { + background-color: #4db6ac !important; +} + +.teal-text.text-lighten-2 { + color: #4db6ac !important; +} + +.teal.lighten-1 { + background-color: #26a69a !important; +} + +.teal-text.text-lighten-1 { + color: #26a69a !important; +} + +.teal.darken-1 { + background-color: #00897b !important; +} + +.teal-text.text-darken-1 { + color: #00897b !important; +} + +.teal.darken-2 { + background-color: #00796b !important; +} + +.teal-text.text-darken-2 { + color: #00796b !important; +} + +.teal.darken-3 { + background-color: #00695c !important; +} + +.teal-text.text-darken-3 { + color: #00695c !important; +} + +.teal.darken-4 { + background-color: #004d40 !important; +} + +.teal-text.text-darken-4 { + color: #004d40 !important; +} + +.teal.accent-1 { + background-color: #a7ffeb !important; +} + +.teal-text.text-accent-1 { + color: #a7ffeb !important; +} + +.teal.accent-2 { + background-color: #64ffda !important; +} + +.teal-text.text-accent-2 { + color: #64ffda !important; +} + +.teal.accent-3 { + background-color: #1de9b6 !important; +} + +.teal-text.text-accent-3 { + color: #1de9b6 !important; +} + +.teal.accent-4 { + background-color: #00bfa5 !important; +} + +.teal-text.text-accent-4 { + color: #00bfa5 !important; +} + +.green { + background-color: #4CAF50 !important; +} + +.green-text { + color: #4CAF50 !important; +} + +.green.lighten-5 { + background-color: #E8F5E9 !important; +} + +.green-text.text-lighten-5 { + color: #E8F5E9 !important; +} + +.green.lighten-4 { + background-color: #C8E6C9 !important; +} + +.green-text.text-lighten-4 { + color: #C8E6C9 !important; +} + +.green.lighten-3 { + background-color: #A5D6A7 !important; +} + +.green-text.text-lighten-3 { + color: #A5D6A7 !important; +} + +.green.lighten-2 { + background-color: #81C784 !important; +} + +.green-text.text-lighten-2 { + color: #81C784 !important; +} + +.green.lighten-1 { + background-color: #66BB6A !important; +} + +.green-text.text-lighten-1 { + color: #66BB6A !important; +} + +.green.darken-1 { + background-color: #43A047 !important; +} + +.green-text.text-darken-1 { + color: #43A047 !important; +} + +.green.darken-2 { + background-color: #388E3C !important; +} + +.green-text.text-darken-2 { + color: #388E3C !important; +} + +.green.darken-3 { + background-color: #2E7D32 !important; +} + +.green-text.text-darken-3 { + color: #2E7D32 !important; +} + +.green.darken-4 { + background-color: #1B5E20 !important; +} + +.green-text.text-darken-4 { + color: #1B5E20 !important; +} + +.green.accent-1 { + background-color: #B9F6CA !important; +} + +.green-text.text-accent-1 { + color: #B9F6CA !important; +} + +.green.accent-2 { + background-color: #69F0AE !important; +} + +.green-text.text-accent-2 { + color: #69F0AE !important; +} + +.green.accent-3 { + background-color: #00E676 !important; +} + +.green-text.text-accent-3 { + color: #00E676 !important; +} + +.green.accent-4 { + background-color: #00C853 !important; +} + +.green-text.text-accent-4 { + color: #00C853 !important; +} + +.light-green { + background-color: #8bc34a !important; +} + +.light-green-text { + color: #8bc34a !important; +} + +.light-green.lighten-5 { + background-color: #f1f8e9 !important; +} + +.light-green-text.text-lighten-5 { + color: #f1f8e9 !important; +} + +.light-green.lighten-4 { + background-color: #dcedc8 !important; +} + +.light-green-text.text-lighten-4 { + color: #dcedc8 !important; +} + +.light-green.lighten-3 { + background-color: #c5e1a5 !important; +} + +.light-green-text.text-lighten-3 { + color: #c5e1a5 !important; +} + +.light-green.lighten-2 { + background-color: #aed581 !important; +} + +.light-green-text.text-lighten-2 { + color: #aed581 !important; +} + +.light-green.lighten-1 { + background-color: #9ccc65 !important; +} + +.light-green-text.text-lighten-1 { + color: #9ccc65 !important; +} + +.light-green.darken-1 { + background-color: #7cb342 !important; +} + +.light-green-text.text-darken-1 { + color: #7cb342 !important; +} + +.light-green.darken-2 { + background-color: #689f38 !important; +} + +.light-green-text.text-darken-2 { + color: #689f38 !important; +} + +.light-green.darken-3 { + background-color: #558b2f !important; +} + +.light-green-text.text-darken-3 { + color: #558b2f !important; +} + +.light-green.darken-4 { + background-color: #33691e !important; +} + +.light-green-text.text-darken-4 { + color: #33691e !important; +} + +.light-green.accent-1 { + background-color: #ccff90 !important; +} + +.light-green-text.text-accent-1 { + color: #ccff90 !important; +} + +.light-green.accent-2 { + background-color: #b2ff59 !important; +} + +.light-green-text.text-accent-2 { + color: #b2ff59 !important; +} + +.light-green.accent-3 { + background-color: #76ff03 !important; +} + +.light-green-text.text-accent-3 { + color: #76ff03 !important; +} + +.light-green.accent-4 { + background-color: #64dd17 !important; +} + +.light-green-text.text-accent-4 { + color: #64dd17 !important; +} + +.lime { + background-color: #cddc39 !important; +} + +.lime-text { + color: #cddc39 !important; +} + +.lime.lighten-5 { + background-color: #f9fbe7 !important; +} + +.lime-text.text-lighten-5 { + color: #f9fbe7 !important; +} + +.lime.lighten-4 { + background-color: #f0f4c3 !important; +} + +.lime-text.text-lighten-4 { + color: #f0f4c3 !important; +} + +.lime.lighten-3 { + background-color: #e6ee9c !important; +} + +.lime-text.text-lighten-3 { + color: #e6ee9c !important; +} + +.lime.lighten-2 { + background-color: #dce775 !important; +} + +.lime-text.text-lighten-2 { + color: #dce775 !important; +} + +.lime.lighten-1 { + background-color: #d4e157 !important; +} + +.lime-text.text-lighten-1 { + color: #d4e157 !important; +} + +.lime.darken-1 { + background-color: #c0ca33 !important; +} + +.lime-text.text-darken-1 { + color: #c0ca33 !important; +} + +.lime.darken-2 { + background-color: #afb42b !important; +} + +.lime-text.text-darken-2 { + color: #afb42b !important; +} + +.lime.darken-3 { + background-color: #9e9d24 !important; +} + +.lime-text.text-darken-3 { + color: #9e9d24 !important; +} + +.lime.darken-4 { + background-color: #827717 !important; +} + +.lime-text.text-darken-4 { + color: #827717 !important; +} + +.lime.accent-1 { + background-color: #f4ff81 !important; +} + +.lime-text.text-accent-1 { + color: #f4ff81 !important; +} + +.lime.accent-2 { + background-color: #eeff41 !important; +} + +.lime-text.text-accent-2 { + color: #eeff41 !important; +} + +.lime.accent-3 { + background-color: #c6ff00 !important; +} + +.lime-text.text-accent-3 { + color: #c6ff00 !important; +} + +.lime.accent-4 { + background-color: #aeea00 !important; +} + +.lime-text.text-accent-4 { + color: #aeea00 !important; +} + +.yellow { + background-color: #ffeb3b !important; +} + +.yellow-text { + color: #ffeb3b !important; +} + +.yellow.lighten-5 { + background-color: #fffde7 !important; +} + +.yellow-text.text-lighten-5 { + color: #fffde7 !important; +} + +.yellow.lighten-4 { + background-color: #fff9c4 !important; +} + +.yellow-text.text-lighten-4 { + color: #fff9c4 !important; +} + +.yellow.lighten-3 { + background-color: #fff59d !important; +} + +.yellow-text.text-lighten-3 { + color: #fff59d !important; +} + +.yellow.lighten-2 { + background-color: #fff176 !important; +} + +.yellow-text.text-lighten-2 { + color: #fff176 !important; +} + +.yellow.lighten-1 { + background-color: #ffee58 !important; +} + +.yellow-text.text-lighten-1 { + color: #ffee58 !important; +} + +.yellow.darken-1 { + background-color: #fdd835 !important; +} + +.yellow-text.text-darken-1 { + color: #fdd835 !important; +} + +.yellow.darken-2 { + background-color: #fbc02d !important; +} + +.yellow-text.text-darken-2 { + color: #fbc02d !important; +} + +.yellow.darken-3 { + background-color: #f9a825 !important; +} + +.yellow-text.text-darken-3 { + color: #f9a825 !important; +} + +.yellow.darken-4 { + background-color: #f57f17 !important; +} + +.yellow-text.text-darken-4 { + color: #f57f17 !important; +} + +.yellow.accent-1 { + background-color: #ffff8d !important; +} + +.yellow-text.text-accent-1 { + color: #ffff8d !important; +} + +.yellow.accent-2 { + background-color: #ffff00 !important; +} + +.yellow-text.text-accent-2 { + color: #ffff00 !important; +} + +.yellow.accent-3 { + background-color: #ffea00 !important; +} + +.yellow-text.text-accent-3 { + color: #ffea00 !important; +} + +.yellow.accent-4 { + background-color: #ffd600 !important; +} + +.yellow-text.text-accent-4 { + color: #ffd600 !important; +} + +.amber { + background-color: #ffc107 !important; +} + +.amber-text { + color: #ffc107 !important; +} + +.amber.lighten-5 { + background-color: #fff8e1 !important; +} + +.amber-text.text-lighten-5 { + color: #fff8e1 !important; +} + +.amber.lighten-4 { + background-color: #ffecb3 !important; +} + +.amber-text.text-lighten-4 { + color: #ffecb3 !important; +} + +.amber.lighten-3 { + background-color: #ffe082 !important; +} + +.amber-text.text-lighten-3 { + color: #ffe082 !important; +} + +.amber.lighten-2 { + background-color: #ffd54f !important; +} + +.amber-text.text-lighten-2 { + color: #ffd54f !important; +} + +.amber.lighten-1 { + background-color: #ffca28 !important; +} + +.amber-text.text-lighten-1 { + color: #ffca28 !important; +} + +.amber.darken-1 { + background-color: #ffb300 !important; +} + +.amber-text.text-darken-1 { + color: #ffb300 !important; +} + +.amber.darken-2 { + background-color: #ffa000 !important; +} + +.amber-text.text-darken-2 { + color: #ffa000 !important; +} + +.amber.darken-3 { + background-color: #ff8f00 !important; +} + +.amber-text.text-darken-3 { + color: #ff8f00 !important; +} + +.amber.darken-4 { + background-color: #ff6f00 !important; +} + +.amber-text.text-darken-4 { + color: #ff6f00 !important; +} + +.amber.accent-1 { + background-color: #ffe57f !important; +} + +.amber-text.text-accent-1 { + color: #ffe57f !important; +} + +.amber.accent-2 { + background-color: #ffd740 !important; +} + +.amber-text.text-accent-2 { + color: #ffd740 !important; +} + +.amber.accent-3 { + background-color: #ffc400 !important; +} + +.amber-text.text-accent-3 { + color: #ffc400 !important; +} + +.amber.accent-4 { + background-color: #ffab00 !important; +} + +.amber-text.text-accent-4 { + color: #ffab00 !important; +} + +.orange { + background-color: #ff9800 !important; +} + +.orange-text { + color: #ff9800 !important; +} + +.orange.lighten-5 { + background-color: #fff3e0 !important; +} + +.orange-text.text-lighten-5 { + color: #fff3e0 !important; +} + +.orange.lighten-4 { + background-color: #ffe0b2 !important; +} + +.orange-text.text-lighten-4 { + color: #ffe0b2 !important; +} + +.orange.lighten-3 { + background-color: #ffcc80 !important; +} + +.orange-text.text-lighten-3 { + color: #ffcc80 !important; +} + +.orange.lighten-2 { + background-color: #ffb74d !important; +} + +.orange-text.text-lighten-2 { + color: #ffb74d !important; +} + +.orange.lighten-1 { + background-color: #ffa726 !important; +} + +.orange-text.text-lighten-1 { + color: #ffa726 !important; +} + +.orange.darken-1 { + background-color: #fb8c00 !important; +} + +.orange-text.text-darken-1 { + color: #fb8c00 !important; +} + +.orange.darken-2 { + background-color: #f57c00 !important; +} + +.orange-text.text-darken-2 { + color: #f57c00 !important; +} + +.orange.darken-3 { + background-color: #ef6c00 !important; +} + +.orange-text.text-darken-3 { + color: #ef6c00 !important; +} + +.orange.darken-4 { + background-color: #e65100 !important; +} + +.orange-text.text-darken-4 { + color: #e65100 !important; +} + +.orange.accent-1 { + background-color: #ffd180 !important; +} + +.orange-text.text-accent-1 { + color: #ffd180 !important; +} + +.orange.accent-2 { + background-color: #ffab40 !important; +} + +.orange-text.text-accent-2 { + color: #ffab40 !important; +} + +.orange.accent-3 { + background-color: #ff9100 !important; +} + +.orange-text.text-accent-3 { + color: #ff9100 !important; +} + +.orange.accent-4 { + background-color: #ff6d00 !important; +} + +.orange-text.text-accent-4 { + color: #ff6d00 !important; +} + +.deep-orange { + background-color: #ff5722 !important; +} + +.deep-orange-text { + color: #ff5722 !important; +} + +.deep-orange.lighten-5 { + background-color: #fbe9e7 !important; +} + +.deep-orange-text.text-lighten-5 { + color: #fbe9e7 !important; +} + +.deep-orange.lighten-4 { + background-color: #ffccbc !important; +} + +.deep-orange-text.text-lighten-4 { + color: #ffccbc !important; +} + +.deep-orange.lighten-3 { + background-color: #ffab91 !important; +} + +.deep-orange-text.text-lighten-3 { + color: #ffab91 !important; +} + +.deep-orange.lighten-2 { + background-color: #ff8a65 !important; +} + +.deep-orange-text.text-lighten-2 { + color: #ff8a65 !important; +} + +.deep-orange.lighten-1 { + background-color: #ff7043 !important; +} + +.deep-orange-text.text-lighten-1 { + color: #ff7043 !important; +} + +.deep-orange.darken-1 { + background-color: #f4511e !important; +} + +.deep-orange-text.text-darken-1 { + color: #f4511e !important; +} + +.deep-orange.darken-2 { + background-color: #e64a19 !important; +} + +.deep-orange-text.text-darken-2 { + color: #e64a19 !important; +} + +.deep-orange.darken-3 { + background-color: #d84315 !important; +} + +.deep-orange-text.text-darken-3 { + color: #d84315 !important; +} + +.deep-orange.darken-4 { + background-color: #bf360c !important; +} + +.deep-orange-text.text-darken-4 { + color: #bf360c !important; +} + +.deep-orange.accent-1 { + background-color: #ff9e80 !important; +} + +.deep-orange-text.text-accent-1 { + color: #ff9e80 !important; +} + +.deep-orange.accent-2 { + background-color: #ff6e40 !important; +} + +.deep-orange-text.text-accent-2 { + color: #ff6e40 !important; +} + +.deep-orange.accent-3 { + background-color: #ff3d00 !important; +} + +.deep-orange-text.text-accent-3 { + color: #ff3d00 !important; +} + +.deep-orange.accent-4 { + background-color: #dd2c00 !important; +} + +.deep-orange-text.text-accent-4 { + color: #dd2c00 !important; +} + +.brown { + background-color: #795548 !important; +} + +.brown-text { + color: #795548 !important; +} + +.brown.lighten-5 { + background-color: #efebe9 !important; +} + +.brown-text.text-lighten-5 { + color: #efebe9 !important; +} + +.brown.lighten-4 { + background-color: #d7ccc8 !important; +} + +.brown-text.text-lighten-4 { + color: #d7ccc8 !important; +} + +.brown.lighten-3 { + background-color: #bcaaa4 !important; +} + +.brown-text.text-lighten-3 { + color: #bcaaa4 !important; +} + +.brown.lighten-2 { + background-color: #a1887f !important; +} + +.brown-text.text-lighten-2 { + color: #a1887f !important; +} + +.brown.lighten-1 { + background-color: #8d6e63 !important; +} + +.brown-text.text-lighten-1 { + color: #8d6e63 !important; +} + +.brown.darken-1 { + background-color: #6d4c41 !important; +} + +.brown-text.text-darken-1 { + color: #6d4c41 !important; +} + +.brown.darken-2 { + background-color: #5d4037 !important; +} + +.brown-text.text-darken-2 { + color: #5d4037 !important; +} + +.brown.darken-3 { + background-color: #4e342e !important; +} + +.brown-text.text-darken-3 { + color: #4e342e !important; +} + +.brown.darken-4 { + background-color: #3e2723 !important; +} + +.brown-text.text-darken-4 { + color: #3e2723 !important; +} + +.blue-grey { + background-color: #607d8b !important; +} + +.blue-grey-text { + color: #607d8b !important; +} + +.blue-grey.lighten-5 { + background-color: #eceff1 !important; +} + +.blue-grey-text.text-lighten-5 { + color: #eceff1 !important; +} + +.blue-grey.lighten-4 { + background-color: #cfd8dc !important; +} + +.blue-grey-text.text-lighten-4 { + color: #cfd8dc !important; +} + +.blue-grey.lighten-3 { + background-color: #b0bec5 !important; +} + +.blue-grey-text.text-lighten-3 { + color: #b0bec5 !important; +} + +.blue-grey.lighten-2 { + background-color: #90a4ae !important; +} + +.blue-grey-text.text-lighten-2 { + color: #90a4ae !important; +} + +.blue-grey.lighten-1 { + background-color: #78909c !important; +} + +.blue-grey-text.text-lighten-1 { + color: #78909c !important; +} + +.blue-grey.darken-1 { + background-color: #546e7a !important; +} + +.blue-grey-text.text-darken-1 { + color: #546e7a !important; +} + +.blue-grey.darken-2 { + background-color: #455a64 !important; +} + +.blue-grey-text.text-darken-2 { + color: #455a64 !important; +} + +.blue-grey.darken-3 { + background-color: #37474f !important; +} + +.blue-grey-text.text-darken-3 { + color: #37474f !important; +} + +.blue-grey.darken-4 { + background-color: #263238 !important; +} + +.blue-grey-text.text-darken-4 { + color: #263238 !important; +} + +.grey { + background-color: #9e9e9e !important; +} + +.grey-text { + color: #9e9e9e !important; +} + +.grey.lighten-5 { + background-color: #fafafa !important; +} + +.grey-text.text-lighten-5 { + color: #fafafa !important; +} + +.grey.lighten-4 { + background-color: #f5f5f5 !important; +} + +.grey-text.text-lighten-4 { + color: #f5f5f5 !important; +} + +.grey.lighten-3 { + background-color: #eeeeee !important; +} + +.grey-text.text-lighten-3 { + color: #eeeeee !important; +} + +.grey.lighten-2 { + background-color: #e0e0e0 !important; +} + +.grey-text.text-lighten-2 { + color: #e0e0e0 !important; +} + +.grey.lighten-1 { + background-color: #bdbdbd !important; +} + +.grey-text.text-lighten-1 { + color: #bdbdbd !important; +} + +.grey.darken-1 { + background-color: #757575 !important; +} + +.grey-text.text-darken-1 { + color: #757575 !important; +} + +.grey.darken-2 { + background-color: #616161 !important; +} + +.grey-text.text-darken-2 { + color: #616161 !important; +} + +.grey.darken-3 { + background-color: #424242 !important; +} + +.grey-text.text-darken-3 { + color: #424242 !important; +} + +.grey.darken-4 { + background-color: #212121 !important; +} + +.grey-text.text-darken-4 { + color: #212121 !important; +} + +.black { + background-color: #000000 !important; +} + +.black-text { + color: #000000 !important; +} + +.white { + background-color: #FFFFFF !important; +} + +.white-text { + color: #FFFFFF !important; +} + +.transparent { + background-color: transparent !important; +} + +.transparent-text { + color: transparent !important; +} + +/*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */ +/** + * 1. Set default font family to sans-serif. + * 2. Prevent iOS and IE text size adjust after device orientation change, + * without disabling user zoom. + */ +html { + font-family: sans-serif; + /* 1 */ + -ms-text-size-adjust: 100%; + /* 2 */ + -webkit-text-size-adjust: 100%; + /* 2 */ +} + +/** + * Remove default margin. + */ +body { + margin: 0; +} + +/* HTML5 display definitions + ========================================================================== */ +/** + * Correct `block` display not defined for any HTML5 element in IE 8/9. + * Correct `block` display not defined for `details` or `summary` in IE 10/11 + * and Firefox. + * Correct `block` display not defined for `main` in IE 11. + */ +article, +aside, +details, +figcaption, +figure, +footer, +header, +hgroup, +main, +menu, +nav, +section, +summary { + display: block; +} + +/** + * 1. Correct `inline-block` display not defined in IE 8/9. + * 2. Normalize vertical alignment of `progress` in Chrome, Firefox, and Opera. + */ +audio, +canvas, +progress, +video { + display: inline-block; + /* 1 */ + vertical-align: baseline; + /* 2 */ +} + +/** + * Prevent modern browsers from displaying `audio` without controls. + * Remove excess height in iOS 5 devices. + */ +audio:not([controls]) { + display: none; + height: 0; +} + +/** + * Address `[hidden]` styling not present in IE 8/9/10. + * Hide the `template` element in IE 8/9/10/11, Safari, and Firefox < 22. + */ +[hidden], +template { + display: none; +} + +/* Links + ========================================================================== */ +/** + * Remove the gray background color from active links in IE 10. + */ +a { + background-color: transparent; +} + +/** + * Improve readability of focused elements when they are also in an + * active/hover state. + */ +a:active, +a:hover { + outline: 0; +} + +/* Text-level semantics + ========================================================================== */ +/** + * Address styling not present in IE 8/9/10/11, Safari, and Chrome. + */ +abbr[title] { + border-bottom: 1px dotted; +} + +/** + * Address style set to `bolder` in Firefox 4+, Safari, and Chrome. + */ +b, +strong { + font-weight: bold; +} + +/** + * Address styling not present in Safari and Chrome. + */ +dfn { + font-style: italic; +} + +/** + * Address variable `h1` font-size and margin within `section` and `article` + * contexts in Firefox 4+, Safari, and Chrome. + */ +h1 { + font-size: 2em; + margin: 0.67em 0; +} + +/** + * Address styling not present in IE 8/9. + */ +mark { + background: #ff0; + color: #000; +} + +/** + * Address inconsistent and variable font size in all browsers. + */ +small { + font-size: 80%; +} + +/** + * Prevent `sub` and `sup` affecting `line-height` in all browsers. + */ +sub, +sup { + font-size: 75%; + line-height: 0; + position: relative; + vertical-align: baseline; +} + +sup { + top: -0.5em; +} + +sub { + bottom: -0.25em; +} + +/* Embedded content + ========================================================================== */ +/** + * Remove border when inside `a` element in IE 8/9/10. + */ +img { + border: 0; +} + +/** + * Correct overflow not hidden in IE 9/10/11. + */ +svg:not(:root) { + overflow: hidden; +} + +/* Grouping content + ========================================================================== */ +/** + * Address margin not present in IE 8/9 and Safari. + */ +figure { + margin: 1em 40px; +} + +/** + * Address differences between Firefox and other browsers. + */ +hr { + -webkit-box-sizing: content-box; + box-sizing: content-box; + height: 0; +} + +/** + * Contain overflow in all browsers. + */ +pre { + overflow: auto; +} + +/** + * Address odd `em`-unit font size rendering in all browsers. + */ +code, +kbd, +pre, +samp { + font-family: monospace, monospace; + font-size: 1em; +} + +/* Forms + ========================================================================== */ +/** + * Known limitation: by default, Chrome and Safari on OS X allow very limited + * styling of `select`, unless a `border` property is set. + */ +/** + * 1. Correct color not being inherited. + * Known issue: affects color of disabled elements. + * 2. Correct font properties not being inherited. + * 3. Address margins set differently in Firefox 4+, Safari, and Chrome. + */ +button, +input, +optgroup, +select, +textarea { + color: inherit; + /* 1 */ + font: inherit; + /* 2 */ + margin: 0; + /* 3 */ +} + +/** + * Address `overflow` set to `hidden` in IE 8/9/10/11. + */ +button { + overflow: visible; +} + +/** + * Address inconsistent `text-transform` inheritance for `button` and `select`. + * All other form control elements do not inherit `text-transform` values. + * Correct `button` style inheritance in Firefox, IE 8/9/10/11, and Opera. + * Correct `select` style inheritance in Firefox. + */ +button, +select { + text-transform: none; +} + +/** + * 1. Avoid the WebKit bug in Android 4.0.* where (2) destroys native `audio` + * and `video` controls. + * 2. Correct inability to style clickable `input` types in iOS. + * 3. Improve usability and consistency of cursor style between image-type + * `input` and others. + */ +button, +html input[type="button"], +input[type="reset"], +input[type="submit"] { + -webkit-appearance: button; + /* 2 */ + cursor: pointer; + /* 3 */ +} + +/** + * Re-set default cursor for disabled elements. + */ +button[disabled], +html input[disabled] { + cursor: default; +} + +/** + * Remove inner padding and border in Firefox 4+. + */ +button::-moz-focus-inner, +input::-moz-focus-inner { + border: 0; + padding: 0; +} + +/** + * Address Firefox 4+ setting `line-height` on `input` using `!important` in + * the UA stylesheet. + */ +input { + line-height: normal; +} + +/** + * It's recommended that you don't attempt to style these elements. + * Firefox's implementation doesn't respect box-sizing, padding, or width. + * + * 1. Address box sizing set to `content-box` in IE 8/9/10. + * 2. Remove excess padding in IE 8/9/10. + */ +input[type="checkbox"], +input[type="radio"] { + -webkit-box-sizing: border-box; + box-sizing: border-box; + /* 1 */ + padding: 0; + /* 2 */ +} + +/** + * Fix the cursor style for Chrome's increment/decrement buttons. For certain + * `font-size` values of the `input`, it causes the cursor style of the + * decrement button to change from `default` to `text`. + */ +input[type="number"]::-webkit-inner-spin-button, +input[type="number"]::-webkit-outer-spin-button { + height: auto; +} + +/** + * 1. Address `appearance` set to `searchfield` in Safari and Chrome. + * 2. Address `box-sizing` set to `border-box` in Safari and Chrome. + */ +input[type="search"] { + -webkit-appearance: textfield; + /* 1 */ + -webkit-box-sizing: content-box; + box-sizing: content-box; + /* 2 */ +} + +/** + * Remove inner padding and search cancel button in Safari and Chrome on OS X. + * Safari (but not Chrome) clips the cancel button when the search input has + * padding (and `textfield` appearance). + */ +input[type="search"]::-webkit-search-cancel-button, +input[type="search"]::-webkit-search-decoration { + -webkit-appearance: none; +} + +/** + * Define consistent border, margin, and padding. + */ +fieldset { + border: 1px solid #c0c0c0; + margin: 0 2px; + padding: 0.35em 0.625em 0.75em; +} + +/** + * 1. Correct `color` not being inherited in IE 8/9/10/11. + * 2. Remove padding so people aren't caught out if they zero out fieldsets. + */ +legend { + border: 0; + /* 1 */ + padding: 0; + /* 2 */ +} + +/** + * Remove default vertical scrollbar in IE 8/9/10/11. + */ +textarea { + overflow: auto; +} + +/** + * Don't inherit the `font-weight` (applied by a rule above). + * NOTE: the default cannot safely be changed in Chrome and Safari on OS X. + */ +optgroup { + font-weight: bold; +} + +/* Tables + ========================================================================== */ +/** + * Remove most spacing between table cells. + */ +table { + border-collapse: collapse; + border-spacing: 0; +} + +td, +th { + padding: 0; +} + +html { + -webkit-box-sizing: border-box; + box-sizing: border-box; +} + +*, *:before, *:after { + -webkit-box-sizing: inherit; + box-sizing: inherit; +} + +ul:not(.browser-default) { + padding-left: 0; + list-style-type: none; +} + +ul:not(.browser-default) > li { + list-style-type: none; +} + +a { + color: #039be5; + text-decoration: none; + -webkit-tap-highlight-color: transparent; +} + +.valign-wrapper { + display: -webkit-box; + display: -webkit-flex; + display: -ms-flexbox; + display: flex; + -webkit-box-align: center; + -webkit-align-items: center; + -ms-flex-align: center; + align-items: center; +} + +.clearfix { + clear: both; +} + +.z-depth-0 { + -webkit-box-shadow: none !important; + box-shadow: none !important; +} + +.z-depth-1, nav, .card-panel, .card, .toast, .btn, .btn-large, .btn-floating, .dropdown-content, .collapsible, .side-nav { + -webkit-box-shadow: 0 2px 2px 0 rgba(0, 0, 0, 0.14), 0 1px 5px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -2px rgba(0, 0, 0, 0.2); + box-shadow: 0 2px 2px 0 rgba(0, 0, 0, 0.14), 0 1px 5px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -2px rgba(0, 0, 0, 0.2); +} + +.z-depth-1-half, .btn:hover, .btn-large:hover, .btn-floating:hover { + -webkit-box-shadow: 0 3px 3px 0 rgba(0, 0, 0, 0.14), 0 1px 7px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -1px rgba(0, 0, 0, 0.2); + box-shadow: 0 3px 3px 0 rgba(0, 0, 0, 0.14), 0 1px 7px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -1px rgba(0, 0, 0, 0.2); +} + +.z-depth-2 { + -webkit-box-shadow: 0 4px 5px 0 rgba(0, 0, 0, 0.14), 0 1px 10px 0 rgba(0, 0, 0, 0.12), 0 2px 4px -1px rgba(0, 0, 0, 0.3); + box-shadow: 0 4px 5px 0 rgba(0, 0, 0, 0.14), 0 1px 10px 0 rgba(0, 0, 0, 0.12), 0 2px 4px -1px rgba(0, 0, 0, 0.3); +} + +.z-depth-3 { + -webkit-box-shadow: 0 6px 10px 0 rgba(0, 0, 0, 0.14), 0 1px 18px 0 rgba(0, 0, 0, 0.12), 0 3px 5px -1px rgba(0, 0, 0, 0.3); + box-shadow: 0 6px 10px 0 rgba(0, 0, 0, 0.14), 0 1px 18px 0 rgba(0, 0, 0, 0.12), 0 3px 5px -1px rgba(0, 0, 0, 0.3); +} + +.z-depth-4, .modal { + -webkit-box-shadow: 0 8px 10px 1px rgba(0, 0, 0, 0.14), 0 3px 14px 2px rgba(0, 0, 0, 0.12), 0 5px 5px -3px rgba(0, 0, 0, 0.3); + box-shadow: 0 8px 10px 1px rgba(0, 0, 0, 0.14), 0 3px 14px 2px rgba(0, 0, 0, 0.12), 0 5px 5px -3px rgba(0, 0, 0, 0.3); +} + +.z-depth-5 { + -webkit-box-shadow: 0 16px 24px 2px rgba(0, 0, 0, 0.14), 0 6px 30px 5px rgba(0, 0, 0, 0.12), 0 8px 10px -5px rgba(0, 0, 0, 0.3); + box-shadow: 0 16px 24px 2px rgba(0, 0, 0, 0.14), 0 6px 30px 5px rgba(0, 0, 0, 0.12), 0 8px 10px -5px rgba(0, 0, 0, 0.3); +} + +.hoverable { + -webkit-transition: -webkit-box-shadow .25s; + transition: -webkit-box-shadow .25s; + transition: box-shadow .25s; + transition: box-shadow .25s, -webkit-box-shadow .25s; +} + +.hoverable:hover { + -webkit-box-shadow: 0 8px 17px 0 rgba(0, 0, 0, 0.2), 0 6px 20px 0 rgba(0, 0, 0, 0.19); + box-shadow: 0 8px 17px 0 rgba(0, 0, 0, 0.2), 0 6px 20px 0 rgba(0, 0, 0, 0.19); +} + +.divider { + height: 1px; + overflow: hidden; + background-color: #e0e0e0; +} + +blockquote { + margin: 20px 0; + padding-left: 1.5rem; + border-left: 5px solid #ee6e73; +} + +i { + line-height: inherit; +} + +i.left { + float: left; + margin-right: 15px; +} + +i.right { + float: right; + margin-left: 15px; +} + +i.tiny { + font-size: 1rem; +} + +i.small { + font-size: 2rem; +} + +i.medium { + font-size: 4rem; +} + +i.large { + font-size: 6rem; +} + +img.responsive-img, +video.responsive-video { + max-width: 100%; + height: auto; +} + +.pagination li { + display: inline-block; + border-radius: 2px; + text-align: center; + vertical-align: top; + height: 30px; +} + +.pagination li a { + color: #444; + display: inline-block; + font-size: 1.2rem; + padding: 0 10px; + line-height: 30px; +} + +.pagination li.active a { + color: #fff; +} + +.pagination li.active { + background-color: #ee6e73; +} + +.pagination li.disabled a { + cursor: default; + color: #999; +} + +.pagination li i { + font-size: 2rem; +} + +.pagination li.pages ul li { + display: inline-block; + float: none; +} + +@media only screen and (max-width: 992px) { + .pagination { + width: 100%; + } + .pagination li.prev, + .pagination li.next { + width: 10%; + } + .pagination li.pages { + width: 80%; + overflow: hidden; + white-space: nowrap; + } +} + +.breadcrumb { + font-size: 18px; + color: rgba(255, 255, 255, 0.7); +} + +.breadcrumb i, +.breadcrumb [class^="mdi-"], .breadcrumb [class*="mdi-"], +.breadcrumb i.material-icons { + display: inline-block; + float: left; + font-size: 24px; +} + +.breadcrumb:before { + content: '\E5CC'; + color: rgba(255, 255, 255, 0.7); + vertical-align: top; + display: inline-block; + font-family: 'Material Icons'; + font-weight: normal; + font-style: normal; + font-size: 25px; + margin: 0 10px 0 8px; + -webkit-font-smoothing: antialiased; +} + +.breadcrumb:first-child:before { + display: none; +} + +.breadcrumb:last-child { + color: #fff; +} + +.parallax-container { + position: relative; + overflow: hidden; + height: 500px; +} + +.parallax-container .parallax { + position: absolute; + top: 0; + left: 0; + right: 0; + bottom: 0; + z-index: -1; +} + +.parallax-container .parallax img { + display: none; + position: absolute; + left: 50%; + bottom: 0; + min-width: 100%; + min-height: 100%; + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + -webkit-transform: translateX(-50%); + transform: translateX(-50%); +} + +.pin-top, .pin-bottom { + position: relative; +} + +.pinned { + position: fixed !important; +} + +/********************* + Transition Classes +**********************/ +ul.staggered-list li { + opacity: 0; +} + +.fade-in { + opacity: 0; + -webkit-transform-origin: 0 50%; + transform-origin: 0 50%; +} + +/********************* + Media Query Classes +**********************/ +@media only screen and (max-width: 600px) { + .hide-on-small-only, .hide-on-small-and-down { + display: none !important; + } +} + +@media only screen and (max-width: 992px) { + .hide-on-med-and-down { + display: none !important; + } +} + +@media only screen and (min-width: 601px) { + .hide-on-med-and-up { + display: none !important; + } +} + +@media only screen and (min-width: 600px) and (max-width: 992px) { + .hide-on-med-only { + display: none !important; + } +} + +@media only screen and (min-width: 993px) { + .hide-on-large-only { + display: none !important; + } +} + +@media only screen and (min-width: 993px) { + .show-on-large { + display: block !important; + } +} + +@media only screen and (min-width: 600px) and (max-width: 992px) { + .show-on-medium { + display: block !important; + } +} + +@media only screen and (max-width: 600px) { + .show-on-small { + display: block !important; + } +} + +@media only screen and (min-width: 601px) { + .show-on-medium-and-up { + display: block !important; + } +} + +@media only screen and (max-width: 992px) { + .show-on-medium-and-down { + display: block !important; + } +} + +@media only screen and (max-width: 600px) { + .center-on-small-only { + text-align: center; + } +} + +.page-footer { + padding-top: 20px; + color: #fff; + background-color: #ee6e73; +} + +.page-footer .footer-copyright { + overflow: hidden; + min-height: 50px; + display: -webkit-box; + display: -webkit-flex; + display: -ms-flexbox; + display: flex; + -webkit-box-align: center; + -webkit-align-items: center; + -ms-flex-align: center; + align-items: center; + padding: 10px 0px; + color: rgba(255, 255, 255, 0.8); + background-color: rgba(51, 51, 51, 0.08); +} + +table, th, td { + border: none; +} + +table { + width: 100%; + display: table; +} + +table.bordered > thead > tr, +table.bordered > tbody > tr { + border-bottom: 1px solid #d0d0d0; +} + +table.striped > tbody > tr:nth-child(odd) { + background-color: #f2f2f2; +} + +table.striped > tbody > tr > td { + border-radius: 0; +} + +table.highlight > tbody > tr { + -webkit-transition: background-color .25s ease; + transition: background-color .25s ease; +} + +table.highlight > tbody > tr:hover { + background-color: #f2f2f2; +} + +table.centered thead tr th, table.centered tbody tr td { + text-align: center; +} + +thead { + border-bottom: 1px solid #d0d0d0; +} + +td, th { + padding: 15px 5px; + display: table-cell; + text-align: left; + vertical-align: middle; + border-radius: 2px; +} + +@media only screen and (max-width: 992px) { + table.responsive-table { + width: 100%; + border-collapse: collapse; + border-spacing: 0; + display: block; + position: relative; + /* sort out borders */ + } + table.responsive-table td:empty:before { + content: '\00a0'; + } + table.responsive-table th, + table.responsive-table td { + margin: 0; + vertical-align: top; + } + table.responsive-table th { + text-align: left; + } + table.responsive-table thead { + display: block; + float: left; + } + table.responsive-table thead tr { + display: block; + padding: 0 10px 0 0; + } + table.responsive-table thead tr th::before { + content: "\00a0"; + } + table.responsive-table tbody { + display: block; + width: auto; + position: relative; + overflow-x: auto; + white-space: nowrap; + } + table.responsive-table tbody tr { + display: inline-block; + vertical-align: top; + } + table.responsive-table th { + display: block; + text-align: right; + } + table.responsive-table td { + display: block; + min-height: 1.25em; + text-align: left; + } + table.responsive-table tr { + padding: 0 10px; + } + table.responsive-table thead { + border: 0; + border-right: 1px solid #d0d0d0; + } + table.responsive-table.bordered th { + border-bottom: 0; + border-left: 0; + } + table.responsive-table.bordered td { + border-left: 0; + border-right: 0; + border-bottom: 0; + } + table.responsive-table.bordered tr { + border: 0; + } + table.responsive-table.bordered tbody tr { + border-right: 1px solid #d0d0d0; + } +} + +.collection { + margin: 0.5rem 0 1rem 0; + border: 1px solid #e0e0e0; + border-radius: 2px; + overflow: hidden; + position: relative; +} + +.collection .collection-item { + background-color: #fff; + line-height: 1.5rem; + padding: 10px 20px; + margin: 0; + border-bottom: 1px solid #e0e0e0; +} + +.collection .collection-item.avatar { + min-height: 84px; + padding-left: 72px; + position: relative; +} + +.collection .collection-item.avatar:not(.circle-clipper) > .circle, +.collection .collection-item.avatar :not(.circle-clipper) > .circle { + position: absolute; + width: 42px; + height: 42px; + overflow: hidden; + left: 15px; + display: inline-block; + vertical-align: middle; +} + +.collection .collection-item.avatar i.circle { + font-size: 18px; + line-height: 42px; + color: #fff; + background-color: #999; + text-align: center; +} + +.collection .collection-item.avatar .title { + font-size: 16px; +} + +.collection .collection-item.avatar p { + margin: 0; +} + +.collection .collection-item.avatar .secondary-content { + position: absolute; + top: 16px; + right: 16px; +} + +.collection .collection-item:last-child { + border-bottom: none; +} + +.collection .collection-item.active { + background-color: #26a69a; + color: #eafaf9; +} + +.collection .collection-item.active .secondary-content { + color: #fff; +} + +.collection a.collection-item { + display: block; + -webkit-transition: .25s; + transition: .25s; + color: #26a69a; +} + +.collection a.collection-item:not(.active):hover { + background-color: #ddd; +} + +.collection.with-header .collection-header { + background-color: #fff; + border-bottom: 1px solid #e0e0e0; + padding: 10px 20px; +} + +.collection.with-header .collection-item { + padding-left: 30px; +} + +.collection.with-header .collection-item.avatar { + padding-left: 72px; +} + +.secondary-content { + float: right; + color: #26a69a; +} + +.collapsible .collection { + margin: 0; + border: none; +} + +.video-container { + position: relative; + padding-bottom: 56.25%; + height: 0; + overflow: hidden; +} + +.video-container iframe, .video-container object, .video-container embed { + position: absolute; + top: 0; + left: 0; + width: 100%; + height: 100%; +} + +.progress { + position: relative; + height: 4px; + display: block; + width: 100%; + background-color: #acece6; + border-radius: 2px; + margin: 0.5rem 0 1rem 0; + overflow: hidden; +} + +.progress .determinate { + position: absolute; + top: 0; + left: 0; + bottom: 0; + background-color: #26a69a; + -webkit-transition: width .3s linear; + transition: width .3s linear; +} + +.progress .indeterminate { + background-color: #26a69a; +} + +.progress .indeterminate:before { + content: ''; + position: absolute; + background-color: inherit; + top: 0; + left: 0; + bottom: 0; + will-change: left, right; + -webkit-animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite; + animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite; +} + +.progress .indeterminate:after { + content: ''; + position: absolute; + background-color: inherit; + top: 0; + left: 0; + bottom: 0; + will-change: left, right; + -webkit-animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite; + animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite; + -webkit-animation-delay: 1.15s; + animation-delay: 1.15s; +} + +@-webkit-keyframes indeterminate { + 0% { + left: -35%; + right: 100%; + } + 60% { + left: 100%; + right: -90%; + } + 100% { + left: 100%; + right: -90%; + } +} + +@keyframes indeterminate { + 0% { + left: -35%; + right: 100%; + } + 60% { + left: 100%; + right: -90%; + } + 100% { + left: 100%; + right: -90%; + } +} + +@-webkit-keyframes indeterminate-short { + 0% { + left: -200%; + right: 100%; + } + 60% { + left: 107%; + right: -8%; + } + 100% { + left: 107%; + right: -8%; + } +} + +@keyframes indeterminate-short { + 0% { + left: -200%; + right: 100%; + } + 60% { + left: 107%; + right: -8%; + } + 100% { + left: 107%; + right: -8%; + } +} + +/******************* + Utility Classes +*******************/ +.hide { + display: none !important; +} + +.left-align { + text-align: left; +} + +.right-align { + text-align: right; +} + +.center, .center-align { + text-align: center; +} + +.left { + float: left !important; +} + +.right { + float: right !important; +} + +.no-select, input[type=range], +input[type=range] + .thumb { + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.circle { + border-radius: 50%; +} + +.center-block { + display: block; + margin-left: auto; + margin-right: auto; +} + +.truncate { + display: block; + white-space: nowrap; + overflow: hidden; + text-overflow: ellipsis; +} + +.no-padding { + padding: 0 !important; +} + +span.badge { + min-width: 3rem; + padding: 0 6px; + margin-left: 14px; + text-align: center; + font-size: 1rem; + line-height: 22px; + height: 22px; + color: #757575; + float: right; + -webkit-box-sizing: border-box; + box-sizing: border-box; +} + +span.badge.new { + font-weight: 300; + font-size: 0.8rem; + color: #fff; + background-color: #26a69a; + border-radius: 2px; +} + +span.badge.new:after { + content: " new"; +} + +span.badge[data-badge-caption]::after { + content: " " attr(data-badge-caption); +} + +nav ul a span.badge { + display: inline-block; + float: none; + margin-left: 4px; + line-height: 22px; + height: 22px; + -webkit-font-smoothing: auto; +} + +.collection-item span.badge { + margin-top: calc(0.75rem - 11px); +} + +.collapsible span.badge { + margin-left: auto; +} + +.side-nav span.badge { + margin-top: calc(24px - 11px); +} + +/* This is needed for some mobile phones to display the Google Icon font properly */ +.material-icons { + text-rendering: optimizeLegibility; + -webkit-font-feature-settings: 'liga'; + -moz-font-feature-settings: 'liga'; + font-feature-settings: 'liga'; +} + +.container { + margin: 0 auto; + max-width: 1280px; + width: 90%; +} + +@media only screen and (min-width: 601px) { + .container { + width: 85%; + } +} + +@media only screen and (min-width: 993px) { + .container { + width: 70%; + } +} + +.container .row { + margin-left: -0.75rem; + margin-right: -0.75rem; +} + +.section { + padding-top: 1rem; + padding-bottom: 1rem; +} + +.section.no-pad { + padding: 0; +} + +.section.no-pad-bot { + padding-bottom: 0; +} + +.section.no-pad-top { + padding-top: 0; +} + +.row { + margin-left: auto; + margin-right: auto; + margin-bottom: 20px; +} + +.row:after { + content: ""; + display: table; + clear: both; +} + +.row .col { + float: left; + -webkit-box-sizing: border-box; + box-sizing: border-box; + padding: 0 0.75rem; + min-height: 1px; +} + +.row .col[class*="push-"], .row .col[class*="pull-"] { + position: relative; +} + +.row .col.s1 { + width: 8.3333333333%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s2 { + width: 16.6666666667%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s3 { + width: 25%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s4 { + width: 33.3333333333%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s5 { + width: 41.6666666667%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s6 { + width: 50%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s7 { + width: 58.3333333333%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s8 { + width: 66.6666666667%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s9 { + width: 75%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s10 { + width: 83.3333333333%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s11 { + width: 91.6666666667%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s12 { + width: 100%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.offset-s1 { + margin-left: 8.3333333333%; +} + +.row .col.pull-s1 { + right: 8.3333333333%; +} + +.row .col.push-s1 { + left: 8.3333333333%; +} + +.row .col.offset-s2 { + margin-left: 16.6666666667%; +} + +.row .col.pull-s2 { + right: 16.6666666667%; +} + +.row .col.push-s2 { + left: 16.6666666667%; +} + +.row .col.offset-s3 { + margin-left: 25%; +} + +.row .col.pull-s3 { + right: 25%; +} + +.row .col.push-s3 { + left: 25%; +} + +.row .col.offset-s4 { + margin-left: 33.3333333333%; +} + +.row .col.pull-s4 { + right: 33.3333333333%; +} + +.row .col.push-s4 { + left: 33.3333333333%; +} + +.row .col.offset-s5 { + margin-left: 41.6666666667%; +} + +.row .col.pull-s5 { + right: 41.6666666667%; +} + +.row .col.push-s5 { + left: 41.6666666667%; +} + +.row .col.offset-s6 { + margin-left: 50%; +} + +.row .col.pull-s6 { + right: 50%; +} + +.row .col.push-s6 { + left: 50%; +} + +.row .col.offset-s7 { + margin-left: 58.3333333333%; +} + +.row .col.pull-s7 { + right: 58.3333333333%; +} + +.row .col.push-s7 { + left: 58.3333333333%; +} + +.row .col.offset-s8 { + margin-left: 66.6666666667%; +} + +.row .col.pull-s8 { + right: 66.6666666667%; +} + +.row .col.push-s8 { + left: 66.6666666667%; +} + +.row .col.offset-s9 { + margin-left: 75%; +} + +.row .col.pull-s9 { + right: 75%; +} + +.row .col.push-s9 { + left: 75%; +} + +.row .col.offset-s10 { + margin-left: 83.3333333333%; +} + +.row .col.pull-s10 { + right: 83.3333333333%; +} + +.row .col.push-s10 { + left: 83.3333333333%; +} + +.row .col.offset-s11 { + margin-left: 91.6666666667%; +} + +.row .col.pull-s11 { + right: 91.6666666667%; +} + +.row .col.push-s11 { + left: 91.6666666667%; +} + +.row .col.offset-s12 { + margin-left: 100%; +} + +.row .col.pull-s12 { + right: 100%; +} + +.row .col.push-s12 { + left: 100%; +} + +@media only screen and (min-width: 601px) { + .row .col.m1 { + width: 8.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m2 { + width: 16.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m3 { + width: 25%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m4 { + width: 33.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m5 { + width: 41.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m6 { + width: 50%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m7 { + width: 58.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m8 { + width: 66.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m9 { + width: 75%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m10 { + width: 83.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m11 { + width: 91.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m12 { + width: 100%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.offset-m1 { + margin-left: 8.3333333333%; + } + .row .col.pull-m1 { + right: 8.3333333333%; + } + .row .col.push-m1 { + left: 8.3333333333%; + } + .row .col.offset-m2 { + margin-left: 16.6666666667%; + } + .row .col.pull-m2 { + right: 16.6666666667%; + } + .row .col.push-m2 { + left: 16.6666666667%; + } + .row .col.offset-m3 { + margin-left: 25%; + } + .row .col.pull-m3 { + right: 25%; + } + .row .col.push-m3 { + left: 25%; + } + .row .col.offset-m4 { + margin-left: 33.3333333333%; + } + .row .col.pull-m4 { + right: 33.3333333333%; + } + .row .col.push-m4 { + left: 33.3333333333%; + } + .row .col.offset-m5 { + margin-left: 41.6666666667%; + } + .row .col.pull-m5 { + right: 41.6666666667%; + } + .row .col.push-m5 { + left: 41.6666666667%; + } + .row .col.offset-m6 { + margin-left: 50%; + } + .row .col.pull-m6 { + right: 50%; + } + .row .col.push-m6 { + left: 50%; + } + .row .col.offset-m7 { + margin-left: 58.3333333333%; + } + .row .col.pull-m7 { + right: 58.3333333333%; + } + .row .col.push-m7 { + left: 58.3333333333%; + } + .row .col.offset-m8 { + margin-left: 66.6666666667%; + } + .row .col.pull-m8 { + right: 66.6666666667%; + } + .row .col.push-m8 { + left: 66.6666666667%; + } + .row .col.offset-m9 { + margin-left: 75%; + } + .row .col.pull-m9 { + right: 75%; + } + .row .col.push-m9 { + left: 75%; + } + .row .col.offset-m10 { + margin-left: 83.3333333333%; + } + .row .col.pull-m10 { + right: 83.3333333333%; + } + .row .col.push-m10 { + left: 83.3333333333%; + } + .row .col.offset-m11 { + margin-left: 91.6666666667%; + } + .row .col.pull-m11 { + right: 91.6666666667%; + } + .row .col.push-m11 { + left: 91.6666666667%; + } + .row .col.offset-m12 { + margin-left: 100%; + } + .row .col.pull-m12 { + right: 100%; + } + .row .col.push-m12 { + left: 100%; + } +} + +@media only screen and (min-width: 993px) { + .row .col.l1 { + width: 8.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l2 { + width: 16.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l3 { + width: 25%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l4 { + width: 33.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l5 { + width: 41.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l6 { + width: 50%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l7 { + width: 58.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l8 { + width: 66.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l9 { + width: 75%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l10 { + width: 83.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l11 { + width: 91.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l12 { + width: 100%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.offset-l1 { + margin-left: 8.3333333333%; + } + .row .col.pull-l1 { + right: 8.3333333333%; + } + .row .col.push-l1 { + left: 8.3333333333%; + } + .row .col.offset-l2 { + margin-left: 16.6666666667%; + } + .row .col.pull-l2 { + right: 16.6666666667%; + } + .row .col.push-l2 { + left: 16.6666666667%; + } + .row .col.offset-l3 { + margin-left: 25%; + } + .row .col.pull-l3 { + right: 25%; + } + .row .col.push-l3 { + left: 25%; + } + .row .col.offset-l4 { + margin-left: 33.3333333333%; + } + .row .col.pull-l4 { + right: 33.3333333333%; + } + .row .col.push-l4 { + left: 33.3333333333%; + } + .row .col.offset-l5 { + margin-left: 41.6666666667%; + } + .row .col.pull-l5 { + right: 41.6666666667%; + } + .row .col.push-l5 { + left: 41.6666666667%; + } + .row .col.offset-l6 { + margin-left: 50%; + } + .row .col.pull-l6 { + right: 50%; + } + .row .col.push-l6 { + left: 50%; + } + .row .col.offset-l7 { + margin-left: 58.3333333333%; + } + .row .col.pull-l7 { + right: 58.3333333333%; + } + .row .col.push-l7 { + left: 58.3333333333%; + } + .row .col.offset-l8 { + margin-left: 66.6666666667%; + } + .row .col.pull-l8 { + right: 66.6666666667%; + } + .row .col.push-l8 { + left: 66.6666666667%; + } + .row .col.offset-l9 { + margin-left: 75%; + } + .row .col.pull-l9 { + right: 75%; + } + .row .col.push-l9 { + left: 75%; + } + .row .col.offset-l10 { + margin-left: 83.3333333333%; + } + .row .col.pull-l10 { + right: 83.3333333333%; + } + .row .col.push-l10 { + left: 83.3333333333%; + } + .row .col.offset-l11 { + margin-left: 91.6666666667%; + } + .row .col.pull-l11 { + right: 91.6666666667%; + } + .row .col.push-l11 { + left: 91.6666666667%; + } + .row .col.offset-l12 { + margin-left: 100%; + } + .row .col.pull-l12 { + right: 100%; + } + .row .col.push-l12 { + left: 100%; + } +} + +@media only screen and (min-width: 1201px) { + .row .col.xl1 { + width: 8.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.xl2 { + width: 16.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.xl3 { + width: 25%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.xl4 { + width: 33.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.xl5 { + width: 41.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.xl6 { + width: 50%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.xl7 { + width: 58.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.xl8 { + width: 66.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.xl9 { + width: 75%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.xl10 { + width: 83.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.xl11 { + width: 91.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.xl12 { + width: 100%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.offset-xl1 { + margin-left: 8.3333333333%; + } + .row .col.pull-xl1 { + right: 8.3333333333%; + } + .row .col.push-xl1 { + left: 8.3333333333%; + } + .row .col.offset-xl2 { + margin-left: 16.6666666667%; + } + .row .col.pull-xl2 { + right: 16.6666666667%; + } + .row .col.push-xl2 { + left: 16.6666666667%; + } + .row .col.offset-xl3 { + margin-left: 25%; + } + .row .col.pull-xl3 { + right: 25%; + } + .row .col.push-xl3 { + left: 25%; + } + .row .col.offset-xl4 { + margin-left: 33.3333333333%; + } + .row .col.pull-xl4 { + right: 33.3333333333%; + } + .row .col.push-xl4 { + left: 33.3333333333%; + } + .row .col.offset-xl5 { + margin-left: 41.6666666667%; + } + .row .col.pull-xl5 { + right: 41.6666666667%; + } + .row .col.push-xl5 { + left: 41.6666666667%; + } + .row .col.offset-xl6 { + margin-left: 50%; + } + .row .col.pull-xl6 { + right: 50%; + } + .row .col.push-xl6 { + left: 50%; + } + .row .col.offset-xl7 { + margin-left: 58.3333333333%; + } + .row .col.pull-xl7 { + right: 58.3333333333%; + } + .row .col.push-xl7 { + left: 58.3333333333%; + } + .row .col.offset-xl8 { + margin-left: 66.6666666667%; + } + .row .col.pull-xl8 { + right: 66.6666666667%; + } + .row .col.push-xl8 { + left: 66.6666666667%; + } + .row .col.offset-xl9 { + margin-left: 75%; + } + .row .col.pull-xl9 { + right: 75%; + } + .row .col.push-xl9 { + left: 75%; + } + .row .col.offset-xl10 { + margin-left: 83.3333333333%; + } + .row .col.pull-xl10 { + right: 83.3333333333%; + } + .row .col.push-xl10 { + left: 83.3333333333%; + } + .row .col.offset-xl11 { + margin-left: 91.6666666667%; + } + .row .col.pull-xl11 { + right: 91.6666666667%; + } + .row .col.push-xl11 { + left: 91.6666666667%; + } + .row .col.offset-xl12 { + margin-left: 100%; + } + .row .col.pull-xl12 { + right: 100%; + } + .row .col.push-xl12 { + left: 100%; + } +} + +nav { + color: #fff; + background-color: #ee6e73; + width: 100%; + height: 56px; + line-height: 56px; +} + +nav.nav-extended { + height: auto; +} + +nav.nav-extended .nav-wrapper { + min-height: 56px; + height: auto; +} + +nav.nav-extended .nav-content { + position: relative; + line-height: normal; +} + +nav a { + color: #fff; +} + +nav i, +nav [class^="mdi-"], nav [class*="mdi-"], +nav i.material-icons { + display: block; + font-size: 24px; + height: 56px; + line-height: 56px; +} + +nav .nav-wrapper { + position: relative; + height: 100%; +} + +@media only screen and (min-width: 993px) { + nav a.button-collapse { + display: none; + } +} + +nav .button-collapse { + float: left; + position: relative; + z-index: 1; + height: 56px; + margin: 0 18px; +} + +nav .button-collapse i { + height: 56px; + line-height: 56px; +} + +nav .brand-logo { + position: absolute; + color: #fff; + display: inline-block; + font-size: 2.1rem; + padding: 0; +} + +nav .brand-logo.center { + left: 50%; + -webkit-transform: translateX(-50%); + transform: translateX(-50%); +} + +@media only screen and (max-width: 992px) { + nav .brand-logo { + left: 50%; + -webkit-transform: translateX(-50%); + transform: translateX(-50%); + } + nav .brand-logo.left, nav .brand-logo.right { + padding: 0; + -webkit-transform: none; + transform: none; + } + nav .brand-logo.left { + left: 0.5rem; + } + nav .brand-logo.right { + right: 0.5rem; + left: auto; + } +} + +nav .brand-logo.right { + right: 0.5rem; + padding: 0; +} + +nav .brand-logo i, +nav .brand-logo [class^="mdi-"], nav .brand-logo [class*="mdi-"], +nav .brand-logo i.material-icons { + float: left; + margin-right: 15px; +} + +nav .nav-title { + display: inline-block; + font-size: 32px; + padding: 28px 0; +} + +nav ul { + margin: 0; +} + +nav ul li { + -webkit-transition: background-color .3s; + transition: background-color .3s; + float: left; + padding: 0; +} + +nav ul li.active { + background-color: rgba(0, 0, 0, 0.1); +} + +nav ul a { + -webkit-transition: background-color .3s; + transition: background-color .3s; + font-size: 1rem; + color: #fff; + display: block; + padding: 0 15px; + cursor: pointer; +} + +nav ul a.btn, nav ul a.btn-large, nav ul a.btn-large, nav ul a.btn-flat, nav ul a.btn-floating { + margin-top: -2px; + margin-left: 15px; + margin-right: 15px; +} + +nav ul a.btn > .material-icons, nav ul a.btn-large > .material-icons, nav ul a.btn-large > .material-icons, nav ul a.btn-flat > .material-icons, nav ul a.btn-floating > .material-icons { + height: inherit; + line-height: inherit; +} + +nav ul a:hover { + background-color: rgba(0, 0, 0, 0.1); +} + +nav ul.left { + float: left; +} + +nav form { + height: 100%; +} + +nav .input-field { + margin: 0; + height: 100%; +} + +nav .input-field input { + height: 100%; + font-size: 1.2rem; + border: none; + padding-left: 2rem; +} + +nav .input-field input:focus, nav .input-field input[type=text]:valid, nav .input-field input[type=password]:valid, nav .input-field input[type=email]:valid, nav .input-field input[type=url]:valid, nav .input-field input[type=date]:valid { + border: none; + -webkit-box-shadow: none; + box-shadow: none; +} + +nav .input-field label { + top: 0; + left: 0; +} + +nav .input-field label i { + color: rgba(255, 255, 255, 0.7); + -webkit-transition: color .3s; + transition: color .3s; +} + +nav .input-field label.active i { + color: #fff; +} + +.navbar-fixed { + position: relative; + height: 56px; + z-index: 997; +} + +.navbar-fixed nav { + position: fixed; +} + +@media only screen and (min-width: 601px) { + nav.nav-extended .nav-wrapper { + min-height: 64px; + } + nav, nav .nav-wrapper i, nav a.button-collapse, nav a.button-collapse i { + height: 64px; + line-height: 64px; + } + .navbar-fixed { + height: 64px; + } +} + +@font-face { + font-family: "Roboto"; + src: local(Roboto Thin), url("../fonts/roboto/Roboto-Thin.woff2") format("woff2"), url("../fonts/roboto/Roboto-Thin.woff") format("woff"); + font-weight: 100; +} + +@font-face { + font-family: "Roboto"; + src: local(Roboto Light), url("../fonts/roboto/Roboto-Light.woff2") format("woff2"), url("../fonts/roboto/Roboto-Light.woff") format("woff"); + font-weight: 300; +} + +@font-face { + font-family: "Roboto"; + src: local(Roboto Regular), url("../fonts/roboto/Roboto-Regular.woff2") format("woff2"), url("../fonts/roboto/Roboto-Regular.woff") format("woff"); + font-weight: 400; +} + +@font-face { + font-family: "Roboto"; + src: local(Roboto Medium), url("../fonts/roboto/Roboto-Medium.woff2") format("woff2"), url("../fonts/roboto/Roboto-Medium.woff") format("woff"); + font-weight: 500; +} + +@font-face { + font-family: "Roboto"; + src: local(Roboto Bold), url("../fonts/roboto/Roboto-Bold.woff2") format("woff2"), url("../fonts/roboto/Roboto-Bold.woff") format("woff"); + font-weight: 700; +} + +a { + text-decoration: none; +} + +html { + line-height: 1.5; + font-family: "Roboto", sans-serif; + font-weight: normal; + color: rgba(0, 0, 0, 0.87); +} + +@media only screen and (min-width: 0) { + html { + font-size: 14px; + } +} + +@media only screen and (min-width: 992px) { + html { + font-size: 14.5px; + } +} + +@media only screen and (min-width: 1200px) { + html { + font-size: 15px; + } +} + +h1, h2, h3, h4, h5, h6 { + font-weight: 400; + line-height: 1.1; +} + +h1 a, h2 a, h3 a, h4 a, h5 a, h6 a { + font-weight: inherit; +} + +h1 { + font-size: 4.2rem; + line-height: 110%; + margin: 2.1rem 0 1.68rem 0; +} + +h2 { + font-size: 3.56rem; + line-height: 110%; + margin: 1.78rem 0 1.424rem 0; +} + +h3 { + font-size: 2.92rem; + line-height: 110%; + margin: 1.46rem 0 1.168rem 0; +} + +h4 { + font-size: 2.28rem; + line-height: 110%; + margin: 1.14rem 0 0.912rem 0; +} + +h5 { + font-size: 1.64rem; + line-height: 110%; + margin: 0.82rem 0 0.656rem 0; +} + +h6 { + font-size: 1rem; + line-height: 110%; + margin: 0.5rem 0 0.4rem 0; +} + +em { + font-style: italic; +} + +strong { + font-weight: 500; +} + +small { + font-size: 75%; +} + +.light, .page-footer .footer-copyright { + font-weight: 300; +} + +.thin { + font-weight: 200; +} + +.flow-text { + font-weight: 300; +} + +@media only screen and (min-width: 360px) { + .flow-text { + font-size: 1.2rem; + } +} + +@media only screen and (min-width: 390px) { + .flow-text { + font-size: 1.224rem; + } +} + +@media only screen and (min-width: 420px) { + .flow-text { + font-size: 1.248rem; + } +} + +@media only screen and (min-width: 450px) { + .flow-text { + font-size: 1.272rem; + } +} + +@media only screen and (min-width: 480px) { + .flow-text { + font-size: 1.296rem; + } +} + +@media only screen and (min-width: 510px) { + .flow-text { + font-size: 1.32rem; + } +} + +@media only screen and (min-width: 540px) { + .flow-text { + font-size: 1.344rem; + } +} + +@media only screen and (min-width: 570px) { + .flow-text { + font-size: 1.368rem; + } +} + +@media only screen and (min-width: 600px) { + .flow-text { + font-size: 1.392rem; + } +} + +@media only screen and (min-width: 630px) { + .flow-text { + font-size: 1.416rem; + } +} + +@media only screen and (min-width: 660px) { + .flow-text { + font-size: 1.44rem; + } +} + +@media only screen and (min-width: 690px) { + .flow-text { + font-size: 1.464rem; + } +} + +@media only screen and (min-width: 720px) { + .flow-text { + font-size: 1.488rem; + } +} + +@media only screen and (min-width: 750px) { + .flow-text { + font-size: 1.512rem; + } +} + +@media only screen and (min-width: 780px) { + .flow-text { + font-size: 1.536rem; + } +} + +@media only screen and (min-width: 810px) { + .flow-text { + font-size: 1.56rem; + } +} + +@media only screen and (min-width: 840px) { + .flow-text { + font-size: 1.584rem; + } +} + +@media only screen and (min-width: 870px) { + .flow-text { + font-size: 1.608rem; + } +} + +@media only screen and (min-width: 900px) { + .flow-text { + font-size: 1.632rem; + } +} + +@media only screen and (min-width: 930px) { + .flow-text { + font-size: 1.656rem; + } +} + +@media only screen and (min-width: 960px) { + .flow-text { + font-size: 1.68rem; + } +} + +@media only screen and (max-width: 360px) { + .flow-text { + font-size: 1.2rem; + } +} + +.scale-transition { + -webkit-transition: -webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important; + transition: -webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important; + transition: transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important; + transition: transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63), -webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important; +} + +.scale-transition.scale-out { + -webkit-transform: scale(0); + transform: scale(0); + -webkit-transition: -webkit-transform .2s !important; + transition: -webkit-transform .2s !important; + transition: transform .2s !important; + transition: transform .2s, -webkit-transform .2s !important; +} + +.scale-transition.scale-in { + -webkit-transform: scale(1); + transform: scale(1); +} + +.card-panel { + -webkit-transition: -webkit-box-shadow .25s; + transition: -webkit-box-shadow .25s; + transition: box-shadow .25s; + transition: box-shadow .25s, -webkit-box-shadow .25s; + padding: 24px; + margin: 0.5rem 0 1rem 0; + border-radius: 2px; + background-color: #fff; +} + +.card { + position: relative; + margin: 0.5rem 0 1rem 0; + background-color: #fff; + -webkit-transition: -webkit-box-shadow .25s; + transition: -webkit-box-shadow .25s; + transition: box-shadow .25s; + transition: box-shadow .25s, -webkit-box-shadow .25s; + border-radius: 2px; +} + +.card .card-title { + font-size: 24px; + font-weight: 300; +} + +.card .card-title.activator { + cursor: pointer; +} + +.card.small, .card.medium, .card.large { + position: relative; +} + +.card.small .card-image, .card.medium .card-image, .card.large .card-image { + max-height: 60%; + overflow: hidden; +} + +.card.small .card-image + .card-content, .card.medium .card-image + .card-content, .card.large .card-image + .card-content { + max-height: 40%; +} + +.card.small .card-content, .card.medium .card-content, .card.large .card-content { + max-height: 100%; + overflow: hidden; +} + +.card.small .card-action, .card.medium .card-action, .card.large .card-action { + position: absolute; + bottom: 0; + left: 0; + right: 0; +} + +.card.small { + height: 300px; +} + +.card.medium { + height: 400px; +} + +.card.large { + height: 500px; +} + +.card.horizontal { + display: -webkit-box; + display: -webkit-flex; + display: -ms-flexbox; + display: flex; +} + +.card.horizontal.small .card-image, .card.horizontal.medium .card-image, .card.horizontal.large .card-image { + height: 100%; + max-height: none; + overflow: visible; +} + +.card.horizontal.small .card-image img, .card.horizontal.medium .card-image img, .card.horizontal.large .card-image img { + height: 100%; +} + +.card.horizontal .card-image { + max-width: 50%; +} + +.card.horizontal .card-image img { + border-radius: 2px 0 0 2px; + max-width: 100%; + width: auto; +} + +.card.horizontal .card-stacked { + display: -webkit-box; + display: -webkit-flex; + display: -ms-flexbox; + display: flex; + -webkit-box-orient: vertical; + -webkit-box-direction: normal; + -webkit-flex-direction: column; + -ms-flex-direction: column; + flex-direction: column; + -webkit-box-flex: 1; + -webkit-flex: 1; + -ms-flex: 1; + flex: 1; + position: relative; +} + +.card.horizontal .card-stacked .card-content { + -webkit-box-flex: 1; + -webkit-flex-grow: 1; + -ms-flex-positive: 1; + flex-grow: 1; +} + +.card.sticky-action .card-action { + z-index: 2; +} + +.card.sticky-action .card-reveal { + z-index: 1; + padding-bottom: 64px; +} + +.card .card-image { + position: relative; +} + +.card .card-image img { + display: block; + border-radius: 2px 2px 0 0; + position: relative; + left: 0; + right: 0; + top: 0; + bottom: 0; + width: 100%; +} + +.card .card-image .card-title { + color: #fff; + position: absolute; + bottom: 0; + left: 0; + max-width: 100%; + padding: 24px; +} + +.card .card-content { + padding: 24px; + border-radius: 0 0 2px 2px; +} + +.card .card-content p { + margin: 0; + color: inherit; +} + +.card .card-content .card-title { + display: block; + line-height: 32px; + margin-bottom: 8px; +} + +.card .card-content .card-title i { + line-height: 32px; +} + +.card .card-action { + position: relative; + background-color: inherit; + border-top: 1px solid rgba(160, 160, 160, 0.2); + padding: 16px 24px; +} + +.card .card-action:last-child { + border-radius: 0 0 2px 2px; +} + +.card .card-action a:not(.btn):not(.btn-large):not(.btn-large):not(.btn-floating) { + color: #ffab40; + margin-right: 24px; + -webkit-transition: color .3s ease; + transition: color .3s ease; + text-transform: uppercase; +} + +.card .card-action a:not(.btn):not(.btn-large):not(.btn-large):not(.btn-floating):hover { + color: #ffd8a6; +} + +.card .card-reveal { + padding: 24px; + position: absolute; + background-color: #fff; + width: 100%; + overflow-y: auto; + left: 0; + top: 100%; + height: 100%; + z-index: 3; + display: none; +} + +.card .card-reveal .card-title { + cursor: pointer; + display: block; +} + +#toast-container { + display: block; + position: fixed; + z-index: 10000; +} + +@media only screen and (max-width: 600px) { + #toast-container { + min-width: 100%; + bottom: 0%; + } +} + +@media only screen and (min-width: 601px) and (max-width: 992px) { + #toast-container { + left: 5%; + bottom: 7%; + max-width: 90%; + } +} + +@media only screen and (min-width: 993px) { + #toast-container { + top: 10%; + right: 7%; + max-width: 86%; + } +} + +.toast { + border-radius: 2px; + top: 35px; + width: auto; + margin-top: 10px; + position: relative; + max-width: 100%; + height: auto; + min-height: 48px; + line-height: 1.5em; + word-break: break-all; + background-color: #323232; + padding: 10px 25px; + font-size: 1.1rem; + font-weight: 300; + color: #fff; + display: -webkit-box; + display: -webkit-flex; + display: -ms-flexbox; + display: flex; + -webkit-box-align: center; + -webkit-align-items: center; + -ms-flex-align: center; + align-items: center; + -webkit-box-pack: justify; + -webkit-justify-content: space-between; + -ms-flex-pack: justify; + justify-content: space-between; + cursor: default; +} + +.toast .toast-action { + color: #eeff41; + font-weight: 500; + margin-right: -25px; + margin-left: 3rem; +} + +.toast.rounded { + border-radius: 24px; +} + +@media only screen and (max-width: 600px) { + .toast { + width: 100%; + border-radius: 0; + } +} + +.tabs { + position: relative; + overflow-x: auto; + overflow-y: hidden; + height: 48px; + width: 100%; + background-color: #fff; + margin: 0 auto; + white-space: nowrap; +} + +.tabs.tabs-transparent { + background-color: transparent; +} + +.tabs.tabs-transparent .tab a, +.tabs.tabs-transparent .tab.disabled a, +.tabs.tabs-transparent .tab.disabled a:hover { + color: rgba(255, 255, 255, 0.7); +} + +.tabs.tabs-transparent .tab a:hover, +.tabs.tabs-transparent .tab a.active { + color: #fff; +} + +.tabs.tabs-transparent .indicator { + background-color: #fff; +} + +.tabs.tabs-fixed-width { + display: -webkit-box; + display: -webkit-flex; + display: -ms-flexbox; + display: flex; +} + +.tabs.tabs-fixed-width .tab { + -webkit-box-flex: 1; + -webkit-flex-grow: 1; + -ms-flex-positive: 1; + flex-grow: 1; +} + +.tabs .tab { + display: inline-block; + text-align: center; + line-height: 48px; + height: 48px; + padding: 0; + margin: 0; + text-transform: uppercase; +} + +.tabs .tab a { + color: rgba(238, 110, 115, 0.7); + display: block; + width: 100%; + height: 100%; + padding: 0 24px; + font-size: 14px; + text-overflow: ellipsis; + overflow: hidden; + -webkit-transition: color .28s ease; + transition: color .28s ease; +} + +.tabs .tab a:hover, .tabs .tab a.active { + background-color: transparent; + color: #ee6e73; +} + +.tabs .tab.disabled a, +.tabs .tab.disabled a:hover { + color: rgba(238, 110, 115, 0.7); + cursor: default; +} + +.tabs .indicator { + position: absolute; + bottom: 0; + height: 2px; + background-color: #f6b2b5; + will-change: left, right; +} + +@media only screen and (max-width: 992px) { + .tabs { + display: -webkit-box; + display: -webkit-flex; + display: -ms-flexbox; + display: flex; + } + .tabs .tab { + -webkit-box-flex: 1; + -webkit-flex-grow: 1; + -ms-flex-positive: 1; + flex-grow: 1; + } + .tabs .tab a { + padding: 0 12px; + } +} + +.material-tooltip { + padding: 10px 8px; + font-size: 1rem; + z-index: 2000; + background-color: transparent; + border-radius: 2px; + color: #fff; + min-height: 36px; + line-height: 120%; + opacity: 0; + position: absolute; + text-align: center; + max-width: calc(100% - 4px); + overflow: hidden; + left: 0; + top: 0; + pointer-events: none; + visibility: hidden; +} + +.backdrop { + position: absolute; + opacity: 0; + height: 7px; + width: 14px; + border-radius: 0 0 50% 50%; + background-color: #323232; + z-index: -1; + -webkit-transform-origin: 50% 0%; + transform-origin: 50% 0%; + visibility: hidden; +} + +.btn, .btn-large, +.btn-flat { + border: none; + border-radius: 2px; + display: inline-block; + height: 36px; + line-height: 36px; + padding: 0 2rem; + text-transform: uppercase; + vertical-align: middle; + -webkit-tap-highlight-color: transparent; +} + +.btn.disabled, .disabled.btn-large, +.btn-floating.disabled, +.btn-large.disabled, +.btn-flat.disabled, +.btn:disabled, +.btn-large:disabled, +.btn-floating:disabled, +.btn-large:disabled, +.btn-flat:disabled, +.btn[disabled], +[disabled].btn-large, +.btn-floating[disabled], +.btn-large[disabled], +.btn-flat[disabled] { + pointer-events: none; + background-color: #DFDFDF !important; + -webkit-box-shadow: none; + box-shadow: none; + color: #9F9F9F !important; + cursor: default; +} + +.btn.disabled:hover, .disabled.btn-large:hover, +.btn-floating.disabled:hover, +.btn-large.disabled:hover, +.btn-flat.disabled:hover, +.btn:disabled:hover, +.btn-large:disabled:hover, +.btn-floating:disabled:hover, +.btn-large:disabled:hover, +.btn-flat:disabled:hover, +.btn[disabled]:hover, +[disabled].btn-large:hover, +.btn-floating[disabled]:hover, +.btn-large[disabled]:hover, +.btn-flat[disabled]:hover { + background-color: #DFDFDF !important; + color: #9F9F9F !important; +} + +.btn, .btn-large, +.btn-floating, +.btn-large, +.btn-flat { + font-size: 1rem; + outline: 0; +} + +.btn i, .btn-large i, +.btn-floating i, +.btn-large i, +.btn-flat i { + font-size: 1.3rem; + line-height: inherit; +} + +.btn:focus, .btn-large:focus, +.btn-floating:focus { + background-color: #1d7d74; +} + +.btn, .btn-large { + text-decoration: none; + color: #fff; + background-color: #26a69a; + text-align: center; + letter-spacing: .5px; + -webkit-transition: .2s ease-out; + transition: .2s ease-out; + cursor: pointer; +} + +.btn:hover, .btn-large:hover { + background-color: #2bbbad; +} + +.btn-floating { + display: inline-block; + color: #fff; + position: relative; + overflow: hidden; + z-index: 1; + width: 40px; + height: 40px; + line-height: 40px; + padding: 0; + background-color: #26a69a; + border-radius: 50%; + -webkit-transition: .3s; + transition: .3s; + cursor: pointer; + vertical-align: middle; +} + +.btn-floating:hover { + background-color: #26a69a; +} + +.btn-floating:before { + border-radius: 0; +} + +.btn-floating.btn-large { + width: 56px; + height: 56px; +} + +.btn-floating.btn-large.halfway-fab { + bottom: -28px; +} + +.btn-floating.btn-large i { + line-height: 56px; +} + +.btn-floating.halfway-fab { + position: absolute; + right: 24px; + bottom: -20px; +} + +.btn-floating.halfway-fab.left { + right: auto; + left: 24px; +} + +.btn-floating i { + width: inherit; + display: inline-block; + text-align: center; + color: #fff; + font-size: 1.6rem; + line-height: 40px; +} + +button.btn-floating { + border: none; +} + +.fixed-action-btn { + position: fixed; + right: 23px; + bottom: 23px; + padding-top: 15px; + margin-bottom: 0; + z-index: 997; +} + +.fixed-action-btn.active ul { + visibility: visible; +} + +.fixed-action-btn.horizontal { + padding: 0 0 0 15px; +} + +.fixed-action-btn.horizontal ul { + text-align: right; + right: 64px; + top: 50%; + -webkit-transform: translateY(-50%); + transform: translateY(-50%); + height: 100%; + left: auto; + width: 500px; + /*width 100% only goes to width of button container */ +} + +.fixed-action-btn.horizontal ul li { + display: inline-block; + margin: 15px 15px 0 0; +} + +.fixed-action-btn.toolbar { + padding: 0; + height: 56px; +} + +.fixed-action-btn.toolbar.active > a i { + opacity: 0; +} + +.fixed-action-btn.toolbar ul { + display: -webkit-box; + display: -webkit-flex; + display: -ms-flexbox; + display: flex; + top: 0; + bottom: 0; + z-index: 1; +} + +.fixed-action-btn.toolbar ul li { + -webkit-box-flex: 1; + -webkit-flex: 1; + -ms-flex: 1; + flex: 1; + display: inline-block; + margin: 0; + height: 100%; + -webkit-transition: none; + transition: none; +} + +.fixed-action-btn.toolbar ul li a { + display: block; + overflow: hidden; + position: relative; + width: 100%; + height: 100%; + background-color: transparent; + -webkit-box-shadow: none; + box-shadow: none; + color: #fff; + line-height: 56px; + z-index: 1; +} + +.fixed-action-btn.toolbar ul li a i { + line-height: inherit; +} + +.fixed-action-btn ul { + left: 0; + right: 0; + text-align: center; + position: absolute; + bottom: 64px; + margin: 0; + visibility: hidden; +} + +.fixed-action-btn ul li { + margin-bottom: 15px; +} + +.fixed-action-btn ul a.btn-floating { + opacity: 0; +} + +.fixed-action-btn .fab-backdrop { + position: absolute; + top: 0; + left: 0; + z-index: -1; + width: 40px; + height: 40px; + background-color: #26a69a; + border-radius: 50%; + -webkit-transform: scale(0); + transform: scale(0); +} + +.btn-flat { + -webkit-box-shadow: none; + box-shadow: none; + background-color: transparent; + color: #343434; + cursor: pointer; + -webkit-transition: background-color .2s; + transition: background-color .2s; +} + +.btn-flat:focus, .btn-flat:hover { + -webkit-box-shadow: none; + box-shadow: none; +} + +.btn-flat:focus { + background-color: rgba(0, 0, 0, 0.1); +} + +.btn-flat.disabled { + background-color: transparent !important; + color: #b3b2b2 !important; + cursor: default; +} + +.btn-large { + height: 54px; + line-height: 54px; +} + +.btn-large i { + font-size: 1.6rem; +} + +.btn-block { + display: block; +} + +.dropdown-content { + background-color: #fff; + margin: 0; + display: none; + min-width: 100px; + max-height: 650px; + overflow-y: auto; + opacity: 0; + position: absolute; + z-index: 999; + will-change: width, height; +} + +.dropdown-content li { + clear: both; + color: rgba(0, 0, 0, 0.87); + cursor: pointer; + min-height: 50px; + line-height: 1.5rem; + width: 100%; + text-align: left; + text-transform: none; +} + +.dropdown-content li:hover, .dropdown-content li.active, .dropdown-content li.selected { + background-color: #eee; +} + +.dropdown-content li.active.selected { + background-color: #e1e1e1; +} + +.dropdown-content li.divider { + min-height: 0; + height: 1px; +} + +.dropdown-content li > a, .dropdown-content li > span { + font-size: 16px; + color: #26a69a; + display: block; + line-height: 22px; + padding: 14px 16px; +} + +.dropdown-content li > span > label { + top: 1px; + left: 0; + height: 18px; +} + +.dropdown-content li > a > i { + height: inherit; + line-height: inherit; + float: left; + margin: 0 24px 0 0; + width: 24px; +} + +.input-field.col .dropdown-content [type="checkbox"] + label { + top: 1px; + left: 0; + height: 18px; +} + +/*! + * Waves v0.6.0 + * http://fian.my.id/Waves + * + * Copyright 2014 Alfiana E. Sibuea and other contributors + * Released under the MIT license + * https://github.com/fians/Waves/blob/master/LICENSE + */ +.waves-effect { + position: relative; + cursor: pointer; + display: inline-block; + overflow: hidden; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + -webkit-tap-highlight-color: transparent; + vertical-align: middle; + z-index: 1; + -webkit-transition: .3s ease-out; + transition: .3s ease-out; +} + +.waves-effect .waves-ripple { + position: absolute; + border-radius: 50%; + width: 20px; + height: 20px; + margin-top: -10px; + margin-left: -10px; + opacity: 0; + background: rgba(0, 0, 0, 0.2); + -webkit-transition: all 0.7s ease-out; + transition: all 0.7s ease-out; + -webkit-transition-property: opacity, -webkit-transform; + transition-property: opacity, -webkit-transform; + transition-property: transform, opacity; + transition-property: transform, opacity, -webkit-transform; + -webkit-transform: scale(0); + transform: scale(0); + pointer-events: none; +} + +.waves-effect.waves-light .waves-ripple { + background-color: rgba(255, 255, 255, 0.45); +} + +.waves-effect.waves-red .waves-ripple { + background-color: rgba(244, 67, 54, 0.7); +} + +.waves-effect.waves-yellow .waves-ripple { + background-color: rgba(255, 235, 59, 0.7); +} + +.waves-effect.waves-orange .waves-ripple { + background-color: rgba(255, 152, 0, 0.7); +} + +.waves-effect.waves-purple .waves-ripple { + background-color: rgba(156, 39, 176, 0.7); +} + +.waves-effect.waves-green .waves-ripple { + background-color: rgba(76, 175, 80, 0.7); +} + +.waves-effect.waves-teal .waves-ripple { + background-color: rgba(0, 150, 136, 0.7); +} + +.waves-effect input[type="button"], .waves-effect input[type="reset"], .waves-effect input[type="submit"] { + border: 0; + font-style: normal; + font-size: inherit; + text-transform: inherit; + background: none; +} + +.waves-effect img { + position: relative; + z-index: -1; +} + +.waves-notransition { + -webkit-transition: none !important; + transition: none !important; +} + +.waves-circle { + -webkit-transform: translateZ(0); + transform: translateZ(0); + -webkit-mask-image: -webkit-radial-gradient(circle, white 100%, black 100%); +} + +.waves-input-wrapper { + border-radius: 0.2em; + vertical-align: bottom; +} + +.waves-input-wrapper .waves-button-input { + position: relative; + top: 0; + left: 0; + z-index: 1; +} + +.waves-circle { + text-align: center; + width: 2.5em; + height: 2.5em; + line-height: 2.5em; + border-radius: 50%; + -webkit-mask-image: none; +} + +.waves-block { + display: block; +} + +/* Firefox Bug: link not triggered */ +.waves-effect .waves-ripple { + z-index: -1; +} + +.modal { + display: none; + position: fixed; + left: 0; + right: 0; + background-color: #fafafa; + padding: 0; + max-height: 70%; + width: 55%; + margin: auto; + overflow-y: auto; + border-radius: 2px; + will-change: top, opacity; +} + +@media only screen and (max-width: 992px) { + .modal { + width: 80%; + } +} + +.modal h1, .modal h2, .modal h3, .modal h4 { + margin-top: 0; +} + +.modal .modal-content { + padding: 24px; +} + +.modal .modal-close { + cursor: pointer; +} + +.modal .modal-footer { + border-radius: 0 0 2px 2px; + background-color: #fafafa; + padding: 4px 6px; + height: 56px; + width: 100%; + text-align: right; +} + +.modal .modal-footer .btn, .modal .modal-footer .btn-large, .modal .modal-footer .btn-flat { + margin: 6px 0; +} + +.modal-overlay { + position: fixed; + z-index: 999; + top: -25%; + left: 0; + bottom: 0; + right: 0; + height: 125%; + width: 100%; + background: #000; + display: none; + will-change: opacity; +} + +.modal.modal-fixed-footer { + padding: 0; + height: 70%; +} + +.modal.modal-fixed-footer .modal-content { + position: absolute; + height: calc(100% - 56px); + max-height: 100%; + width: 100%; + overflow-y: auto; +} + +.modal.modal-fixed-footer .modal-footer { + border-top: 1px solid rgba(0, 0, 0, 0.1); + position: absolute; + bottom: 0; +} + +.modal.bottom-sheet { + top: auto; + bottom: -100%; + margin: 0; + width: 100%; + max-height: 45%; + border-radius: 0; + will-change: bottom, opacity; +} + +.collapsible { + border-top: 1px solid #ddd; + border-right: 1px solid #ddd; + border-left: 1px solid #ddd; + margin: 0.5rem 0 1rem 0; +} + +.collapsible-header { + display: -webkit-box; + display: -webkit-flex; + display: -ms-flexbox; + display: flex; + cursor: pointer; + -webkit-tap-highlight-color: transparent; + line-height: 1.5; + padding: 1rem; + background-color: #fff; + border-bottom: 1px solid #ddd; +} + +.collapsible-header i { + width: 2rem; + font-size: 1.6rem; + display: inline-block; + text-align: center; + margin-right: 1rem; +} + +.collapsible-body { + display: none; + border-bottom: 1px solid #ddd; + -webkit-box-sizing: border-box; + box-sizing: border-box; + padding: 2rem; +} + +.side-nav .collapsible, +.side-nav.fixed .collapsible { + border: none; + -webkit-box-shadow: none; + box-shadow: none; +} + +.side-nav .collapsible li, +.side-nav.fixed .collapsible li { + padding: 0; +} + +.side-nav .collapsible-header, +.side-nav.fixed .collapsible-header { + background-color: transparent; + border: none; + line-height: inherit; + height: inherit; + padding: 0 16px; +} + +.side-nav .collapsible-header:hover, +.side-nav.fixed .collapsible-header:hover { + background-color: rgba(0, 0, 0, 0.05); +} + +.side-nav .collapsible-header i, +.side-nav.fixed .collapsible-header i { + line-height: inherit; +} + +.side-nav .collapsible-body, +.side-nav.fixed .collapsible-body { + border: 0; + background-color: #fff; +} + +.side-nav .collapsible-body li a, +.side-nav.fixed .collapsible-body li a { + padding: 0 23.5px 0 31px; +} + +.collapsible.popout { + border: none; + -webkit-box-shadow: none; + box-shadow: none; +} + +.collapsible.popout > li { + -webkit-box-shadow: 0 2px 5px 0 rgba(0, 0, 0, 0.16), 0 2px 10px 0 rgba(0, 0, 0, 0.12); + box-shadow: 0 2px 5px 0 rgba(0, 0, 0, 0.16), 0 2px 10px 0 rgba(0, 0, 0, 0.12); + margin: 0 24px; + -webkit-transition: margin 0.35s cubic-bezier(0.25, 0.46, 0.45, 0.94); + transition: margin 0.35s cubic-bezier(0.25, 0.46, 0.45, 0.94); +} + +.collapsible.popout > li.active { + -webkit-box-shadow: 0 5px 11px 0 rgba(0, 0, 0, 0.18), 0 4px 15px 0 rgba(0, 0, 0, 0.15); + box-shadow: 0 5px 11px 0 rgba(0, 0, 0, 0.18), 0 4px 15px 0 rgba(0, 0, 0, 0.15); + margin: 16px 0; +} + +.chip { + display: inline-block; + height: 32px; + font-size: 13px; + font-weight: 500; + color: rgba(0, 0, 0, 0.6); + line-height: 32px; + padding: 0 12px; + border-radius: 16px; + background-color: #e4e4e4; + margin-bottom: 5px; + margin-right: 5px; +} + +.chip > img { + float: left; + margin: 0 8px 0 -12px; + height: 32px; + width: 32px; + border-radius: 50%; +} + +.chip .close { + cursor: pointer; + float: right; + font-size: 16px; + line-height: 32px; + padding-left: 8px; +} + +.chips { + border: none; + border-bottom: 1px solid #9e9e9e; + -webkit-box-shadow: none; + box-shadow: none; + margin: 0 0 20px 0; + min-height: 45px; + outline: none; + -webkit-transition: all .3s; + transition: all .3s; +} + +.chips.focus { + border-bottom: 1px solid #26a69a; + -webkit-box-shadow: 0 1px 0 0 #26a69a; + box-shadow: 0 1px 0 0 #26a69a; +} + +.chips:hover { + cursor: text; +} + +.chips .chip.selected { + background-color: #26a69a; + color: #fff; +} + +.chips .input { + background: none; + border: 0; + color: rgba(0, 0, 0, 0.6); + display: inline-block; + font-size: 1rem; + height: 3rem; + line-height: 32px; + outline: 0; + margin: 0; + padding: 0 !important; + width: 120px !important; +} + +.chips .input:focus { + border: 0 !important; + -webkit-box-shadow: none !important; + box-shadow: none !important; +} + +.chips .autocomplete-content { + margin-top: 0; + margin-bottom: 0; +} + +.prefix ~ .chips { + margin-left: 3rem; + width: 92%; + width: calc(100% - 3rem); +} + +.chips:empty ~ label { + font-size: 0.8rem; + -webkit-transform: translateY(-140%); + transform: translateY(-140%); +} + +.materialboxed { + display: block; + cursor: -webkit-zoom-in; + cursor: zoom-in; + position: relative; + -webkit-transition: opacity .4s; + transition: opacity .4s; + -webkit-backface-visibility: hidden; +} + +.materialboxed:hover:not(.active) { + opacity: .8; +} + +.materialboxed.active { + cursor: -webkit-zoom-out; + cursor: zoom-out; +} + +#materialbox-overlay { + position: fixed; + top: 0; + right: 0; + bottom: 0; + left: 0; + background-color: #292929; + z-index: 1000; + will-change: opacity; +} + +.materialbox-caption { + position: fixed; + display: none; + color: #fff; + line-height: 50px; + bottom: 0; + left: 0; + width: 100%; + text-align: center; + padding: 0% 15%; + height: 50px; + z-index: 1000; + -webkit-font-smoothing: antialiased; +} + +select:focus { + outline: 1px solid #c9f3ef; +} + +button:focus { + outline: none; + background-color: #2ab7a9; +} + +label { + font-size: 0.8rem; + color: #9e9e9e; +} + +/* Text Inputs + Textarea + ========================================================================== */ +/* Style Placeholders */ +::-webkit-input-placeholder { + color: #d1d1d1; +} +::-moz-placeholder { + color: #d1d1d1; +} +:-ms-input-placeholder { + color: #d1d1d1; +} +::placeholder { + color: #d1d1d1; +} + +/* Text inputs */ +input:not([type]), +input[type=text]:not(.browser-default), +input[type=password]:not(.browser-default), +input[type=email]:not(.browser-default), +input[type=url]:not(.browser-default), +input[type=time]:not(.browser-default), +input[type=date]:not(.browser-default), +input[type=datetime]:not(.browser-default), +input[type=datetime-local]:not(.browser-default), +input[type=tel]:not(.browser-default), +input[type=number]:not(.browser-default), +input[type=search]:not(.browser-default), +textarea.materialize-textarea { + background-color: transparent; + border: none; + border-bottom: 1px solid #9e9e9e; + border-radius: 0; + outline: none; + height: 3rem; + width: 100%; + font-size: 1rem; + margin: 0 0 20px 0; + padding: 0; + -webkit-box-shadow: none; + box-shadow: none; + -webkit-box-sizing: content-box; + box-sizing: content-box; + -webkit-transition: all 0.3s; + transition: all 0.3s; +} + +input:not([type]):disabled, input:not([type])[readonly="readonly"], +input[type=text]:not(.browser-default):disabled, +input[type=text]:not(.browser-default)[readonly="readonly"], +input[type=password]:not(.browser-default):disabled, +input[type=password]:not(.browser-default)[readonly="readonly"], +input[type=email]:not(.browser-default):disabled, +input[type=email]:not(.browser-default)[readonly="readonly"], +input[type=url]:not(.browser-default):disabled, +input[type=url]:not(.browser-default)[readonly="readonly"], +input[type=time]:not(.browser-default):disabled, +input[type=time]:not(.browser-default)[readonly="readonly"], +input[type=date]:not(.browser-default):disabled, +input[type=date]:not(.browser-default)[readonly="readonly"], +input[type=datetime]:not(.browser-default):disabled, +input[type=datetime]:not(.browser-default)[readonly="readonly"], +input[type=datetime-local]:not(.browser-default):disabled, +input[type=datetime-local]:not(.browser-default)[readonly="readonly"], +input[type=tel]:not(.browser-default):disabled, +input[type=tel]:not(.browser-default)[readonly="readonly"], +input[type=number]:not(.browser-default):disabled, +input[type=number]:not(.browser-default)[readonly="readonly"], +input[type=search]:not(.browser-default):disabled, +input[type=search]:not(.browser-default)[readonly="readonly"], +textarea.materialize-textarea:disabled, +textarea.materialize-textarea[readonly="readonly"] { + color: rgba(0, 0, 0, 0.42); + border-bottom: 1px dotted rgba(0, 0, 0, 0.42); +} + +input:not([type]):disabled + label, +input:not([type])[readonly="readonly"] + label, +input[type=text]:not(.browser-default):disabled + label, +input[type=text]:not(.browser-default)[readonly="readonly"] + label, +input[type=password]:not(.browser-default):disabled + label, +input[type=password]:not(.browser-default)[readonly="readonly"] + label, +input[type=email]:not(.browser-default):disabled + label, +input[type=email]:not(.browser-default)[readonly="readonly"] + label, +input[type=url]:not(.browser-default):disabled + label, +input[type=url]:not(.browser-default)[readonly="readonly"] + label, +input[type=time]:not(.browser-default):disabled + label, +input[type=time]:not(.browser-default)[readonly="readonly"] + label, +input[type=date]:not(.browser-default):disabled + label, +input[type=date]:not(.browser-default)[readonly="readonly"] + label, +input[type=datetime]:not(.browser-default):disabled + label, +input[type=datetime]:not(.browser-default)[readonly="readonly"] + label, +input[type=datetime-local]:not(.browser-default):disabled + label, +input[type=datetime-local]:not(.browser-default)[readonly="readonly"] + label, +input[type=tel]:not(.browser-default):disabled + label, +input[type=tel]:not(.browser-default)[readonly="readonly"] + label, +input[type=number]:not(.browser-default):disabled + label, +input[type=number]:not(.browser-default)[readonly="readonly"] + label, +input[type=search]:not(.browser-default):disabled + label, +input[type=search]:not(.browser-default)[readonly="readonly"] + label, +textarea.materialize-textarea:disabled + label, +textarea.materialize-textarea[readonly="readonly"] + label { + color: rgba(0, 0, 0, 0.42); +} + +input:not([type]):focus:not([readonly]), +input[type=text]:not(.browser-default):focus:not([readonly]), +input[type=password]:not(.browser-default):focus:not([readonly]), +input[type=email]:not(.browser-default):focus:not([readonly]), +input[type=url]:not(.browser-default):focus:not([readonly]), +input[type=time]:not(.browser-default):focus:not([readonly]), +input[type=date]:not(.browser-default):focus:not([readonly]), +input[type=datetime]:not(.browser-default):focus:not([readonly]), +input[type=datetime-local]:not(.browser-default):focus:not([readonly]), +input[type=tel]:not(.browser-default):focus:not([readonly]), +input[type=number]:not(.browser-default):focus:not([readonly]), +input[type=search]:not(.browser-default):focus:not([readonly]), +textarea.materialize-textarea:focus:not([readonly]) { + border-bottom: 1px solid #26a69a; + -webkit-box-shadow: 0 1px 0 0 #26a69a; + box-shadow: 0 1px 0 0 #26a69a; +} + +input:not([type]):focus:not([readonly]) + label, +input[type=text]:not(.browser-default):focus:not([readonly]) + label, +input[type=password]:not(.browser-default):focus:not([readonly]) + label, +input[type=email]:not(.browser-default):focus:not([readonly]) + label, +input[type=url]:not(.browser-default):focus:not([readonly]) + label, +input[type=time]:not(.browser-default):focus:not([readonly]) + label, +input[type=date]:not(.browser-default):focus:not([readonly]) + label, +input[type=datetime]:not(.browser-default):focus:not([readonly]) + label, +input[type=datetime-local]:not(.browser-default):focus:not([readonly]) + label, +input[type=tel]:not(.browser-default):focus:not([readonly]) + label, +input[type=number]:not(.browser-default):focus:not([readonly]) + label, +input[type=search]:not(.browser-default):focus:not([readonly]) + label, +textarea.materialize-textarea:focus:not([readonly]) + label { + color: #26a69a; +} + +input:not([type]).validate + label, +input[type=text]:not(.browser-default).validate + label, +input[type=password]:not(.browser-default).validate + label, +input[type=email]:not(.browser-default).validate + label, +input[type=url]:not(.browser-default).validate + label, +input[type=time]:not(.browser-default).validate + label, +input[type=date]:not(.browser-default).validate + label, +input[type=datetime]:not(.browser-default).validate + label, +input[type=datetime-local]:not(.browser-default).validate + label, +input[type=tel]:not(.browser-default).validate + label, +input[type=number]:not(.browser-default).validate + label, +input[type=search]:not(.browser-default).validate + label, +textarea.materialize-textarea.validate + label { + width: 100%; +} + +input:not([type]).invalid + label:after, +input:not([type]).valid + label:after, +input[type=text]:not(.browser-default).invalid + label:after, +input[type=text]:not(.browser-default).valid + label:after, +input[type=password]:not(.browser-default).invalid + label:after, +input[type=password]:not(.browser-default).valid + label:after, +input[type=email]:not(.browser-default).invalid + label:after, +input[type=email]:not(.browser-default).valid + label:after, +input[type=url]:not(.browser-default).invalid + label:after, +input[type=url]:not(.browser-default).valid + label:after, +input[type=time]:not(.browser-default).invalid + label:after, +input[type=time]:not(.browser-default).valid + label:after, +input[type=date]:not(.browser-default).invalid + label:after, +input[type=date]:not(.browser-default).valid + label:after, +input[type=datetime]:not(.browser-default).invalid + label:after, +input[type=datetime]:not(.browser-default).valid + label:after, +input[type=datetime-local]:not(.browser-default).invalid + label:after, +input[type=datetime-local]:not(.browser-default).valid + label:after, +input[type=tel]:not(.browser-default).invalid + label:after, +input[type=tel]:not(.browser-default).valid + label:after, +input[type=number]:not(.browser-default).invalid + label:after, +input[type=number]:not(.browser-default).valid + label:after, +input[type=search]:not(.browser-default).invalid + label:after, +input[type=search]:not(.browser-default).valid + label:after, +textarea.materialize-textarea.invalid + label:after, +textarea.materialize-textarea.valid + label:after { + display: none; +} + +input:not([type]).invalid + label.active:after, +input:not([type]).valid + label.active:after, +input[type=text]:not(.browser-default).invalid + label.active:after, +input[type=text]:not(.browser-default).valid + label.active:after, +input[type=password]:not(.browser-default).invalid + label.active:after, +input[type=password]:not(.browser-default).valid + label.active:after, +input[type=email]:not(.browser-default).invalid + label.active:after, +input[type=email]:not(.browser-default).valid + label.active:after, +input[type=url]:not(.browser-default).invalid + label.active:after, +input[type=url]:not(.browser-default).valid + label.active:after, +input[type=time]:not(.browser-default).invalid + label.active:after, +input[type=time]:not(.browser-default).valid + label.active:after, +input[type=date]:not(.browser-default).invalid + label.active:after, +input[type=date]:not(.browser-default).valid + label.active:after, +input[type=datetime]:not(.browser-default).invalid + label.active:after, +input[type=datetime]:not(.browser-default).valid + label.active:after, +input[type=datetime-local]:not(.browser-default).invalid + label.active:after, +input[type=datetime-local]:not(.browser-default).valid + label.active:after, +input[type=tel]:not(.browser-default).invalid + label.active:after, +input[type=tel]:not(.browser-default).valid + label.active:after, +input[type=number]:not(.browser-default).invalid + label.active:after, +input[type=number]:not(.browser-default).valid + label.active:after, +input[type=search]:not(.browser-default).invalid + label.active:after, +input[type=search]:not(.browser-default).valid + label.active:after, +textarea.materialize-textarea.invalid + label.active:after, +textarea.materialize-textarea.valid + label.active:after { + display: block; +} + +/* Validation Sass Placeholders */ +input.valid:not([type]), input.valid:not([type]):focus, +input[type=text].valid:not(.browser-default), +input[type=text].valid:not(.browser-default):focus, +input[type=password].valid:not(.browser-default), +input[type=password].valid:not(.browser-default):focus, +input[type=email].valid:not(.browser-default), +input[type=email].valid:not(.browser-default):focus, +input[type=url].valid:not(.browser-default), +input[type=url].valid:not(.browser-default):focus, +input[type=time].valid:not(.browser-default), +input[type=time].valid:not(.browser-default):focus, +input[type=date].valid:not(.browser-default), +input[type=date].valid:not(.browser-default):focus, +input[type=datetime].valid:not(.browser-default), +input[type=datetime].valid:not(.browser-default):focus, +input[type=datetime-local].valid:not(.browser-default), +input[type=datetime-local].valid:not(.browser-default):focus, +input[type=tel].valid:not(.browser-default), +input[type=tel].valid:not(.browser-default):focus, +input[type=number].valid:not(.browser-default), +input[type=number].valid:not(.browser-default):focus, +input[type=search].valid:not(.browser-default), +input[type=search].valid:not(.browser-default):focus, +textarea.materialize-textarea.valid, +textarea.materialize-textarea.valid:focus, .select-wrapper.valid > input.select-dropdown { + border-bottom: 1px solid #4CAF50; + -webkit-box-shadow: 0 1px 0 0 #4CAF50; + box-shadow: 0 1px 0 0 #4CAF50; +} + +input.invalid:not([type]), input.invalid:not([type]):focus, +input[type=text].invalid:not(.browser-default), +input[type=text].invalid:not(.browser-default):focus, +input[type=password].invalid:not(.browser-default), +input[type=password].invalid:not(.browser-default):focus, +input[type=email].invalid:not(.browser-default), +input[type=email].invalid:not(.browser-default):focus, +input[type=url].invalid:not(.browser-default), +input[type=url].invalid:not(.browser-default):focus, +input[type=time].invalid:not(.browser-default), +input[type=time].invalid:not(.browser-default):focus, +input[type=date].invalid:not(.browser-default), +input[type=date].invalid:not(.browser-default):focus, +input[type=datetime].invalid:not(.browser-default), +input[type=datetime].invalid:not(.browser-default):focus, +input[type=datetime-local].invalid:not(.browser-default), +input[type=datetime-local].invalid:not(.browser-default):focus, +input[type=tel].invalid:not(.browser-default), +input[type=tel].invalid:not(.browser-default):focus, +input[type=number].invalid:not(.browser-default), +input[type=number].invalid:not(.browser-default):focus, +input[type=search].invalid:not(.browser-default), +input[type=search].invalid:not(.browser-default):focus, +textarea.materialize-textarea.invalid, +textarea.materialize-textarea.invalid:focus, .select-wrapper.invalid > input.select-dropdown { + border-bottom: 1px solid #F44336; + -webkit-box-shadow: 0 1px 0 0 #F44336; + box-shadow: 0 1px 0 0 #F44336; +} + +input:not([type]).valid + label:after, +input:not([type]):focus.valid + label:after, +input[type=text]:not(.browser-default).valid + label:after, +input[type=text]:not(.browser-default):focus.valid + label:after, +input[type=password]:not(.browser-default).valid + label:after, +input[type=password]:not(.browser-default):focus.valid + label:after, +input[type=email]:not(.browser-default).valid + label:after, +input[type=email]:not(.browser-default):focus.valid + label:after, +input[type=url]:not(.browser-default).valid + label:after, +input[type=url]:not(.browser-default):focus.valid + label:after, +input[type=time]:not(.browser-default).valid + label:after, +input[type=time]:not(.browser-default):focus.valid + label:after, +input[type=date]:not(.browser-default).valid + label:after, +input[type=date]:not(.browser-default):focus.valid + label:after, +input[type=datetime]:not(.browser-default).valid + label:after, +input[type=datetime]:not(.browser-default):focus.valid + label:after, +input[type=datetime-local]:not(.browser-default).valid + label:after, +input[type=datetime-local]:not(.browser-default):focus.valid + label:after, +input[type=tel]:not(.browser-default).valid + label:after, +input[type=tel]:not(.browser-default):focus.valid + label:after, +input[type=number]:not(.browser-default).valid + label:after, +input[type=number]:not(.browser-default):focus.valid + label:after, +input[type=search]:not(.browser-default).valid + label:after, +input[type=search]:not(.browser-default):focus.valid + label:after, +textarea.materialize-textarea.valid + label:after, +textarea.materialize-textarea:focus.valid + label:after, .select-wrapper.valid + label:after { + content: attr(data-success); + color: #4CAF50; + opacity: 1; + -webkit-transform: translateY(9px); + transform: translateY(9px); +} + +input:not([type]).invalid + label:after, +input:not([type]):focus.invalid + label:after, +input[type=text]:not(.browser-default).invalid + label:after, +input[type=text]:not(.browser-default):focus.invalid + label:after, +input[type=password]:not(.browser-default).invalid + label:after, +input[type=password]:not(.browser-default):focus.invalid + label:after, +input[type=email]:not(.browser-default).invalid + label:after, +input[type=email]:not(.browser-default):focus.invalid + label:after, +input[type=url]:not(.browser-default).invalid + label:after, +input[type=url]:not(.browser-default):focus.invalid + label:after, +input[type=time]:not(.browser-default).invalid + label:after, +input[type=time]:not(.browser-default):focus.invalid + label:after, +input[type=date]:not(.browser-default).invalid + label:after, +input[type=date]:not(.browser-default):focus.invalid + label:after, +input[type=datetime]:not(.browser-default).invalid + label:after, +input[type=datetime]:not(.browser-default):focus.invalid + label:after, +input[type=datetime-local]:not(.browser-default).invalid + label:after, +input[type=datetime-local]:not(.browser-default):focus.invalid + label:after, +input[type=tel]:not(.browser-default).invalid + label:after, +input[type=tel]:not(.browser-default):focus.invalid + label:after, +input[type=number]:not(.browser-default).invalid + label:after, +input[type=number]:not(.browser-default):focus.invalid + label:after, +input[type=search]:not(.browser-default).invalid + label:after, +input[type=search]:not(.browser-default):focus.invalid + label:after, +textarea.materialize-textarea.invalid + label:after, +textarea.materialize-textarea:focus.invalid + label:after, .select-wrapper.invalid + label:after { + content: attr(data-error); + color: #F44336; + opacity: 1; + -webkit-transform: translateY(9px); + transform: translateY(9px); +} + +input:not([type]) + label:after, +input[type=text]:not(.browser-default) + label:after, +input[type=password]:not(.browser-default) + label:after, +input[type=email]:not(.browser-default) + label:after, +input[type=url]:not(.browser-default) + label:after, +input[type=time]:not(.browser-default) + label:after, +input[type=date]:not(.browser-default) + label:after, +input[type=datetime]:not(.browser-default) + label:after, +input[type=datetime-local]:not(.browser-default) + label:after, +input[type=tel]:not(.browser-default) + label:after, +input[type=number]:not(.browser-default) + label:after, +input[type=search]:not(.browser-default) + label:after, +textarea.materialize-textarea + label:after, .select-wrapper + label:after { + display: block; + content: ""; + position: absolute; + top: 100%; + left: 0; + opacity: 0; + -webkit-transition: .2s opacity ease-out, .2s color ease-out; + transition: .2s opacity ease-out, .2s color ease-out; +} + +.input-field { + position: relative; + margin-top: 1rem; +} + +.input-field.inline { + display: inline-block; + vertical-align: middle; + margin-left: 5px; +} + +.input-field.inline input, +.input-field.inline .select-dropdown { + margin-bottom: 1rem; +} + +.input-field.col label { + left: 0.75rem; +} + +.input-field.col .prefix ~ label, +.input-field.col .prefix ~ .validate ~ label { + width: calc(100% - 3rem - 1.5rem); +} + +.input-field label { + color: #9e9e9e; + position: absolute; + top: 0; + left: 0; + height: 100%; + font-size: 1rem; + cursor: text; + -webkit-transition: -webkit-transform .2s ease-out; + transition: -webkit-transform .2s ease-out; + transition: transform .2s ease-out; + transition: transform .2s ease-out, -webkit-transform .2s ease-out; + -webkit-transform-origin: 0% 100%; + transform-origin: 0% 100%; + text-align: initial; + -webkit-transform: translateY(12px); + transform: translateY(12px); + pointer-events: none; +} + +.input-field label:not(.label-icon).active { + -webkit-transform: translateY(-14px) scale(0.8); + transform: translateY(-14px) scale(0.8); + -webkit-transform-origin: 0 0; + transform-origin: 0 0; +} + +.input-field .prefix { + position: absolute; + width: 3rem; + font-size: 2rem; + -webkit-transition: color .2s; + transition: color .2s; +} + +.input-field .prefix.active { + color: #26a69a; +} + +.input-field .prefix ~ input, +.input-field .prefix ~ textarea, +.input-field .prefix ~ label, +.input-field .prefix ~ .validate ~ label, +.input-field .prefix ~ .autocomplete-content { + margin-left: 3rem; + width: 92%; + width: calc(100% - 3rem); +} + +.input-field .prefix ~ label { + margin-left: 3rem; +} + +@media only screen and (max-width: 992px) { + .input-field .prefix ~ input { + width: 86%; + width: calc(100% - 3rem); + } +} + +@media only screen and (max-width: 600px) { + .input-field .prefix ~ input { + width: 80%; + width: calc(100% - 3rem); + } +} + +/* Search Field */ +.input-field input[type=search] { + display: block; + line-height: inherit; +} + +.nav-wrapper .input-field input[type=search] { + height: inherit; + padding-left: 4rem; + width: calc(100% - 4rem); + border: 0; + -webkit-box-shadow: none; + box-shadow: none; +} + +.input-field input[type=search]:focus { + background-color: #fff; + border: 0; + -webkit-box-shadow: none; + box-shadow: none; + color: #444; +} + +.input-field input[type=search]:focus + label i, +.input-field input[type=search]:focus ~ .mdi-navigation-close, +.input-field input[type=search]:focus ~ .material-icons { + color: #444; +} + +.input-field input[type=search] + label { + left: 1rem; +} + +.input-field input[type=search] ~ .mdi-navigation-close, +.input-field input[type=search] ~ .material-icons { + position: absolute; + top: 0; + right: 1rem; + color: transparent; + cursor: pointer; + font-size: 2rem; + -webkit-transition: .3s color; + transition: .3s color; +} + +/* Textarea */ +textarea { + width: 100%; + height: 3rem; + background-color: transparent; +} + +textarea.materialize-textarea { + overflow-y: hidden; + /* prevents scroll bar flash */ + padding: .8rem 0 1.6rem 0; + /* prevents text jump on Enter keypress */ + resize: none; + min-height: 3rem; +} + +textarea.materialize-textarea.validate + label { + height: 100%; +} + +textarea.materialize-textarea.validate + label::after { + top: calc(100% - 12px); +} + +textarea.materialize-textarea.validate + label:not(.label-icon).active { + -webkit-transform: translateY(-25px); + transform: translateY(-25px); +} + +.hiddendiv { + display: none; + white-space: pre-wrap; + word-wrap: break-word; + overflow-wrap: break-word; + /* future version of deprecated 'word-wrap' */ + padding-top: 1.2rem; + /* prevents text jump on Enter keypress */ + position: absolute; + top: 0; +} + +/* Autocomplete */ +.autocomplete-content { + margin-top: -20px; + margin-bottom: 20px; + display: block; + opacity: 1; + position: static; +} + +.autocomplete-content li .highlight { + color: #444; +} + +.autocomplete-content li img { + height: 40px; + width: 40px; + margin: 5px 15px; +} + +/* Radio Buttons + ========================================================================== */ +[type="radio"]:not(:checked), +[type="radio"]:checked { + position: absolute; + opacity: 0; + pointer-events: none; +} + +[type="radio"]:not(:checked) + label, +[type="radio"]:checked + label { + position: relative; + padding-left: 35px; + cursor: pointer; + display: inline-block; + height: 25px; + line-height: 25px; + font-size: 1rem; + -webkit-transition: .28s ease; + transition: .28s ease; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +[type="radio"] + label:before, +[type="radio"] + label:after { + content: ''; + position: absolute; + left: 0; + top: 0; + margin: 4px; + width: 16px; + height: 16px; + z-index: 0; + -webkit-transition: .28s ease; + transition: .28s ease; +} + +/* Unchecked styles */ +[type="radio"]:not(:checked) + label:before, +[type="radio"]:not(:checked) + label:after, +[type="radio"]:checked + label:before, +[type="radio"]:checked + label:after, +[type="radio"].with-gap:checked + label:before, +[type="radio"].with-gap:checked + label:after { + border-radius: 50%; +} + +[type="radio"]:not(:checked) + label:before, +[type="radio"]:not(:checked) + label:after { + border: 2px solid #5a5a5a; +} + +[type="radio"]:not(:checked) + label:after { + -webkit-transform: scale(0); + transform: scale(0); +} + +/* Checked styles */ +[type="radio"]:checked + label:before { + border: 2px solid transparent; +} + +[type="radio"]:checked + label:after, +[type="radio"].with-gap:checked + label:before, +[type="radio"].with-gap:checked + label:after { + border: 2px solid #26a69a; +} + +[type="radio"]:checked + label:after, +[type="radio"].with-gap:checked + label:after { + background-color: #26a69a; +} + +[type="radio"]:checked + label:after { + -webkit-transform: scale(1.02); + transform: scale(1.02); +} + +/* Radio With gap */ +[type="radio"].with-gap:checked + label:after { + -webkit-transform: scale(0.5); + transform: scale(0.5); +} + +/* Focused styles */ +[type="radio"].tabbed:focus + label:before { + -webkit-box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1); + box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1); +} + +/* Disabled Radio With gap */ +[type="radio"].with-gap:disabled:checked + label:before { + border: 2px solid rgba(0, 0, 0, 0.42); +} + +[type="radio"].with-gap:disabled:checked + label:after { + border: none; + background-color: rgba(0, 0, 0, 0.42); +} + +/* Disabled style */ +[type="radio"]:disabled:not(:checked) + label:before, +[type="radio"]:disabled:checked + label:before { + background-color: transparent; + border-color: rgba(0, 0, 0, 0.42); +} + +[type="radio"]:disabled + label { + color: rgba(0, 0, 0, 0.42); +} + +[type="radio"]:disabled:not(:checked) + label:before { + border-color: rgba(0, 0, 0, 0.42); +} + +[type="radio"]:disabled:checked + label:after { + background-color: rgba(0, 0, 0, 0.42); + border-color: #949494; +} + +/* Checkboxes + ========================================================================== */ +/* CUSTOM CSS CHECKBOXES */ +form p { + margin-bottom: 10px; + text-align: left; +} + +form p:last-child { + margin-bottom: 0; +} + +/* Remove default checkbox */ +[type="checkbox"]:not(:checked), +[type="checkbox"]:checked { + position: absolute; + opacity: 0; + pointer-events: none; +} + +[type="checkbox"] { + /* checkbox aspect */ +} + +[type="checkbox"] + label { + position: relative; + padding-left: 35px; + cursor: pointer; + display: inline-block; + height: 25px; + line-height: 25px; + font-size: 1rem; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +[type="checkbox"] + label:before, +[type="checkbox"]:not(.filled-in) + label:after { + content: ''; + position: absolute; + top: 0; + left: 0; + width: 18px; + height: 18px; + z-index: 0; + border: 2px solid #5a5a5a; + border-radius: 1px; + margin-top: 2px; + -webkit-transition: .2s; + transition: .2s; +} + +[type="checkbox"]:not(.filled-in) + label:after { + border: 0; + -webkit-transform: scale(0); + transform: scale(0); +} + +[type="checkbox"]:not(:checked):disabled + label:before { + border: none; + background-color: rgba(0, 0, 0, 0.42); +} + +[type="checkbox"].tabbed:focus + label:after { + -webkit-transform: scale(1); + transform: scale(1); + border: 0; + border-radius: 50%; + -webkit-box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1); + box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1); + background-color: rgba(0, 0, 0, 0.1); +} + +[type="checkbox"]:checked + label:before { + top: -4px; + left: -5px; + width: 12px; + height: 22px; + border-top: 2px solid transparent; + border-left: 2px solid transparent; + border-right: 2px solid #26a69a; + border-bottom: 2px solid #26a69a; + -webkit-transform: rotate(40deg); + transform: rotate(40deg); + -webkit-backface-visibility: hidden; + backface-visibility: hidden; + -webkit-transform-origin: 100% 100%; + transform-origin: 100% 100%; +} + +[type="checkbox"]:checked:disabled + label:before { + border-right: 2px solid rgba(0, 0, 0, 0.42); + border-bottom: 2px solid rgba(0, 0, 0, 0.42); +} + +/* Indeterminate checkbox */ +[type="checkbox"]:indeterminate + label:before { + top: -11px; + left: -12px; + width: 10px; + height: 22px; + border-top: none; + border-left: none; + border-right: 2px solid #26a69a; + border-bottom: none; + -webkit-transform: rotate(90deg); + transform: rotate(90deg); + -webkit-backface-visibility: hidden; + backface-visibility: hidden; + -webkit-transform-origin: 100% 100%; + transform-origin: 100% 100%; +} + +[type="checkbox"]:indeterminate:disabled + label:before { + border-right: 2px solid rgba(0, 0, 0, 0.42); + background-color: transparent; +} + +[type="checkbox"].filled-in + label:after { + border-radius: 2px; +} + +[type="checkbox"].filled-in + label:before, +[type="checkbox"].filled-in + label:after { + content: ''; + left: 0; + position: absolute; + /* .1s delay is for check animation */ + -webkit-transition: border .25s, background-color .25s, width .20s .1s, height .20s .1s, top .20s .1s, left .20s .1s; + transition: border .25s, background-color .25s, width .20s .1s, height .20s .1s, top .20s .1s, left .20s .1s; + z-index: 1; +} + +[type="checkbox"].filled-in:not(:checked) + label:before { + width: 0; + height: 0; + border: 3px solid transparent; + left: 6px; + top: 10px; + -webkit-transform: rotateZ(37deg); + transform: rotateZ(37deg); + -webkit-transform-origin: 100% 100%; + transform-origin: 100% 100%; +} + +[type="checkbox"].filled-in:not(:checked) + label:after { + height: 20px; + width: 20px; + background-color: transparent; + border: 2px solid #5a5a5a; + top: 0px; + z-index: 0; +} + +[type="checkbox"].filled-in:checked + label:before { + top: 0; + left: 1px; + width: 8px; + height: 13px; + border-top: 2px solid transparent; + border-left: 2px solid transparent; + border-right: 2px solid #fff; + border-bottom: 2px solid #fff; + -webkit-transform: rotateZ(37deg); + transform: rotateZ(37deg); + -webkit-transform-origin: 100% 100%; + transform-origin: 100% 100%; +} + +[type="checkbox"].filled-in:checked + label:after { + top: 0; + width: 20px; + height: 20px; + border: 2px solid #26a69a; + background-color: #26a69a; + z-index: 0; +} + +[type="checkbox"].filled-in.tabbed:focus + label:after { + border-radius: 2px; + border-color: #5a5a5a; + background-color: rgba(0, 0, 0, 0.1); +} + +[type="checkbox"].filled-in.tabbed:checked:focus + label:after { + border-radius: 2px; + background-color: #26a69a; + border-color: #26a69a; +} + +[type="checkbox"].filled-in:disabled:not(:checked) + label:before { + background-color: transparent; + border: 2px solid transparent; +} + +[type="checkbox"].filled-in:disabled:not(:checked) + label:after { + border-color: transparent; + background-color: #949494; +} + +[type="checkbox"].filled-in:disabled:checked + label:before { + background-color: transparent; +} + +[type="checkbox"].filled-in:disabled:checked + label:after { + background-color: #949494; + border-color: #949494; +} + +/* Switch + ========================================================================== */ +.switch, +.switch * { + -webkit-tap-highlight-color: transparent; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.switch label { + cursor: pointer; +} + +.switch label input[type=checkbox] { + opacity: 0; + width: 0; + height: 0; +} + +.switch label input[type=checkbox]:checked + .lever { + background-color: #84c7c1; +} + +.switch label input[type=checkbox]:checked + .lever:before, .switch label input[type=checkbox]:checked + .lever:after { + left: 18px; +} + +.switch label input[type=checkbox]:checked + .lever:after { + background-color: #26a69a; +} + +.switch label .lever { + content: ""; + display: inline-block; + position: relative; + width: 36px; + height: 14px; + background-color: rgba(0, 0, 0, 0.38); + border-radius: 15px; + margin-right: 10px; + -webkit-transition: background 0.3s ease; + transition: background 0.3s ease; + vertical-align: middle; + margin: 0 16px; +} + +.switch label .lever:before, .switch label .lever:after { + content: ""; + position: absolute; + display: inline-block; + width: 20px; + height: 20px; + border-radius: 50%; + left: 0; + top: -3px; + -webkit-transition: left 0.3s ease, background .3s ease, -webkit-box-shadow 0.1s ease, -webkit-transform .1s ease; + transition: left 0.3s ease, background .3s ease, -webkit-box-shadow 0.1s ease, -webkit-transform .1s ease; + transition: left 0.3s ease, background .3s ease, box-shadow 0.1s ease, transform .1s ease; + transition: left 0.3s ease, background .3s ease, box-shadow 0.1s ease, transform .1s ease, -webkit-box-shadow 0.1s ease, -webkit-transform .1s ease; +} + +.switch label .lever:before { + background-color: rgba(38, 166, 154, 0.15); +} + +.switch label .lever:after { + background-color: #F1F1F1; + -webkit-box-shadow: 0px 3px 1px -2px rgba(0, 0, 0, 0.2), 0px 2px 2px 0px rgba(0, 0, 0, 0.14), 0px 1px 5px 0px rgba(0, 0, 0, 0.12); + box-shadow: 0px 3px 1px -2px rgba(0, 0, 0, 0.2), 0px 2px 2px 0px rgba(0, 0, 0, 0.14), 0px 1px 5px 0px rgba(0, 0, 0, 0.12); +} + +input[type=checkbox]:checked:not(:disabled) ~ .lever:active::before, +input[type=checkbox]:checked:not(:disabled).tabbed:focus ~ .lever::before { + -webkit-transform: scale(2.4); + transform: scale(2.4); + background-color: rgba(38, 166, 154, 0.15); +} + +input[type=checkbox]:not(:disabled) ~ .lever:active:before, +input[type=checkbox]:not(:disabled).tabbed:focus ~ .lever::before { + -webkit-transform: scale(2.4); + transform: scale(2.4); + background-color: rgba(0, 0, 0, 0.08); +} + +.switch input[type=checkbox][disabled] + .lever { + cursor: default; + background-color: rgba(0, 0, 0, 0.12); +} + +.switch label input[type=checkbox][disabled] + .lever:after, +.switch label input[type=checkbox][disabled]:checked + .lever:after { + background-color: #949494; +} + +/* Select Field + ========================================================================== */ +select { + display: none; +} + +select.browser-default { + display: block; +} + +select { + background-color: rgba(255, 255, 255, 0.9); + width: 100%; + padding: 5px; + border: 1px solid #f2f2f2; + border-radius: 2px; + height: 3rem; +} + +.input-field > select { + display: block; + position: absolute; + width: 0; + pointer-events: none; + height: 0; + top: 0; + left: 0; + opacity: 0; +} + +.select-label { + position: absolute; +} + +.select-wrapper { + position: relative; +} + +.select-wrapper.valid + label, +.select-wrapper.invalid + label { + width: 100%; + pointer-events: none; +} + +.select-wrapper input.select-dropdown { + position: relative; + cursor: pointer; + background-color: transparent; + border: none; + border-bottom: 1px solid #9e9e9e; + outline: none; + height: 3rem; + line-height: 3rem; + width: 100%; + font-size: 1rem; + margin: 0 0 20px 0; + padding: 0; + display: block; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.select-wrapper span.caret { + color: initial; + position: absolute; + right: 0; + top: 0; + bottom: 0; + height: 10px; + margin: auto 0; + font-size: 10px; + line-height: 10px; +} + +.select-wrapper + label { + position: absolute; + top: -26px; + font-size: 0.8rem; +} + +select:disabled { + color: rgba(0, 0, 0, 0.42); +} + +.select-wrapper.disabled span.caret, +.select-wrapper.disabled + label { + color: rgba(0, 0, 0, 0.42); +} + +.select-wrapper input.select-dropdown:disabled { + color: rgba(0, 0, 0, 0.42); + cursor: default; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.select-wrapper i { + color: rgba(0, 0, 0, 0.3); +} + +.select-dropdown li.disabled, +.select-dropdown li.disabled > span, +.select-dropdown li.optgroup { + color: rgba(0, 0, 0, 0.3); + background-color: transparent; +} + +.select-dropdown.dropdown-content li.active { + background-color: transparent; +} + +.select-dropdown.dropdown-content li:hover { + background-color: rgba(0, 0, 0, 0.06); +} + +.select-dropdown.dropdown-content li.selected { + background-color: rgba(0, 0, 0, 0.03); +} + +.prefix ~ .select-wrapper { + margin-left: 3rem; + width: 92%; + width: calc(100% - 3rem); +} + +.prefix ~ label { + margin-left: 3rem; +} + +.select-dropdown li img { + height: 40px; + width: 40px; + margin: 5px 15px; + float: right; +} + +.select-dropdown li.optgroup { + border-top: 1px solid #eee; +} + +.select-dropdown li.optgroup.selected > span { + color: rgba(0, 0, 0, 0.7); +} + +.select-dropdown li.optgroup > span { + color: rgba(0, 0, 0, 0.4); +} + +.select-dropdown li.optgroup ~ li.optgroup-option { + padding-left: 1rem; +} + +/* File Input + ========================================================================== */ +.file-field { + position: relative; +} + +.file-field .file-path-wrapper { + overflow: hidden; + padding-left: 10px; +} + +.file-field input.file-path { + width: 100%; +} + +.file-field .btn, .file-field .btn-large { + float: left; + height: 3rem; + line-height: 3rem; +} + +.file-field span { + cursor: pointer; +} + +.file-field input[type=file] { + position: absolute; + top: 0; + right: 0; + left: 0; + bottom: 0; + width: 100%; + margin: 0; + padding: 0; + font-size: 20px; + cursor: pointer; + opacity: 0; + filter: alpha(opacity=0); +} + +.file-field input[type=file]::-webkit-file-upload-button { + display: none; +} + +/* Range + ========================================================================== */ +.range-field { + position: relative; +} + +input[type=range], +input[type=range] + .thumb { + cursor: pointer; +} + +input[type=range] { + position: relative; + background-color: transparent; + border: none; + outline: none; + width: 100%; + margin: 15px 0; + padding: 0; +} + +input[type=range]:focus { + outline: none; +} + +input[type=range] + .thumb { + position: absolute; + top: 10px; + left: 0; + border: none; + height: 0; + width: 0; + border-radius: 50%; + background-color: #26a69a; + margin-left: 7px; + -webkit-transform-origin: 50% 50%; + transform-origin: 50% 50%; + -webkit-transform: rotate(-45deg); + transform: rotate(-45deg); +} + +input[type=range] + .thumb .value { + display: block; + width: 30px; + text-align: center; + color: #26a69a; + font-size: 0; + -webkit-transform: rotate(45deg); + transform: rotate(45deg); +} + +input[type=range] + .thumb.active { + border-radius: 50% 50% 50% 0; +} + +input[type=range] + .thumb.active .value { + color: #fff; + margin-left: -1px; + margin-top: 8px; + font-size: 10px; +} + +input[type=range] { + -webkit-appearance: none; +} + +input[type=range]::-webkit-slider-runnable-track { + height: 3px; + background: #c2c0c2; + border: none; +} + +input[type=range]::-webkit-slider-thumb { + -webkit-appearance: none; + border: none; + height: 14px; + width: 14px; + border-radius: 50%; + background-color: #26a69a; + -webkit-transform-origin: 50% 50%; + transform-origin: 50% 50%; + margin: -5px 0 0 0; + -webkit-transition: .3s; + transition: .3s; +} + +input[type=range]:focus::-webkit-slider-runnable-track { + background: #ccc; +} + +input[type=range] { + /* fix for FF unable to apply focus style bug */ + border: 1px solid white; + /*required for proper track sizing in FF*/ +} + +input[type=range]::-moz-range-track { + height: 3px; + background: #ddd; + border: none; +} + +input[type=range]::-moz-range-thumb { + border: none; + height: 14px; + width: 14px; + border-radius: 50%; + background: #26a69a; + margin-top: -5px; +} + +input[type=range]:-moz-focusring { + outline: 1px solid #fff; + outline-offset: -1px; +} + +input[type=range]:focus::-moz-range-track { + background: #ccc; +} + +input[type=range]::-ms-track { + height: 3px; + background: transparent; + border-color: transparent; + border-width: 6px 0; + /*remove default tick marks*/ + color: transparent; +} + +input[type=range]::-ms-fill-lower { + background: #777; +} + +input[type=range]::-ms-fill-upper { + background: #ddd; +} + +input[type=range]::-ms-thumb { + border: none; + height: 14px; + width: 14px; + border-radius: 50%; + background: #26a69a; +} + +input[type=range]:focus::-ms-fill-lower { + background: #888; +} + +input[type=range]:focus::-ms-fill-upper { + background: #ccc; +} + +/*************** + Nav List +***************/ +.table-of-contents.fixed { + position: fixed; +} + +.table-of-contents li { + padding: 2px 0; +} + +.table-of-contents a { + display: inline-block; + font-weight: 300; + color: #757575; + padding-left: 20px; + height: 1.5rem; + line-height: 1.5rem; + letter-spacing: .4; + display: inline-block; +} + +.table-of-contents a:hover { + color: #a8a8a8; + padding-left: 19px; + border-left: 1px solid #ee6e73; +} + +.table-of-contents a.active { + font-weight: 500; + padding-left: 18px; + border-left: 2px solid #ee6e73; +} + +.side-nav { + position: fixed; + width: 300px; + left: 0; + top: 0; + margin: 0; + -webkit-transform: translateX(-100%); + transform: translateX(-100%); + height: 100%; + height: calc(100% + 60px); + height: -moz-calc(100%); + padding-bottom: 60px; + background-color: #fff; + z-index: 999; + overflow-y: auto; + will-change: transform; + -webkit-backface-visibility: hidden; + backface-visibility: hidden; + -webkit-transform: translateX(-105%); + transform: translateX(-105%); +} + +.side-nav.right-aligned { + right: 0; + -webkit-transform: translateX(105%); + transform: translateX(105%); + left: auto; + -webkit-transform: translateX(100%); + transform: translateX(100%); +} + +.side-nav .collapsible { + margin: 0; +} + +.side-nav li { + float: none; + line-height: 48px; +} + +.side-nav li.active { + background-color: rgba(0, 0, 0, 0.05); +} + +.side-nav li > a { + color: rgba(0, 0, 0, 0.87); + display: block; + font-size: 14px; + font-weight: 500; + height: 48px; + line-height: 48px; + padding: 0 32px; +} + +.side-nav li > a:hover { + background-color: rgba(0, 0, 0, 0.05); +} + +.side-nav li > a.btn, .side-nav li > a.btn-large, .side-nav li > a.btn-large, .side-nav li > a.btn-flat, .side-nav li > a.btn-floating { + margin: 10px 15px; +} + +.side-nav li > a.btn, .side-nav li > a.btn-large, .side-nav li > a.btn-large, .side-nav li > a.btn-floating { + color: #fff; +} + +.side-nav li > a.btn-flat { + color: #343434; +} + +.side-nav li > a.btn:hover, .side-nav li > a.btn-large:hover, .side-nav li > a.btn-large:hover { + background-color: #2bbbad; +} + +.side-nav li > a.btn-floating:hover { + background-color: #26a69a; +} + +.side-nav li > a > i, +.side-nav li > a > [class^="mdi-"], .side-nav li > a li > a > [class*="mdi-"], +.side-nav li > a > i.material-icons { + float: left; + height: 48px; + line-height: 48px; + margin: 0 32px 0 0; + width: 24px; + color: rgba(0, 0, 0, 0.54); +} + +.side-nav .divider { + margin: 8px 0 0 0; +} + +.side-nav .subheader { + cursor: initial; + pointer-events: none; + color: rgba(0, 0, 0, 0.54); + font-size: 14px; + font-weight: 500; + line-height: 48px; +} + +.side-nav .subheader:hover { + background-color: transparent; +} + +.side-nav .user-view, +.side-nav .userView { + position: relative; + padding: 32px 32px 0; + margin-bottom: 8px; +} + +.side-nav .user-view > a, +.side-nav .userView > a { + height: auto; + padding: 0; +} + +.side-nav .user-view > a:hover, +.side-nav .userView > a:hover { + background-color: transparent; +} + +.side-nav .user-view .background, +.side-nav .userView .background { + overflow: hidden; + position: absolute; + top: 0; + right: 0; + bottom: 0; + left: 0; + z-index: -1; +} + +.side-nav .user-view .circle, .side-nav .user-view .name, .side-nav .user-view .email, +.side-nav .userView .circle, +.side-nav .userView .name, +.side-nav .userView .email { + display: block; +} + +.side-nav .user-view .circle, +.side-nav .userView .circle { + height: 64px; + width: 64px; +} + +.side-nav .user-view .name, +.side-nav .user-view .email, +.side-nav .userView .name, +.side-nav .userView .email { + font-size: 14px; + line-height: 24px; +} + +.side-nav .user-view .name, +.side-nav .userView .name { + margin-top: 16px; + font-weight: 500; +} + +.side-nav .user-view .email, +.side-nav .userView .email { + padding-bottom: 16px; + font-weight: 400; +} + +.drag-target { + height: 100%; + width: 10px; + position: fixed; + top: 0; + z-index: 998; +} + +.side-nav.fixed { + left: 0; + -webkit-transform: translateX(0); + transform: translateX(0); + position: fixed; +} + +.side-nav.fixed.right-aligned { + right: 0; + left: auto; +} + +@media only screen and (max-width: 992px) { + .side-nav.fixed { + -webkit-transform: translateX(-105%); + transform: translateX(-105%); + } + .side-nav.fixed.right-aligned { + -webkit-transform: translateX(105%); + transform: translateX(105%); + } + .side-nav a { + padding: 0 16px; + } + .side-nav .user-view, + .side-nav .userView { + padding: 16px 16px 0; + } +} + +.side-nav .collapsible-body > ul:not(.collapsible) > li.active, +.side-nav.fixed .collapsible-body > ul:not(.collapsible) > li.active { + background-color: #ee6e73; +} + +.side-nav .collapsible-body > ul:not(.collapsible) > li.active a, +.side-nav.fixed .collapsible-body > ul:not(.collapsible) > li.active a { + color: #fff; +} + +.side-nav .collapsible-body { + padding: 0; +} + +#sidenav-overlay { + position: fixed; + top: 0; + left: 0; + right: 0; + height: 120vh; + background-color: rgba(0, 0, 0, 0.5); + z-index: 997; + will-change: opacity; +} + +/* + @license + Copyright (c) 2014 The Polymer Project Authors. All rights reserved. + This code may only be used under the BSD style license found at http://polymer.github.io/LICENSE.txt + The complete set of authors may be found at http://polymer.github.io/AUTHORS.txt + The complete set of contributors may be found at http://polymer.github.io/CONTRIBUTORS.txt + Code distributed by Google as part of the polymer project is also + subject to an additional IP rights grant found at http://polymer.github.io/PATENTS.txt + */ +/**************************/ +/* STYLES FOR THE SPINNER */ +/**************************/ +/* + * Constants: + * STROKEWIDTH = 3px + * ARCSIZE = 270 degrees (amount of circle the arc takes up) + * ARCTIME = 1333ms (time it takes to expand and contract arc) + * ARCSTARTROT = 216 degrees (how much the start location of the arc + * should rotate each time, 216 gives us a + * 5 pointed star shape (it's 360/5 * 3). + * For a 7 pointed star, we might do + * 360/7 * 3 = 154.286) + * CONTAINERWIDTH = 28px + * SHRINK_TIME = 400ms + */ +.preloader-wrapper { + display: inline-block; + position: relative; + width: 50px; + height: 50px; +} + +.preloader-wrapper.small { + width: 36px; + height: 36px; +} + +.preloader-wrapper.big { + width: 64px; + height: 64px; +} + +.preloader-wrapper.active { + /* duration: 360 * ARCTIME / (ARCSTARTROT + (360-ARCSIZE)) */ + -webkit-animation: container-rotate 1568ms linear infinite; + animation: container-rotate 1568ms linear infinite; +} + +@-webkit-keyframes container-rotate { + to { + -webkit-transform: rotate(360deg); + } +} + +@keyframes container-rotate { + to { + -webkit-transform: rotate(360deg); + transform: rotate(360deg); + } +} + +.spinner-layer { + position: absolute; + width: 100%; + height: 100%; + opacity: 0; + border-color: #26a69a; +} + +.spinner-blue, +.spinner-blue-only { + border-color: #4285f4; +} + +.spinner-red, +.spinner-red-only { + border-color: #db4437; +} + +.spinner-yellow, +.spinner-yellow-only { + border-color: #f4b400; +} + +.spinner-green, +.spinner-green-only { + border-color: #0f9d58; +} + +/** + * IMPORTANT NOTE ABOUT CSS ANIMATION PROPERTIES (keanulee): + * + * iOS Safari (tested on iOS 8.1) does not handle animation-delay very well - it doesn't + * guarantee that the animation will start _exactly_ after that value. So we avoid using + * animation-delay and instead set custom keyframes for each color (as redundant as it + * seems). + * + * We write out each animation in full (instead of separating animation-name, + * animation-duration, etc.) because under the polyfill, Safari does not recognize those + * specific properties properly, treats them as -webkit-animation, and overrides the + * other animation rules. See https://github.com/Polymer/platform/issues/53. + */ +.active .spinner-layer.spinner-blue { + /* durations: 4 * ARCTIME */ + -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; + animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; +} + +.active .spinner-layer.spinner-red { + /* durations: 4 * ARCTIME */ + -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; + animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; +} + +.active .spinner-layer.spinner-yellow { + /* durations: 4 * ARCTIME */ + -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; + animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; +} + +.active .spinner-layer.spinner-green { + /* durations: 4 * ARCTIME */ + -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; + animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; +} + +.active .spinner-layer, +.active .spinner-layer.spinner-blue-only, +.active .spinner-layer.spinner-red-only, +.active .spinner-layer.spinner-yellow-only, +.active .spinner-layer.spinner-green-only { + /* durations: 4 * ARCTIME */ + opacity: 1; + -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; + animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; +} + +@-webkit-keyframes fill-unfill-rotate { + 12.5% { + -webkit-transform: rotate(135deg); + } + /* 0.5 * ARCSIZE */ + 25% { + -webkit-transform: rotate(270deg); + } + /* 1 * ARCSIZE */ + 37.5% { + -webkit-transform: rotate(405deg); + } + /* 1.5 * ARCSIZE */ + 50% { + -webkit-transform: rotate(540deg); + } + /* 2 * ARCSIZE */ + 62.5% { + -webkit-transform: rotate(675deg); + } + /* 2.5 * ARCSIZE */ + 75% { + -webkit-transform: rotate(810deg); + } + /* 3 * ARCSIZE */ + 87.5% { + -webkit-transform: rotate(945deg); + } + /* 3.5 * ARCSIZE */ + to { + -webkit-transform: rotate(1080deg); + } + /* 4 * ARCSIZE */ +} + +@keyframes fill-unfill-rotate { + 12.5% { + -webkit-transform: rotate(135deg); + transform: rotate(135deg); + } + /* 0.5 * ARCSIZE */ + 25% { + -webkit-transform: rotate(270deg); + transform: rotate(270deg); + } + /* 1 * ARCSIZE */ + 37.5% { + -webkit-transform: rotate(405deg); + transform: rotate(405deg); + } + /* 1.5 * ARCSIZE */ + 50% { + -webkit-transform: rotate(540deg); + transform: rotate(540deg); + } + /* 2 * ARCSIZE */ + 62.5% { + -webkit-transform: rotate(675deg); + transform: rotate(675deg); + } + /* 2.5 * ARCSIZE */ + 75% { + -webkit-transform: rotate(810deg); + transform: rotate(810deg); + } + /* 3 * ARCSIZE */ + 87.5% { + -webkit-transform: rotate(945deg); + transform: rotate(945deg); + } + /* 3.5 * ARCSIZE */ + to { + -webkit-transform: rotate(1080deg); + transform: rotate(1080deg); + } + /* 4 * ARCSIZE */ +} + +@-webkit-keyframes blue-fade-in-out { + from { + opacity: 1; + } + 25% { + opacity: 1; + } + 26% { + opacity: 0; + } + 89% { + opacity: 0; + } + 90% { + opacity: 1; + } + 100% { + opacity: 1; + } +} + +@keyframes blue-fade-in-out { + from { + opacity: 1; + } + 25% { + opacity: 1; + } + 26% { + opacity: 0; + } + 89% { + opacity: 0; + } + 90% { + opacity: 1; + } + 100% { + opacity: 1; + } +} + +@-webkit-keyframes red-fade-in-out { + from { + opacity: 0; + } + 15% { + opacity: 0; + } + 25% { + opacity: 1; + } + 50% { + opacity: 1; + } + 51% { + opacity: 0; + } +} + +@keyframes red-fade-in-out { + from { + opacity: 0; + } + 15% { + opacity: 0; + } + 25% { + opacity: 1; + } + 50% { + opacity: 1; + } + 51% { + opacity: 0; + } +} + +@-webkit-keyframes yellow-fade-in-out { + from { + opacity: 0; + } + 40% { + opacity: 0; + } + 50% { + opacity: 1; + } + 75% { + opacity: 1; + } + 76% { + opacity: 0; + } +} + +@keyframes yellow-fade-in-out { + from { + opacity: 0; + } + 40% { + opacity: 0; + } + 50% { + opacity: 1; + } + 75% { + opacity: 1; + } + 76% { + opacity: 0; + } +} + +@-webkit-keyframes green-fade-in-out { + from { + opacity: 0; + } + 65% { + opacity: 0; + } + 75% { + opacity: 1; + } + 90% { + opacity: 1; + } + 100% { + opacity: 0; + } +} + +@keyframes green-fade-in-out { + from { + opacity: 0; + } + 65% { + opacity: 0; + } + 75% { + opacity: 1; + } + 90% { + opacity: 1; + } + 100% { + opacity: 0; + } +} + +/** + * Patch the gap that appear between the two adjacent div.circle-clipper while the + * spinner is rotating (appears on Chrome 38, Safari 7.1, and IE 11). + */ +.gap-patch { + position: absolute; + top: 0; + left: 45%; + width: 10%; + height: 100%; + overflow: hidden; + border-color: inherit; +} + +.gap-patch .circle { + width: 1000%; + left: -450%; +} + +.circle-clipper { + display: inline-block; + position: relative; + width: 50%; + height: 100%; + overflow: hidden; + border-color: inherit; +} + +.circle-clipper .circle { + width: 200%; + height: 100%; + border-width: 3px; + /* STROKEWIDTH */ + border-style: solid; + border-color: inherit; + border-bottom-color: transparent !important; + border-radius: 50%; + -webkit-animation: none; + animation: none; + position: absolute; + top: 0; + right: 0; + bottom: 0; +} + +.circle-clipper.left .circle { + left: 0; + border-right-color: transparent !important; + -webkit-transform: rotate(129deg); + transform: rotate(129deg); +} + +.circle-clipper.right .circle { + left: -100%; + border-left-color: transparent !important; + -webkit-transform: rotate(-129deg); + transform: rotate(-129deg); +} + +.active .circle-clipper.left .circle { + /* duration: ARCTIME */ + -webkit-animation: left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; + animation: left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; +} + +.active .circle-clipper.right .circle { + /* duration: ARCTIME */ + -webkit-animation: right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; + animation: right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; +} + +@-webkit-keyframes left-spin { + from { + -webkit-transform: rotate(130deg); + } + 50% { + -webkit-transform: rotate(-5deg); + } + to { + -webkit-transform: rotate(130deg); + } +} + +@keyframes left-spin { + from { + -webkit-transform: rotate(130deg); + transform: rotate(130deg); + } + 50% { + -webkit-transform: rotate(-5deg); + transform: rotate(-5deg); + } + to { + -webkit-transform: rotate(130deg); + transform: rotate(130deg); + } +} + +@-webkit-keyframes right-spin { + from { + -webkit-transform: rotate(-130deg); + } + 50% { + -webkit-transform: rotate(5deg); + } + to { + -webkit-transform: rotate(-130deg); + } +} + +@keyframes right-spin { + from { + -webkit-transform: rotate(-130deg); + transform: rotate(-130deg); + } + 50% { + -webkit-transform: rotate(5deg); + transform: rotate(5deg); + } + to { + -webkit-transform: rotate(-130deg); + transform: rotate(-130deg); + } +} + +#spinnerContainer.cooldown { + /* duration: SHRINK_TIME */ + -webkit-animation: container-rotate 1568ms linear infinite, fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1); + animation: container-rotate 1568ms linear infinite, fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1); +} + +@-webkit-keyframes fade-out { + from { + opacity: 1; + } + to { + opacity: 0; + } +} + +@keyframes fade-out { + from { + opacity: 1; + } + to { + opacity: 0; + } +} + +.slider { + position: relative; + height: 400px; + width: 100%; +} + +.slider.fullscreen { + height: 100%; + width: 100%; + position: absolute; + top: 0; + left: 0; + right: 0; + bottom: 0; +} + +.slider.fullscreen ul.slides { + height: 100%; +} + +.slider.fullscreen ul.indicators { + z-index: 2; + bottom: 30px; +} + +.slider .slides { + background-color: #9e9e9e; + margin: 0; + height: 400px; +} + +.slider .slides li { + opacity: 0; + position: absolute; + top: 0; + left: 0; + z-index: 1; + width: 100%; + height: inherit; + overflow: hidden; +} + +.slider .slides li img { + height: 100%; + width: 100%; + background-size: cover; + background-position: center; +} + +.slider .slides li .caption { + color: #fff; + position: absolute; + top: 15%; + left: 15%; + width: 70%; + opacity: 0; +} + +.slider .slides li .caption p { + color: #e0e0e0; +} + +.slider .slides li.active { + z-index: 2; +} + +.slider .indicators { + position: absolute; + text-align: center; + left: 0; + right: 0; + bottom: 0; + margin: 0; +} + +.slider .indicators .indicator-item { + display: inline-block; + position: relative; + cursor: pointer; + height: 16px; + width: 16px; + margin: 0 12px; + background-color: #e0e0e0; + -webkit-transition: background-color .3s; + transition: background-color .3s; + border-radius: 50%; +} + +.slider .indicators .indicator-item.active { + background-color: #4CAF50; +} + +.carousel { + overflow: hidden; + position: relative; + width: 100%; + height: 400px; + -webkit-perspective: 500px; + perspective: 500px; + -webkit-transform-style: preserve-3d; + transform-style: preserve-3d; + -webkit-transform-origin: 0% 50%; + transform-origin: 0% 50%; +} + +.carousel.carousel-slider { + top: 0; + left: 0; +} + +.carousel.carousel-slider .carousel-fixed-item { + position: absolute; + left: 0; + right: 0; + bottom: 20px; + z-index: 1; +} + +.carousel.carousel-slider .carousel-fixed-item.with-indicators { + bottom: 68px; +} + +.carousel.carousel-slider .carousel-item { + width: 100%; + height: 100%; + min-height: 400px; + position: absolute; + top: 0; + left: 0; +} + +.carousel.carousel-slider .carousel-item h2 { + font-size: 24px; + font-weight: 500; + line-height: 32px; +} + +.carousel.carousel-slider .carousel-item p { + font-size: 15px; +} + +.carousel .carousel-item { + display: none; + width: 200px; + height: 200px; + position: absolute; + top: 0; + left: 0; +} + +.carousel .carousel-item > img { + width: 100%; +} + +.carousel .indicators { + position: absolute; + text-align: center; + left: 0; + right: 0; + bottom: 0; + margin: 0; +} + +.carousel .indicators .indicator-item { + display: inline-block; + position: relative; + cursor: pointer; + height: 8px; + width: 8px; + margin: 24px 4px; + background-color: rgba(255, 255, 255, 0.5); + -webkit-transition: background-color .3s; + transition: background-color .3s; + border-radius: 50%; +} + +.carousel .indicators .indicator-item.active { + background-color: #fff; +} + +.carousel.scrolling .carousel-item .materialboxed, +.carousel .carousel-item:not(.active) .materialboxed { + pointer-events: none; +} + +.tap-target-wrapper { + width: 800px; + height: 800px; + position: fixed; + z-index: 1000; + visibility: hidden; + -webkit-transition: visibility 0s .3s; + transition: visibility 0s .3s; +} + +.tap-target-wrapper.open { + visibility: visible; + -webkit-transition: visibility 0s; + transition: visibility 0s; +} + +.tap-target-wrapper.open .tap-target { + -webkit-transform: scale(1); + transform: scale(1); + opacity: .95; + -webkit-transition: opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1), -webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1); + transition: opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1), -webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1); + transition: transform 0.3s cubic-bezier(0.42, 0, 0.58, 1), opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1); + transition: transform 0.3s cubic-bezier(0.42, 0, 0.58, 1), opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1), -webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1); +} + +.tap-target-wrapper.open .tap-target-wave::before { + -webkit-transform: scale(1); + transform: scale(1); +} + +.tap-target-wrapper.open .tap-target-wave::after { + visibility: visible; + -webkit-animation: pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite; + animation: pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite; + -webkit-transition: opacity .3s, visibility 0s 1s, -webkit-transform .3s; + transition: opacity .3s, visibility 0s 1s, -webkit-transform .3s; + transition: opacity .3s, transform .3s, visibility 0s 1s; + transition: opacity .3s, transform .3s, visibility 0s 1s, -webkit-transform .3s; +} + +.tap-target { + position: absolute; + font-size: 1rem; + border-radius: 50%; + background-color: #ee6e73; + -webkit-box-shadow: 0 20px 20px 0 rgba(0, 0, 0, 0.14), 0 10px 50px 0 rgba(0, 0, 0, 0.12), 0 30px 10px -20px rgba(0, 0, 0, 0.2); + box-shadow: 0 20px 20px 0 rgba(0, 0, 0, 0.14), 0 10px 50px 0 rgba(0, 0, 0, 0.12), 0 30px 10px -20px rgba(0, 0, 0, 0.2); + width: 100%; + height: 100%; + opacity: 0; + -webkit-transform: scale(0); + transform: scale(0); + -webkit-transition: opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1), -webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1); + transition: opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1), -webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1); + transition: transform 0.3s cubic-bezier(0.42, 0, 0.58, 1), opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1); + transition: transform 0.3s cubic-bezier(0.42, 0, 0.58, 1), opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1), -webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1); +} + +.tap-target-content { + position: relative; + display: table-cell; +} + +.tap-target-wave { + position: absolute; + border-radius: 50%; + z-index: 10001; +} + +.tap-target-wave::before, .tap-target-wave::after { + content: ''; + display: block; + position: absolute; + width: 100%; + height: 100%; + border-radius: 50%; + background-color: #ffffff; +} + +.tap-target-wave::before { + -webkit-transform: scale(0); + transform: scale(0); + -webkit-transition: -webkit-transform .3s; + transition: -webkit-transform .3s; + transition: transform .3s; + transition: transform .3s, -webkit-transform .3s; +} + +.tap-target-wave::after { + visibility: hidden; + -webkit-transition: opacity .3s, visibility 0s, -webkit-transform .3s; + transition: opacity .3s, visibility 0s, -webkit-transform .3s; + transition: opacity .3s, transform .3s, visibility 0s; + transition: opacity .3s, transform .3s, visibility 0s, -webkit-transform .3s; + z-index: -1; +} + +.tap-target-origin { + top: 50%; + left: 50%; + -webkit-transform: translate(-50%, -50%); + transform: translate(-50%, -50%); + z-index: 10002; + position: absolute !important; +} + +.tap-target-origin:not(.btn):not(.btn-large), .tap-target-origin:not(.btn):not(.btn-large):hover { + background: none; +} + +@media only screen and (max-width: 600px) { + .tap-target, .tap-target-wrapper { + width: 600px; + height: 600px; + } +} + +.pulse { + overflow: initial; + position: relative; +} + +.pulse::before { + content: ''; + display: block; + position: absolute; + width: 100%; + height: 100%; + top: 0; + left: 0; + background-color: inherit; + border-radius: inherit; + -webkit-transition: opacity .3s, -webkit-transform .3s; + transition: opacity .3s, -webkit-transform .3s; + transition: opacity .3s, transform .3s; + transition: opacity .3s, transform .3s, -webkit-transform .3s; + -webkit-animation: pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite; + animation: pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite; + z-index: -1; +} + +@-webkit-keyframes pulse-animation { + 0% { + opacity: 1; + -webkit-transform: scale(1); + transform: scale(1); + } + 50% { + opacity: 0; + -webkit-transform: scale(1.5); + transform: scale(1.5); + } + 100% { + opacity: 0; + -webkit-transform: scale(1.5); + transform: scale(1.5); + } +} + +@keyframes pulse-animation { + 0% { + opacity: 1; + -webkit-transform: scale(1); + transform: scale(1); + } + 50% { + opacity: 0; + -webkit-transform: scale(1.5); + transform: scale(1.5); + } + 100% { + opacity: 0; + -webkit-transform: scale(1.5); + transform: scale(1.5); + } +} + +/* ========================================================================== + $BASE-PICKER + ========================================================================== */ +/** + * Note: the root picker element should *NOT* be styled more than what's here. + */ +.picker { + font-size: 16px; + text-align: left; + line-height: 1.2; + color: #000000; + position: absolute; + z-index: 10000; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + outline: none; +} + +/** + * The picker input element. + */ +.picker__input { + cursor: default; +} + +/** + * When the picker is opened, the input element is "activated". + */ +.picker__input.picker__input--active { + border-color: #0089ec; +} + +/** + * The holder is the only "scrollable" top-level container element. + */ +.picker__holder { + width: 100%; + overflow-y: auto; + -webkit-overflow-scrolling: touch; +} + +/*! + * Default mobile-first, responsive styling for pickadate.js + * Demo: http://amsul.github.io/pickadate.js + */ +/** + * Note: the root picker element should *NOT* be styled more than what's here. + */ +/** + * Make the holder and frame fullscreen. + */ +.picker__holder, +.picker__frame { + bottom: 0; + left: 0; + right: 0; + top: 100%; +} + +/** + * The holder should overlay the entire screen. + */ +.picker__holder { + position: fixed; + -webkit-transition: background 0.15s ease-out, top 0s 0.15s; + transition: background 0.15s ease-out, top 0s 0.15s; + -webkit-backface-visibility: hidden; +} + +/** + * The frame that bounds the box contents of the picker. + */ +.picker__frame { + position: absolute; + margin: 0 auto; + min-width: 256px; + width: 300px; + max-height: 350px; + -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; + filter: alpha(opacity=0); + -moz-opacity: 0; + opacity: 0; + -webkit-transition: all 0.15s ease-out; + transition: all 0.15s ease-out; +} + +@media (min-height: 28.875em) { + .picker__frame { + overflow: visible; + top: auto; + bottom: -100%; + max-height: 80%; + } +} + +@media (min-height: 40.125em) { + .picker__frame { + margin-bottom: 7.5%; + } +} + +/** + * The wrapper sets the stage to vertically align the box contents. + */ +.picker__wrap { + display: table; + width: 100%; + height: 100%; +} + +@media (min-height: 28.875em) { + .picker__wrap { + display: block; + } +} + +/** + * The box contains all the picker contents. + */ +.picker__box { + background: #ffffff; + display: table-cell; + vertical-align: middle; +} + +@media (min-height: 28.875em) { + .picker__box { + display: block; + border: 1px solid #777777; + border-top-color: #898989; + border-bottom-width: 0; + border-radius: 5px 5px 0 0; + -webkit-box-shadow: 0 12px 36px 16px rgba(0, 0, 0, 0.24); + box-shadow: 0 12px 36px 16px rgba(0, 0, 0, 0.24); + } +} + +/** + * When the picker opens... + */ +.picker--opened .picker__holder { + top: 0; + background: transparent; + -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorstr=#1E000000,endColorstr=#1E000000)"; + zoom: 1; + background: rgba(0, 0, 0, 0.32); + -webkit-transition: background 0.15s ease-out; + transition: background 0.15s ease-out; +} + +.picker--opened .picker__frame { + top: 0; + -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=100)"; + filter: alpha(opacity=100); + -moz-opacity: 1; + opacity: 1; +} + +@media (min-height: 35.875em) { + .picker--opened .picker__frame { + top: 10%; + bottom: auto; + } +} + +/** + * For `large` screens, transform into an inline picker. + */ +/* ========================================================================== + CUSTOM MATERIALIZE STYLES + ========================================================================== */ +.picker__input.picker__input--active { + border-color: #E3F2FD; +} + +.picker__frame { + margin: 0 auto; + max-width: 325px; +} + +@media (min-height: 38.875em) { + .picker--opened .picker__frame { + top: 10%; + bottom: auto; + } +} + +@media only screen and (min-width: 601px) { + .picker__box { + display: -webkit-box; + display: -webkit-flex; + display: -ms-flexbox; + display: flex; + } + .picker__frame { + width: 80%; + max-width: 600px; + } +} + +/* ========================================================================== + $BASE-DATE-PICKER + ========================================================================== */ +/** + * The picker box. + */ +.picker__box { + padding: 0; + border-radius: 2px; + overflow: hidden; +} + +/** + * The header containing the month and year stuff. + */ +.picker__header { + text-align: center; + position: relative; + margin-top: .75em; +} + +/** + * The month and year labels. + */ +.picker__month, +.picker__year { + display: inline-block; + margin-left: .25em; + margin-right: .25em; +} + +/** + * The month and year selectors. + */ +.picker__select--month, +.picker__select--year { + height: 2em; + padding: 0; + margin-left: .25em; + margin-right: .25em; +} + +.picker__select--month.browser-default { + display: inline; + background-color: #FFFFFF; + width: 40%; +} + +.picker__select--year.browser-default { + display: inline; + background-color: #FFFFFF; + width: 26%; +} + +.picker__select--month:focus, +.picker__select--year:focus { + border-color: rgba(0, 0, 0, 0.05); +} + +/** + * The month navigation buttons. + */ +.picker__nav--prev, +.picker__nav--next { + position: absolute; + padding: .5em 1.25em; + width: 1em; + height: 1em; + -webkit-box-sizing: content-box; + box-sizing: content-box; + top: -0.25em; +} + +.picker__nav--prev { + left: -1em; + padding-right: 1.25em; +} + +.picker__nav--next { + right: -1em; + padding-left: 1.25em; +} + +.picker__nav--disabled, +.picker__nav--disabled:hover, +.picker__nav--disabled:before, +.picker__nav--disabled:before:hover { + cursor: default; + background: none; + border-right-color: #f5f5f5; + border-left-color: #f5f5f5; +} + +/** + * The calendar table of dates + */ +.picker__table { + text-align: center; + border-collapse: collapse; + border-spacing: 0; + table-layout: fixed; + font-size: 1rem; + width: 100%; + margin-top: .75em; + margin-bottom: .5em; +} + +.picker__table th, .picker__table td { + text-align: center; +} + +.picker__table td { + margin: 0; + padding: 0; +} + +/** + * The weekday labels + */ +.picker__weekday { + width: 14.285714286%; + font-size: .75em; + padding-bottom: .25em; + color: #999999; + font-weight: 500; + /* Increase the spacing a tad */ +} + +@media (min-height: 33.875em) { + .picker__weekday { + padding-bottom: .5em; + } +} + +/** + * The days on the calendar + */ +.picker__day--today { + position: relative; + color: #595959; + letter-spacing: -.3; + padding: .75rem 0; + font-weight: 400; + border: 1px solid transparent; +} + +.picker__day--disabled:before { + border-top-color: #aaaaaa; +} + +.picker__day--infocus:hover { + cursor: pointer; + color: #000; + font-weight: 500; +} + +.picker__day--outfocus { + display: none; + padding: .75rem 0; + color: #fff; +} + +.picker__day--outfocus:hover { + cursor: pointer; + color: #dddddd; + font-weight: 500; +} + +.picker__day--highlighted:hover, +.picker--focused .picker__day--highlighted { + cursor: pointer; +} + +.picker__day--selected, +.picker__day--selected:hover, +.picker--focused .picker__day--selected { + border-radius: 50%; + -webkit-transform: scale(0.75); + transform: scale(0.75); + background: #0089ec; + color: #ffffff; +} + +.picker__day--disabled, +.picker__day--disabled:hover, +.picker--focused .picker__day--disabled { + background: #f5f5f5; + border-color: #f5f5f5; + color: #dddddd; + cursor: default; +} + +.picker__day--highlighted.picker__day--disabled, +.picker__day--highlighted.picker__day--disabled:hover { + background: #bbbbbb; +} + +/** + * The footer containing the "today", "clear", and "close" buttons. + */ +.picker__footer { + text-align: right; +} + +.picker__button--today, +.picker__button--clear, +.picker__button--close { + border: 1px solid #ffffff; + background: #ffffff; + font-size: .8em; + padding: .66em 0; + font-weight: bold; + width: 33%; + display: inline-block; + vertical-align: bottom; +} + +.picker__button--today:hover, +.picker__button--clear:hover, +.picker__button--close:hover { + cursor: pointer; + color: #000000; + background: #b1dcfb; + border-bottom-color: #b1dcfb; +} + +.picker__button--today:focus, +.picker__button--clear:focus, +.picker__button--close:focus { + background: #b1dcfb; + border-color: rgba(0, 0, 0, 0.05); + outline: none; +} + +.picker__button--today:before, +.picker__button--clear:before, +.picker__button--close:before { + position: relative; + display: inline-block; + height: 0; +} + +.picker__button--today:before, +.picker__button--clear:before { + content: " "; + margin-right: .45em; +} + +.picker__button--today:before { + top: -0.05em; + width: 0; + border-top: 0.66em solid #0059bc; + border-left: .66em solid transparent; +} + +.picker__button--clear:before { + top: -0.25em; + width: .66em; + border-top: 3px solid #ee2200; +} + +.picker__button--close:before { + content: "\D7"; + top: -0.1em; + vertical-align: top; + font-size: 1.1em; + margin-right: .35em; + color: #777777; +} + +.picker__button--today[disabled], +.picker__button--today[disabled]:hover { + background: #f5f5f5; + border-color: #f5f5f5; + color: #dddddd; + cursor: default; +} + +.picker__button--today[disabled]:before { + border-top-color: #aaaaaa; +} + +/* ========================================================================== + CUSTOM MATERIALIZE STYLES + ========================================================================== */ +/*.picker__box { + border-radius: 2px; + overflow: hidden; +}*/ +.picker__date-display { + text-align: left; + background-color: #26a69a; + color: #fff; + padding: 18px; + font-weight: 300; +} + +@media only screen and (min-width: 601px) { + .picker__date-display { + -webkit-box-flex: 1; + -webkit-flex: 1; + -ms-flex: 1; + flex: 1; + } + .picker__weekday-display { + display: block; + } + .picker__container__wrapper { + -webkit-box-flex: 2; + -webkit-flex: 2; + -ms-flex: 2; + flex: 2; + } +} + +.picker__nav--prev:hover, +.picker__nav--next:hover { + cursor: pointer; + color: #000000; + background: #a1ded8; +} + +.picker__weekday-display { + font-weight: 500; + font-size: 2.8rem; + margin-right: 5px; + margin-top: 4px; +} + +.picker__month-display { + font-size: 2.8rem; + font-weight: 500; +} + +.picker__day-display { + font-size: 2.8rem; + font-weight: 500; + margin-right: 5px; +} + +.picker__year-display { + font-size: 1.5rem; + font-weight: 500; + color: rgba(255, 255, 255, 0.7); +} + +/*.picker__box { + padding: 0; +}*/ +.picker__calendar-container { + padding: 0 1rem; +} + +.picker__calendar-container thead { + border: none; +} + +.picker__table { + margin-top: 0; + margin-bottom: .5em; +} + +.picker__day--infocus { + color: rgba(0, 0, 0, 0.87); + letter-spacing: -.3px; + padding: 0.75rem 0; + font-weight: 400; + border: 1px solid transparent; +} + +@media only screen and (min-width: 601px) { + .picker__day--infocus { + padding: 1.1rem 0; + } +} + +.picker__day.picker__day--today { + color: #26a69a; +} + +.picker__day.picker__day--today.picker__day--selected { + color: #fff; +} + +.picker__weekday { + font-size: .9rem; +} + +.picker__day--selected, +.picker__day--selected:hover, +.picker--focused .picker__day--selected { + border-radius: 50%; + -webkit-transform: scale(0.9); + transform: scale(0.9); + background-color: #26a69a; + color: #ffffff; +} + +.picker__day--selected.picker__day--outfocus, +.picker__day--selected:hover.picker__day--outfocus, +.picker--focused .picker__day--selected.picker__day--outfocus { + background-color: #a1ded8; +} + +.picker__footer { + text-align: right; + padding: 5px 10px; +} + +.picker__close, .picker__today, .picker__clear { + font-size: 1.1rem; + padding: 0 1rem; + color: #26a69a; +} + +.picker__clear { + color: #f44336; + float: left; +} + +.picker__nav--prev:before, +.picker__nav--next:before { + content: " "; + border-top: .5em solid transparent; + border-bottom: .5em solid transparent; + border-right: 0.75em solid #676767; + width: 0; + height: 0; + display: block; + margin: 0 auto; +} + +.picker__nav--next:before { + border-right: 0; + border-left: 0.75em solid #676767; +} + +button.picker__today:focus, button.picker__clear:focus, button.picker__close:focus { + background-color: #a1ded8; +} + +/* ========================================================================== + $BASE-TIME-PICKER + ========================================================================== */ +/** + * The list of times. + */ +.picker__list { + list-style: none; + padding: 0.75em 0 4.2em; + margin: 0; +} + +/** + * The times on the clock. + */ +.picker__list-item { + border-bottom: 1px solid #ddd; + border-top: 1px solid #ddd; + margin-bottom: -1px; + position: relative; + background: #fff; + padding: .75em 1.25em; +} + +@media (min-height: 46.75em) { + .picker__list-item { + padding: .5em 1em; + } +} + +/* Hovered time */ +.picker__list-item:hover { + cursor: pointer; + color: #000; + background: #b1dcfb; + border-color: #0089ec; + z-index: 10; +} + +/* Highlighted and hovered/focused time */ +.picker__list-item--highlighted { + border-color: #0089ec; + z-index: 10; +} + +.picker__list-item--highlighted:hover, +.picker--focused .picker__list-item--highlighted { + cursor: pointer; + color: #000; + background: #b1dcfb; +} + +/* Selected and hovered/focused time */ +.picker__list-item--selected, +.picker__list-item--selected:hover, +.picker--focused .picker__list-item--selected { + background: #0089ec; + color: #fff; + z-index: 10; +} + +/* Disabled time */ +.picker__list-item--disabled, +.picker__list-item--disabled:hover, +.picker--focused .picker__list-item--disabled { + background: #f5f5f5; + border-color: #f5f5f5; + color: #ddd; + cursor: default; + border-color: #ddd; + z-index: auto; +} + +/** + * The clear button + */ +.picker--time .picker__button--clear { + display: block; + width: 80%; + margin: 1em auto 0; + padding: 1em 1.25em; + background: none; + border: 0; + font-weight: 500; + font-size: .67em; + text-align: center; + text-transform: uppercase; + color: rgba(0, 0, 0, 0.87); +} + +.picker--time .picker__button--clear:hover, +.picker--time .picker__button--clear:focus { + color: #000; + background: #b1dcfb; + background: #ee2200; + border-color: #ee2200; + cursor: pointer; + color: #fff; + outline: none; +} + +.picker--time .picker__button--clear:before { + top: -0.25em; + color: rgba(0, 0, 0, 0.87); + font-size: 1.25em; + font-weight: bold; +} + +.picker--time .picker__button--clear:hover:before, +.picker--time .picker__button--clear:focus:before { + color: #fff; +} + +/* ========================================================================== + $DEFAULT-TIME-PICKER + ========================================================================== */ +/** + * The frame the bounds the time picker. + */ +.picker--time .picker__frame { + min-width: 256px; + max-width: 320px; +} + +/** + * The picker box. + */ +.picker--time .picker__box { + font-size: 1em; + background: #f2f2f2; + padding: 0; +} + +@media (min-height: 40.125em) { + .picker--time .picker__box { + margin-bottom: 5em; + } +} + +/* ========================================================================== + $DEFAULT-TIME-PICKER + ========================================================================== */ +.clockpicker-display { + font-size: 4rem; + font-weight: bold; + text-align: center; + color: rgba(255, 255, 255, 0.6); + font-weight: 400; + clear: both; + position: relative; +} + +.clockpicker-span-am-pm { + font-size: 1.3rem; + position: absolute; + right: 1rem; + bottom: 0.3rem; + line-height: 2rem; + font-weight: 500; +} + +@media only screen and (min-width: 601px) { + .clockpicker-display { + top: 32%; + } + .clockpicker-span-am-pm { + position: relative; + right: auto; + bottom: auto; + text-align: center; + margin-top: 1.2rem; + } +} + +.text-primary { + color: white; +} + +.clockpicker-span-hours { + margin-right: 3px; +} + +.clockpicker-span-minutes { + margin-left: 3px; +} + +.clockpicker-span-hours, +.clockpicker-span-minutes, +.clockpicker-span-am-pm div { + cursor: pointer; +} + +.clockpicker-moving { + cursor: move; +} + +.clockpicker-plate { + background-color: #eee; + border-radius: 50%; + width: 270px; + height: 270px; + overflow: visible; + position: relative; + margin: auto; + margin-top: 25px; + margin-bottom: 5px; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.clockpicker-canvas, +.clockpicker-dial { + width: 270px; + height: 270px; + position: absolute; + left: -1px; + top: -1px; +} + +.clockpicker-minutes { + visibility: hidden; +} + +.clockpicker-tick { + border-radius: 50%; + color: rgba(0, 0, 0, 0.87); + line-height: 40px; + text-align: center; + width: 40px; + height: 40px; + position: absolute; + cursor: pointer; +} + +.clockpicker-tick.active, +.clockpicker-tick:hover { + background-color: rgba(38, 166, 154, 0.25); +} + +.clockpicker-dial { + -webkit-transition: -webkit-transform 350ms, opacity 350ms; + -webkit-transition: opacity 350ms, -webkit-transform 350ms; + transition: opacity 350ms, -webkit-transform 350ms; + transition: transform 350ms, opacity 350ms; + transition: transform 350ms, opacity 350ms, -webkit-transform 350ms; +} + +.clockpicker-dial-out { + opacity: 0; +} + +.clockpicker-hours.clockpicker-dial-out { + -webkit-transform: scale(1.2, 1.2); + transform: scale(1.2, 1.2); +} + +.clockpicker-minutes.clockpicker-dial-out { + -webkit-transform: scale(0.8, 0.8); + transform: scale(0.8, 0.8); +} + +.clockpicker-canvas { + -webkit-transition: opacity 175ms; + transition: opacity 175ms; +} + +.clockpicker-canvas-out { + opacity: 0.25; +} + +.clockpicker-canvas-bearing { + stroke: none; + fill: #26a69a; +} + +.clockpicker-canvas-bg { + stroke: none; + fill: #26a69a; +} + +.clockpicker-canvas-bg-trans { + fill: #26a69a; +} + +.clockpicker-canvas line { + stroke: #26a69a; + stroke-width: 4; + stroke-linecap: round; + /*shape-rendering: crispEdges;*/ +} diff --git a/src/main/webapp/css/materialize.min.css b/src/main/webapp/css/materialize.min.css new file mode 100644 index 0000000..de1a4e3 --- /dev/null +++ b/src/main/webapp/css/materialize.min.css @@ -0,0 +1,16 @@ +/*! + * Materialize v0.100.2 (http://materializecss.com) + * Copyright 2014-2017 Materialize + * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE) + */ +.materialize-red{background-color:#e51c23 !important}.materialize-red-text{color:#e51c23 !important}.materialize-red.lighten-5{background-color:#fdeaeb !important}.materialize-red-text.text-lighten-5{color:#fdeaeb !important}.materialize-red.lighten-4{background-color:#f8c1c3 !important}.materialize-red-text.text-lighten-4{color:#f8c1c3 !important}.materialize-red.lighten-3{background-color:#f3989b !important}.materialize-red-text.text-lighten-3{color:#f3989b !important}.materialize-red.lighten-2{background-color:#ee6e73 !important}.materialize-red-text.text-lighten-2{color:#ee6e73 !important}.materialize-red.lighten-1{background-color:#ea454b !important}.materialize-red-text.text-lighten-1{color:#ea454b !important}.materialize-red.darken-1{background-color:#d0181e !important}.materialize-red-text.text-darken-1{color:#d0181e !important}.materialize-red.darken-2{background-color:#b9151b !important}.materialize-red-text.text-darken-2{color:#b9151b !important}.materialize-red.darken-3{background-color:#a21318 !important}.materialize-red-text.text-darken-3{color:#a21318 !important}.materialize-red.darken-4{background-color:#8b1014 !important}.materialize-red-text.text-darken-4{color:#8b1014 !important}.red{background-color:#F44336 !important}.red-text{color:#F44336 !important}.red.lighten-5{background-color:#FFEBEE !important}.red-text.text-lighten-5{color:#FFEBEE !important}.red.lighten-4{background-color:#FFCDD2 !important}.red-text.text-lighten-4{color:#FFCDD2 !important}.red.lighten-3{background-color:#EF9A9A !important}.red-text.text-lighten-3{color:#EF9A9A !important}.red.lighten-2{background-color:#E57373 !important}.red-text.text-lighten-2{color:#E57373 !important}.red.lighten-1{background-color:#EF5350 !important}.red-text.text-lighten-1{color:#EF5350 !important}.red.darken-1{background-color:#E53935 !important}.red-text.text-darken-1{color:#E53935 !important}.red.darken-2{background-color:#D32F2F !important}.red-text.text-darken-2{color:#D32F2F !important}.red.darken-3{background-color:#C62828 !important}.red-text.text-darken-3{color:#C62828 !important}.red.darken-4{background-color:#B71C1C !important}.red-text.text-darken-4{color:#B71C1C !important}.red.accent-1{background-color:#FF8A80 !important}.red-text.text-accent-1{color:#FF8A80 !important}.red.accent-2{background-color:#FF5252 !important}.red-text.text-accent-2{color:#FF5252 !important}.red.accent-3{background-color:#FF1744 !important}.red-text.text-accent-3{color:#FF1744 !important}.red.accent-4{background-color:#D50000 !important}.red-text.text-accent-4{color:#D50000 !important}.pink{background-color:#e91e63 !important}.pink-text{color:#e91e63 !important}.pink.lighten-5{background-color:#fce4ec !important}.pink-text.text-lighten-5{color:#fce4ec !important}.pink.lighten-4{background-color:#f8bbd0 !important}.pink-text.text-lighten-4{color:#f8bbd0 !important}.pink.lighten-3{background-color:#f48fb1 !important}.pink-text.text-lighten-3{color:#f48fb1 !important}.pink.lighten-2{background-color:#f06292 !important}.pink-text.text-lighten-2{color:#f06292 !important}.pink.lighten-1{background-color:#ec407a !important}.pink-text.text-lighten-1{color:#ec407a !important}.pink.darken-1{background-color:#d81b60 !important}.pink-text.text-darken-1{color:#d81b60 !important}.pink.darken-2{background-color:#c2185b !important}.pink-text.text-darken-2{color:#c2185b !important}.pink.darken-3{background-color:#ad1457 !important}.pink-text.text-darken-3{color:#ad1457 !important}.pink.darken-4{background-color:#880e4f !important}.pink-text.text-darken-4{color:#880e4f !important}.pink.accent-1{background-color:#ff80ab !important}.pink-text.text-accent-1{color:#ff80ab !important}.pink.accent-2{background-color:#ff4081 !important}.pink-text.text-accent-2{color:#ff4081 !important}.pink.accent-3{background-color:#f50057 !important}.pink-text.text-accent-3{color:#f50057 !important}.pink.accent-4{background-color:#c51162 !important}.pink-text.text-accent-4{color:#c51162 !important}.purple{background-color:#9c27b0 !important}.purple-text{color:#9c27b0 !important}.purple.lighten-5{background-color:#f3e5f5 !important}.purple-text.text-lighten-5{color:#f3e5f5 !important}.purple.lighten-4{background-color:#e1bee7 !important}.purple-text.text-lighten-4{color:#e1bee7 !important}.purple.lighten-3{background-color:#ce93d8 !important}.purple-text.text-lighten-3{color:#ce93d8 !important}.purple.lighten-2{background-color:#ba68c8 !important}.purple-text.text-lighten-2{color:#ba68c8 !important}.purple.lighten-1{background-color:#ab47bc !important}.purple-text.text-lighten-1{color:#ab47bc !important}.purple.darken-1{background-color:#8e24aa !important}.purple-text.text-darken-1{color:#8e24aa !important}.purple.darken-2{background-color:#7b1fa2 !important}.purple-text.text-darken-2{color:#7b1fa2 !important}.purple.darken-3{background-color:#6a1b9a !important}.purple-text.text-darken-3{color:#6a1b9a !important}.purple.darken-4{background-color:#4a148c !important}.purple-text.text-darken-4{color:#4a148c !important}.purple.accent-1{background-color:#ea80fc !important}.purple-text.text-accent-1{color:#ea80fc !important}.purple.accent-2{background-color:#e040fb !important}.purple-text.text-accent-2{color:#e040fb !important}.purple.accent-3{background-color:#d500f9 !important}.purple-text.text-accent-3{color:#d500f9 !important}.purple.accent-4{background-color:#a0f !important}.purple-text.text-accent-4{color:#a0f !important}.deep-purple{background-color:#673ab7 !important}.deep-purple-text{color:#673ab7 !important}.deep-purple.lighten-5{background-color:#ede7f6 !important}.deep-purple-text.text-lighten-5{color:#ede7f6 !important}.deep-purple.lighten-4{background-color:#d1c4e9 !important}.deep-purple-text.text-lighten-4{color:#d1c4e9 !important}.deep-purple.lighten-3{background-color:#b39ddb !important}.deep-purple-text.text-lighten-3{color:#b39ddb !important}.deep-purple.lighten-2{background-color:#9575cd !important}.deep-purple-text.text-lighten-2{color:#9575cd !important}.deep-purple.lighten-1{background-color:#7e57c2 !important}.deep-purple-text.text-lighten-1{color:#7e57c2 !important}.deep-purple.darken-1{background-color:#5e35b1 !important}.deep-purple-text.text-darken-1{color:#5e35b1 !important}.deep-purple.darken-2{background-color:#512da8 !important}.deep-purple-text.text-darken-2{color:#512da8 !important}.deep-purple.darken-3{background-color:#4527a0 !important}.deep-purple-text.text-darken-3{color:#4527a0 !important}.deep-purple.darken-4{background-color:#311b92 !important}.deep-purple-text.text-darken-4{color:#311b92 !important}.deep-purple.accent-1{background-color:#b388ff !important}.deep-purple-text.text-accent-1{color:#b388ff !important}.deep-purple.accent-2{background-color:#7c4dff !important}.deep-purple-text.text-accent-2{color:#7c4dff !important}.deep-purple.accent-3{background-color:#651fff !important}.deep-purple-text.text-accent-3{color:#651fff !important}.deep-purple.accent-4{background-color:#6200ea !important}.deep-purple-text.text-accent-4{color:#6200ea !important}.indigo{background-color:#3f51b5 !important}.indigo-text{color:#3f51b5 !important}.indigo.lighten-5{background-color:#e8eaf6 !important}.indigo-text.text-lighten-5{color:#e8eaf6 !important}.indigo.lighten-4{background-color:#c5cae9 !important}.indigo-text.text-lighten-4{color:#c5cae9 !important}.indigo.lighten-3{background-color:#9fa8da !important}.indigo-text.text-lighten-3{color:#9fa8da !important}.indigo.lighten-2{background-color:#7986cb !important}.indigo-text.text-lighten-2{color:#7986cb !important}.indigo.lighten-1{background-color:#5c6bc0 !important}.indigo-text.text-lighten-1{color:#5c6bc0 !important}.indigo.darken-1{background-color:#3949ab !important}.indigo-text.text-darken-1{color:#3949ab !important}.indigo.darken-2{background-color:#303f9f !important}.indigo-text.text-darken-2{color:#303f9f !important}.indigo.darken-3{background-color:#283593 !important}.indigo-text.text-darken-3{color:#283593 !important}.indigo.darken-4{background-color:#1a237e !important}.indigo-text.text-darken-4{color:#1a237e !important}.indigo.accent-1{background-color:#8c9eff !important}.indigo-text.text-accent-1{color:#8c9eff !important}.indigo.accent-2{background-color:#536dfe !important}.indigo-text.text-accent-2{color:#536dfe !important}.indigo.accent-3{background-color:#3d5afe !important}.indigo-text.text-accent-3{color:#3d5afe !important}.indigo.accent-4{background-color:#304ffe !important}.indigo-text.text-accent-4{color:#304ffe !important}.blue{background-color:#2196F3 !important}.blue-text{color:#2196F3 !important}.blue.lighten-5{background-color:#E3F2FD !important}.blue-text.text-lighten-5{color:#E3F2FD !important}.blue.lighten-4{background-color:#BBDEFB !important}.blue-text.text-lighten-4{color:#BBDEFB !important}.blue.lighten-3{background-color:#90CAF9 !important}.blue-text.text-lighten-3{color:#90CAF9 !important}.blue.lighten-2{background-color:#64B5F6 !important}.blue-text.text-lighten-2{color:#64B5F6 !important}.blue.lighten-1{background-color:#42A5F5 !important}.blue-text.text-lighten-1{color:#42A5F5 !important}.blue.darken-1{background-color:#1E88E5 !important}.blue-text.text-darken-1{color:#1E88E5 !important}.blue.darken-2{background-color:#1976D2 !important}.blue-text.text-darken-2{color:#1976D2 !important}.blue.darken-3{background-color:#1565C0 !important}.blue-text.text-darken-3{color:#1565C0 !important}.blue.darken-4{background-color:#0D47A1 !important}.blue-text.text-darken-4{color:#0D47A1 !important}.blue.accent-1{background-color:#82B1FF !important}.blue-text.text-accent-1{color:#82B1FF !important}.blue.accent-2{background-color:#448AFF !important}.blue-text.text-accent-2{color:#448AFF !important}.blue.accent-3{background-color:#2979FF !important}.blue-text.text-accent-3{color:#2979FF !important}.blue.accent-4{background-color:#2962FF !important}.blue-text.text-accent-4{color:#2962FF !important}.light-blue{background-color:#03a9f4 !important}.light-blue-text{color:#03a9f4 !important}.light-blue.lighten-5{background-color:#e1f5fe !important}.light-blue-text.text-lighten-5{color:#e1f5fe !important}.light-blue.lighten-4{background-color:#b3e5fc !important}.light-blue-text.text-lighten-4{color:#b3e5fc !important}.light-blue.lighten-3{background-color:#81d4fa !important}.light-blue-text.text-lighten-3{color:#81d4fa !important}.light-blue.lighten-2{background-color:#4fc3f7 !important}.light-blue-text.text-lighten-2{color:#4fc3f7 !important}.light-blue.lighten-1{background-color:#29b6f6 !important}.light-blue-text.text-lighten-1{color:#29b6f6 !important}.light-blue.darken-1{background-color:#039be5 !important}.light-blue-text.text-darken-1{color:#039be5 !important}.light-blue.darken-2{background-color:#0288d1 !important}.light-blue-text.text-darken-2{color:#0288d1 !important}.light-blue.darken-3{background-color:#0277bd !important}.light-blue-text.text-darken-3{color:#0277bd !important}.light-blue.darken-4{background-color:#01579b !important}.light-blue-text.text-darken-4{color:#01579b !important}.light-blue.accent-1{background-color:#80d8ff !important}.light-blue-text.text-accent-1{color:#80d8ff !important}.light-blue.accent-2{background-color:#40c4ff !important}.light-blue-text.text-accent-2{color:#40c4ff !important}.light-blue.accent-3{background-color:#00b0ff !important}.light-blue-text.text-accent-3{color:#00b0ff !important}.light-blue.accent-4{background-color:#0091ea !important}.light-blue-text.text-accent-4{color:#0091ea !important}.cyan{background-color:#00bcd4 !important}.cyan-text{color:#00bcd4 !important}.cyan.lighten-5{background-color:#e0f7fa !important}.cyan-text.text-lighten-5{color:#e0f7fa !important}.cyan.lighten-4{background-color:#b2ebf2 !important}.cyan-text.text-lighten-4{color:#b2ebf2 !important}.cyan.lighten-3{background-color:#80deea !important}.cyan-text.text-lighten-3{color:#80deea !important}.cyan.lighten-2{background-color:#4dd0e1 !important}.cyan-text.text-lighten-2{color:#4dd0e1 !important}.cyan.lighten-1{background-color:#26c6da !important}.cyan-text.text-lighten-1{color:#26c6da !important}.cyan.darken-1{background-color:#00acc1 !important}.cyan-text.text-darken-1{color:#00acc1 !important}.cyan.darken-2{background-color:#0097a7 !important}.cyan-text.text-darken-2{color:#0097a7 !important}.cyan.darken-3{background-color:#00838f !important}.cyan-text.text-darken-3{color:#00838f !important}.cyan.darken-4{background-color:#006064 !important}.cyan-text.text-darken-4{color:#006064 !important}.cyan.accent-1{background-color:#84ffff !important}.cyan-text.text-accent-1{color:#84ffff !important}.cyan.accent-2{background-color:#18ffff !important}.cyan-text.text-accent-2{color:#18ffff !important}.cyan.accent-3{background-color:#00e5ff !important}.cyan-text.text-accent-3{color:#00e5ff !important}.cyan.accent-4{background-color:#00b8d4 !important}.cyan-text.text-accent-4{color:#00b8d4 !important}.teal{background-color:#009688 !important}.teal-text{color:#009688 !important}.teal.lighten-5{background-color:#e0f2f1 !important}.teal-text.text-lighten-5{color:#e0f2f1 !important}.teal.lighten-4{background-color:#b2dfdb !important}.teal-text.text-lighten-4{color:#b2dfdb !important}.teal.lighten-3{background-color:#80cbc4 !important}.teal-text.text-lighten-3{color:#80cbc4 !important}.teal.lighten-2{background-color:#4db6ac !important}.teal-text.text-lighten-2{color:#4db6ac !important}.teal.lighten-1{background-color:#26a69a !important}.teal-text.text-lighten-1{color:#26a69a !important}.teal.darken-1{background-color:#00897b !important}.teal-text.text-darken-1{color:#00897b !important}.teal.darken-2{background-color:#00796b !important}.teal-text.text-darken-2{color:#00796b !important}.teal.darken-3{background-color:#00695c !important}.teal-text.text-darken-3{color:#00695c !important}.teal.darken-4{background-color:#004d40 !important}.teal-text.text-darken-4{color:#004d40 !important}.teal.accent-1{background-color:#a7ffeb !important}.teal-text.text-accent-1{color:#a7ffeb !important}.teal.accent-2{background-color:#64ffda !important}.teal-text.text-accent-2{color:#64ffda !important}.teal.accent-3{background-color:#1de9b6 !important}.teal-text.text-accent-3{color:#1de9b6 !important}.teal.accent-4{background-color:#00bfa5 !important}.teal-text.text-accent-4{color:#00bfa5 !important}.green{background-color:#4CAF50 !important}.green-text{color:#4CAF50 !important}.green.lighten-5{background-color:#E8F5E9 !important}.green-text.text-lighten-5{color:#E8F5E9 !important}.green.lighten-4{background-color:#C8E6C9 !important}.green-text.text-lighten-4{color:#C8E6C9 !important}.green.lighten-3{background-color:#A5D6A7 !important}.green-text.text-lighten-3{color:#A5D6A7 !important}.green.lighten-2{background-color:#81C784 !important}.green-text.text-lighten-2{color:#81C784 !important}.green.lighten-1{background-color:#66BB6A !important}.green-text.text-lighten-1{color:#66BB6A !important}.green.darken-1{background-color:#43A047 !important}.green-text.text-darken-1{color:#43A047 !important}.green.darken-2{background-color:#388E3C !important}.green-text.text-darken-2{color:#388E3C !important}.green.darken-3{background-color:#2E7D32 !important}.green-text.text-darken-3{color:#2E7D32 !important}.green.darken-4{background-color:#1B5E20 !important}.green-text.text-darken-4{color:#1B5E20 !important}.green.accent-1{background-color:#B9F6CA !important}.green-text.text-accent-1{color:#B9F6CA !important}.green.accent-2{background-color:#69F0AE !important}.green-text.text-accent-2{color:#69F0AE !important}.green.accent-3{background-color:#00E676 !important}.green-text.text-accent-3{color:#00E676 !important}.green.accent-4{background-color:#00C853 !important}.green-text.text-accent-4{color:#00C853 !important}.light-green{background-color:#8bc34a !important}.light-green-text{color:#8bc34a !important}.light-green.lighten-5{background-color:#f1f8e9 !important}.light-green-text.text-lighten-5{color:#f1f8e9 !important}.light-green.lighten-4{background-color:#dcedc8 !important}.light-green-text.text-lighten-4{color:#dcedc8 !important}.light-green.lighten-3{background-color:#c5e1a5 !important}.light-green-text.text-lighten-3{color:#c5e1a5 !important}.light-green.lighten-2{background-color:#aed581 !important}.light-green-text.text-lighten-2{color:#aed581 !important}.light-green.lighten-1{background-color:#9ccc65 !important}.light-green-text.text-lighten-1{color:#9ccc65 !important}.light-green.darken-1{background-color:#7cb342 !important}.light-green-text.text-darken-1{color:#7cb342 !important}.light-green.darken-2{background-color:#689f38 !important}.light-green-text.text-darken-2{color:#689f38 !important}.light-green.darken-3{background-color:#558b2f !important}.light-green-text.text-darken-3{color:#558b2f !important}.light-green.darken-4{background-color:#33691e !important}.light-green-text.text-darken-4{color:#33691e !important}.light-green.accent-1{background-color:#ccff90 !important}.light-green-text.text-accent-1{color:#ccff90 !important}.light-green.accent-2{background-color:#b2ff59 !important}.light-green-text.text-accent-2{color:#b2ff59 !important}.light-green.accent-3{background-color:#76ff03 !important}.light-green-text.text-accent-3{color:#76ff03 !important}.light-green.accent-4{background-color:#64dd17 !important}.light-green-text.text-accent-4{color:#64dd17 !important}.lime{background-color:#cddc39 !important}.lime-text{color:#cddc39 !important}.lime.lighten-5{background-color:#f9fbe7 !important}.lime-text.text-lighten-5{color:#f9fbe7 !important}.lime.lighten-4{background-color:#f0f4c3 !important}.lime-text.text-lighten-4{color:#f0f4c3 !important}.lime.lighten-3{background-color:#e6ee9c !important}.lime-text.text-lighten-3{color:#e6ee9c !important}.lime.lighten-2{background-color:#dce775 !important}.lime-text.text-lighten-2{color:#dce775 !important}.lime.lighten-1{background-color:#d4e157 !important}.lime-text.text-lighten-1{color:#d4e157 !important}.lime.darken-1{background-color:#c0ca33 !important}.lime-text.text-darken-1{color:#c0ca33 !important}.lime.darken-2{background-color:#afb42b !important}.lime-text.text-darken-2{color:#afb42b !important}.lime.darken-3{background-color:#9e9d24 !important}.lime-text.text-darken-3{color:#9e9d24 !important}.lime.darken-4{background-color:#827717 !important}.lime-text.text-darken-4{color:#827717 !important}.lime.accent-1{background-color:#f4ff81 !important}.lime-text.text-accent-1{color:#f4ff81 !important}.lime.accent-2{background-color:#eeff41 !important}.lime-text.text-accent-2{color:#eeff41 !important}.lime.accent-3{background-color:#c6ff00 !important}.lime-text.text-accent-3{color:#c6ff00 !important}.lime.accent-4{background-color:#aeea00 !important}.lime-text.text-accent-4{color:#aeea00 !important}.yellow{background-color:#ffeb3b !important}.yellow-text{color:#ffeb3b !important}.yellow.lighten-5{background-color:#fffde7 !important}.yellow-text.text-lighten-5{color:#fffde7 !important}.yellow.lighten-4{background-color:#fff9c4 !important}.yellow-text.text-lighten-4{color:#fff9c4 !important}.yellow.lighten-3{background-color:#fff59d !important}.yellow-text.text-lighten-3{color:#fff59d !important}.yellow.lighten-2{background-color:#fff176 !important}.yellow-text.text-lighten-2{color:#fff176 !important}.yellow.lighten-1{background-color:#ffee58 !important}.yellow-text.text-lighten-1{color:#ffee58 !important}.yellow.darken-1{background-color:#fdd835 !important}.yellow-text.text-darken-1{color:#fdd835 !important}.yellow.darken-2{background-color:#fbc02d !important}.yellow-text.text-darken-2{color:#fbc02d !important}.yellow.darken-3{background-color:#f9a825 !important}.yellow-text.text-darken-3{color:#f9a825 !important}.yellow.darken-4{background-color:#f57f17 !important}.yellow-text.text-darken-4{color:#f57f17 !important}.yellow.accent-1{background-color:#ffff8d !important}.yellow-text.text-accent-1{color:#ffff8d !important}.yellow.accent-2{background-color:#ff0 !important}.yellow-text.text-accent-2{color:#ff0 !important}.yellow.accent-3{background-color:#ffea00 !important}.yellow-text.text-accent-3{color:#ffea00 !important}.yellow.accent-4{background-color:#ffd600 !important}.yellow-text.text-accent-4{color:#ffd600 !important}.amber{background-color:#ffc107 !important}.amber-text{color:#ffc107 !important}.amber.lighten-5{background-color:#fff8e1 !important}.amber-text.text-lighten-5{color:#fff8e1 !important}.amber.lighten-4{background-color:#ffecb3 !important}.amber-text.text-lighten-4{color:#ffecb3 !important}.amber.lighten-3{background-color:#ffe082 !important}.amber-text.text-lighten-3{color:#ffe082 !important}.amber.lighten-2{background-color:#ffd54f !important}.amber-text.text-lighten-2{color:#ffd54f !important}.amber.lighten-1{background-color:#ffca28 !important}.amber-text.text-lighten-1{color:#ffca28 !important}.amber.darken-1{background-color:#ffb300 !important}.amber-text.text-darken-1{color:#ffb300 !important}.amber.darken-2{background-color:#ffa000 !important}.amber-text.text-darken-2{color:#ffa000 !important}.amber.darken-3{background-color:#ff8f00 !important}.amber-text.text-darken-3{color:#ff8f00 !important}.amber.darken-4{background-color:#ff6f00 !important}.amber-text.text-darken-4{color:#ff6f00 !important}.amber.accent-1{background-color:#ffe57f !important}.amber-text.text-accent-1{color:#ffe57f !important}.amber.accent-2{background-color:#ffd740 !important}.amber-text.text-accent-2{color:#ffd740 !important}.amber.accent-3{background-color:#ffc400 !important}.amber-text.text-accent-3{color:#ffc400 !important}.amber.accent-4{background-color:#ffab00 !important}.amber-text.text-accent-4{color:#ffab00 !important}.orange{background-color:#ff9800 !important}.orange-text{color:#ff9800 !important}.orange.lighten-5{background-color:#fff3e0 !important}.orange-text.text-lighten-5{color:#fff3e0 !important}.orange.lighten-4{background-color:#ffe0b2 !important}.orange-text.text-lighten-4{color:#ffe0b2 !important}.orange.lighten-3{background-color:#ffcc80 !important}.orange-text.text-lighten-3{color:#ffcc80 !important}.orange.lighten-2{background-color:#ffb74d !important}.orange-text.text-lighten-2{color:#ffb74d !important}.orange.lighten-1{background-color:#ffa726 !important}.orange-text.text-lighten-1{color:#ffa726 !important}.orange.darken-1{background-color:#fb8c00 !important}.orange-text.text-darken-1{color:#fb8c00 !important}.orange.darken-2{background-color:#f57c00 !important}.orange-text.text-darken-2{color:#f57c00 !important}.orange.darken-3{background-color:#ef6c00 !important}.orange-text.text-darken-3{color:#ef6c00 !important}.orange.darken-4{background-color:#e65100 !important}.orange-text.text-darken-4{color:#e65100 !important}.orange.accent-1{background-color:#ffd180 !important}.orange-text.text-accent-1{color:#ffd180 !important}.orange.accent-2{background-color:#ffab40 !important}.orange-text.text-accent-2{color:#ffab40 !important}.orange.accent-3{background-color:#ff9100 !important}.orange-text.text-accent-3{color:#ff9100 !important}.orange.accent-4{background-color:#ff6d00 !important}.orange-text.text-accent-4{color:#ff6d00 !important}.deep-orange{background-color:#ff5722 !important}.deep-orange-text{color:#ff5722 !important}.deep-orange.lighten-5{background-color:#fbe9e7 !important}.deep-orange-text.text-lighten-5{color:#fbe9e7 !important}.deep-orange.lighten-4{background-color:#ffccbc !important}.deep-orange-text.text-lighten-4{color:#ffccbc !important}.deep-orange.lighten-3{background-color:#ffab91 !important}.deep-orange-text.text-lighten-3{color:#ffab91 !important}.deep-orange.lighten-2{background-color:#ff8a65 !important}.deep-orange-text.text-lighten-2{color:#ff8a65 !important}.deep-orange.lighten-1{background-color:#ff7043 !important}.deep-orange-text.text-lighten-1{color:#ff7043 !important}.deep-orange.darken-1{background-color:#f4511e !important}.deep-orange-text.text-darken-1{color:#f4511e !important}.deep-orange.darken-2{background-color:#e64a19 !important}.deep-orange-text.text-darken-2{color:#e64a19 !important}.deep-orange.darken-3{background-color:#d84315 !important}.deep-orange-text.text-darken-3{color:#d84315 !important}.deep-orange.darken-4{background-color:#bf360c !important}.deep-orange-text.text-darken-4{color:#bf360c !important}.deep-orange.accent-1{background-color:#ff9e80 !important}.deep-orange-text.text-accent-1{color:#ff9e80 !important}.deep-orange.accent-2{background-color:#ff6e40 !important}.deep-orange-text.text-accent-2{color:#ff6e40 !important}.deep-orange.accent-3{background-color:#ff3d00 !important}.deep-orange-text.text-accent-3{color:#ff3d00 !important}.deep-orange.accent-4{background-color:#dd2c00 !important}.deep-orange-text.text-accent-4{color:#dd2c00 !important}.brown{background-color:#795548 !important}.brown-text{color:#795548 !important}.brown.lighten-5{background-color:#efebe9 !important}.brown-text.text-lighten-5{color:#efebe9 !important}.brown.lighten-4{background-color:#d7ccc8 !important}.brown-text.text-lighten-4{color:#d7ccc8 !important}.brown.lighten-3{background-color:#bcaaa4 !important}.brown-text.text-lighten-3{color:#bcaaa4 !important}.brown.lighten-2{background-color:#a1887f !important}.brown-text.text-lighten-2{color:#a1887f !important}.brown.lighten-1{background-color:#8d6e63 !important}.brown-text.text-lighten-1{color:#8d6e63 !important}.brown.darken-1{background-color:#6d4c41 !important}.brown-text.text-darken-1{color:#6d4c41 !important}.brown.darken-2{background-color:#5d4037 !important}.brown-text.text-darken-2{color:#5d4037 !important}.brown.darken-3{background-color:#4e342e !important}.brown-text.text-darken-3{color:#4e342e !important}.brown.darken-4{background-color:#3e2723 !important}.brown-text.text-darken-4{color:#3e2723 !important}.blue-grey{background-color:#607d8b !important}.blue-grey-text{color:#607d8b !important}.blue-grey.lighten-5{background-color:#eceff1 !important}.blue-grey-text.text-lighten-5{color:#eceff1 !important}.blue-grey.lighten-4{background-color:#cfd8dc !important}.blue-grey-text.text-lighten-4{color:#cfd8dc !important}.blue-grey.lighten-3{background-color:#b0bec5 !important}.blue-grey-text.text-lighten-3{color:#b0bec5 !important}.blue-grey.lighten-2{background-color:#90a4ae !important}.blue-grey-text.text-lighten-2{color:#90a4ae !important}.blue-grey.lighten-1{background-color:#78909c !important}.blue-grey-text.text-lighten-1{color:#78909c !important}.blue-grey.darken-1{background-color:#546e7a !important}.blue-grey-text.text-darken-1{color:#546e7a !important}.blue-grey.darken-2{background-color:#455a64 !important}.blue-grey-text.text-darken-2{color:#455a64 !important}.blue-grey.darken-3{background-color:#37474f !important}.blue-grey-text.text-darken-3{color:#37474f !important}.blue-grey.darken-4{background-color:#263238 !important}.blue-grey-text.text-darken-4{color:#263238 !important}.grey{background-color:#9e9e9e !important}.grey-text{color:#9e9e9e !important}.grey.lighten-5{background-color:#fafafa !important}.grey-text.text-lighten-5{color:#fafafa !important}.grey.lighten-4{background-color:#f5f5f5 !important}.grey-text.text-lighten-4{color:#f5f5f5 !important}.grey.lighten-3{background-color:#eee !important}.grey-text.text-lighten-3{color:#eee !important}.grey.lighten-2{background-color:#e0e0e0 !important}.grey-text.text-lighten-2{color:#e0e0e0 !important}.grey.lighten-1{background-color:#bdbdbd !important}.grey-text.text-lighten-1{color:#bdbdbd !important}.grey.darken-1{background-color:#757575 !important}.grey-text.text-darken-1{color:#757575 !important}.grey.darken-2{background-color:#616161 !important}.grey-text.text-darken-2{color:#616161 !important}.grey.darken-3{background-color:#424242 !important}.grey-text.text-darken-3{color:#424242 !important}.grey.darken-4{background-color:#212121 !important}.grey-text.text-darken-4{color:#212121 !important}.black{background-color:#000 !important}.black-text{color:#000 !important}.white{background-color:#fff !important}.white-text{color:#fff !important}.transparent{background-color:transparent !important}.transparent-text{color:transparent !important}/*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */html{font-family:sans-serif;-ms-text-size-adjust:100%;-webkit-text-size-adjust:100%}body{margin:0}article,aside,details,figcaption,figure,footer,header,hgroup,main,menu,nav,section,summary{display:block}audio,canvas,progress,video{display:inline-block;vertical-align:baseline}audio:not([controls]){display:none;height:0}[hidden],template{display:none}a{background-color:transparent}a:active,a:hover{outline:0}abbr[title]{border-bottom:1px dotted}b,strong{font-weight:bold}dfn{font-style:italic}h1{font-size:2em;margin:0.67em 0}mark{background:#ff0;color:#000}small{font-size:80%}sub,sup{font-size:75%;line-height:0;position:relative;vertical-align:baseline}sup{top:-0.5em}sub{bottom:-0.25em}img{border:0}svg:not(:root){overflow:hidden}figure{margin:1em 40px}hr{-webkit-box-sizing:content-box;box-sizing:content-box;height:0}pre{overflow:auto}code,kbd,pre,samp{font-family:monospace, monospace;font-size:1em}button,input,optgroup,select,textarea{color:inherit;font:inherit;margin:0}button{overflow:visible}button,select{text-transform:none}button,html input[type="button"],input[type="reset"],input[type="submit"]{-webkit-appearance:button;cursor:pointer}button[disabled],html input[disabled]{cursor:default}button::-moz-focus-inner,input::-moz-focus-inner{border:0;padding:0}input{line-height:normal}input[type="checkbox"],input[type="radio"]{-webkit-box-sizing:border-box;box-sizing:border-box;padding:0}input[type="number"]::-webkit-inner-spin-button,input[type="number"]::-webkit-outer-spin-button{height:auto}input[type="search"]{-webkit-appearance:textfield;-webkit-box-sizing:content-box;box-sizing:content-box}input[type="search"]::-webkit-search-cancel-button,input[type="search"]::-webkit-search-decoration{-webkit-appearance:none}fieldset{border:1px solid #c0c0c0;margin:0 2px;padding:0.35em 0.625em 0.75em}legend{border:0;padding:0}textarea{overflow:auto}optgroup{font-weight:bold}table{border-collapse:collapse;border-spacing:0}td,th{padding:0}html{-webkit-box-sizing:border-box;box-sizing:border-box}*,*:before,*:after{-webkit-box-sizing:inherit;box-sizing:inherit}ul:not(.browser-default){padding-left:0;list-style-type:none}ul:not(.browser-default)>li{list-style-type:none}a{color:#039be5;text-decoration:none;-webkit-tap-highlight-color:transparent}.valign-wrapper{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center}.clearfix{clear:both}.z-depth-0{-webkit-box-shadow:none !important;box-shadow:none !important}.z-depth-1,nav,.card-panel,.card,.toast,.btn,.btn-large,.btn-floating,.dropdown-content,.collapsible,.side-nav{-webkit-box-shadow:0 2px 2px 0 rgba(0,0,0,0.14),0 1px 5px 0 rgba(0,0,0,0.12),0 3px 1px -2px rgba(0,0,0,0.2);box-shadow:0 2px 2px 0 rgba(0,0,0,0.14),0 1px 5px 0 rgba(0,0,0,0.12),0 3px 1px -2px rgba(0,0,0,0.2)}.z-depth-1-half,.btn:hover,.btn-large:hover,.btn-floating:hover{-webkit-box-shadow:0 3px 3px 0 rgba(0,0,0,0.14),0 1px 7px 0 rgba(0,0,0,0.12),0 3px 1px -1px rgba(0,0,0,0.2);box-shadow:0 3px 3px 0 rgba(0,0,0,0.14),0 1px 7px 0 rgba(0,0,0,0.12),0 3px 1px -1px rgba(0,0,0,0.2)}.z-depth-2{-webkit-box-shadow:0 4px 5px 0 rgba(0,0,0,0.14),0 1px 10px 0 rgba(0,0,0,0.12),0 2px 4px -1px rgba(0,0,0,0.3);box-shadow:0 4px 5px 0 rgba(0,0,0,0.14),0 1px 10px 0 rgba(0,0,0,0.12),0 2px 4px -1px rgba(0,0,0,0.3)}.z-depth-3{-webkit-box-shadow:0 6px 10px 0 rgba(0,0,0,0.14),0 1px 18px 0 rgba(0,0,0,0.12),0 3px 5px -1px rgba(0,0,0,0.3);box-shadow:0 6px 10px 0 rgba(0,0,0,0.14),0 1px 18px 0 rgba(0,0,0,0.12),0 3px 5px -1px rgba(0,0,0,0.3)}.z-depth-4,.modal{-webkit-box-shadow:0 8px 10px 1px rgba(0,0,0,0.14),0 3px 14px 2px rgba(0,0,0,0.12),0 5px 5px -3px rgba(0,0,0,0.3);box-shadow:0 8px 10px 1px rgba(0,0,0,0.14),0 3px 14px 2px rgba(0,0,0,0.12),0 5px 5px -3px rgba(0,0,0,0.3)}.z-depth-5{-webkit-box-shadow:0 16px 24px 2px rgba(0,0,0,0.14),0 6px 30px 5px rgba(0,0,0,0.12),0 8px 10px -5px rgba(0,0,0,0.3);box-shadow:0 16px 24px 2px rgba(0,0,0,0.14),0 6px 30px 5px rgba(0,0,0,0.12),0 8px 10px -5px rgba(0,0,0,0.3)}.hoverable{-webkit-transition:-webkit-box-shadow .25s;transition:-webkit-box-shadow .25s;transition:box-shadow .25s;transition:box-shadow .25s, -webkit-box-shadow .25s}.hoverable:hover{-webkit-box-shadow:0 8px 17px 0 rgba(0,0,0,0.2),0 6px 20px 0 rgba(0,0,0,0.19);box-shadow:0 8px 17px 0 rgba(0,0,0,0.2),0 6px 20px 0 rgba(0,0,0,0.19)}.divider{height:1px;overflow:hidden;background-color:#e0e0e0}blockquote{margin:20px 0;padding-left:1.5rem;border-left:5px solid #ee6e73}i{line-height:inherit}i.left{float:left;margin-right:15px}i.right{float:right;margin-left:15px}i.tiny{font-size:1rem}i.small{font-size:2rem}i.medium{font-size:4rem}i.large{font-size:6rem}img.responsive-img,video.responsive-video{max-width:100%;height:auto}.pagination li{display:inline-block;border-radius:2px;text-align:center;vertical-align:top;height:30px}.pagination li a{color:#444;display:inline-block;font-size:1.2rem;padding:0 10px;line-height:30px}.pagination li.active a{color:#fff}.pagination li.active{background-color:#ee6e73}.pagination li.disabled a{cursor:default;color:#999}.pagination li i{font-size:2rem}.pagination li.pages ul li{display:inline-block;float:none}@media only screen and (max-width: 992px){.pagination{width:100%}.pagination li.prev,.pagination li.next{width:10%}.pagination li.pages{width:80%;overflow:hidden;white-space:nowrap}}.breadcrumb{font-size:18px;color:rgba(255,255,255,0.7)}.breadcrumb i,.breadcrumb [class^="mdi-"],.breadcrumb [class*="mdi-"],.breadcrumb i.material-icons{display:inline-block;float:left;font-size:24px}.breadcrumb:before{content:'\E5CC';color:rgba(255,255,255,0.7);vertical-align:top;display:inline-block;font-family:'Material Icons';font-weight:normal;font-style:normal;font-size:25px;margin:0 10px 0 8px;-webkit-font-smoothing:antialiased}.breadcrumb:first-child:before{display:none}.breadcrumb:last-child{color:#fff}.parallax-container{position:relative;overflow:hidden;height:500px}.parallax-container .parallax{position:absolute;top:0;left:0;right:0;bottom:0;z-index:-1}.parallax-container .parallax img{display:none;position:absolute;left:50%;bottom:0;min-width:100%;min-height:100%;-webkit-transform:translate3d(0, 0, 0);transform:translate3d(0, 0, 0);-webkit-transform:translateX(-50%);transform:translateX(-50%)}.pin-top,.pin-bottom{position:relative}.pinned{position:fixed !important}ul.staggered-list li{opacity:0}.fade-in{opacity:0;-webkit-transform-origin:0 50%;transform-origin:0 50%}@media only screen and (max-width: 600px){.hide-on-small-only,.hide-on-small-and-down{display:none !important}}@media only screen and (max-width: 992px){.hide-on-med-and-down{display:none !important}}@media only screen and (min-width: 601px){.hide-on-med-and-up{display:none !important}}@media only screen and (min-width: 600px) and (max-width: 992px){.hide-on-med-only{display:none !important}}@media only screen and (min-width: 993px){.hide-on-large-only{display:none !important}}@media only screen and (min-width: 993px){.show-on-large{display:block !important}}@media only screen and (min-width: 600px) and (max-width: 992px){.show-on-medium{display:block !important}}@media only screen and (max-width: 600px){.show-on-small{display:block !important}}@media only screen and (min-width: 601px){.show-on-medium-and-up{display:block !important}}@media only screen and (max-width: 992px){.show-on-medium-and-down{display:block !important}}@media only screen and (max-width: 600px){.center-on-small-only{text-align:center}}.page-footer{padding-top:20px;color:#fff;background-color:#ee6e73}.page-footer .footer-copyright{overflow:hidden;min-height:50px;display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;padding:10px 0px;color:rgba(255,255,255,0.8);background-color:rgba(51,51,51,0.08)}table,th,td{border:none}table{width:100%;display:table}table.bordered>thead>tr,table.bordered>tbody>tr{border-bottom:1px solid #d0d0d0}table.striped>tbody>tr:nth-child(odd){background-color:#f2f2f2}table.striped>tbody>tr>td{border-radius:0}table.highlight>tbody>tr{-webkit-transition:background-color .25s ease;transition:background-color .25s ease}table.highlight>tbody>tr:hover{background-color:#f2f2f2}table.centered thead tr th,table.centered tbody tr td{text-align:center}thead{border-bottom:1px solid #d0d0d0}td,th{padding:15px 5px;display:table-cell;text-align:left;vertical-align:middle;border-radius:2px}@media only screen and (max-width: 992px){table.responsive-table{width:100%;border-collapse:collapse;border-spacing:0;display:block;position:relative}table.responsive-table td:empty:before{content:'\00a0'}table.responsive-table th,table.responsive-table td{margin:0;vertical-align:top}table.responsive-table th{text-align:left}table.responsive-table thead{display:block;float:left}table.responsive-table thead tr{display:block;padding:0 10px 0 0}table.responsive-table thead tr th::before{content:"\00a0"}table.responsive-table tbody{display:block;width:auto;position:relative;overflow-x:auto;white-space:nowrap}table.responsive-table tbody tr{display:inline-block;vertical-align:top}table.responsive-table th{display:block;text-align:right}table.responsive-table td{display:block;min-height:1.25em;text-align:left}table.responsive-table tr{padding:0 10px}table.responsive-table thead{border:0;border-right:1px solid #d0d0d0}table.responsive-table.bordered th{border-bottom:0;border-left:0}table.responsive-table.bordered td{border-left:0;border-right:0;border-bottom:0}table.responsive-table.bordered tr{border:0}table.responsive-table.bordered tbody tr{border-right:1px solid #d0d0d0}}.collection{margin:.5rem 0 1rem 0;border:1px solid #e0e0e0;border-radius:2px;overflow:hidden;position:relative}.collection .collection-item{background-color:#fff;line-height:1.5rem;padding:10px 20px;margin:0;border-bottom:1px solid #e0e0e0}.collection .collection-item.avatar{min-height:84px;padding-left:72px;position:relative}.collection .collection-item.avatar:not(.circle-clipper)>.circle,.collection .collection-item.avatar :not(.circle-clipper)>.circle{position:absolute;width:42px;height:42px;overflow:hidden;left:15px;display:inline-block;vertical-align:middle}.collection .collection-item.avatar i.circle{font-size:18px;line-height:42px;color:#fff;background-color:#999;text-align:center}.collection .collection-item.avatar .title{font-size:16px}.collection .collection-item.avatar p{margin:0}.collection .collection-item.avatar .secondary-content{position:absolute;top:16px;right:16px}.collection .collection-item:last-child{border-bottom:none}.collection .collection-item.active{background-color:#26a69a;color:#eafaf9}.collection .collection-item.active .secondary-content{color:#fff}.collection a.collection-item{display:block;-webkit-transition:.25s;transition:.25s;color:#26a69a}.collection a.collection-item:not(.active):hover{background-color:#ddd}.collection.with-header .collection-header{background-color:#fff;border-bottom:1px solid #e0e0e0;padding:10px 20px}.collection.with-header .collection-item{padding-left:30px}.collection.with-header .collection-item.avatar{padding-left:72px}.secondary-content{float:right;color:#26a69a}.collapsible .collection{margin:0;border:none}.video-container{position:relative;padding-bottom:56.25%;height:0;overflow:hidden}.video-container iframe,.video-container object,.video-container embed{position:absolute;top:0;left:0;width:100%;height:100%}.progress{position:relative;height:4px;display:block;width:100%;background-color:#acece6;border-radius:2px;margin:.5rem 0 1rem 0;overflow:hidden}.progress .determinate{position:absolute;top:0;left:0;bottom:0;background-color:#26a69a;-webkit-transition:width .3s linear;transition:width .3s linear}.progress .indeterminate{background-color:#26a69a}.progress .indeterminate:before{content:'';position:absolute;background-color:inherit;top:0;left:0;bottom:0;will-change:left, right;-webkit-animation:indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite;animation:indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite}.progress .indeterminate:after{content:'';position:absolute;background-color:inherit;top:0;left:0;bottom:0;will-change:left, right;-webkit-animation:indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite;animation:indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite;-webkit-animation-delay:1.15s;animation-delay:1.15s}@-webkit-keyframes indeterminate{0%{left:-35%;right:100%}60%{left:100%;right:-90%}100%{left:100%;right:-90%}}@keyframes indeterminate{0%{left:-35%;right:100%}60%{left:100%;right:-90%}100%{left:100%;right:-90%}}@-webkit-keyframes indeterminate-short{0%{left:-200%;right:100%}60%{left:107%;right:-8%}100%{left:107%;right:-8%}}@keyframes indeterminate-short{0%{left:-200%;right:100%}60%{left:107%;right:-8%}100%{left:107%;right:-8%}}.hide{display:none !important}.left-align{text-align:left}.right-align{text-align:right}.center,.center-align{text-align:center}.left{float:left !important}.right{float:right !important}.no-select,input[type=range],input[type=range]+.thumb{-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.circle{border-radius:50%}.center-block{display:block;margin-left:auto;margin-right:auto}.truncate{display:block;white-space:nowrap;overflow:hidden;text-overflow:ellipsis}.no-padding{padding:0 !important}span.badge{min-width:3rem;padding:0 6px;margin-left:14px;text-align:center;font-size:1rem;line-height:22px;height:22px;color:#757575;float:right;-webkit-box-sizing:border-box;box-sizing:border-box}span.badge.new{font-weight:300;font-size:0.8rem;color:#fff;background-color:#26a69a;border-radius:2px}span.badge.new:after{content:" new"}span.badge[data-badge-caption]::after{content:" " attr(data-badge-caption)}nav ul a span.badge{display:inline-block;float:none;margin-left:4px;line-height:22px;height:22px;-webkit-font-smoothing:auto}.collection-item span.badge{margin-top:calc(.75rem - 11px)}.collapsible span.badge{margin-left:auto}.side-nav span.badge{margin-top:calc(24px - 11px)}.material-icons{text-rendering:optimizeLegibility;-webkit-font-feature-settings:'liga';-moz-font-feature-settings:'liga';font-feature-settings:'liga'}.container{margin:0 auto;max-width:1280px;width:90%}@media only screen and (min-width: 601px){.container{width:85%}}@media only screen and (min-width: 993px){.container{width:70%}}.container .row{margin-left:-.75rem;margin-right:-.75rem}.section{padding-top:1rem;padding-bottom:1rem}.section.no-pad{padding:0}.section.no-pad-bot{padding-bottom:0}.section.no-pad-top{padding-top:0}.row{margin-left:auto;margin-right:auto;margin-bottom:20px}.row:after{content:"";display:table;clear:both}.row .col{float:left;-webkit-box-sizing:border-box;box-sizing:border-box;padding:0 .75rem;min-height:1px}.row .col[class*="push-"],.row .col[class*="pull-"]{position:relative}.row .col.s1{width:8.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s2{width:16.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s3{width:25%;margin-left:auto;left:auto;right:auto}.row .col.s4{width:33.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s5{width:41.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s6{width:50%;margin-left:auto;left:auto;right:auto}.row .col.s7{width:58.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s8{width:66.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s9{width:75%;margin-left:auto;left:auto;right:auto}.row .col.s10{width:83.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s11{width:91.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s12{width:100%;margin-left:auto;left:auto;right:auto}.row .col.offset-s1{margin-left:8.3333333333%}.row .col.pull-s1{right:8.3333333333%}.row .col.push-s1{left:8.3333333333%}.row .col.offset-s2{margin-left:16.6666666667%}.row .col.pull-s2{right:16.6666666667%}.row .col.push-s2{left:16.6666666667%}.row .col.offset-s3{margin-left:25%}.row .col.pull-s3{right:25%}.row .col.push-s3{left:25%}.row .col.offset-s4{margin-left:33.3333333333%}.row .col.pull-s4{right:33.3333333333%}.row .col.push-s4{left:33.3333333333%}.row .col.offset-s5{margin-left:41.6666666667%}.row .col.pull-s5{right:41.6666666667%}.row .col.push-s5{left:41.6666666667%}.row .col.offset-s6{margin-left:50%}.row .col.pull-s6{right:50%}.row .col.push-s6{left:50%}.row .col.offset-s7{margin-left:58.3333333333%}.row .col.pull-s7{right:58.3333333333%}.row .col.push-s7{left:58.3333333333%}.row .col.offset-s8{margin-left:66.6666666667%}.row .col.pull-s8{right:66.6666666667%}.row .col.push-s8{left:66.6666666667%}.row .col.offset-s9{margin-left:75%}.row .col.pull-s9{right:75%}.row .col.push-s9{left:75%}.row .col.offset-s10{margin-left:83.3333333333%}.row .col.pull-s10{right:83.3333333333%}.row .col.push-s10{left:83.3333333333%}.row .col.offset-s11{margin-left:91.6666666667%}.row .col.pull-s11{right:91.6666666667%}.row .col.push-s11{left:91.6666666667%}.row .col.offset-s12{margin-left:100%}.row .col.pull-s12{right:100%}.row .col.push-s12{left:100%}@media only screen and (min-width: 601px){.row .col.m1{width:8.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m2{width:16.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m3{width:25%;margin-left:auto;left:auto;right:auto}.row .col.m4{width:33.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m5{width:41.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m6{width:50%;margin-left:auto;left:auto;right:auto}.row .col.m7{width:58.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m8{width:66.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m9{width:75%;margin-left:auto;left:auto;right:auto}.row .col.m10{width:83.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m11{width:91.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m12{width:100%;margin-left:auto;left:auto;right:auto}.row .col.offset-m1{margin-left:8.3333333333%}.row .col.pull-m1{right:8.3333333333%}.row .col.push-m1{left:8.3333333333%}.row .col.offset-m2{margin-left:16.6666666667%}.row .col.pull-m2{right:16.6666666667%}.row .col.push-m2{left:16.6666666667%}.row .col.offset-m3{margin-left:25%}.row .col.pull-m3{right:25%}.row .col.push-m3{left:25%}.row .col.offset-m4{margin-left:33.3333333333%}.row .col.pull-m4{right:33.3333333333%}.row .col.push-m4{left:33.3333333333%}.row .col.offset-m5{margin-left:41.6666666667%}.row .col.pull-m5{right:41.6666666667%}.row .col.push-m5{left:41.6666666667%}.row .col.offset-m6{margin-left:50%}.row .col.pull-m6{right:50%}.row .col.push-m6{left:50%}.row .col.offset-m7{margin-left:58.3333333333%}.row .col.pull-m7{right:58.3333333333%}.row .col.push-m7{left:58.3333333333%}.row .col.offset-m8{margin-left:66.6666666667%}.row .col.pull-m8{right:66.6666666667%}.row .col.push-m8{left:66.6666666667%}.row .col.offset-m9{margin-left:75%}.row .col.pull-m9{right:75%}.row .col.push-m9{left:75%}.row .col.offset-m10{margin-left:83.3333333333%}.row .col.pull-m10{right:83.3333333333%}.row .col.push-m10{left:83.3333333333%}.row .col.offset-m11{margin-left:91.6666666667%}.row .col.pull-m11{right:91.6666666667%}.row .col.push-m11{left:91.6666666667%}.row .col.offset-m12{margin-left:100%}.row .col.pull-m12{right:100%}.row .col.push-m12{left:100%}}@media only screen and (min-width: 993px){.row .col.l1{width:8.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l2{width:16.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l3{width:25%;margin-left:auto;left:auto;right:auto}.row .col.l4{width:33.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l5{width:41.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l6{width:50%;margin-left:auto;left:auto;right:auto}.row .col.l7{width:58.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l8{width:66.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l9{width:75%;margin-left:auto;left:auto;right:auto}.row .col.l10{width:83.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l11{width:91.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l12{width:100%;margin-left:auto;left:auto;right:auto}.row .col.offset-l1{margin-left:8.3333333333%}.row .col.pull-l1{right:8.3333333333%}.row .col.push-l1{left:8.3333333333%}.row .col.offset-l2{margin-left:16.6666666667%}.row .col.pull-l2{right:16.6666666667%}.row .col.push-l2{left:16.6666666667%}.row .col.offset-l3{margin-left:25%}.row .col.pull-l3{right:25%}.row .col.push-l3{left:25%}.row .col.offset-l4{margin-left:33.3333333333%}.row .col.pull-l4{right:33.3333333333%}.row .col.push-l4{left:33.3333333333%}.row .col.offset-l5{margin-left:41.6666666667%}.row .col.pull-l5{right:41.6666666667%}.row .col.push-l5{left:41.6666666667%}.row .col.offset-l6{margin-left:50%}.row .col.pull-l6{right:50%}.row .col.push-l6{left:50%}.row .col.offset-l7{margin-left:58.3333333333%}.row .col.pull-l7{right:58.3333333333%}.row .col.push-l7{left:58.3333333333%}.row .col.offset-l8{margin-left:66.6666666667%}.row .col.pull-l8{right:66.6666666667%}.row .col.push-l8{left:66.6666666667%}.row .col.offset-l9{margin-left:75%}.row .col.pull-l9{right:75%}.row .col.push-l9{left:75%}.row .col.offset-l10{margin-left:83.3333333333%}.row .col.pull-l10{right:83.3333333333%}.row .col.push-l10{left:83.3333333333%}.row .col.offset-l11{margin-left:91.6666666667%}.row .col.pull-l11{right:91.6666666667%}.row .col.push-l11{left:91.6666666667%}.row .col.offset-l12{margin-left:100%}.row .col.pull-l12{right:100%}.row .col.push-l12{left:100%}}@media only screen and (min-width: 1201px){.row .col.xl1{width:8.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.xl2{width:16.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.xl3{width:25%;margin-left:auto;left:auto;right:auto}.row .col.xl4{width:33.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.xl5{width:41.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.xl6{width:50%;margin-left:auto;left:auto;right:auto}.row .col.xl7{width:58.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.xl8{width:66.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.xl9{width:75%;margin-left:auto;left:auto;right:auto}.row .col.xl10{width:83.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.xl11{width:91.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.xl12{width:100%;margin-left:auto;left:auto;right:auto}.row .col.offset-xl1{margin-left:8.3333333333%}.row .col.pull-xl1{right:8.3333333333%}.row .col.push-xl1{left:8.3333333333%}.row .col.offset-xl2{margin-left:16.6666666667%}.row .col.pull-xl2{right:16.6666666667%}.row .col.push-xl2{left:16.6666666667%}.row .col.offset-xl3{margin-left:25%}.row .col.pull-xl3{right:25%}.row .col.push-xl3{left:25%}.row .col.offset-xl4{margin-left:33.3333333333%}.row .col.pull-xl4{right:33.3333333333%}.row .col.push-xl4{left:33.3333333333%}.row .col.offset-xl5{margin-left:41.6666666667%}.row .col.pull-xl5{right:41.6666666667%}.row .col.push-xl5{left:41.6666666667%}.row .col.offset-xl6{margin-left:50%}.row .col.pull-xl6{right:50%}.row .col.push-xl6{left:50%}.row .col.offset-xl7{margin-left:58.3333333333%}.row .col.pull-xl7{right:58.3333333333%}.row .col.push-xl7{left:58.3333333333%}.row .col.offset-xl8{margin-left:66.6666666667%}.row .col.pull-xl8{right:66.6666666667%}.row .col.push-xl8{left:66.6666666667%}.row .col.offset-xl9{margin-left:75%}.row .col.pull-xl9{right:75%}.row .col.push-xl9{left:75%}.row .col.offset-xl10{margin-left:83.3333333333%}.row .col.pull-xl10{right:83.3333333333%}.row .col.push-xl10{left:83.3333333333%}.row .col.offset-xl11{margin-left:91.6666666667%}.row .col.pull-xl11{right:91.6666666667%}.row .col.push-xl11{left:91.6666666667%}.row .col.offset-xl12{margin-left:100%}.row .col.pull-xl12{right:100%}.row .col.push-xl12{left:100%}}nav{color:#fff;background-color:#ee6e73;width:100%;height:56px;line-height:56px}nav.nav-extended{height:auto}nav.nav-extended .nav-wrapper{min-height:56px;height:auto}nav.nav-extended .nav-content{position:relative;line-height:normal}nav a{color:#fff}nav i,nav [class^="mdi-"],nav [class*="mdi-"],nav i.material-icons{display:block;font-size:24px;height:56px;line-height:56px}nav .nav-wrapper{position:relative;height:100%}@media only screen and (min-width: 993px){nav a.button-collapse{display:none}}nav .button-collapse{float:left;position:relative;z-index:1;height:56px;margin:0 18px}nav .button-collapse i{height:56px;line-height:56px}nav .brand-logo{position:absolute;color:#fff;display:inline-block;font-size:2.1rem;padding:0}nav .brand-logo.center{left:50%;-webkit-transform:translateX(-50%);transform:translateX(-50%)}@media only screen and (max-width: 992px){nav .brand-logo{left:50%;-webkit-transform:translateX(-50%);transform:translateX(-50%)}nav .brand-logo.left,nav .brand-logo.right{padding:0;-webkit-transform:none;transform:none}nav .brand-logo.left{left:0.5rem}nav .brand-logo.right{right:0.5rem;left:auto}}nav .brand-logo.right{right:0.5rem;padding:0}nav .brand-logo i,nav .brand-logo [class^="mdi-"],nav .brand-logo [class*="mdi-"],nav .brand-logo i.material-icons{float:left;margin-right:15px}nav .nav-title{display:inline-block;font-size:32px;padding:28px 0}nav ul{margin:0}nav ul li{-webkit-transition:background-color .3s;transition:background-color .3s;float:left;padding:0}nav ul li.active{background-color:rgba(0,0,0,0.1)}nav ul a{-webkit-transition:background-color .3s;transition:background-color .3s;font-size:1rem;color:#fff;display:block;padding:0 15px;cursor:pointer}nav ul a.btn,nav ul a.btn-large,nav ul a.btn-large,nav ul a.btn-flat,nav ul a.btn-floating{margin-top:-2px;margin-left:15px;margin-right:15px}nav ul a.btn>.material-icons,nav ul a.btn-large>.material-icons,nav ul a.btn-large>.material-icons,nav ul a.btn-flat>.material-icons,nav ul a.btn-floating>.material-icons{height:inherit;line-height:inherit}nav ul a:hover{background-color:rgba(0,0,0,0.1)}nav ul.left{float:left}nav form{height:100%}nav .input-field{margin:0;height:100%}nav .input-field input{height:100%;font-size:1.2rem;border:none;padding-left:2rem}nav .input-field input:focus,nav .input-field input[type=text]:valid,nav .input-field input[type=password]:valid,nav .input-field input[type=email]:valid,nav .input-field input[type=url]:valid,nav .input-field input[type=date]:valid{border:none;-webkit-box-shadow:none;box-shadow:none}nav .input-field label{top:0;left:0}nav .input-field label i{color:rgba(255,255,255,0.7);-webkit-transition:color .3s;transition:color .3s}nav .input-field label.active i{color:#fff}.navbar-fixed{position:relative;height:56px;z-index:997}.navbar-fixed nav{position:fixed}@media only screen and (min-width: 601px){nav.nav-extended .nav-wrapper{min-height:64px}nav,nav .nav-wrapper i,nav a.button-collapse,nav a.button-collapse i{height:64px;line-height:64px}.navbar-fixed{height:64px}}@font-face{font-family:"Roboto";src:local(Roboto Thin),url("../fonts/roboto/Roboto-Thin.woff2") format("woff2"),url("../fonts/roboto/Roboto-Thin.woff") format("woff");font-weight:100}@font-face{font-family:"Roboto";src:local(Roboto Light),url("../fonts/roboto/Roboto-Light.woff2") format("woff2"),url("../fonts/roboto/Roboto-Light.woff") format("woff");font-weight:300}@font-face{font-family:"Roboto";src:local(Roboto Regular),url("../fonts/roboto/Roboto-Regular.woff2") format("woff2"),url("../fonts/roboto/Roboto-Regular.woff") format("woff");font-weight:400}@font-face{font-family:"Roboto";src:local(Roboto Medium),url("../fonts/roboto/Roboto-Medium.woff2") format("woff2"),url("../fonts/roboto/Roboto-Medium.woff") format("woff");font-weight:500}@font-face{font-family:"Roboto";src:local(Roboto Bold),url("../fonts/roboto/Roboto-Bold.woff2") format("woff2"),url("../fonts/roboto/Roboto-Bold.woff") format("woff");font-weight:700}a{text-decoration:none}html{line-height:1.5;font-family:"Roboto", sans-serif;font-weight:normal;color:rgba(0,0,0,0.87)}@media only screen and (min-width: 0){html{font-size:14px}}@media only screen and (min-width: 992px){html{font-size:14.5px}}@media only screen and (min-width: 1200px){html{font-size:15px}}h1,h2,h3,h4,h5,h6{font-weight:400;line-height:1.1}h1 a,h2 a,h3 a,h4 a,h5 a,h6 a{font-weight:inherit}h1{font-size:4.2rem;line-height:110%;margin:2.1rem 0 1.68rem 0}h2{font-size:3.56rem;line-height:110%;margin:1.78rem 0 1.424rem 0}h3{font-size:2.92rem;line-height:110%;margin:1.46rem 0 1.168rem 0}h4{font-size:2.28rem;line-height:110%;margin:1.14rem 0 .912rem 0}h5{font-size:1.64rem;line-height:110%;margin:.82rem 0 .656rem 0}h6{font-size:1rem;line-height:110%;margin:.5rem 0 .4rem 0}em{font-style:italic}strong{font-weight:500}small{font-size:75%}.light,.page-footer .footer-copyright{font-weight:300}.thin{font-weight:200}.flow-text{font-weight:300}@media only screen and (min-width: 360px){.flow-text{font-size:1.2rem}}@media only screen and (min-width: 390px){.flow-text{font-size:1.224rem}}@media only screen and (min-width: 420px){.flow-text{font-size:1.248rem}}@media only screen and (min-width: 450px){.flow-text{font-size:1.272rem}}@media only screen and (min-width: 480px){.flow-text{font-size:1.296rem}}@media only screen and (min-width: 510px){.flow-text{font-size:1.32rem}}@media only screen and (min-width: 540px){.flow-text{font-size:1.344rem}}@media only screen and (min-width: 570px){.flow-text{font-size:1.368rem}}@media only screen and (min-width: 600px){.flow-text{font-size:1.392rem}}@media only screen and (min-width: 630px){.flow-text{font-size:1.416rem}}@media only screen and (min-width: 660px){.flow-text{font-size:1.44rem}}@media only screen and (min-width: 690px){.flow-text{font-size:1.464rem}}@media only screen and (min-width: 720px){.flow-text{font-size:1.488rem}}@media only screen and (min-width: 750px){.flow-text{font-size:1.512rem}}@media only screen and (min-width: 780px){.flow-text{font-size:1.536rem}}@media only screen and (min-width: 810px){.flow-text{font-size:1.56rem}}@media only screen and (min-width: 840px){.flow-text{font-size:1.584rem}}@media only screen and (min-width: 870px){.flow-text{font-size:1.608rem}}@media only screen and (min-width: 900px){.flow-text{font-size:1.632rem}}@media only screen and (min-width: 930px){.flow-text{font-size:1.656rem}}@media only screen and (min-width: 960px){.flow-text{font-size:1.68rem}}@media only screen and (max-width: 360px){.flow-text{font-size:1.2rem}}.scale-transition{-webkit-transition:-webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;transition:-webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;transition:transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;transition:transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63), -webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important}.scale-transition.scale-out{-webkit-transform:scale(0);transform:scale(0);-webkit-transition:-webkit-transform .2s !important;transition:-webkit-transform .2s !important;transition:transform .2s !important;transition:transform .2s, -webkit-transform .2s !important}.scale-transition.scale-in{-webkit-transform:scale(1);transform:scale(1)}.card-panel{-webkit-transition:-webkit-box-shadow .25s;transition:-webkit-box-shadow .25s;transition:box-shadow .25s;transition:box-shadow .25s, -webkit-box-shadow .25s;padding:24px;margin:.5rem 0 1rem 0;border-radius:2px;background-color:#fff}.card{position:relative;margin:.5rem 0 1rem 0;background-color:#fff;-webkit-transition:-webkit-box-shadow .25s;transition:-webkit-box-shadow .25s;transition:box-shadow .25s;transition:box-shadow .25s, -webkit-box-shadow .25s;border-radius:2px}.card .card-title{font-size:24px;font-weight:300}.card .card-title.activator{cursor:pointer}.card.small,.card.medium,.card.large{position:relative}.card.small .card-image,.card.medium .card-image,.card.large .card-image{max-height:60%;overflow:hidden}.card.small .card-image+.card-content,.card.medium .card-image+.card-content,.card.large .card-image+.card-content{max-height:40%}.card.small .card-content,.card.medium .card-content,.card.large .card-content{max-height:100%;overflow:hidden}.card.small .card-action,.card.medium .card-action,.card.large .card-action{position:absolute;bottom:0;left:0;right:0}.card.small{height:300px}.card.medium{height:400px}.card.large{height:500px}.card.horizontal{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex}.card.horizontal.small .card-image,.card.horizontal.medium .card-image,.card.horizontal.large .card-image{height:100%;max-height:none;overflow:visible}.card.horizontal.small .card-image img,.card.horizontal.medium .card-image img,.card.horizontal.large .card-image img{height:100%}.card.horizontal .card-image{max-width:50%}.card.horizontal .card-image img{border-radius:2px 0 0 2px;max-width:100%;width:auto}.card.horizontal .card-stacked{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;-webkit-box-flex:1;-webkit-flex:1;-ms-flex:1;flex:1;position:relative}.card.horizontal .card-stacked .card-content{-webkit-box-flex:1;-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1}.card.sticky-action .card-action{z-index:2}.card.sticky-action .card-reveal{z-index:1;padding-bottom:64px}.card .card-image{position:relative}.card .card-image img{display:block;border-radius:2px 2px 0 0;position:relative;left:0;right:0;top:0;bottom:0;width:100%}.card .card-image .card-title{color:#fff;position:absolute;bottom:0;left:0;max-width:100%;padding:24px}.card .card-content{padding:24px;border-radius:0 0 2px 2px}.card .card-content p{margin:0;color:inherit}.card .card-content .card-title{display:block;line-height:32px;margin-bottom:8px}.card .card-content .card-title i{line-height:32px}.card .card-action{position:relative;background-color:inherit;border-top:1px solid rgba(160,160,160,0.2);padding:16px 24px}.card .card-action:last-child{border-radius:0 0 2px 2px}.card .card-action a:not(.btn):not(.btn-large):not(.btn-large):not(.btn-floating){color:#ffab40;margin-right:24px;-webkit-transition:color .3s ease;transition:color .3s ease;text-transform:uppercase}.card .card-action a:not(.btn):not(.btn-large):not(.btn-large):not(.btn-floating):hover{color:#ffd8a6}.card .card-reveal{padding:24px;position:absolute;background-color:#fff;width:100%;overflow-y:auto;left:0;top:100%;height:100%;z-index:3;display:none}.card .card-reveal .card-title{cursor:pointer;display:block}#toast-container{display:block;position:fixed;z-index:10000}@media only screen and (max-width: 600px){#toast-container{min-width:100%;bottom:0%}}@media only screen and (min-width: 601px) and (max-width: 992px){#toast-container{left:5%;bottom:7%;max-width:90%}}@media only screen and (min-width: 993px){#toast-container{top:10%;right:7%;max-width:86%}}.toast{border-radius:2px;top:35px;width:auto;margin-top:10px;position:relative;max-width:100%;height:auto;min-height:48px;line-height:1.5em;word-break:break-all;background-color:#323232;padding:10px 25px;font-size:1.1rem;font-weight:300;color:#fff;display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:justify;-webkit-justify-content:space-between;-ms-flex-pack:justify;justify-content:space-between;cursor:default}.toast .toast-action{color:#eeff41;font-weight:500;margin-right:-25px;margin-left:3rem}.toast.rounded{border-radius:24px}@media only screen and (max-width: 600px){.toast{width:100%;border-radius:0}}.tabs{position:relative;overflow-x:auto;overflow-y:hidden;height:48px;width:100%;background-color:#fff;margin:0 auto;white-space:nowrap}.tabs.tabs-transparent{background-color:transparent}.tabs.tabs-transparent .tab a,.tabs.tabs-transparent .tab.disabled a,.tabs.tabs-transparent .tab.disabled a:hover{color:rgba(255,255,255,0.7)}.tabs.tabs-transparent .tab a:hover,.tabs.tabs-transparent .tab a.active{color:#fff}.tabs.tabs-transparent .indicator{background-color:#fff}.tabs.tabs-fixed-width{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex}.tabs.tabs-fixed-width .tab{-webkit-box-flex:1;-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1}.tabs .tab{display:inline-block;text-align:center;line-height:48px;height:48px;padding:0;margin:0;text-transform:uppercase}.tabs .tab a{color:rgba(238,110,115,0.7);display:block;width:100%;height:100%;padding:0 24px;font-size:14px;text-overflow:ellipsis;overflow:hidden;-webkit-transition:color .28s ease;transition:color .28s ease}.tabs .tab a:hover,.tabs .tab a.active{background-color:transparent;color:#ee6e73}.tabs .tab.disabled a,.tabs .tab.disabled a:hover{color:rgba(238,110,115,0.7);cursor:default}.tabs .indicator{position:absolute;bottom:0;height:2px;background-color:#f6b2b5;will-change:left, right}@media only screen and (max-width: 992px){.tabs{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex}.tabs .tab{-webkit-box-flex:1;-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1}.tabs .tab a{padding:0 12px}}.material-tooltip{padding:10px 8px;font-size:1rem;z-index:2000;background-color:transparent;border-radius:2px;color:#fff;min-height:36px;line-height:120%;opacity:0;position:absolute;text-align:center;max-width:calc(100% - 4px);overflow:hidden;left:0;top:0;pointer-events:none;visibility:hidden}.backdrop{position:absolute;opacity:0;height:7px;width:14px;border-radius:0 0 50% 50%;background-color:#323232;z-index:-1;-webkit-transform-origin:50% 0%;transform-origin:50% 0%;visibility:hidden}.btn,.btn-large,.btn-flat{border:none;border-radius:2px;display:inline-block;height:36px;line-height:36px;padding:0 2rem;text-transform:uppercase;vertical-align:middle;-webkit-tap-highlight-color:transparent}.btn.disabled,.disabled.btn-large,.btn-floating.disabled,.btn-large.disabled,.btn-flat.disabled,.btn:disabled,.btn-large:disabled,.btn-floating:disabled,.btn-large:disabled,.btn-flat:disabled,.btn[disabled],[disabled].btn-large,.btn-floating[disabled],.btn-large[disabled],.btn-flat[disabled]{pointer-events:none;background-color:#DFDFDF !important;-webkit-box-shadow:none;box-shadow:none;color:#9F9F9F !important;cursor:default}.btn.disabled:hover,.disabled.btn-large:hover,.btn-floating.disabled:hover,.btn-large.disabled:hover,.btn-flat.disabled:hover,.btn:disabled:hover,.btn-large:disabled:hover,.btn-floating:disabled:hover,.btn-large:disabled:hover,.btn-flat:disabled:hover,.btn[disabled]:hover,[disabled].btn-large:hover,.btn-floating[disabled]:hover,.btn-large[disabled]:hover,.btn-flat[disabled]:hover{background-color:#DFDFDF !important;color:#9F9F9F !important}.btn,.btn-large,.btn-floating,.btn-large,.btn-flat{font-size:1rem;outline:0}.btn i,.btn-large i,.btn-floating i,.btn-large i,.btn-flat i{font-size:1.3rem;line-height:inherit}.btn:focus,.btn-large:focus,.btn-floating:focus{background-color:#1d7d74}.btn,.btn-large{text-decoration:none;color:#fff;background-color:#26a69a;text-align:center;letter-spacing:.5px;-webkit-transition:.2s ease-out;transition:.2s ease-out;cursor:pointer}.btn:hover,.btn-large:hover{background-color:#2bbbad}.btn-floating{display:inline-block;color:#fff;position:relative;overflow:hidden;z-index:1;width:40px;height:40px;line-height:40px;padding:0;background-color:#26a69a;border-radius:50%;-webkit-transition:.3s;transition:.3s;cursor:pointer;vertical-align:middle}.btn-floating:hover{background-color:#26a69a}.btn-floating:before{border-radius:0}.btn-floating.btn-large{width:56px;height:56px}.btn-floating.btn-large.halfway-fab{bottom:-28px}.btn-floating.btn-large i{line-height:56px}.btn-floating.halfway-fab{position:absolute;right:24px;bottom:-20px}.btn-floating.halfway-fab.left{right:auto;left:24px}.btn-floating i{width:inherit;display:inline-block;text-align:center;color:#fff;font-size:1.6rem;line-height:40px}button.btn-floating{border:none}.fixed-action-btn{position:fixed;right:23px;bottom:23px;padding-top:15px;margin-bottom:0;z-index:997}.fixed-action-btn.active ul{visibility:visible}.fixed-action-btn.horizontal{padding:0 0 0 15px}.fixed-action-btn.horizontal ul{text-align:right;right:64px;top:50%;-webkit-transform:translateY(-50%);transform:translateY(-50%);height:100%;left:auto;width:500px}.fixed-action-btn.horizontal ul li{display:inline-block;margin:15px 15px 0 0}.fixed-action-btn.toolbar{padding:0;height:56px}.fixed-action-btn.toolbar.active>a i{opacity:0}.fixed-action-btn.toolbar ul{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;top:0;bottom:0;z-index:1}.fixed-action-btn.toolbar ul li{-webkit-box-flex:1;-webkit-flex:1;-ms-flex:1;flex:1;display:inline-block;margin:0;height:100%;-webkit-transition:none;transition:none}.fixed-action-btn.toolbar ul li a{display:block;overflow:hidden;position:relative;width:100%;height:100%;background-color:transparent;-webkit-box-shadow:none;box-shadow:none;color:#fff;line-height:56px;z-index:1}.fixed-action-btn.toolbar ul li a i{line-height:inherit}.fixed-action-btn ul{left:0;right:0;text-align:center;position:absolute;bottom:64px;margin:0;visibility:hidden}.fixed-action-btn ul li{margin-bottom:15px}.fixed-action-btn ul a.btn-floating{opacity:0}.fixed-action-btn .fab-backdrop{position:absolute;top:0;left:0;z-index:-1;width:40px;height:40px;background-color:#26a69a;border-radius:50%;-webkit-transform:scale(0);transform:scale(0)}.btn-flat{-webkit-box-shadow:none;box-shadow:none;background-color:transparent;color:#343434;cursor:pointer;-webkit-transition:background-color .2s;transition:background-color .2s}.btn-flat:focus,.btn-flat:hover{-webkit-box-shadow:none;box-shadow:none}.btn-flat:focus{background-color:rgba(0,0,0,0.1)}.btn-flat.disabled{background-color:transparent !important;color:#b3b2b2 !important;cursor:default}.btn-large{height:54px;line-height:54px}.btn-large i{font-size:1.6rem}.btn-block{display:block}.dropdown-content{background-color:#fff;margin:0;display:none;min-width:100px;max-height:650px;overflow-y:auto;opacity:0;position:absolute;z-index:999;will-change:width, height}.dropdown-content li{clear:both;color:rgba(0,0,0,0.87);cursor:pointer;min-height:50px;line-height:1.5rem;width:100%;text-align:left;text-transform:none}.dropdown-content li:hover,.dropdown-content li.active,.dropdown-content li.selected{background-color:#eee}.dropdown-content li.active.selected{background-color:#e1e1e1}.dropdown-content li.divider{min-height:0;height:1px}.dropdown-content li>a,.dropdown-content li>span{font-size:16px;color:#26a69a;display:block;line-height:22px;padding:14px 16px}.dropdown-content li>span>label{top:1px;left:0;height:18px}.dropdown-content li>a>i{height:inherit;line-height:inherit;float:left;margin:0 24px 0 0;width:24px}.input-field.col .dropdown-content [type="checkbox"]+label{top:1px;left:0;height:18px}/*! + * Waves v0.6.0 + * http://fian.my.id/Waves + * + * Copyright 2014 Alfiana E. Sibuea and other contributors + * Released under the MIT license + * https://github.com/fians/Waves/blob/master/LICENSE + */.waves-effect{position:relative;cursor:pointer;display:inline-block;overflow:hidden;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;-webkit-tap-highlight-color:transparent;vertical-align:middle;z-index:1;-webkit-transition:.3s ease-out;transition:.3s ease-out}.waves-effect .waves-ripple{position:absolute;border-radius:50%;width:20px;height:20px;margin-top:-10px;margin-left:-10px;opacity:0;background:rgba(0,0,0,0.2);-webkit-transition:all 0.7s ease-out;transition:all 0.7s ease-out;-webkit-transition-property:opacity, -webkit-transform;transition-property:opacity, -webkit-transform;transition-property:transform, opacity;transition-property:transform, opacity, -webkit-transform;-webkit-transform:scale(0);transform:scale(0);pointer-events:none}.waves-effect.waves-light .waves-ripple{background-color:rgba(255,255,255,0.45)}.waves-effect.waves-red .waves-ripple{background-color:rgba(244,67,54,0.7)}.waves-effect.waves-yellow .waves-ripple{background-color:rgba(255,235,59,0.7)}.waves-effect.waves-orange .waves-ripple{background-color:rgba(255,152,0,0.7)}.waves-effect.waves-purple .waves-ripple{background-color:rgba(156,39,176,0.7)}.waves-effect.waves-green .waves-ripple{background-color:rgba(76,175,80,0.7)}.waves-effect.waves-teal .waves-ripple{background-color:rgba(0,150,136,0.7)}.waves-effect input[type="button"],.waves-effect input[type="reset"],.waves-effect input[type="submit"]{border:0;font-style:normal;font-size:inherit;text-transform:inherit;background:none}.waves-effect img{position:relative;z-index:-1}.waves-notransition{-webkit-transition:none !important;transition:none !important}.waves-circle{-webkit-transform:translateZ(0);transform:translateZ(0);-webkit-mask-image:-webkit-radial-gradient(circle, white 100%, black 100%)}.waves-input-wrapper{border-radius:0.2em;vertical-align:bottom}.waves-input-wrapper .waves-button-input{position:relative;top:0;left:0;z-index:1}.waves-circle{text-align:center;width:2.5em;height:2.5em;line-height:2.5em;border-radius:50%;-webkit-mask-image:none}.waves-block{display:block}.waves-effect .waves-ripple{z-index:-1}.modal{display:none;position:fixed;left:0;right:0;background-color:#fafafa;padding:0;max-height:70%;width:55%;margin:auto;overflow-y:auto;border-radius:2px;will-change:top, opacity}@media only screen and (max-width: 992px){.modal{width:80%}}.modal h1,.modal h2,.modal h3,.modal h4{margin-top:0}.modal .modal-content{padding:24px}.modal .modal-close{cursor:pointer}.modal .modal-footer{border-radius:0 0 2px 2px;background-color:#fafafa;padding:4px 6px;height:56px;width:100%;text-align:right}.modal .modal-footer .btn,.modal .modal-footer .btn-large,.modal .modal-footer .btn-flat{margin:6px 0}.modal-overlay{position:fixed;z-index:999;top:-25%;left:0;bottom:0;right:0;height:125%;width:100%;background:#000;display:none;will-change:opacity}.modal.modal-fixed-footer{padding:0;height:70%}.modal.modal-fixed-footer .modal-content{position:absolute;height:calc(100% - 56px);max-height:100%;width:100%;overflow-y:auto}.modal.modal-fixed-footer .modal-footer{border-top:1px solid rgba(0,0,0,0.1);position:absolute;bottom:0}.modal.bottom-sheet{top:auto;bottom:-100%;margin:0;width:100%;max-height:45%;border-radius:0;will-change:bottom, opacity}.collapsible{border-top:1px solid #ddd;border-right:1px solid #ddd;border-left:1px solid #ddd;margin:.5rem 0 1rem 0}.collapsible-header{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;cursor:pointer;-webkit-tap-highlight-color:transparent;line-height:1.5;padding:1rem;background-color:#fff;border-bottom:1px solid #ddd}.collapsible-header i{width:2rem;font-size:1.6rem;display:inline-block;text-align:center;margin-right:1rem}.collapsible-body{display:none;border-bottom:1px solid #ddd;-webkit-box-sizing:border-box;box-sizing:border-box;padding:2rem}.side-nav .collapsible,.side-nav.fixed .collapsible{border:none;-webkit-box-shadow:none;box-shadow:none}.side-nav .collapsible li,.side-nav.fixed .collapsible li{padding:0}.side-nav .collapsible-header,.side-nav.fixed .collapsible-header{background-color:transparent;border:none;line-height:inherit;height:inherit;padding:0 16px}.side-nav .collapsible-header:hover,.side-nav.fixed .collapsible-header:hover{background-color:rgba(0,0,0,0.05)}.side-nav .collapsible-header i,.side-nav.fixed .collapsible-header i{line-height:inherit}.side-nav .collapsible-body,.side-nav.fixed .collapsible-body{border:0;background-color:#fff}.side-nav .collapsible-body li a,.side-nav.fixed .collapsible-body li a{padding:0 23.5px 0 31px}.collapsible.popout{border:none;-webkit-box-shadow:none;box-shadow:none}.collapsible.popout>li{-webkit-box-shadow:0 2px 5px 0 rgba(0,0,0,0.16),0 2px 10px 0 rgba(0,0,0,0.12);box-shadow:0 2px 5px 0 rgba(0,0,0,0.16),0 2px 10px 0 rgba(0,0,0,0.12);margin:0 24px;-webkit-transition:margin 0.35s cubic-bezier(0.25, 0.46, 0.45, 0.94);transition:margin 0.35s cubic-bezier(0.25, 0.46, 0.45, 0.94)}.collapsible.popout>li.active{-webkit-box-shadow:0 5px 11px 0 rgba(0,0,0,0.18),0 4px 15px 0 rgba(0,0,0,0.15);box-shadow:0 5px 11px 0 rgba(0,0,0,0.18),0 4px 15px 0 rgba(0,0,0,0.15);margin:16px 0}.chip{display:inline-block;height:32px;font-size:13px;font-weight:500;color:rgba(0,0,0,0.6);line-height:32px;padding:0 12px;border-radius:16px;background-color:#e4e4e4;margin-bottom:5px;margin-right:5px}.chip>img{float:left;margin:0 8px 0 -12px;height:32px;width:32px;border-radius:50%}.chip .close{cursor:pointer;float:right;font-size:16px;line-height:32px;padding-left:8px}.chips{border:none;border-bottom:1px solid #9e9e9e;-webkit-box-shadow:none;box-shadow:none;margin:0 0 20px 0;min-height:45px;outline:none;-webkit-transition:all .3s;transition:all .3s}.chips.focus{border-bottom:1px solid #26a69a;-webkit-box-shadow:0 1px 0 0 #26a69a;box-shadow:0 1px 0 0 #26a69a}.chips:hover{cursor:text}.chips .chip.selected{background-color:#26a69a;color:#fff}.chips .input{background:none;border:0;color:rgba(0,0,0,0.6);display:inline-block;font-size:1rem;height:3rem;line-height:32px;outline:0;margin:0;padding:0 !important;width:120px !important}.chips .input:focus{border:0 !important;-webkit-box-shadow:none !important;box-shadow:none !important}.chips .autocomplete-content{margin-top:0;margin-bottom:0}.prefix ~ .chips{margin-left:3rem;width:92%;width:calc(100% - 3rem)}.chips:empty ~ label{font-size:0.8rem;-webkit-transform:translateY(-140%);transform:translateY(-140%)}.materialboxed{display:block;cursor:-webkit-zoom-in;cursor:zoom-in;position:relative;-webkit-transition:opacity .4s;transition:opacity .4s;-webkit-backface-visibility:hidden}.materialboxed:hover:not(.active){opacity:.8}.materialboxed.active{cursor:-webkit-zoom-out;cursor:zoom-out}#materialbox-overlay{position:fixed;top:0;right:0;bottom:0;left:0;background-color:#292929;z-index:1000;will-change:opacity}.materialbox-caption{position:fixed;display:none;color:#fff;line-height:50px;bottom:0;left:0;width:100%;text-align:center;padding:0% 15%;height:50px;z-index:1000;-webkit-font-smoothing:antialiased}select:focus{outline:1px solid #c9f3ef}button:focus{outline:none;background-color:#2ab7a9}label{font-size:.8rem;color:#9e9e9e}::-webkit-input-placeholder{color:#d1d1d1}::-moz-placeholder{color:#d1d1d1}:-ms-input-placeholder{color:#d1d1d1}::placeholder{color:#d1d1d1}input:not([type]),input[type=text]:not(.browser-default),input[type=password]:not(.browser-default),input[type=email]:not(.browser-default),input[type=url]:not(.browser-default),input[type=time]:not(.browser-default),input[type=date]:not(.browser-default),input[type=datetime]:not(.browser-default),input[type=datetime-local]:not(.browser-default),input[type=tel]:not(.browser-default),input[type=number]:not(.browser-default),input[type=search]:not(.browser-default),textarea.materialize-textarea{background-color:transparent;border:none;border-bottom:1px solid #9e9e9e;border-radius:0;outline:none;height:3rem;width:100%;font-size:1rem;margin:0 0 20px 0;padding:0;-webkit-box-shadow:none;box-shadow:none;-webkit-box-sizing:content-box;box-sizing:content-box;-webkit-transition:all 0.3s;transition:all 0.3s}input:not([type]):disabled,input:not([type])[readonly="readonly"],input[type=text]:not(.browser-default):disabled,input[type=text]:not(.browser-default)[readonly="readonly"],input[type=password]:not(.browser-default):disabled,input[type=password]:not(.browser-default)[readonly="readonly"],input[type=email]:not(.browser-default):disabled,input[type=email]:not(.browser-default)[readonly="readonly"],input[type=url]:not(.browser-default):disabled,input[type=url]:not(.browser-default)[readonly="readonly"],input[type=time]:not(.browser-default):disabled,input[type=time]:not(.browser-default)[readonly="readonly"],input[type=date]:not(.browser-default):disabled,input[type=date]:not(.browser-default)[readonly="readonly"],input[type=datetime]:not(.browser-default):disabled,input[type=datetime]:not(.browser-default)[readonly="readonly"],input[type=datetime-local]:not(.browser-default):disabled,input[type=datetime-local]:not(.browser-default)[readonly="readonly"],input[type=tel]:not(.browser-default):disabled,input[type=tel]:not(.browser-default)[readonly="readonly"],input[type=number]:not(.browser-default):disabled,input[type=number]:not(.browser-default)[readonly="readonly"],input[type=search]:not(.browser-default):disabled,input[type=search]:not(.browser-default)[readonly="readonly"],textarea.materialize-textarea:disabled,textarea.materialize-textarea[readonly="readonly"]{color:rgba(0,0,0,0.42);border-bottom:1px dotted rgba(0,0,0,0.42)}input:not([type]):disabled+label,input:not([type])[readonly="readonly"]+label,input[type=text]:not(.browser-default):disabled+label,input[type=text]:not(.browser-default)[readonly="readonly"]+label,input[type=password]:not(.browser-default):disabled+label,input[type=password]:not(.browser-default)[readonly="readonly"]+label,input[type=email]:not(.browser-default):disabled+label,input[type=email]:not(.browser-default)[readonly="readonly"]+label,input[type=url]:not(.browser-default):disabled+label,input[type=url]:not(.browser-default)[readonly="readonly"]+label,input[type=time]:not(.browser-default):disabled+label,input[type=time]:not(.browser-default)[readonly="readonly"]+label,input[type=date]:not(.browser-default):disabled+label,input[type=date]:not(.browser-default)[readonly="readonly"]+label,input[type=datetime]:not(.browser-default):disabled+label,input[type=datetime]:not(.browser-default)[readonly="readonly"]+label,input[type=datetime-local]:not(.browser-default):disabled+label,input[type=datetime-local]:not(.browser-default)[readonly="readonly"]+label,input[type=tel]:not(.browser-default):disabled+label,input[type=tel]:not(.browser-default)[readonly="readonly"]+label,input[type=number]:not(.browser-default):disabled+label,input[type=number]:not(.browser-default)[readonly="readonly"]+label,input[type=search]:not(.browser-default):disabled+label,input[type=search]:not(.browser-default)[readonly="readonly"]+label,textarea.materialize-textarea:disabled+label,textarea.materialize-textarea[readonly="readonly"]+label{color:rgba(0,0,0,0.42)}input:not([type]):focus:not([readonly]),input[type=text]:not(.browser-default):focus:not([readonly]),input[type=password]:not(.browser-default):focus:not([readonly]),input[type=email]:not(.browser-default):focus:not([readonly]),input[type=url]:not(.browser-default):focus:not([readonly]),input[type=time]:not(.browser-default):focus:not([readonly]),input[type=date]:not(.browser-default):focus:not([readonly]),input[type=datetime]:not(.browser-default):focus:not([readonly]),input[type=datetime-local]:not(.browser-default):focus:not([readonly]),input[type=tel]:not(.browser-default):focus:not([readonly]),input[type=number]:not(.browser-default):focus:not([readonly]),input[type=search]:not(.browser-default):focus:not([readonly]),textarea.materialize-textarea:focus:not([readonly]){border-bottom:1px solid #26a69a;-webkit-box-shadow:0 1px 0 0 #26a69a;box-shadow:0 1px 0 0 #26a69a}input:not([type]):focus:not([readonly])+label,input[type=text]:not(.browser-default):focus:not([readonly])+label,input[type=password]:not(.browser-default):focus:not([readonly])+label,input[type=email]:not(.browser-default):focus:not([readonly])+label,input[type=url]:not(.browser-default):focus:not([readonly])+label,input[type=time]:not(.browser-default):focus:not([readonly])+label,input[type=date]:not(.browser-default):focus:not([readonly])+label,input[type=datetime]:not(.browser-default):focus:not([readonly])+label,input[type=datetime-local]:not(.browser-default):focus:not([readonly])+label,input[type=tel]:not(.browser-default):focus:not([readonly])+label,input[type=number]:not(.browser-default):focus:not([readonly])+label,input[type=search]:not(.browser-default):focus:not([readonly])+label,textarea.materialize-textarea:focus:not([readonly])+label{color:#26a69a}input:not([type]).validate+label,input[type=text]:not(.browser-default).validate+label,input[type=password]:not(.browser-default).validate+label,input[type=email]:not(.browser-default).validate+label,input[type=url]:not(.browser-default).validate+label,input[type=time]:not(.browser-default).validate+label,input[type=date]:not(.browser-default).validate+label,input[type=datetime]:not(.browser-default).validate+label,input[type=datetime-local]:not(.browser-default).validate+label,input[type=tel]:not(.browser-default).validate+label,input[type=number]:not(.browser-default).validate+label,input[type=search]:not(.browser-default).validate+label,textarea.materialize-textarea.validate+label{width:100%}input:not([type]).invalid+label:after,input:not([type]).valid+label:after,input[type=text]:not(.browser-default).invalid+label:after,input[type=text]:not(.browser-default).valid+label:after,input[type=password]:not(.browser-default).invalid+label:after,input[type=password]:not(.browser-default).valid+label:after,input[type=email]:not(.browser-default).invalid+label:after,input[type=email]:not(.browser-default).valid+label:after,input[type=url]:not(.browser-default).invalid+label:after,input[type=url]:not(.browser-default).valid+label:after,input[type=time]:not(.browser-default).invalid+label:after,input[type=time]:not(.browser-default).valid+label:after,input[type=date]:not(.browser-default).invalid+label:after,input[type=date]:not(.browser-default).valid+label:after,input[type=datetime]:not(.browser-default).invalid+label:after,input[type=datetime]:not(.browser-default).valid+label:after,input[type=datetime-local]:not(.browser-default).invalid+label:after,input[type=datetime-local]:not(.browser-default).valid+label:after,input[type=tel]:not(.browser-default).invalid+label:after,input[type=tel]:not(.browser-default).valid+label:after,input[type=number]:not(.browser-default).invalid+label:after,input[type=number]:not(.browser-default).valid+label:after,input[type=search]:not(.browser-default).invalid+label:after,input[type=search]:not(.browser-default).valid+label:after,textarea.materialize-textarea.invalid+label:after,textarea.materialize-textarea.valid+label:after{display:none}input:not([type]).invalid+label.active:after,input:not([type]).valid+label.active:after,input[type=text]:not(.browser-default).invalid+label.active:after,input[type=text]:not(.browser-default).valid+label.active:after,input[type=password]:not(.browser-default).invalid+label.active:after,input[type=password]:not(.browser-default).valid+label.active:after,input[type=email]:not(.browser-default).invalid+label.active:after,input[type=email]:not(.browser-default).valid+label.active:after,input[type=url]:not(.browser-default).invalid+label.active:after,input[type=url]:not(.browser-default).valid+label.active:after,input[type=time]:not(.browser-default).invalid+label.active:after,input[type=time]:not(.browser-default).valid+label.active:after,input[type=date]:not(.browser-default).invalid+label.active:after,input[type=date]:not(.browser-default).valid+label.active:after,input[type=datetime]:not(.browser-default).invalid+label.active:after,input[type=datetime]:not(.browser-default).valid+label.active:after,input[type=datetime-local]:not(.browser-default).invalid+label.active:after,input[type=datetime-local]:not(.browser-default).valid+label.active:after,input[type=tel]:not(.browser-default).invalid+label.active:after,input[type=tel]:not(.browser-default).valid+label.active:after,input[type=number]:not(.browser-default).invalid+label.active:after,input[type=number]:not(.browser-default).valid+label.active:after,input[type=search]:not(.browser-default).invalid+label.active:after,input[type=search]:not(.browser-default).valid+label.active:after,textarea.materialize-textarea.invalid+label.active:after,textarea.materialize-textarea.valid+label.active:after{display:block}input.valid:not([type]),input.valid:not([type]):focus,input[type=text].valid:not(.browser-default),input[type=text].valid:not(.browser-default):focus,input[type=password].valid:not(.browser-default),input[type=password].valid:not(.browser-default):focus,input[type=email].valid:not(.browser-default),input[type=email].valid:not(.browser-default):focus,input[type=url].valid:not(.browser-default),input[type=url].valid:not(.browser-default):focus,input[type=time].valid:not(.browser-default),input[type=time].valid:not(.browser-default):focus,input[type=date].valid:not(.browser-default),input[type=date].valid:not(.browser-default):focus,input[type=datetime].valid:not(.browser-default),input[type=datetime].valid:not(.browser-default):focus,input[type=datetime-local].valid:not(.browser-default),input[type=datetime-local].valid:not(.browser-default):focus,input[type=tel].valid:not(.browser-default),input[type=tel].valid:not(.browser-default):focus,input[type=number].valid:not(.browser-default),input[type=number].valid:not(.browser-default):focus,input[type=search].valid:not(.browser-default),input[type=search].valid:not(.browser-default):focus,textarea.materialize-textarea.valid,textarea.materialize-textarea.valid:focus,.select-wrapper.valid>input.select-dropdown{border-bottom:1px solid #4CAF50;-webkit-box-shadow:0 1px 0 0 #4CAF50;box-shadow:0 1px 0 0 #4CAF50}input.invalid:not([type]),input.invalid:not([type]):focus,input[type=text].invalid:not(.browser-default),input[type=text].invalid:not(.browser-default):focus,input[type=password].invalid:not(.browser-default),input[type=password].invalid:not(.browser-default):focus,input[type=email].invalid:not(.browser-default),input[type=email].invalid:not(.browser-default):focus,input[type=url].invalid:not(.browser-default),input[type=url].invalid:not(.browser-default):focus,input[type=time].invalid:not(.browser-default),input[type=time].invalid:not(.browser-default):focus,input[type=date].invalid:not(.browser-default),input[type=date].invalid:not(.browser-default):focus,input[type=datetime].invalid:not(.browser-default),input[type=datetime].invalid:not(.browser-default):focus,input[type=datetime-local].invalid:not(.browser-default),input[type=datetime-local].invalid:not(.browser-default):focus,input[type=tel].invalid:not(.browser-default),input[type=tel].invalid:not(.browser-default):focus,input[type=number].invalid:not(.browser-default),input[type=number].invalid:not(.browser-default):focus,input[type=search].invalid:not(.browser-default),input[type=search].invalid:not(.browser-default):focus,textarea.materialize-textarea.invalid,textarea.materialize-textarea.invalid:focus,.select-wrapper.invalid>input.select-dropdown{border-bottom:1px solid #F44336;-webkit-box-shadow:0 1px 0 0 #F44336;box-shadow:0 1px 0 0 #F44336}input:not([type]).valid+label:after,input:not([type]):focus.valid+label:after,input[type=text]:not(.browser-default).valid+label:after,input[type=text]:not(.browser-default):focus.valid+label:after,input[type=password]:not(.browser-default).valid+label:after,input[type=password]:not(.browser-default):focus.valid+label:after,input[type=email]:not(.browser-default).valid+label:after,input[type=email]:not(.browser-default):focus.valid+label:after,input[type=url]:not(.browser-default).valid+label:after,input[type=url]:not(.browser-default):focus.valid+label:after,input[type=time]:not(.browser-default).valid+label:after,input[type=time]:not(.browser-default):focus.valid+label:after,input[type=date]:not(.browser-default).valid+label:after,input[type=date]:not(.browser-default):focus.valid+label:after,input[type=datetime]:not(.browser-default).valid+label:after,input[type=datetime]:not(.browser-default):focus.valid+label:after,input[type=datetime-local]:not(.browser-default).valid+label:after,input[type=datetime-local]:not(.browser-default):focus.valid+label:after,input[type=tel]:not(.browser-default).valid+label:after,input[type=tel]:not(.browser-default):focus.valid+label:after,input[type=number]:not(.browser-default).valid+label:after,input[type=number]:not(.browser-default):focus.valid+label:after,input[type=search]:not(.browser-default).valid+label:after,input[type=search]:not(.browser-default):focus.valid+label:after,textarea.materialize-textarea.valid+label:after,textarea.materialize-textarea:focus.valid+label:after,.select-wrapper.valid+label:after{content:attr(data-success);color:#4CAF50;opacity:1;-webkit-transform:translateY(9px);transform:translateY(9px)}input:not([type]).invalid+label:after,input:not([type]):focus.invalid+label:after,input[type=text]:not(.browser-default).invalid+label:after,input[type=text]:not(.browser-default):focus.invalid+label:after,input[type=password]:not(.browser-default).invalid+label:after,input[type=password]:not(.browser-default):focus.invalid+label:after,input[type=email]:not(.browser-default).invalid+label:after,input[type=email]:not(.browser-default):focus.invalid+label:after,input[type=url]:not(.browser-default).invalid+label:after,input[type=url]:not(.browser-default):focus.invalid+label:after,input[type=time]:not(.browser-default).invalid+label:after,input[type=time]:not(.browser-default):focus.invalid+label:after,input[type=date]:not(.browser-default).invalid+label:after,input[type=date]:not(.browser-default):focus.invalid+label:after,input[type=datetime]:not(.browser-default).invalid+label:after,input[type=datetime]:not(.browser-default):focus.invalid+label:after,input[type=datetime-local]:not(.browser-default).invalid+label:after,input[type=datetime-local]:not(.browser-default):focus.invalid+label:after,input[type=tel]:not(.browser-default).invalid+label:after,input[type=tel]:not(.browser-default):focus.invalid+label:after,input[type=number]:not(.browser-default).invalid+label:after,input[type=number]:not(.browser-default):focus.invalid+label:after,input[type=search]:not(.browser-default).invalid+label:after,input[type=search]:not(.browser-default):focus.invalid+label:after,textarea.materialize-textarea.invalid+label:after,textarea.materialize-textarea:focus.invalid+label:after,.select-wrapper.invalid+label:after{content:attr(data-error);color:#F44336;opacity:1;-webkit-transform:translateY(9px);transform:translateY(9px)}input:not([type])+label:after,input[type=text]:not(.browser-default)+label:after,input[type=password]:not(.browser-default)+label:after,input[type=email]:not(.browser-default)+label:after,input[type=url]:not(.browser-default)+label:after,input[type=time]:not(.browser-default)+label:after,input[type=date]:not(.browser-default)+label:after,input[type=datetime]:not(.browser-default)+label:after,input[type=datetime-local]:not(.browser-default)+label:after,input[type=tel]:not(.browser-default)+label:after,input[type=number]:not(.browser-default)+label:after,input[type=search]:not(.browser-default)+label:after,textarea.materialize-textarea+label:after,.select-wrapper+label:after{display:block;content:"";position:absolute;top:100%;left:0;opacity:0;-webkit-transition:.2s opacity ease-out, .2s color ease-out;transition:.2s opacity ease-out, .2s color ease-out}.input-field{position:relative;margin-top:1rem}.input-field.inline{display:inline-block;vertical-align:middle;margin-left:5px}.input-field.inline input,.input-field.inline .select-dropdown{margin-bottom:1rem}.input-field.col label{left:.75rem}.input-field.col .prefix ~ label,.input-field.col .prefix ~ .validate ~ label{width:calc(100% - 3rem - 1.5rem)}.input-field label{color:#9e9e9e;position:absolute;top:0;left:0;height:100%;font-size:1rem;cursor:text;-webkit-transition:-webkit-transform .2s ease-out;transition:-webkit-transform .2s ease-out;transition:transform .2s ease-out;transition:transform .2s ease-out, -webkit-transform .2s ease-out;-webkit-transform-origin:0% 100%;transform-origin:0% 100%;text-align:initial;-webkit-transform:translateY(12px);transform:translateY(12px);pointer-events:none}.input-field label:not(.label-icon).active{-webkit-transform:translateY(-14px) scale(0.8);transform:translateY(-14px) scale(0.8);-webkit-transform-origin:0 0;transform-origin:0 0}.input-field .prefix{position:absolute;width:3rem;font-size:2rem;-webkit-transition:color .2s;transition:color .2s}.input-field .prefix.active{color:#26a69a}.input-field .prefix ~ input,.input-field .prefix ~ textarea,.input-field .prefix ~ label,.input-field .prefix ~ .validate ~ label,.input-field .prefix ~ .autocomplete-content{margin-left:3rem;width:92%;width:calc(100% - 3rem)}.input-field .prefix ~ label{margin-left:3rem}@media only screen and (max-width: 992px){.input-field .prefix ~ input{width:86%;width:calc(100% - 3rem)}}@media only screen and (max-width: 600px){.input-field .prefix ~ input{width:80%;width:calc(100% - 3rem)}}.input-field input[type=search]{display:block;line-height:inherit}.nav-wrapper .input-field input[type=search]{height:inherit;padding-left:4rem;width:calc(100% - 4rem);border:0;-webkit-box-shadow:none;box-shadow:none}.input-field input[type=search]:focus{background-color:#fff;border:0;-webkit-box-shadow:none;box-shadow:none;color:#444}.input-field input[type=search]:focus+label i,.input-field input[type=search]:focus ~ .mdi-navigation-close,.input-field input[type=search]:focus ~ .material-icons{color:#444}.input-field input[type=search]+label{left:1rem}.input-field input[type=search] ~ .mdi-navigation-close,.input-field input[type=search] ~ .material-icons{position:absolute;top:0;right:1rem;color:transparent;cursor:pointer;font-size:2rem;-webkit-transition:.3s color;transition:.3s color}textarea{width:100%;height:3rem;background-color:transparent}textarea.materialize-textarea{overflow-y:hidden;padding:.8rem 0 1.6rem 0;resize:none;min-height:3rem}textarea.materialize-textarea.validate+label{height:100%}textarea.materialize-textarea.validate+label::after{top:calc(100% - 12px)}textarea.materialize-textarea.validate+label:not(.label-icon).active{-webkit-transform:translateY(-25px);transform:translateY(-25px)}.hiddendiv{display:none;white-space:pre-wrap;word-wrap:break-word;overflow-wrap:break-word;padding-top:1.2rem;position:absolute;top:0}.autocomplete-content{margin-top:-20px;margin-bottom:20px;display:block;opacity:1;position:static}.autocomplete-content li .highlight{color:#444}.autocomplete-content li img{height:40px;width:40px;margin:5px 15px}[type="radio"]:not(:checked),[type="radio"]:checked{position:absolute;opacity:0;pointer-events:none}[type="radio"]:not(:checked)+label,[type="radio"]:checked+label{position:relative;padding-left:35px;cursor:pointer;display:inline-block;height:25px;line-height:25px;font-size:1rem;-webkit-transition:.28s ease;transition:.28s ease;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}[type="radio"]+label:before,[type="radio"]+label:after{content:'';position:absolute;left:0;top:0;margin:4px;width:16px;height:16px;z-index:0;-webkit-transition:.28s ease;transition:.28s ease}[type="radio"]:not(:checked)+label:before,[type="radio"]:not(:checked)+label:after,[type="radio"]:checked+label:before,[type="radio"]:checked+label:after,[type="radio"].with-gap:checked+label:before,[type="radio"].with-gap:checked+label:after{border-radius:50%}[type="radio"]:not(:checked)+label:before,[type="radio"]:not(:checked)+label:after{border:2px solid #5a5a5a}[type="radio"]:not(:checked)+label:after{-webkit-transform:scale(0);transform:scale(0)}[type="radio"]:checked+label:before{border:2px solid transparent}[type="radio"]:checked+label:after,[type="radio"].with-gap:checked+label:before,[type="radio"].with-gap:checked+label:after{border:2px solid #26a69a}[type="radio"]:checked+label:after,[type="radio"].with-gap:checked+label:after{background-color:#26a69a}[type="radio"]:checked+label:after{-webkit-transform:scale(1.02);transform:scale(1.02)}[type="radio"].with-gap:checked+label:after{-webkit-transform:scale(0.5);transform:scale(0.5)}[type="radio"].tabbed:focus+label:before{-webkit-box-shadow:0 0 0 10px rgba(0,0,0,0.1);box-shadow:0 0 0 10px rgba(0,0,0,0.1)}[type="radio"].with-gap:disabled:checked+label:before{border:2px solid rgba(0,0,0,0.42)}[type="radio"].with-gap:disabled:checked+label:after{border:none;background-color:rgba(0,0,0,0.42)}[type="radio"]:disabled:not(:checked)+label:before,[type="radio"]:disabled:checked+label:before{background-color:transparent;border-color:rgba(0,0,0,0.42)}[type="radio"]:disabled+label{color:rgba(0,0,0,0.42)}[type="radio"]:disabled:not(:checked)+label:before{border-color:rgba(0,0,0,0.42)}[type="radio"]:disabled:checked+label:after{background-color:rgba(0,0,0,0.42);border-color:#949494}form p{margin-bottom:10px;text-align:left}form p:last-child{margin-bottom:0}[type="checkbox"]:not(:checked),[type="checkbox"]:checked{position:absolute;opacity:0;pointer-events:none}[type="checkbox"]+label{position:relative;padding-left:35px;cursor:pointer;display:inline-block;height:25px;line-height:25px;font-size:1rem;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}[type="checkbox"]+label:before,[type="checkbox"]:not(.filled-in)+label:after{content:'';position:absolute;top:0;left:0;width:18px;height:18px;z-index:0;border:2px solid #5a5a5a;border-radius:1px;margin-top:2px;-webkit-transition:.2s;transition:.2s}[type="checkbox"]:not(.filled-in)+label:after{border:0;-webkit-transform:scale(0);transform:scale(0)}[type="checkbox"]:not(:checked):disabled+label:before{border:none;background-color:rgba(0,0,0,0.42)}[type="checkbox"].tabbed:focus+label:after{-webkit-transform:scale(1);transform:scale(1);border:0;border-radius:50%;-webkit-box-shadow:0 0 0 10px rgba(0,0,0,0.1);box-shadow:0 0 0 10px rgba(0,0,0,0.1);background-color:rgba(0,0,0,0.1)}[type="checkbox"]:checked+label:before{top:-4px;left:-5px;width:12px;height:22px;border-top:2px solid transparent;border-left:2px solid transparent;border-right:2px solid #26a69a;border-bottom:2px solid #26a69a;-webkit-transform:rotate(40deg);transform:rotate(40deg);-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-transform-origin:100% 100%;transform-origin:100% 100%}[type="checkbox"]:checked:disabled+label:before{border-right:2px solid rgba(0,0,0,0.42);border-bottom:2px solid rgba(0,0,0,0.42)}[type="checkbox"]:indeterminate+label:before{top:-11px;left:-12px;width:10px;height:22px;border-top:none;border-left:none;border-right:2px solid #26a69a;border-bottom:none;-webkit-transform:rotate(90deg);transform:rotate(90deg);-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-transform-origin:100% 100%;transform-origin:100% 100%}[type="checkbox"]:indeterminate:disabled+label:before{border-right:2px solid rgba(0,0,0,0.42);background-color:transparent}[type="checkbox"].filled-in+label:after{border-radius:2px}[type="checkbox"].filled-in+label:before,[type="checkbox"].filled-in+label:after{content:'';left:0;position:absolute;-webkit-transition:border .25s, background-color .25s, width .20s .1s, height .20s .1s, top .20s .1s, left .20s .1s;transition:border .25s, background-color .25s, width .20s .1s, height .20s .1s, top .20s .1s, left .20s .1s;z-index:1}[type="checkbox"].filled-in:not(:checked)+label:before{width:0;height:0;border:3px solid transparent;left:6px;top:10px;-webkit-transform:rotateZ(37deg);transform:rotateZ(37deg);-webkit-transform-origin:100% 100%;transform-origin:100% 100%}[type="checkbox"].filled-in:not(:checked)+label:after{height:20px;width:20px;background-color:transparent;border:2px solid #5a5a5a;top:0px;z-index:0}[type="checkbox"].filled-in:checked+label:before{top:0;left:1px;width:8px;height:13px;border-top:2px solid transparent;border-left:2px solid transparent;border-right:2px solid #fff;border-bottom:2px solid #fff;-webkit-transform:rotateZ(37deg);transform:rotateZ(37deg);-webkit-transform-origin:100% 100%;transform-origin:100% 100%}[type="checkbox"].filled-in:checked+label:after{top:0;width:20px;height:20px;border:2px solid #26a69a;background-color:#26a69a;z-index:0}[type="checkbox"].filled-in.tabbed:focus+label:after{border-radius:2px;border-color:#5a5a5a;background-color:rgba(0,0,0,0.1)}[type="checkbox"].filled-in.tabbed:checked:focus+label:after{border-radius:2px;background-color:#26a69a;border-color:#26a69a}[type="checkbox"].filled-in:disabled:not(:checked)+label:before{background-color:transparent;border:2px solid transparent}[type="checkbox"].filled-in:disabled:not(:checked)+label:after{border-color:transparent;background-color:#949494}[type="checkbox"].filled-in:disabled:checked+label:before{background-color:transparent}[type="checkbox"].filled-in:disabled:checked+label:after{background-color:#949494;border-color:#949494}.switch,.switch *{-webkit-tap-highlight-color:transparent;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.switch label{cursor:pointer}.switch label input[type=checkbox]{opacity:0;width:0;height:0}.switch label input[type=checkbox]:checked+.lever{background-color:#84c7c1}.switch label input[type=checkbox]:checked+.lever:before,.switch label input[type=checkbox]:checked+.lever:after{left:18px}.switch label input[type=checkbox]:checked+.lever:after{background-color:#26a69a}.switch label .lever{content:"";display:inline-block;position:relative;width:36px;height:14px;background-color:rgba(0,0,0,0.38);border-radius:15px;margin-right:10px;-webkit-transition:background 0.3s ease;transition:background 0.3s ease;vertical-align:middle;margin:0 16px}.switch label .lever:before,.switch label .lever:after{content:"";position:absolute;display:inline-block;width:20px;height:20px;border-radius:50%;left:0;top:-3px;-webkit-transition:left 0.3s ease, background .3s ease, -webkit-box-shadow 0.1s ease, -webkit-transform .1s ease;transition:left 0.3s ease, background .3s ease, -webkit-box-shadow 0.1s ease, -webkit-transform .1s ease;transition:left 0.3s ease, background .3s ease, box-shadow 0.1s ease, transform .1s ease;transition:left 0.3s ease, background .3s ease, box-shadow 0.1s ease, transform .1s ease, -webkit-box-shadow 0.1s ease, -webkit-transform .1s ease}.switch label .lever:before{background-color:rgba(38,166,154,0.15)}.switch label .lever:after{background-color:#F1F1F1;-webkit-box-shadow:0px 3px 1px -2px rgba(0,0,0,0.2),0px 2px 2px 0px rgba(0,0,0,0.14),0px 1px 5px 0px rgba(0,0,0,0.12);box-shadow:0px 3px 1px -2px rgba(0,0,0,0.2),0px 2px 2px 0px rgba(0,0,0,0.14),0px 1px 5px 0px rgba(0,0,0,0.12)}input[type=checkbox]:checked:not(:disabled) ~ .lever:active::before,input[type=checkbox]:checked:not(:disabled).tabbed:focus ~ .lever::before{-webkit-transform:scale(2.4);transform:scale(2.4);background-color:rgba(38,166,154,0.15)}input[type=checkbox]:not(:disabled) ~ .lever:active:before,input[type=checkbox]:not(:disabled).tabbed:focus ~ .lever::before{-webkit-transform:scale(2.4);transform:scale(2.4);background-color:rgba(0,0,0,0.08)}.switch input[type=checkbox][disabled]+.lever{cursor:default;background-color:rgba(0,0,0,0.12)}.switch label input[type=checkbox][disabled]+.lever:after,.switch label input[type=checkbox][disabled]:checked+.lever:after{background-color:#949494}select{display:none}select.browser-default{display:block}select{background-color:rgba(255,255,255,0.9);width:100%;padding:5px;border:1px solid #f2f2f2;border-radius:2px;height:3rem}.input-field>select{display:block;position:absolute;width:0;pointer-events:none;height:0;top:0;left:0;opacity:0}.select-label{position:absolute}.select-wrapper{position:relative}.select-wrapper.valid+label,.select-wrapper.invalid+label{width:100%;pointer-events:none}.select-wrapper input.select-dropdown{position:relative;cursor:pointer;background-color:transparent;border:none;border-bottom:1px solid #9e9e9e;outline:none;height:3rem;line-height:3rem;width:100%;font-size:1rem;margin:0 0 20px 0;padding:0;display:block;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.select-wrapper span.caret{color:initial;position:absolute;right:0;top:0;bottom:0;height:10px;margin:auto 0;font-size:10px;line-height:10px}.select-wrapper+label{position:absolute;top:-26px;font-size:.8rem}select:disabled{color:rgba(0,0,0,0.42)}.select-wrapper.disabled span.caret,.select-wrapper.disabled+label{color:rgba(0,0,0,0.42)}.select-wrapper input.select-dropdown:disabled{color:rgba(0,0,0,0.42);cursor:default;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.select-wrapper i{color:rgba(0,0,0,0.3)}.select-dropdown li.disabled,.select-dropdown li.disabled>span,.select-dropdown li.optgroup{color:rgba(0,0,0,0.3);background-color:transparent}.select-dropdown.dropdown-content li.active{background-color:transparent}.select-dropdown.dropdown-content li:hover{background-color:rgba(0,0,0,0.06)}.select-dropdown.dropdown-content li.selected{background-color:rgba(0,0,0,0.03)}.prefix ~ .select-wrapper{margin-left:3rem;width:92%;width:calc(100% - 3rem)}.prefix ~ label{margin-left:3rem}.select-dropdown li img{height:40px;width:40px;margin:5px 15px;float:right}.select-dropdown li.optgroup{border-top:1px solid #eee}.select-dropdown li.optgroup.selected>span{color:rgba(0,0,0,0.7)}.select-dropdown li.optgroup>span{color:rgba(0,0,0,0.4)}.select-dropdown li.optgroup ~ li.optgroup-option{padding-left:1rem}.file-field{position:relative}.file-field .file-path-wrapper{overflow:hidden;padding-left:10px}.file-field input.file-path{width:100%}.file-field .btn,.file-field .btn-large{float:left;height:3rem;line-height:3rem}.file-field span{cursor:pointer}.file-field input[type=file]{position:absolute;top:0;right:0;left:0;bottom:0;width:100%;margin:0;padding:0;font-size:20px;cursor:pointer;opacity:0;filter:alpha(opacity=0)}.file-field input[type=file]::-webkit-file-upload-button{display:none}.range-field{position:relative}input[type=range],input[type=range]+.thumb{cursor:pointer}input[type=range]{position:relative;background-color:transparent;border:none;outline:none;width:100%;margin:15px 0;padding:0}input[type=range]:focus{outline:none}input[type=range]+.thumb{position:absolute;top:10px;left:0;border:none;height:0;width:0;border-radius:50%;background-color:#26a69a;margin-left:7px;-webkit-transform-origin:50% 50%;transform-origin:50% 50%;-webkit-transform:rotate(-45deg);transform:rotate(-45deg)}input[type=range]+.thumb .value{display:block;width:30px;text-align:center;color:#26a69a;font-size:0;-webkit-transform:rotate(45deg);transform:rotate(45deg)}input[type=range]+.thumb.active{border-radius:50% 50% 50% 0}input[type=range]+.thumb.active .value{color:#fff;margin-left:-1px;margin-top:8px;font-size:10px}input[type=range]{-webkit-appearance:none}input[type=range]::-webkit-slider-runnable-track{height:3px;background:#c2c0c2;border:none}input[type=range]::-webkit-slider-thumb{-webkit-appearance:none;border:none;height:14px;width:14px;border-radius:50%;background-color:#26a69a;-webkit-transform-origin:50% 50%;transform-origin:50% 50%;margin:-5px 0 0 0;-webkit-transition:.3s;transition:.3s}input[type=range]:focus::-webkit-slider-runnable-track{background:#ccc}input[type=range]{border:1px solid white}input[type=range]::-moz-range-track{height:3px;background:#ddd;border:none}input[type=range]::-moz-range-thumb{border:none;height:14px;width:14px;border-radius:50%;background:#26a69a;margin-top:-5px}input[type=range]:-moz-focusring{outline:1px solid #fff;outline-offset:-1px}input[type=range]:focus::-moz-range-track{background:#ccc}input[type=range]::-ms-track{height:3px;background:transparent;border-color:transparent;border-width:6px 0;color:transparent}input[type=range]::-ms-fill-lower{background:#777}input[type=range]::-ms-fill-upper{background:#ddd}input[type=range]::-ms-thumb{border:none;height:14px;width:14px;border-radius:50%;background:#26a69a}input[type=range]:focus::-ms-fill-lower{background:#888}input[type=range]:focus::-ms-fill-upper{background:#ccc}.table-of-contents.fixed{position:fixed}.table-of-contents li{padding:2px 0}.table-of-contents a{display:inline-block;font-weight:300;color:#757575;padding-left:20px;height:1.5rem;line-height:1.5rem;letter-spacing:.4;display:inline-block}.table-of-contents a:hover{color:#a8a8a8;padding-left:19px;border-left:1px solid #ee6e73}.table-of-contents a.active{font-weight:500;padding-left:18px;border-left:2px solid #ee6e73}.side-nav{position:fixed;width:300px;left:0;top:0;margin:0;-webkit-transform:translateX(-100%);transform:translateX(-100%);height:100%;height:calc(100% + 60px);height:-moz-calc(100%);padding-bottom:60px;background-color:#fff;z-index:999;overflow-y:auto;will-change:transform;-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-transform:translateX(-105%);transform:translateX(-105%)}.side-nav.right-aligned{right:0;-webkit-transform:translateX(105%);transform:translateX(105%);left:auto;-webkit-transform:translateX(100%);transform:translateX(100%)}.side-nav .collapsible{margin:0}.side-nav li{float:none;line-height:48px}.side-nav li.active{background-color:rgba(0,0,0,0.05)}.side-nav li>a{color:rgba(0,0,0,0.87);display:block;font-size:14px;font-weight:500;height:48px;line-height:48px;padding:0 32px}.side-nav li>a:hover{background-color:rgba(0,0,0,0.05)}.side-nav li>a.btn,.side-nav li>a.btn-large,.side-nav li>a.btn-large,.side-nav li>a.btn-flat,.side-nav li>a.btn-floating{margin:10px 15px}.side-nav li>a.btn,.side-nav li>a.btn-large,.side-nav li>a.btn-large,.side-nav li>a.btn-floating{color:#fff}.side-nav li>a.btn-flat{color:#343434}.side-nav li>a.btn:hover,.side-nav li>a.btn-large:hover,.side-nav li>a.btn-large:hover{background-color:#2bbbad}.side-nav li>a.btn-floating:hover{background-color:#26a69a}.side-nav li>a>i,.side-nav li>a>[class^="mdi-"],.side-nav li>a li>a>[class*="mdi-"],.side-nav li>a>i.material-icons{float:left;height:48px;line-height:48px;margin:0 32px 0 0;width:24px;color:rgba(0,0,0,0.54)}.side-nav .divider{margin:8px 0 0 0}.side-nav .subheader{cursor:initial;pointer-events:none;color:rgba(0,0,0,0.54);font-size:14px;font-weight:500;line-height:48px}.side-nav .subheader:hover{background-color:transparent}.side-nav .user-view,.side-nav .userView{position:relative;padding:32px 32px 0;margin-bottom:8px}.side-nav .user-view>a,.side-nav .userView>a{height:auto;padding:0}.side-nav .user-view>a:hover,.side-nav .userView>a:hover{background-color:transparent}.side-nav .user-view .background,.side-nav .userView .background{overflow:hidden;position:absolute;top:0;right:0;bottom:0;left:0;z-index:-1}.side-nav .user-view .circle,.side-nav .user-view .name,.side-nav .user-view .email,.side-nav .userView .circle,.side-nav .userView .name,.side-nav .userView .email{display:block}.side-nav .user-view .circle,.side-nav .userView .circle{height:64px;width:64px}.side-nav .user-view .name,.side-nav .user-view .email,.side-nav .userView .name,.side-nav .userView .email{font-size:14px;line-height:24px}.side-nav .user-view .name,.side-nav .userView .name{margin-top:16px;font-weight:500}.side-nav .user-view .email,.side-nav .userView .email{padding-bottom:16px;font-weight:400}.drag-target{height:100%;width:10px;position:fixed;top:0;z-index:998}.side-nav.fixed{left:0;-webkit-transform:translateX(0);transform:translateX(0);position:fixed}.side-nav.fixed.right-aligned{right:0;left:auto}@media only screen and (max-width: 992px){.side-nav.fixed{-webkit-transform:translateX(-105%);transform:translateX(-105%)}.side-nav.fixed.right-aligned{-webkit-transform:translateX(105%);transform:translateX(105%)}.side-nav a{padding:0 16px}.side-nav .user-view,.side-nav .userView{padding:16px 16px 0}}.side-nav .collapsible-body>ul:not(.collapsible)>li.active,.side-nav.fixed .collapsible-body>ul:not(.collapsible)>li.active{background-color:#ee6e73}.side-nav .collapsible-body>ul:not(.collapsible)>li.active a,.side-nav.fixed .collapsible-body>ul:not(.collapsible)>li.active a{color:#fff}.side-nav .collapsible-body{padding:0}#sidenav-overlay{position:fixed;top:0;left:0;right:0;height:120vh;background-color:rgba(0,0,0,0.5);z-index:997;will-change:opacity}.preloader-wrapper{display:inline-block;position:relative;width:50px;height:50px}.preloader-wrapper.small{width:36px;height:36px}.preloader-wrapper.big{width:64px;height:64px}.preloader-wrapper.active{-webkit-animation:container-rotate 1568ms linear infinite;animation:container-rotate 1568ms linear infinite}@-webkit-keyframes container-rotate{to{-webkit-transform:rotate(360deg)}}@keyframes container-rotate{to{-webkit-transform:rotate(360deg);transform:rotate(360deg)}}.spinner-layer{position:absolute;width:100%;height:100%;opacity:0;border-color:#26a69a}.spinner-blue,.spinner-blue-only{border-color:#4285f4}.spinner-red,.spinner-red-only{border-color:#db4437}.spinner-yellow,.spinner-yellow-only{border-color:#f4b400}.spinner-green,.spinner-green-only{border-color:#0f9d58}.active .spinner-layer.spinner-blue{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer.spinner-red{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer.spinner-yellow{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer.spinner-green{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer,.active .spinner-layer.spinner-blue-only,.active .spinner-layer.spinner-red-only,.active .spinner-layer.spinner-yellow-only,.active .spinner-layer.spinner-green-only{opacity:1;-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}@-webkit-keyframes fill-unfill-rotate{12.5%{-webkit-transform:rotate(135deg)}25%{-webkit-transform:rotate(270deg)}37.5%{-webkit-transform:rotate(405deg)}50%{-webkit-transform:rotate(540deg)}62.5%{-webkit-transform:rotate(675deg)}75%{-webkit-transform:rotate(810deg)}87.5%{-webkit-transform:rotate(945deg)}to{-webkit-transform:rotate(1080deg)}}@keyframes fill-unfill-rotate{12.5%{-webkit-transform:rotate(135deg);transform:rotate(135deg)}25%{-webkit-transform:rotate(270deg);transform:rotate(270deg)}37.5%{-webkit-transform:rotate(405deg);transform:rotate(405deg)}50%{-webkit-transform:rotate(540deg);transform:rotate(540deg)}62.5%{-webkit-transform:rotate(675deg);transform:rotate(675deg)}75%{-webkit-transform:rotate(810deg);transform:rotate(810deg)}87.5%{-webkit-transform:rotate(945deg);transform:rotate(945deg)}to{-webkit-transform:rotate(1080deg);transform:rotate(1080deg)}}@-webkit-keyframes blue-fade-in-out{from{opacity:1}25%{opacity:1}26%{opacity:0}89%{opacity:0}90%{opacity:1}100%{opacity:1}}@keyframes blue-fade-in-out{from{opacity:1}25%{opacity:1}26%{opacity:0}89%{opacity:0}90%{opacity:1}100%{opacity:1}}@-webkit-keyframes red-fade-in-out{from{opacity:0}15%{opacity:0}25%{opacity:1}50%{opacity:1}51%{opacity:0}}@keyframes red-fade-in-out{from{opacity:0}15%{opacity:0}25%{opacity:1}50%{opacity:1}51%{opacity:0}}@-webkit-keyframes yellow-fade-in-out{from{opacity:0}40%{opacity:0}50%{opacity:1}75%{opacity:1}76%{opacity:0}}@keyframes yellow-fade-in-out{from{opacity:0}40%{opacity:0}50%{opacity:1}75%{opacity:1}76%{opacity:0}}@-webkit-keyframes green-fade-in-out{from{opacity:0}65%{opacity:0}75%{opacity:1}90%{opacity:1}100%{opacity:0}}@keyframes green-fade-in-out{from{opacity:0}65%{opacity:0}75%{opacity:1}90%{opacity:1}100%{opacity:0}}.gap-patch{position:absolute;top:0;left:45%;width:10%;height:100%;overflow:hidden;border-color:inherit}.gap-patch .circle{width:1000%;left:-450%}.circle-clipper{display:inline-block;position:relative;width:50%;height:100%;overflow:hidden;border-color:inherit}.circle-clipper .circle{width:200%;height:100%;border-width:3px;border-style:solid;border-color:inherit;border-bottom-color:transparent !important;border-radius:50%;-webkit-animation:none;animation:none;position:absolute;top:0;right:0;bottom:0}.circle-clipper.left .circle{left:0;border-right-color:transparent !important;-webkit-transform:rotate(129deg);transform:rotate(129deg)}.circle-clipper.right .circle{left:-100%;border-left-color:transparent !important;-webkit-transform:rotate(-129deg);transform:rotate(-129deg)}.active .circle-clipper.left .circle{-webkit-animation:left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .circle-clipper.right .circle{-webkit-animation:right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}@-webkit-keyframes left-spin{from{-webkit-transform:rotate(130deg)}50%{-webkit-transform:rotate(-5deg)}to{-webkit-transform:rotate(130deg)}}@keyframes left-spin{from{-webkit-transform:rotate(130deg);transform:rotate(130deg)}50%{-webkit-transform:rotate(-5deg);transform:rotate(-5deg)}to{-webkit-transform:rotate(130deg);transform:rotate(130deg)}}@-webkit-keyframes right-spin{from{-webkit-transform:rotate(-130deg)}50%{-webkit-transform:rotate(5deg)}to{-webkit-transform:rotate(-130deg)}}@keyframes right-spin{from{-webkit-transform:rotate(-130deg);transform:rotate(-130deg)}50%{-webkit-transform:rotate(5deg);transform:rotate(5deg)}to{-webkit-transform:rotate(-130deg);transform:rotate(-130deg)}}#spinnerContainer.cooldown{-webkit-animation:container-rotate 1568ms linear infinite,fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1);animation:container-rotate 1568ms linear infinite,fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1)}@-webkit-keyframes fade-out{from{opacity:1}to{opacity:0}}@keyframes fade-out{from{opacity:1}to{opacity:0}}.slider{position:relative;height:400px;width:100%}.slider.fullscreen{height:100%;width:100%;position:absolute;top:0;left:0;right:0;bottom:0}.slider.fullscreen ul.slides{height:100%}.slider.fullscreen ul.indicators{z-index:2;bottom:30px}.slider .slides{background-color:#9e9e9e;margin:0;height:400px}.slider .slides li{opacity:0;position:absolute;top:0;left:0;z-index:1;width:100%;height:inherit;overflow:hidden}.slider .slides li img{height:100%;width:100%;background-size:cover;background-position:center}.slider .slides li .caption{color:#fff;position:absolute;top:15%;left:15%;width:70%;opacity:0}.slider .slides li .caption p{color:#e0e0e0}.slider .slides li.active{z-index:2}.slider .indicators{position:absolute;text-align:center;left:0;right:0;bottom:0;margin:0}.slider .indicators .indicator-item{display:inline-block;position:relative;cursor:pointer;height:16px;width:16px;margin:0 12px;background-color:#e0e0e0;-webkit-transition:background-color .3s;transition:background-color .3s;border-radius:50%}.slider .indicators .indicator-item.active{background-color:#4CAF50}.carousel{overflow:hidden;position:relative;width:100%;height:400px;-webkit-perspective:500px;perspective:500px;-webkit-transform-style:preserve-3d;transform-style:preserve-3d;-webkit-transform-origin:0% 50%;transform-origin:0% 50%}.carousel.carousel-slider{top:0;left:0}.carousel.carousel-slider .carousel-fixed-item{position:absolute;left:0;right:0;bottom:20px;z-index:1}.carousel.carousel-slider .carousel-fixed-item.with-indicators{bottom:68px}.carousel.carousel-slider .carousel-item{width:100%;height:100%;min-height:400px;position:absolute;top:0;left:0}.carousel.carousel-slider .carousel-item h2{font-size:24px;font-weight:500;line-height:32px}.carousel.carousel-slider .carousel-item p{font-size:15px}.carousel .carousel-item{display:none;width:200px;height:200px;position:absolute;top:0;left:0}.carousel .carousel-item>img{width:100%}.carousel .indicators{position:absolute;text-align:center;left:0;right:0;bottom:0;margin:0}.carousel .indicators .indicator-item{display:inline-block;position:relative;cursor:pointer;height:8px;width:8px;margin:24px 4px;background-color:rgba(255,255,255,0.5);-webkit-transition:background-color .3s;transition:background-color .3s;border-radius:50%}.carousel .indicators .indicator-item.active{background-color:#fff}.carousel.scrolling .carousel-item .materialboxed,.carousel .carousel-item:not(.active) .materialboxed{pointer-events:none}.tap-target-wrapper{width:800px;height:800px;position:fixed;z-index:1000;visibility:hidden;-webkit-transition:visibility 0s .3s;transition:visibility 0s .3s}.tap-target-wrapper.open{visibility:visible;-webkit-transition:visibility 0s;transition:visibility 0s}.tap-target-wrapper.open .tap-target{-webkit-transform:scale(1);transform:scale(1);opacity:.95;-webkit-transition:opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1),-webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1);transition:opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1),-webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1);transition:transform 0.3s cubic-bezier(0.42, 0, 0.58, 1),opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1);transition:transform 0.3s cubic-bezier(0.42, 0, 0.58, 1),opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1),-webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1)}.tap-target-wrapper.open .tap-target-wave::before{-webkit-transform:scale(1);transform:scale(1)}.tap-target-wrapper.open .tap-target-wave::after{visibility:visible;-webkit-animation:pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite;animation:pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite;-webkit-transition:opacity .3s, visibility 0s 1s, -webkit-transform .3s;transition:opacity .3s, visibility 0s 1s, -webkit-transform .3s;transition:opacity .3s, transform .3s, visibility 0s 1s;transition:opacity .3s, transform .3s, visibility 0s 1s, -webkit-transform .3s}.tap-target{position:absolute;font-size:1rem;border-radius:50%;background-color:#ee6e73;-webkit-box-shadow:0 20px 20px 0 rgba(0,0,0,0.14),0 10px 50px 0 rgba(0,0,0,0.12),0 30px 10px -20px rgba(0,0,0,0.2);box-shadow:0 20px 20px 0 rgba(0,0,0,0.14),0 10px 50px 0 rgba(0,0,0,0.12),0 30px 10px -20px rgba(0,0,0,0.2);width:100%;height:100%;opacity:0;-webkit-transform:scale(0);transform:scale(0);-webkit-transition:opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1),-webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1);transition:opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1),-webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1);transition:transform 0.3s cubic-bezier(0.42, 0, 0.58, 1),opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1);transition:transform 0.3s cubic-bezier(0.42, 0, 0.58, 1),opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1),-webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1)}.tap-target-content{position:relative;display:table-cell}.tap-target-wave{position:absolute;border-radius:50%;z-index:10001}.tap-target-wave::before,.tap-target-wave::after{content:'';display:block;position:absolute;width:100%;height:100%;border-radius:50%;background-color:#ffffff}.tap-target-wave::before{-webkit-transform:scale(0);transform:scale(0);-webkit-transition:-webkit-transform .3s;transition:-webkit-transform .3s;transition:transform .3s;transition:transform .3s, -webkit-transform .3s}.tap-target-wave::after{visibility:hidden;-webkit-transition:opacity .3s, visibility 0s, -webkit-transform .3s;transition:opacity .3s, visibility 0s, -webkit-transform .3s;transition:opacity .3s, transform .3s, visibility 0s;transition:opacity .3s, transform .3s, visibility 0s, -webkit-transform .3s;z-index:-1}.tap-target-origin{top:50%;left:50%;-webkit-transform:translate(-50%, -50%);transform:translate(-50%, -50%);z-index:10002;position:absolute !important}.tap-target-origin:not(.btn):not(.btn-large),.tap-target-origin:not(.btn):not(.btn-large):hover{background:none}@media only screen and (max-width: 600px){.tap-target,.tap-target-wrapper{width:600px;height:600px}}.pulse{overflow:initial;position:relative}.pulse::before{content:'';display:block;position:absolute;width:100%;height:100%;top:0;left:0;background-color:inherit;border-radius:inherit;-webkit-transition:opacity .3s, -webkit-transform .3s;transition:opacity .3s, -webkit-transform .3s;transition:opacity .3s, transform .3s;transition:opacity .3s, transform .3s, -webkit-transform .3s;-webkit-animation:pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite;animation:pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite;z-index:-1}@-webkit-keyframes pulse-animation{0%{opacity:1;-webkit-transform:scale(1);transform:scale(1)}50%{opacity:0;-webkit-transform:scale(1.5);transform:scale(1.5)}100%{opacity:0;-webkit-transform:scale(1.5);transform:scale(1.5)}}@keyframes pulse-animation{0%{opacity:1;-webkit-transform:scale(1);transform:scale(1)}50%{opacity:0;-webkit-transform:scale(1.5);transform:scale(1.5)}100%{opacity:0;-webkit-transform:scale(1.5);transform:scale(1.5)}}.picker{font-size:16px;text-align:left;line-height:1.2;color:#000000;position:absolute;z-index:10000;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;outline:none}.picker__input{cursor:default}.picker__input.picker__input--active{border-color:#0089ec}.picker__holder{width:100%;overflow-y:auto;-webkit-overflow-scrolling:touch}/*! + * Default mobile-first, responsive styling for pickadate.js + * Demo: http://amsul.github.io/pickadate.js + */.picker__holder,.picker__frame{bottom:0;left:0;right:0;top:100%}.picker__holder{position:fixed;-webkit-transition:background 0.15s ease-out, top 0s 0.15s;transition:background 0.15s ease-out, top 0s 0.15s;-webkit-backface-visibility:hidden}.picker__frame{position:absolute;margin:0 auto;min-width:256px;width:300px;max-height:350px;-ms-filter:"progid:DXImageTransform.Microsoft.Alpha(Opacity=0)";filter:alpha(opacity=0);-moz-opacity:0;opacity:0;-webkit-transition:all 0.15s ease-out;transition:all 0.15s ease-out}@media (min-height: 28.875em){.picker__frame{overflow:visible;top:auto;bottom:-100%;max-height:80%}}@media (min-height: 40.125em){.picker__frame{margin-bottom:7.5%}}.picker__wrap{display:table;width:100%;height:100%}@media (min-height: 28.875em){.picker__wrap{display:block}}.picker__box{background:#ffffff;display:table-cell;vertical-align:middle}@media (min-height: 28.875em){.picker__box{display:block;border:1px solid #777777;border-top-color:#898989;border-bottom-width:0;border-radius:5px 5px 0 0;-webkit-box-shadow:0 12px 36px 16px rgba(0,0,0,0.24);box-shadow:0 12px 36px 16px rgba(0,0,0,0.24)}}.picker--opened .picker__holder{top:0;background:transparent;-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorstr=#1E000000,endColorstr=#1E000000)";zoom:1;background:rgba(0,0,0,0.32);-webkit-transition:background 0.15s ease-out;transition:background 0.15s ease-out}.picker--opened .picker__frame{top:0;-ms-filter:"progid:DXImageTransform.Microsoft.Alpha(Opacity=100)";filter:alpha(opacity=100);-moz-opacity:1;opacity:1}@media (min-height: 35.875em){.picker--opened .picker__frame{top:10%;bottom:auto}}.picker__input.picker__input--active{border-color:#E3F2FD}.picker__frame{margin:0 auto;max-width:325px}@media (min-height: 38.875em){.picker--opened .picker__frame{top:10%;bottom:auto}}@media only screen and (min-width: 601px){.picker__box{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex}.picker__frame{width:80%;max-width:600px}}.picker__box{padding:0;border-radius:2px;overflow:hidden}.picker__header{text-align:center;position:relative;margin-top:.75em}.picker__month,.picker__year{display:inline-block;margin-left:.25em;margin-right:.25em}.picker__select--month,.picker__select--year{height:2em;padding:0;margin-left:.25em;margin-right:.25em}.picker__select--month.browser-default{display:inline;background-color:#FFFFFF;width:40%}.picker__select--year.browser-default{display:inline;background-color:#FFFFFF;width:26%}.picker__select--month:focus,.picker__select--year:focus{border-color:rgba(0,0,0,0.05)}.picker__nav--prev,.picker__nav--next{position:absolute;padding:.5em 1.25em;width:1em;height:1em;-webkit-box-sizing:content-box;box-sizing:content-box;top:-0.25em}.picker__nav--prev{left:-1em;padding-right:1.25em}.picker__nav--next{right:-1em;padding-left:1.25em}.picker__nav--disabled,.picker__nav--disabled:hover,.picker__nav--disabled:before,.picker__nav--disabled:before:hover{cursor:default;background:none;border-right-color:#f5f5f5;border-left-color:#f5f5f5}.picker__table{text-align:center;border-collapse:collapse;border-spacing:0;table-layout:fixed;font-size:1rem;width:100%;margin-top:.75em;margin-bottom:.5em}.picker__table th,.picker__table td{text-align:center}.picker__table td{margin:0;padding:0}.picker__weekday{width:14.285714286%;font-size:.75em;padding-bottom:.25em;color:#999999;font-weight:500}@media (min-height: 33.875em){.picker__weekday{padding-bottom:.5em}}.picker__day--today{position:relative;color:#595959;letter-spacing:-.3;padding:.75rem 0;font-weight:400;border:1px solid transparent}.picker__day--disabled:before{border-top-color:#aaaaaa}.picker__day--infocus:hover{cursor:pointer;color:#000;font-weight:500}.picker__day--outfocus{display:none;padding:.75rem 0;color:#fff}.picker__day--outfocus:hover{cursor:pointer;color:#dddddd;font-weight:500}.picker__day--highlighted:hover,.picker--focused .picker__day--highlighted{cursor:pointer}.picker__day--selected,.picker__day--selected:hover,.picker--focused .picker__day--selected{border-radius:50%;-webkit-transform:scale(0.75);transform:scale(0.75);background:#0089ec;color:#ffffff}.picker__day--disabled,.picker__day--disabled:hover,.picker--focused .picker__day--disabled{background:#f5f5f5;border-color:#f5f5f5;color:#dddddd;cursor:default}.picker__day--highlighted.picker__day--disabled,.picker__day--highlighted.picker__day--disabled:hover{background:#bbbbbb}.picker__footer{text-align:right}.picker__button--today,.picker__button--clear,.picker__button--close{border:1px solid #ffffff;background:#ffffff;font-size:.8em;padding:.66em 0;font-weight:bold;width:33%;display:inline-block;vertical-align:bottom}.picker__button--today:hover,.picker__button--clear:hover,.picker__button--close:hover{cursor:pointer;color:#000000;background:#b1dcfb;border-bottom-color:#b1dcfb}.picker__button--today:focus,.picker__button--clear:focus,.picker__button--close:focus{background:#b1dcfb;border-color:rgba(0,0,0,0.05);outline:none}.picker__button--today:before,.picker__button--clear:before,.picker__button--close:before{position:relative;display:inline-block;height:0}.picker__button--today:before,.picker__button--clear:before{content:" ";margin-right:.45em}.picker__button--today:before{top:-0.05em;width:0;border-top:0.66em solid #0059bc;border-left:.66em solid transparent}.picker__button--clear:before{top:-0.25em;width:.66em;border-top:3px solid #ee2200}.picker__button--close:before{content:"\D7";top:-0.1em;vertical-align:top;font-size:1.1em;margin-right:.35em;color:#777777}.picker__button--today[disabled],.picker__button--today[disabled]:hover{background:#f5f5f5;border-color:#f5f5f5;color:#dddddd;cursor:default}.picker__button--today[disabled]:before{border-top-color:#aaaaaa}.picker__date-display{text-align:left;background-color:#26a69a;color:#fff;padding:18px;font-weight:300}@media only screen and (min-width: 601px){.picker__date-display{-webkit-box-flex:1;-webkit-flex:1;-ms-flex:1;flex:1}.picker__weekday-display{display:block}.picker__container__wrapper{-webkit-box-flex:2;-webkit-flex:2;-ms-flex:2;flex:2}}.picker__nav--prev:hover,.picker__nav--next:hover{cursor:pointer;color:#000000;background:#a1ded8}.picker__weekday-display{font-weight:500;font-size:2.8rem;margin-right:5px;margin-top:4px}.picker__month-display{font-size:2.8rem;font-weight:500}.picker__day-display{font-size:2.8rem;font-weight:500;margin-right:5px}.picker__year-display{font-size:1.5rem;font-weight:500;color:rgba(255,255,255,0.7)}.picker__calendar-container{padding:0 1rem}.picker__calendar-container thead{border:none}.picker__table{margin-top:0;margin-bottom:.5em}.picker__day--infocus{color:rgba(0,0,0,0.87);letter-spacing:-.3px;padding:0.75rem 0;font-weight:400;border:1px solid transparent}@media only screen and (min-width: 601px){.picker__day--infocus{padding:1.1rem 0}}.picker__day.picker__day--today{color:#26a69a}.picker__day.picker__day--today.picker__day--selected{color:#fff}.picker__weekday{font-size:.9rem}.picker__day--selected,.picker__day--selected:hover,.picker--focused .picker__day--selected{border-radius:50%;-webkit-transform:scale(0.9);transform:scale(0.9);background-color:#26a69a;color:#ffffff}.picker__day--selected.picker__day--outfocus,.picker__day--selected:hover.picker__day--outfocus,.picker--focused .picker__day--selected.picker__day--outfocus{background-color:#a1ded8}.picker__footer{text-align:right;padding:5px 10px}.picker__close,.picker__today,.picker__clear{font-size:1.1rem;padding:0 1rem;color:#26a69a}.picker__clear{color:#f44336;float:left}.picker__nav--prev:before,.picker__nav--next:before{content:" ";border-top:.5em solid transparent;border-bottom:.5em solid transparent;border-right:0.75em solid #676767;width:0;height:0;display:block;margin:0 auto}.picker__nav--next:before{border-right:0;border-left:0.75em solid #676767}button.picker__today:focus,button.picker__clear:focus,button.picker__close:focus{background-color:#a1ded8}.picker__list{list-style:none;padding:0.75em 0 4.2em;margin:0}.picker__list-item{border-bottom:1px solid #ddd;border-top:1px solid #ddd;margin-bottom:-1px;position:relative;background:#fff;padding:.75em 1.25em}@media (min-height: 46.75em){.picker__list-item{padding:.5em 1em}}.picker__list-item:hover{cursor:pointer;color:#000;background:#b1dcfb;border-color:#0089ec;z-index:10}.picker__list-item--highlighted{border-color:#0089ec;z-index:10}.picker__list-item--highlighted:hover,.picker--focused .picker__list-item--highlighted{cursor:pointer;color:#000;background:#b1dcfb}.picker__list-item--selected,.picker__list-item--selected:hover,.picker--focused .picker__list-item--selected{background:#0089ec;color:#fff;z-index:10}.picker__list-item--disabled,.picker__list-item--disabled:hover,.picker--focused .picker__list-item--disabled{background:#f5f5f5;border-color:#f5f5f5;color:#ddd;cursor:default;border-color:#ddd;z-index:auto}.picker--time .picker__button--clear{display:block;width:80%;margin:1em auto 0;padding:1em 1.25em;background:none;border:0;font-weight:500;font-size:.67em;text-align:center;text-transform:uppercase;color:rgba(0,0,0,0.87)}.picker--time .picker__button--clear:hover,.picker--time .picker__button--clear:focus{color:#000;background:#b1dcfb;background:#ee2200;border-color:#ee2200;cursor:pointer;color:#fff;outline:none}.picker--time .picker__button--clear:before{top:-0.25em;color:rgba(0,0,0,0.87);font-size:1.25em;font-weight:bold}.picker--time .picker__button--clear:hover:before,.picker--time .picker__button--clear:focus:before{color:#fff}.picker--time .picker__frame{min-width:256px;max-width:320px}.picker--time .picker__box{font-size:1em;background:#f2f2f2;padding:0}@media (min-height: 40.125em){.picker--time .picker__box{margin-bottom:5em}}.clockpicker-display{font-size:4rem;font-weight:bold;text-align:center;color:rgba(255,255,255,0.6);font-weight:400;clear:both;position:relative}.clockpicker-span-am-pm{font-size:1.3rem;position:absolute;right:1rem;bottom:0.3rem;line-height:2rem;font-weight:500}@media only screen and (min-width: 601px){.clockpicker-display{top:32%}.clockpicker-span-am-pm{position:relative;right:auto;bottom:auto;text-align:center;margin-top:1.2rem}}.text-primary{color:#fff}.clockpicker-span-hours{margin-right:3px}.clockpicker-span-minutes{margin-left:3px}.clockpicker-span-hours,.clockpicker-span-minutes,.clockpicker-span-am-pm div{cursor:pointer}.clockpicker-moving{cursor:move}.clockpicker-plate{background-color:#eee;border-radius:50%;width:270px;height:270px;overflow:visible;position:relative;margin:auto;margin-top:25px;margin-bottom:5px;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.clockpicker-canvas,.clockpicker-dial{width:270px;height:270px;position:absolute;left:-1px;top:-1px}.clockpicker-minutes{visibility:hidden}.clockpicker-tick{border-radius:50%;color:rgba(0,0,0,0.87);line-height:40px;text-align:center;width:40px;height:40px;position:absolute;cursor:pointer}.clockpicker-tick.active,.clockpicker-tick:hover{background-color:rgba(38,166,154,0.25)}.clockpicker-dial{-webkit-transition:-webkit-transform 350ms, opacity 350ms;-webkit-transition:opacity 350ms, -webkit-transform 350ms;transition:opacity 350ms, -webkit-transform 350ms;transition:transform 350ms, opacity 350ms;transition:transform 350ms, opacity 350ms, -webkit-transform 350ms}.clockpicker-dial-out{opacity:0}.clockpicker-hours.clockpicker-dial-out{-webkit-transform:scale(1.2, 1.2);transform:scale(1.2, 1.2)}.clockpicker-minutes.clockpicker-dial-out{-webkit-transform:scale(0.8, 0.8);transform:scale(0.8, 0.8)}.clockpicker-canvas{-webkit-transition:opacity 175ms;transition:opacity 175ms}.clockpicker-canvas-out{opacity:0.25}.clockpicker-canvas-bearing{stroke:none;fill:#26a69a}.clockpicker-canvas-bg{stroke:none;fill:#26a69a}.clockpicker-canvas-bg-trans{fill:#26a69a}.clockpicker-canvas line{stroke:#26a69a;stroke-width:4;stroke-linecap:round} diff --git a/src/main/webapp/fonts/roboto/Roboto-Bold.woff b/src/main/webapp/fonts/roboto/Roboto-Bold.woff new file mode 100644 index 0000000..c55d1e7 Binary files /dev/null and b/src/main/webapp/fonts/roboto/Roboto-Bold.woff differ diff --git a/src/main/webapp/fonts/roboto/Roboto-Bold.woff2 b/src/main/webapp/fonts/roboto/Roboto-Bold.woff2 new file mode 100644 index 0000000..ab12197 Binary files /dev/null and b/src/main/webapp/fonts/roboto/Roboto-Bold.woff2 differ diff --git a/src/main/webapp/fonts/roboto/Roboto-Light.woff b/src/main/webapp/fonts/roboto/Roboto-Light.woff new file mode 100644 index 0000000..3f9e8c5 Binary files /dev/null and b/src/main/webapp/fonts/roboto/Roboto-Light.woff differ diff --git a/src/main/webapp/fonts/roboto/Roboto-Light.woff2 b/src/main/webapp/fonts/roboto/Roboto-Light.woff2 new file mode 100644 index 0000000..0707d9a Binary files /dev/null and b/src/main/webapp/fonts/roboto/Roboto-Light.woff2 differ diff --git a/src/main/webapp/fonts/roboto/Roboto-Medium.woff b/src/main/webapp/fonts/roboto/Roboto-Medium.woff new file mode 100644 index 0000000..ced7907 Binary files /dev/null and b/src/main/webapp/fonts/roboto/Roboto-Medium.woff differ diff --git a/src/main/webapp/fonts/roboto/Roboto-Medium.woff2 b/src/main/webapp/fonts/roboto/Roboto-Medium.woff2 new file mode 100644 index 0000000..723a323 Binary files /dev/null and b/src/main/webapp/fonts/roboto/Roboto-Medium.woff2 differ diff --git a/src/main/webapp/fonts/roboto/Roboto-Regular.woff b/src/main/webapp/fonts/roboto/Roboto-Regular.woff new file mode 100644 index 0000000..e401bcf Binary files /dev/null and b/src/main/webapp/fonts/roboto/Roboto-Regular.woff differ diff --git a/src/main/webapp/fonts/roboto/Roboto-Regular.woff2 b/src/main/webapp/fonts/roboto/Roboto-Regular.woff2 new file mode 100644 index 0000000..5bd7bd6 Binary files /dev/null and b/src/main/webapp/fonts/roboto/Roboto-Regular.woff2 differ diff --git a/src/main/webapp/fonts/roboto/Roboto-Thin.woff b/src/main/webapp/fonts/roboto/Roboto-Thin.woff new file mode 100644 index 0000000..175d076 Binary files /dev/null and b/src/main/webapp/fonts/roboto/Roboto-Thin.woff differ diff --git a/src/main/webapp/fonts/roboto/Roboto-Thin.woff2 b/src/main/webapp/fonts/roboto/Roboto-Thin.woff2 new file mode 100644 index 0000000..2917239 Binary files /dev/null and b/src/main/webapp/fonts/roboto/Roboto-Thin.woff2 differ diff --git a/src/main/webapp/img/nlphub-logo-2.png b/src/main/webapp/img/nlphub-logo-2.png new file mode 100644 index 0000000..c0a9ccd Binary files /dev/null and b/src/main/webapp/img/nlphub-logo-2.png differ diff --git a/src/main/webapp/img/nlphub-logo-2.svg b/src/main/webapp/img/nlphub-logo-2.svg new file mode 100644 index 0000000..f909d92 --- /dev/null +++ b/src/main/webapp/img/nlphub-logo-2.svg @@ -0,0 +1,154 @@ + + + + + + + + + + + + + + + + + + image/svg+xml + + + + + + + + + + + + + + + + + + + + + Natural Language Processing + + + diff --git a/src/main/webapp/img/nlphub-logo-3.png b/src/main/webapp/img/nlphub-logo-3.png new file mode 100644 index 0000000..d8846d8 Binary files /dev/null and b/src/main/webapp/img/nlphub-logo-3.png differ diff --git a/src/main/webapp/img/nlphub-logo.png b/src/main/webapp/img/nlphub-logo.png new file mode 100644 index 0000000..42fc2ad Binary files /dev/null and b/src/main/webapp/img/nlphub-logo.png differ diff --git a/src/main/webapp/img/nlphub-logo.svg b/src/main/webapp/img/nlphub-logo.svg new file mode 100644 index 0000000..e7a5f72 --- /dev/null +++ b/src/main/webapp/img/nlphub-logo.svg @@ -0,0 +1,101 @@ + + + + + + + + + + image/svg+xml + + + + + + + + + + + + + + + + + + + diff --git a/src/main/webapp/img/upload.png b/src/main/webapp/img/upload.png new file mode 100644 index 0000000..5dd4658 Binary files /dev/null and b/src/main/webapp/img/upload.png differ diff --git a/src/main/webapp/index.jsp b/src/main/webapp/index.jsp new file mode 100644 index 0000000..ad7235d --- /dev/null +++ b/src/main/webapp/index.jsp @@ -0,0 +1,454 @@ + + + + + + +NLPHub v1.2 + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+ + +
+

Name Entity Recognition

+
+ Language selection +
+
+
+

Select the desired + language:

+
+
+ +
+
+
+
+ +
+ Input text +
+
+
+

Use the button to upload a text file or drag and drop a file in the upload area; or paste a text in + the text area.

+
+
+
+ +
Upload text file
+
+
+
+
+ +
+
+
+ + +
+ Annotations (mark annotation you want to use) +
+ +
+
+
+ + + +
+ + Execute +
+
+ +
+				
+
+
+ + +
+ + +
+ + + \ No newline at end of file diff --git a/src/main/webapp/js/jquery.simple.websocket.min.js b/src/main/webapp/js/jquery.simple.websocket.min.js new file mode 100644 index 0000000..51019ea --- /dev/null +++ b/src/main/webapp/js/jquery.simple.websocket.min.js @@ -0,0 +1 @@ +!function(a){"object"==typeof module&&"object"==typeof module.exports?module.exports=a(jQuery):a(jQuery)}(function(a){var b=function(b){if(this._opt=null,!this._isNotEmpty(b,"url"))throw new Error("Missing argument, example usage: $.simpleWebSocket({ url: 'ws://127.0.0.1:3000' }); ");this._opt=b,this._ws=null,this._reConnectTries=60,this._reConnectDeferred=null,this._dataType=this._prop(this._opt,"dataType","json"),this._listeners=[];var c=this;return this._api=function(){return{connect:function(){return a.extend(c._api,c._reConnect.apply(c,[]))},isConnected:function(a){return a?(a.apply(this,[c._isConnected.apply(c,[])]),c._api):c._isConnected.apply(c,[])},send:function(b){return a.extend(c._api,c._send.apply(c,[b]))},listen:function(b){return a.extend(c._api,c._listenReconnect.apply(c,[b]))},remove:function(a){return c._remove.apply(c,[a]),c._api},removeAll:function(){return c._removeAll.apply(c,[]),c._api},close:function(){return c._close.apply(c,[]),c._reset.apply(c,[]),c._api}}}(),this._api};return b.prototype={_createWebSocket:function(a){var b;if(!(b=a.protocols?void 0!==window.MozWebSocket?new MozWebSocket(a.url,a.protocols):window.WebSocket?new WebSocket(a.url,a.protocols):null:void 0!==window.MozWebSocket?new MozWebSocket(a.url):window.WebSocket?new WebSocket(a.url):null))throw new Error("Error, websocket could not be initialized.");return b},_bindSocketEvents:function(b,c){var d=this;a(b).bind("open",c.open).bind("close",c.close).bind("message",function(a){try{if(d._dataType&&"json"===d._dataType.toLowerCase()){var b=JSON.parse(a.originalEvent.data);c[a.type].call(this,b)}else if(d._dataType&&"xml"===d._dataType.toLowerCase()){var e=new DOMParser,f=e.parseFromString(a.originalEvent.data,"text/xml");c[a.type].call(this,f)}else c[a.type]&&c[a.type].call(this,a.originalEvent.data)}catch(b){c[a.type]&&c[a.type].call(this,a.originalEvent.data)}}).bind("error",function(a){c.error&&c.error.call(this,a)})},_webSocket:function(a){var b=this._createWebSocket(a);return this._bindSocketEvents(b,a),b},_getSocketEventHandler:function(a){var b=this;return{open:function(b){var c=this;a&&a.resolve(c)},close:function(b){a&&a.rejectWith(b)},message:function(a){for(var c=0,d=b._listeners.length;c0?window.setTimeout(function(){a._reConnect.apply(a,[])},a._prop.apply(a,[a._opt,"timeout",1e4])):a._reConnectDeferred.rejectWith.apply(a,[b])})},_reConnect:function(){var a=this;return this._reConnectDeferred&&"pending"===this._reConnectDeferred.state()||this._reset(),this._ws&&1===this._ws.readyState?this._reConnectDeferred.resolve(this._ws):this._reConnectTry(),a._reConnectDeferred.promise.apply(a,[])},_preparePayload:function(a){return this._opt.dataType&&"text"===this._opt.dataType.toLowerCase()?a:this._opt.dataType&&"xml"===this._opt.dataType.toLowerCase()?a:(this._opt.dataType&&this._opt.dataType.toLowerCase(),JSON.stringify(a))},_send:function(b){var c=this,d=a.Deferred();return function(a){c._reConnect.apply(c,[]).done(function(b){b.send(a),d.resolve.apply(c,[c._api])}).fail(function(a){d.rejectWith.apply(c,[a])})}(this._preparePayload(b)),d.promise()},_indexOfListener:function(a){for(var b=0,c=this._listeners.length;b").get(0).files,a.formdata=void 0!==window.FormData,e.fn.uploadFile=function(t){function r(){D||(D=!0,function e(){if(w.sequential||(w.sequentialCount=99999),0==x.length&&0==F.length)w.afterUploadAll&&w.afterUploadAll(C),D=!1;else{if(F.length1?t.showError&&e("
"+t.multiDragErrorStr+"
").appendTo(a.errorLog):0!=t.onSelect(o)&&l(t,a,o)}),r.on("dragleave",function(a){e(this).removeClass(t.dragDropHoverClass)}),e(document).on("dragenter",function(e){e.stopPropagation(),e.preventDefault()}),e(document).on("dragover",function(a){a.stopPropagation(),a.preventDefault();var r=e(this);r.hasClass(t.dragDropContainerClass)||r.removeClass(t.dragDropHoverClass)}),e(document).on("drop",function(a){a.stopPropagation(),a.preventDefault(),e(this).removeClass(t.dragDropHoverClass)})}function s(e){var a=e/1024;return parseInt(a)>1024?(a/1024).toFixed(2)+" MB":a.toFixed(2)+" KB"}function i(a){var t,r,o=[],s=(o="string"==jQuery.type(a)?a.split("&"):e.param(a).split("&")).length,i=[];for(t=0;ta.maxFileSize)a.showError&&e("
"+r[o].name+" "+a.sizeErrorStr+s(a.maxFileSize)+"
").appendTo(t.errorLog);else if(-1!=a.maxFileCount&&t.selectedFiles>=a.maxFileCount)a.showError&&e("
"+r[o].name+" "+a.maxFileCountErrorStr+a.maxFileCount+"
").appendTo(t.errorLog);else{t.selectedFiles++,t.existingFileNames.push(r[o].name);var l=e.extend({},a),u=new FormData,p=a.fileName.replace("[]","");u.append(p,r[o]);var c=a.formData;if(c)for(var h=i(c),f=0;f");C.appendTo("body");var b=[];b.push(r[o].name),v(C,l,w,b,t,r[o]),t.fileCounter++}else a.showError&&e("
"+r[o].name+" "+a.duplicateErrorStr+"
").appendTo(t.errorLog);else a.showError&&e("
"+r[o].name+" "+a.extErrorStr+a.allowedTypes+"
").appendTo(t.errorLog)}function n(e,a,t){var r=a.allowedTypes.toLowerCase().split(/[\s,]+/g),o=t.split(".").pop().toLowerCase();return!("*"!=a.allowedTypes&&jQuery.inArray(o,r)<0)}function d(e,a){var t=!1;if(e.existingFileNames.length)for(var r=0;r"),u="";o.multiple&&(o.fileName.indexOf("[]")!=o.fileName.length-2&&(o.fileName+="[]"),u="");var p=e(u).appendTo(d);p.change(function(){t.errorLog.html("");o.allowedTypes.toLowerCase().split(",");var i=[];if(this.files){for(g=0;g"+u+" "+o.extErrorStr+o.allowedTypes+"").appendTo(t.errorLog));if(p.push({name:u,size:"NA"}),0==o.onSelect(p))return}if(c(o,t),s.unbind("click"),d.hide(),h(t,r,o,s),d.addClass(r),o.serialize&&a.fileapi&&a.formdata){d.removeClass(r);var f=this.files;d.remove(),l(o,t,f)}else{for(var w="",g=0;g":w+=i[g]+"
",t.fileCounter++;if(-1!=o.maxFileCount&&t.selectedFiles+i.length>o.maxFileCount)return void(o.showError&&e("
"+w+" "+o.maxFileCountErrorStr+o.maxFileCount+"
").appendTo(t.errorLog));t.selectedFiles+=i.length;var C=new m(t,o);C.filename.html(w),v(d,o,C,i,t,null)}}),o.nestedForms?(d.css({margin:0,padding:0}),s.css({position:"relative",overflow:"hidden",cursor:"default"}),p.css({position:"absolute",cursor:"pointer",top:"0px",width:"100%",height:"100%",left:"0px","z-index":"100",opacity:"0.0",filter:"alpha(opacity=0)","-ms-filter":"alpha(opacity=0)","-khtml-opacity":"0.0","-moz-opacity":"0.0"}),d.appendTo(s)):(d.appendTo(e("body")),d.css({margin:0,padding:0,display:"block",position:"absolute",left:"-250px"}),-1!=navigator.appVersion.indexOf("MSIE ")?s.attr("for",i):s.click(function(){p.click()}))}function f(a,t){return this.statusbar=e("
").width(t.statusBarWidth),this.preview=e("").width(t.previewWidth).height(t.previewHeight).appendTo(this.statusbar).hide(),this.filename=e("
").appendTo(this.statusbar),this.progressDiv=e("
").appendTo(this.statusbar).hide(),this.progressbar=e("
").appendTo(this.progressDiv),this.abort=e("
"+t.abortStr+"
").appendTo(this.statusbar).hide(),this.cancel=e("
"+t.cancelStr+"
").appendTo(this.statusbar).hide(),this.done=e("
"+t.doneStr+"
").appendTo(this.statusbar).hide(),this.download=e("
"+t.downloadStr+"
").appendTo(this.statusbar).hide(),this.del=e("
"+t.deleteStr+"
").appendTo(this.statusbar).hide(),this.abort.addClass("ajax-file-upload-red"),this.done.addClass("ajax-file-upload-green"),this.download.addClass("ajax-file-upload-green"),this.cancel.addClass("ajax-file-upload-red"),this.del.addClass("ajax-file-upload-red"),this}function m(a,t){var r=null;return(r=t.customProgressBar?new t.customProgressBar(a,t):new f(a,t)).abort.addClass(a.formGroup),r.abort.addClass(t.abortButtonClass),r.cancel.addClass(a.formGroup),r.cancel.addClass(t.cancelButtonClass),t.extraHTML&&(r.extraHTML=e("
"+t.extraHTML()+"
").insertAfter(r.filename)),"bottom"==t.uploadQueueOrder?e(a.container).append(r.statusbar):e(a.container).prepend(r.statusbar),r}function v(t,o,s,l,n,d){var h={cache:!1,contentType:!1,processData:!1,forceSync:!1,type:o.method,data:o.formData,formData:o.fileData,dataType:o.returnType,headers:o.headers,beforeSubmit:function(a,r,d){if(0!=o.onSubmit.call(this,l)){if(o.dynamicFormData){var p=i(o.dynamicFormData());if(p)for(var h=0;h"+o.uploadErrorStr+"
"),s.cancel.show(),t.remove(),s.cancel.click(function(){x.splice(x.indexOf(t),1),u(n,l),s.statusbar.remove(),o.onCancel.call(n,l,s),n.selectedFiles-=l.length,c(o,n)}),!1},beforeSend:function(e,t){for(var r in t.headers)e.setRequestHeader(r,t.headers[r]);s.progressDiv.show(),s.cancel.hide(),s.done.hide(),o.showAbort&&(s.abort.show(),s.abort.click(function(){u(n,l),e.abort(),n.selectedFiles-=l.length,o.onAbort.call(n,l,s)})),a.formdata?s.progressbar.width("1%"):s.progressbar.width("5%")},uploadProgress:function(e,a,t,r){r>98&&(r=98);var i=r+"%";r>1&&s.progressbar.width(i),o.showProgress&&(s.progressbar.html(i),s.progressbar.css("text-align","center"))},success:function(a,r,i){if(s.cancel.remove(),F.pop(),"json"==o.returnType&&"object"==e.type(a)&&a.hasOwnProperty(o.customErrorKeyStr)){s.abort.hide();var d=a[o.customErrorKeyStr];return o.onError.call(this,l,200,d,s),o.showStatusAfterError?(s.progressDiv.hide(),s.statusbar.append("ERROR: "+d+"")):(s.statusbar.hide(),s.statusbar.remove()),n.selectedFiles-=l.length,void t.remove()}n.responses.push(a),s.progressbar.width("100%"),o.showProgress&&(s.progressbar.html("100%"),s.progressbar.css("text-align","center")),s.abort.hide(),o.onSuccess.call(this,l,a,i,s),o.showStatusAfterSuccess?(o.showDone?(s.done.show(),s.done.click(function(){s.statusbar.hide("slow"),s.statusbar.remove()})):s.done.hide(),o.showDelete?(s.del.show(),s.del.click(function(){u(n,l),s.statusbar.hide().remove(),o.deleteCallback&&o.deleteCallback.call(this,a,s),n.selectedFiles-=l.length,c(o,n)})):s.del.hide()):(s.statusbar.hide("slow"),s.statusbar.remove()),o.showDownload&&(s.download.show(),s.download.click(function(){o.downloadCallback&&o.downloadCallback(a,s)})),t.remove()},error:function(e,a,r){s.cancel.remove(),F.pop(),s.abort.hide(),"abort"==e.statusText?(s.statusbar.hide("slow").remove(),c(o,n)):(o.onError.call(this,l,a,r,s),o.showStatusAfterError?(s.progressDiv.hide(),s.statusbar.append("ERROR: "+r+"")):(s.statusbar.hide(),s.statusbar.remove()),n.selectedFiles-=l.length),t.remove()}};o.showPreview&&null!=d&&"image"==d.type.toLowerCase().split("/").shift()&&p(d,s.preview),o.autoSubmit?(t.ajaxForm(h),x.push(t),r()):(o.showCancel&&(s.cancel.show(),s.cancel.click(function(){x.splice(x.indexOf(t),1),u(n,l),t.remove(),s.statusbar.remove(),o.onCancel.call(n,l,s),n.selectedFiles-=l.length,c(o,n)})),t.ajaxForm(h))}var w=e.extend({url:"",method:"POST",enctype:"multipart/form-data",returnType:null,allowDuplicates:!0,duplicateStrict:!1,allowedTypes:"*",acceptFiles:"*",fileName:"file",formData:!1,dynamicFormData:!1,maxFileSize:-1,maxFileCount:-1,multiple:!0,dragDrop:!0,autoSubmit:!0,showCancel:!0,showAbort:!0,showDone:!1,showDelete:!1,showError:!0,showStatusAfterSuccess:!0,showStatusAfterError:!0,showFileCounter:!0,fileCounterStyle:"). ",showFileSize:!0,showProgress:!1,nestedForms:!0,showDownload:!1,onLoad:function(e){},onSelect:function(e){return!0},onSubmit:function(e,a){},onSuccess:function(e,a,t,r){},onError:function(e,a,t,r){},onCancel:function(e,a){},onAbort:function(e,a){},downloadCallback:!1,deleteCallback:!1,afterUploadAll:!1,serialize:!0,sequential:!1,sequentialCount:2,customProgressBar:!1,abortButtonClass:"ajax-file-upload-abort",cancelButtonClass:"ajax-file-upload-cancel",dragDropContainerClass:"ajax-upload-dragdrop",dragDropHoverClass:"state-hover",errorClass:"ajax-file-upload-error",uploadButtonClass:"ajax-file-upload",dragDropStr:"Drag & Drop Files",uploadStr:"Upload",abortStr:"Abort",cancelStr:"Cancel",deleteStr:"Delete",doneStr:"Done",multiDragErrorStr:"Multiple File Drag & Drop is not allowed.",extErrorStr:"is not allowed. Allowed extensions: ",duplicateErrorStr:"is not allowed. File already exists.",sizeErrorStr:"is not allowed. Allowed Max size: ",uploadErrorStr:"Upload is not allowed",maxFileCountErrorStr:" is not allowed. Maximum allowed files are:",downloadStr:"Download",customErrorKeyStr:"jquery-upload-file-error",showQueueDiv:!1,statusBarWidth:400,dragdropWidth:400,showPreview:!1,previewHeight:"auto",previewWidth:"100%",extraHTML:!1,uploadQueueOrder:"top",headers:{}},t);this.fileCounter=1,this.selectedFiles=0;var g="ajax-file-upload-"+(new Date).getTime();this.formGroup=g,this.errorLog=e("
"),this.responses=[],this.existingFileNames=[],a.formdata||(w.dragDrop=!1),a.formdata&&1!==w.maxFileCount||(w.multiple=!1),e(this).html("");var C=this,b=e("
"+w.uploadStr+"
");e(b).addClass(w.uploadButtonClass),function a(){if(e.fn.ajaxForm){if(w.dragDrop){var t=e('
').width(w.dragdropWidth);e(C).append(t),e(t).append(b),e(t).append(e(w.dragDropStr)),o(C,w,t)}else e(C).append(b);e(C).append(C.errorLog),w.showQueueDiv?C.container=e("#"+w.showQueueDiv):C.container=e("
").insertAfter(e(C)),w.onLoad.call(this,C),h(C,g,w,b)}else window.setTimeout(a,10)}(),this.startUpload=function(){e("form").each(function(a,t){e(this).hasClass(C.formGroup)&&x.push(e(this))}),x.length>=1&&r()},this.getFileCount=function(){return C.selectedFiles},this.stopUpload=function(){e("."+w.abortButtonClass).each(function(a,t){e(this).hasClass(C.formGroup)&&e(this).click()}),e("."+w.cancelButtonClass).each(function(a,t){e(this).hasClass(C.formGroup)&&e(this).click()})},this.cancelAll=function(){e("."+w.cancelButtonClass).each(function(a,t){e(this).hasClass(C.formGroup)&&e(this).click()})},this.update=function(a){w=e.extend(w,a),a.hasOwnProperty("url")&&e("form").each(function(t,r){e(this).attr("action",a.url)})},this.enqueueFile=function(e){e instanceof File&&l(w,C,[e])},this.reset=function(e){C.fileCounter=1,C.selectedFiles=0,C.errorLog.html(""),0!=e&&C.container.html("")},this.remove=function(){C.container.html(""),e(C).remove()},this.createProgress=function(e,a,t){var r=new m(this,w);r.progressDiv.show(),r.progressbar.width("100%");var o="";return o=w.showFileCounter?C.fileCounter+w.fileCounterStyle+e:e,w.showFileSize&&(o+=" ("+s(t)+")"),r.filename.html(o),C.fileCounter++,C.selectedFiles++,w.showPreview&&(r.preview.attr("src",a),r.preview.show()),w.showDownload&&(r.download.show(),r.download.click(function(){w.downloadCallback&&w.downloadCallback.call(C,[e],r)})),w.showDelete&&(r.del.show(),r.del.click(function(){r.statusbar.hide().remove();var a=[e];w.deleteCallback&&w.deleteCallback.call(this,a,r),C.selectedFiles-=1,c(w,C)})),r},this.getResponses=function(){return this.responses};var x=[],F=[],D=!1;return this}}(jQuery); \ No newline at end of file diff --git a/src/main/webapp/js/main.js b/src/main/webapp/js/main.js new file mode 100644 index 0000000..c2f485a --- /dev/null +++ b/src/main/webapp/js/main.js @@ -0,0 +1,156 @@ +$(document).ready(function(){ + +// $("#upload-button").uploadFile({ +// url : "uploader.php", +// fileName : "myfile", +// maxFileCount : 100, +// multiple : false, +// maxFileSize : 1024 * 1000 * 1, +// showFileCounter : false, +// showCancel : true, +// allowedTypes : "txt", +// //dragDropStr : "", +// doneStr : "Done", +// abortStr : "End", +// cancelStr : "Cancel", +// extErrorStr : "Only text file (.txt), please", +// sizeErrorStr : "Max size: 1 Mb", +// onLoad : function(obj) { +// //resizeTutor(); +// }, +// onSuccess : function(files, data, xhr) { +// alert("Success"); +// /*$(".ajax-file-upload-statusbar") +// .hide(); +// $(".obfuscating").css('opacity', '0.6'); +// $(".obfuscating").show(); +// $("#uploadedimg").attr("src", "images/" + uName + "/" + files[0]); +// source = $("#uploadedimg").attr("src"); +// window.setTimeout(function(){ sizePopupUpload(); $("#popup-1-section").show();}, 500);*/ +// }, +// onError : function(files, status, +// errMsg, pd) { +// alert(errMsg); +// } +// }); + + + $( "#execute-button" ).click(function() { + var firstnameBox = $.trim( $('#input-textarea').val() ) + if (firstnameBox == "") { + $('#input-textarea').css("border-color","red"); + $('#input-textarea').attr("placeholder", "Paste your text here!"); + } + else { + $('#input-textarea').css("border-color","#555"); + doStartComputation(); + } + }); + + doCallback = function(uri) { + $.ajax({ + url : "nlphub-servlet", + type : 'GET', + datatype : 'json', + data : { + uri : uri + }, + success : function(data) { + var obj = eval("(" + data + ")"); + var str = JSON.stringify(obj, undefined, 4); + $('#result').html(syntaxHighlight(str)); + } + }); + } + + doStartComputation = function() { + var options = "default"; + options = $("input[type=checkbox]:checked").map( + function () {return this.value;}).get().join("|"); + $('#result').html(""); + //var token2Send = getUrlParameter("token") == null ? "" : getUrlParameter("token"); + var tokenParam = getUrlParameter("token"); + var token2Send = ((tokenParam == null) || (tokenParam.length == 0)) ? "18fed2d9-030b-4c77-93af-af2015d945f7-843339462" : getUrlParameter("token"); + + webSocket.send({ + 'action': 'start', + 'text' : $("#input-textarea").val(), + 'options' : options, + 'token' : token2Send + }).done(function() { + showProgressBar(true); + enableCommands(false); + }).fail(function(e) { + console.log("failed"); + }); + } + + doHandleResponse = function(message) { + if (message.response == "error") { + $('#result').html(""+message.value+""); + enableCommands(true); + showProgressBar(false); + } + else if (message.response == "computing") { + showProgressBar(true); + enableCommands(false); + } + else if (message.response == "computed") { + showProgressBar(false); + enableCommands(true); + console.log("message="+message.value); + if (message.value.startsWith("http")) { + $('#downloadLink').html("Result: Download " + + "View"); + } + } + } +}); + +function showProgressBar(show) { + var display = (show) ? "visible" : "hidden"; + $('#progressBar').css('visibility', display); +} + +function enableCommands(enable) { + if (enable) { + $('#execute-button').removeAttr("disabled"); + $('#execute-button').text('Execute'); + $('input[type=checkbox]').removeAttr("disabled"); + } else { + $('#execute-button').text('Computing ...'); + $('input[type=checkbox]').attr('disabled', 'true'); + $('#execute-button').attr('disabled', 'disabled'); + $('#downloadLink').html(""); + } +} + +function syntaxHighlight(json) { + if (typeof json != 'string') { + json = JSON.stringify(json, undefined, 1); + } + json = json.replace(/&/g, '&').replace(//g, '>'); + return json.replace(/("(\\u[a-zA-Z0-9]{4}|\\[^u]|[^\\"])*"(\s*:)?|\b(true|false|null)\b|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?)/g, function (match) { + var cls = 'number'; + if (/^"/.test(match)) { + if (/:$/.test(match)) { + cls = 'key'; + } else { + cls = 'string'; + } + } else if (/true|false/.test(match)) { + cls = 'boolean'; + } else if (/null/.test(match)) { + cls = 'null'; + } + return '' + match + ''; + + }); +} + +function getUrlParameter(name) { + name = name.replace(/[\[]/, '\\[').replace(/[\]]/, '\\]'); + var regex = new RegExp('[\\?&]' + name + '=([^&#]*)'); + var results = regex.exec(location.search); + return results === null ? '' : decodeURIComponent(results[1].replace(/\+/g, ' ')); +}; \ No newline at end of file diff --git a/src/main/webapp/js/materialize.js b/src/main/webapp/js/materialize.js new file mode 100644 index 0000000..10df8db --- /dev/null +++ b/src/main/webapp/js/materialize.js @@ -0,0 +1,10021 @@ +/*! + * Materialize v0.100.2 (http://materializecss.com) + * Copyright 2014-2017 Materialize + * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE) + */ +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +// Check for jQuery. +if (typeof jQuery === 'undefined') { + // Check if require is a defined function. + if (typeof require === 'function') { + jQuery = $ = require('jquery'); + // Else use the dollar sign alias. + } else { + jQuery = $; + } +} +; /* + * jQuery Easing v1.4.0 - http://gsgd.co.uk/sandbox/jquery/easing/ + * Open source under the BSD License. + * Copyright © 2008 George McGinley Smith + * All rights reserved. + * https://raw.github.com/gdsmith/jquery-easing/master/LICENSE + */ + +(function (factory) { + if (typeof define === "function" && define.amd) { + define(['jquery'], function ($) { + return factory($); + }); + } else if (typeof module === "object" && typeof module.exports === "object") { + exports = factory(require('jquery')); + } else { + factory(jQuery); + } +})(function ($) { + + // Preserve the original jQuery "swing" easing as "jswing" + $.easing['jswing'] = $.easing['swing']; + + var pow = Math.pow, + sqrt = Math.sqrt, + sin = Math.sin, + cos = Math.cos, + PI = Math.PI, + c1 = 1.70158, + c2 = c1 * 1.525, + c3 = c1 + 1, + c4 = 2 * PI / 3, + c5 = 2 * PI / 4.5; + + // x is the fraction of animation progress, in the range 0..1 + function bounceOut(x) { + var n1 = 7.5625, + d1 = 2.75; + if (x < 1 / d1) { + return n1 * x * x; + } else if (x < 2 / d1) { + return n1 * (x -= 1.5 / d1) * x + .75; + } else if (x < 2.5 / d1) { + return n1 * (x -= 2.25 / d1) * x + .9375; + } else { + return n1 * (x -= 2.625 / d1) * x + .984375; + } + } + + $.extend($.easing, { + def: 'easeOutQuad', + swing: function (x) { + return $.easing[$.easing.def](x); + }, + easeInQuad: function (x) { + return x * x; + }, + easeOutQuad: function (x) { + return 1 - (1 - x) * (1 - x); + }, + easeInOutQuad: function (x) { + return x < 0.5 ? 2 * x * x : 1 - pow(-2 * x + 2, 2) / 2; + }, + easeInCubic: function (x) { + return x * x * x; + }, + easeOutCubic: function (x) { + return 1 - pow(1 - x, 3); + }, + easeInOutCubic: function (x) { + return x < 0.5 ? 4 * x * x * x : 1 - pow(-2 * x + 2, 3) / 2; + }, + easeInQuart: function (x) { + return x * x * x * x; + }, + easeOutQuart: function (x) { + return 1 - pow(1 - x, 4); + }, + easeInOutQuart: function (x) { + return x < 0.5 ? 8 * x * x * x * x : 1 - pow(-2 * x + 2, 4) / 2; + }, + easeInQuint: function (x) { + return x * x * x * x * x; + }, + easeOutQuint: function (x) { + return 1 - pow(1 - x, 5); + }, + easeInOutQuint: function (x) { + return x < 0.5 ? 16 * x * x * x * x * x : 1 - pow(-2 * x + 2, 5) / 2; + }, + easeInSine: function (x) { + return 1 - cos(x * PI / 2); + }, + easeOutSine: function (x) { + return sin(x * PI / 2); + }, + easeInOutSine: function (x) { + return -(cos(PI * x) - 1) / 2; + }, + easeInExpo: function (x) { + return x === 0 ? 0 : pow(2, 10 * x - 10); + }, + easeOutExpo: function (x) { + return x === 1 ? 1 : 1 - pow(2, -10 * x); + }, + easeInOutExpo: function (x) { + return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? pow(2, 20 * x - 10) / 2 : (2 - pow(2, -20 * x + 10)) / 2; + }, + easeInCirc: function (x) { + return 1 - sqrt(1 - pow(x, 2)); + }, + easeOutCirc: function (x) { + return sqrt(1 - pow(x - 1, 2)); + }, + easeInOutCirc: function (x) { + return x < 0.5 ? (1 - sqrt(1 - pow(2 * x, 2))) / 2 : (sqrt(1 - pow(-2 * x + 2, 2)) + 1) / 2; + }, + easeInElastic: function (x) { + return x === 0 ? 0 : x === 1 ? 1 : -pow(2, 10 * x - 10) * sin((x * 10 - 10.75) * c4); + }, + easeOutElastic: function (x) { + return x === 0 ? 0 : x === 1 ? 1 : pow(2, -10 * x) * sin((x * 10 - 0.75) * c4) + 1; + }, + easeInOutElastic: function (x) { + return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? -(pow(2, 20 * x - 10) * sin((20 * x - 11.125) * c5)) / 2 : pow(2, -20 * x + 10) * sin((20 * x - 11.125) * c5) / 2 + 1; + }, + easeInBack: function (x) { + return c3 * x * x * x - c1 * x * x; + }, + easeOutBack: function (x) { + return 1 + c3 * pow(x - 1, 3) + c1 * pow(x - 1, 2); + }, + easeInOutBack: function (x) { + return x < 0.5 ? pow(2 * x, 2) * ((c2 + 1) * 2 * x - c2) / 2 : (pow(2 * x - 2, 2) * ((c2 + 1) * (x * 2 - 2) + c2) + 2) / 2; + }, + easeInBounce: function (x) { + return 1 - bounceOut(1 - x); + }, + easeOutBounce: bounceOut, + easeInOutBounce: function (x) { + return x < 0.5 ? (1 - bounceOut(1 - 2 * x)) / 2 : (1 + bounceOut(2 * x - 1)) / 2; + } + }); +});; // Custom Easing +jQuery.extend(jQuery.easing, { + easeInOutMaterial: function (x, t, b, c, d) { + if ((t /= d / 2) < 1) return c / 2 * t * t + b; + return c / 4 * ((t -= 2) * t * t + 2) + b; + } +});; /*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */ +/*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */ +/*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */ +jQuery.Velocity ? console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity.") : (!function (e) { + function t(e) { + var t = e.length, + a = r.type(e);return "function" === a || r.isWindow(e) ? !1 : 1 === e.nodeType && t ? !0 : "array" === a || 0 === t || "number" == typeof t && t > 0 && t - 1 in e; + }if (!e.jQuery) { + var r = function (e, t) { + return new r.fn.init(e, t); + };r.isWindow = function (e) { + return null != e && e == e.window; + }, r.type = function (e) { + return null == e ? e + "" : "object" == typeof e || "function" == typeof e ? n[i.call(e)] || "object" : typeof e; + }, r.isArray = Array.isArray || function (e) { + return "array" === r.type(e); + }, r.isPlainObject = function (e) { + var t;if (!e || "object" !== r.type(e) || e.nodeType || r.isWindow(e)) return !1;try { + if (e.constructor && !o.call(e, "constructor") && !o.call(e.constructor.prototype, "isPrototypeOf")) return !1; + } catch (a) { + return !1; + }for (t in e) {}return void 0 === t || o.call(e, t); + }, r.each = function (e, r, a) { + var n, + o = 0, + i = e.length, + s = t(e);if (a) { + if (s) for (; i > o && (n = r.apply(e[o], a), n !== !1); o++) {} else for (o in e) { + if (n = r.apply(e[o], a), n === !1) break; + } + } else if (s) for (; i > o && (n = r.call(e[o], o, e[o]), n !== !1); o++) {} else for (o in e) { + if (n = r.call(e[o], o, e[o]), n === !1) break; + }return e; + }, r.data = function (e, t, n) { + if (void 0 === n) { + var o = e[r.expando], + i = o && a[o];if (void 0 === t) return i;if (i && t in i) return i[t]; + } else if (void 0 !== t) { + var o = e[r.expando] || (e[r.expando] = ++r.uuid);return a[o] = a[o] || {}, a[o][t] = n, n; + } + }, r.removeData = function (e, t) { + var n = e[r.expando], + o = n && a[n];o && r.each(t, function (e, t) { + delete o[t]; + }); + }, r.extend = function () { + var e, + t, + a, + n, + o, + i, + s = arguments[0] || {}, + l = 1, + u = arguments.length, + c = !1;for ("boolean" == typeof s && (c = s, s = arguments[l] || {}, l++), "object" != typeof s && "function" !== r.type(s) && (s = {}), l === u && (s = this, l--); u > l; l++) { + if (null != (o = arguments[l])) for (n in o) { + e = s[n], a = o[n], s !== a && (c && a && (r.isPlainObject(a) || (t = r.isArray(a))) ? (t ? (t = !1, i = e && r.isArray(e) ? e : []) : i = e && r.isPlainObject(e) ? e : {}, s[n] = r.extend(c, i, a)) : void 0 !== a && (s[n] = a)); + } + }return s; + }, r.queue = function (e, a, n) { + function o(e, r) { + var a = r || [];return null != e && (t(Object(e)) ? !function (e, t) { + for (var r = +t.length, a = 0, n = e.length; r > a;) { + e[n++] = t[a++]; + }if (r !== r) for (; void 0 !== t[a];) { + e[n++] = t[a++]; + }return e.length = n, e; + }(a, "string" == typeof e ? [e] : e) : [].push.call(a, e)), a; + }if (e) { + a = (a || "fx") + "queue";var i = r.data(e, a);return n ? (!i || r.isArray(n) ? i = r.data(e, a, o(n)) : i.push(n), i) : i || []; + } + }, r.dequeue = function (e, t) { + r.each(e.nodeType ? [e] : e, function (e, a) { + t = t || "fx";var n = r.queue(a, t), + o = n.shift();"inprogress" === o && (o = n.shift()), o && ("fx" === t && n.unshift("inprogress"), o.call(a, function () { + r.dequeue(a, t); + })); + }); + }, r.fn = r.prototype = { init: function (e) { + if (e.nodeType) return this[0] = e, this;throw new Error("Not a DOM node."); + }, offset: function () { + var t = this[0].getBoundingClientRect ? this[0].getBoundingClientRect() : { top: 0, left: 0 };return { top: t.top + (e.pageYOffset || document.scrollTop || 0) - (document.clientTop || 0), left: t.left + (e.pageXOffset || document.scrollLeft || 0) - (document.clientLeft || 0) }; + }, position: function () { + function e() { + for (var e = this.offsetParent || document; e && "html" === !e.nodeType.toLowerCase && "static" === e.style.position;) { + e = e.offsetParent; + }return e || document; + }var t = this[0], + e = e.apply(t), + a = this.offset(), + n = /^(?:body|html)$/i.test(e.nodeName) ? { top: 0, left: 0 } : r(e).offset();return a.top -= parseFloat(t.style.marginTop) || 0, a.left -= parseFloat(t.style.marginLeft) || 0, e.style && (n.top += parseFloat(e.style.borderTopWidth) || 0, n.left += parseFloat(e.style.borderLeftWidth) || 0), { top: a.top - n.top, left: a.left - n.left }; + } };var a = {};r.expando = "velocity" + new Date().getTime(), r.uuid = 0;for (var n = {}, o = n.hasOwnProperty, i = n.toString, s = "Boolean Number String Function Array Date RegExp Object Error".split(" "), l = 0; l < s.length; l++) { + n["[object " + s[l] + "]"] = s[l].toLowerCase(); + }r.fn.init.prototype = r.fn, e.Velocity = { Utilities: r }; + } +}(window), function (e) { + "object" == typeof module && "object" == typeof module.exports ? module.exports = e() : "function" == typeof define && define.amd ? define(e) : e(); +}(function () { + return function (e, t, r, a) { + function n(e) { + for (var t = -1, r = e ? e.length : 0, a = []; ++t < r;) { + var n = e[t];n && a.push(n); + }return a; + }function o(e) { + return m.isWrapped(e) ? e = [].slice.call(e) : m.isNode(e) && (e = [e]), e; + }function i(e) { + var t = f.data(e, "velocity");return null === t ? a : t; + }function s(e) { + return function (t) { + return Math.round(t * e) * (1 / e); + }; + }function l(e, r, a, n) { + function o(e, t) { + return 1 - 3 * t + 3 * e; + }function i(e, t) { + return 3 * t - 6 * e; + }function s(e) { + return 3 * e; + }function l(e, t, r) { + return ((o(t, r) * e + i(t, r)) * e + s(t)) * e; + }function u(e, t, r) { + return 3 * o(t, r) * e * e + 2 * i(t, r) * e + s(t); + }function c(t, r) { + for (var n = 0; m > n; ++n) { + var o = u(r, e, a);if (0 === o) return r;var i = l(r, e, a) - t;r -= i / o; + }return r; + }function p() { + for (var t = 0; b > t; ++t) { + w[t] = l(t * x, e, a); + } + }function f(t, r, n) { + var o, + i, + s = 0;do { + i = r + (n - r) / 2, o = l(i, e, a) - t, o > 0 ? n = i : r = i; + } while (Math.abs(o) > h && ++s < v);return i; + }function d(t) { + for (var r = 0, n = 1, o = b - 1; n != o && w[n] <= t; ++n) { + r += x; + }--n;var i = (t - w[n]) / (w[n + 1] - w[n]), + s = r + i * x, + l = u(s, e, a);return l >= y ? c(t, s) : 0 == l ? s : f(t, r, r + x); + }function g() { + V = !0, (e != r || a != n) && p(); + }var m = 4, + y = .001, + h = 1e-7, + v = 10, + b = 11, + x = 1 / (b - 1), + S = "Float32Array" in t;if (4 !== arguments.length) return !1;for (var P = 0; 4 > P; ++P) { + if ("number" != typeof arguments[P] || isNaN(arguments[P]) || !isFinite(arguments[P])) return !1; + }e = Math.min(e, 1), a = Math.min(a, 1), e = Math.max(e, 0), a = Math.max(a, 0);var w = S ? new Float32Array(b) : new Array(b), + V = !1, + C = function (t) { + return V || g(), e === r && a === n ? t : 0 === t ? 0 : 1 === t ? 1 : l(d(t), r, n); + };C.getControlPoints = function () { + return [{ x: e, y: r }, { x: a, y: n }]; + };var T = "generateBezier(" + [e, r, a, n] + ")";return C.toString = function () { + return T; + }, C; + }function u(e, t) { + var r = e;return m.isString(e) ? b.Easings[e] || (r = !1) : r = m.isArray(e) && 1 === e.length ? s.apply(null, e) : m.isArray(e) && 2 === e.length ? x.apply(null, e.concat([t])) : m.isArray(e) && 4 === e.length ? l.apply(null, e) : !1, r === !1 && (r = b.Easings[b.defaults.easing] ? b.defaults.easing : v), r; + }function c(e) { + if (e) { + var t = new Date().getTime(), + r = b.State.calls.length;r > 1e4 && (b.State.calls = n(b.State.calls));for (var o = 0; r > o; o++) { + if (b.State.calls[o]) { + var s = b.State.calls[o], + l = s[0], + u = s[2], + d = s[3], + g = !!d, + y = null;d || (d = b.State.calls[o][3] = t - 16);for (var h = Math.min((t - d) / u.duration, 1), v = 0, x = l.length; x > v; v++) { + var P = l[v], + V = P.element;if (i(V)) { + var C = !1;if (u.display !== a && null !== u.display && "none" !== u.display) { + if ("flex" === u.display) { + var T = ["-webkit-box", "-moz-box", "-ms-flexbox", "-webkit-flex"];f.each(T, function (e, t) { + S.setPropertyValue(V, "display", t); + }); + }S.setPropertyValue(V, "display", u.display); + }u.visibility !== a && "hidden" !== u.visibility && S.setPropertyValue(V, "visibility", u.visibility);for (var k in P) { + if ("element" !== k) { + var A, + F = P[k], + j = m.isString(F.easing) ? b.Easings[F.easing] : F.easing;if (1 === h) A = F.endValue;else { + var E = F.endValue - F.startValue;if (A = F.startValue + E * j(h, u, E), !g && A === F.currentValue) continue; + }if (F.currentValue = A, "tween" === k) y = A;else { + if (S.Hooks.registered[k]) { + var H = S.Hooks.getRoot(k), + N = i(V).rootPropertyValueCache[H];N && (F.rootPropertyValue = N); + }var L = S.setPropertyValue(V, k, F.currentValue + (0 === parseFloat(A) ? "" : F.unitType), F.rootPropertyValue, F.scrollData);S.Hooks.registered[k] && (i(V).rootPropertyValueCache[H] = S.Normalizations.registered[H] ? S.Normalizations.registered[H]("extract", null, L[1]) : L[1]), "transform" === L[0] && (C = !0); + } + } + }u.mobileHA && i(V).transformCache.translate3d === a && (i(V).transformCache.translate3d = "(0px, 0px, 0px)", C = !0), C && S.flushTransformCache(V); + } + }u.display !== a && "none" !== u.display && (b.State.calls[o][2].display = !1), u.visibility !== a && "hidden" !== u.visibility && (b.State.calls[o][2].visibility = !1), u.progress && u.progress.call(s[1], s[1], h, Math.max(0, d + u.duration - t), d, y), 1 === h && p(o); + } + } + }b.State.isTicking && w(c); + }function p(e, t) { + if (!b.State.calls[e]) return !1;for (var r = b.State.calls[e][0], n = b.State.calls[e][1], o = b.State.calls[e][2], s = b.State.calls[e][4], l = !1, u = 0, c = r.length; c > u; u++) { + var p = r[u].element;if (t || o.loop || ("none" === o.display && S.setPropertyValue(p, "display", o.display), "hidden" === o.visibility && S.setPropertyValue(p, "visibility", o.visibility)), o.loop !== !0 && (f.queue(p)[1] === a || !/\.velocityQueueEntryFlag/i.test(f.queue(p)[1])) && i(p)) { + i(p).isAnimating = !1, i(p).rootPropertyValueCache = {};var d = !1;f.each(S.Lists.transforms3D, function (e, t) { + var r = /^scale/.test(t) ? 1 : 0, + n = i(p).transformCache[t];i(p).transformCache[t] !== a && new RegExp("^\\(" + r + "[^.]").test(n) && (d = !0, delete i(p).transformCache[t]); + }), o.mobileHA && (d = !0, delete i(p).transformCache.translate3d), d && S.flushTransformCache(p), S.Values.removeClass(p, "velocity-animating"); + }if (!t && o.complete && !o.loop && u === c - 1) try { + o.complete.call(n, n); + } catch (g) { + setTimeout(function () { + throw g; + }, 1); + }s && o.loop !== !0 && s(n), i(p) && o.loop === !0 && !t && (f.each(i(p).tweensContainer, function (e, t) { + /^rotate/.test(e) && 360 === parseFloat(t.endValue) && (t.endValue = 0, t.startValue = 360), /^backgroundPosition/.test(e) && 100 === parseFloat(t.endValue) && "%" === t.unitType && (t.endValue = 0, t.startValue = 100); + }), b(p, "reverse", { loop: !0, delay: o.delay })), o.queue !== !1 && f.dequeue(p, o.queue); + }b.State.calls[e] = !1;for (var m = 0, y = b.State.calls.length; y > m; m++) { + if (b.State.calls[m] !== !1) { + l = !0;break; + } + }l === !1 && (b.State.isTicking = !1, delete b.State.calls, b.State.calls = []); + }var f, + d = function () { + if (r.documentMode) return r.documentMode;for (var e = 7; e > 4; e--) { + var t = r.createElement("div");if (t.innerHTML = "", t.getElementsByTagName("span").length) return t = null, e; + }return a; + }(), + g = function () { + var e = 0;return t.webkitRequestAnimationFrame || t.mozRequestAnimationFrame || function (t) { + var r, + a = new Date().getTime();return r = Math.max(0, 16 - (a - e)), e = a + r, setTimeout(function () { + t(a + r); + }, r); + }; + }(), + m = { isString: function (e) { + return "string" == typeof e; + }, isArray: Array.isArray || function (e) { + return "[object Array]" === Object.prototype.toString.call(e); + }, isFunction: function (e) { + return "[object Function]" === Object.prototype.toString.call(e); + }, isNode: function (e) { + return e && e.nodeType; + }, isNodeList: function (e) { + return "object" == typeof e && /^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e)) && e.length !== a && (0 === e.length || "object" == typeof e[0] && e[0].nodeType > 0); + }, isWrapped: function (e) { + return e && (e.jquery || t.Zepto && t.Zepto.zepto.isZ(e)); + }, isSVG: function (e) { + return t.SVGElement && e instanceof t.SVGElement; + }, isEmptyObject: function (e) { + for (var t in e) { + return !1; + }return !0; + } }, + y = !1;if (e.fn && e.fn.jquery ? (f = e, y = !0) : f = t.Velocity.Utilities, 8 >= d && !y) throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if (7 >= d) return void (jQuery.fn.velocity = jQuery.fn.animate);var h = 400, + v = "swing", + b = { State: { isMobile: /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent), isAndroid: /Android/i.test(navigator.userAgent), isGingerbread: /Android 2\.3\.[3-7]/i.test(navigator.userAgent), isChrome: t.chrome, isFirefox: /Firefox/i.test(navigator.userAgent), prefixElement: r.createElement("div"), prefixMatches: {}, scrollAnchor: null, scrollPropertyLeft: null, scrollPropertyTop: null, isTicking: !1, calls: [] }, CSS: {}, Utilities: f, Redirects: {}, Easings: {}, Promise: t.Promise, defaults: { queue: "", duration: h, easing: v, begin: a, complete: a, progress: a, display: a, visibility: a, loop: !1, delay: !1, mobileHA: !0, _cacheValues: !0 }, init: function (e) { + f.data(e, "velocity", { isSVG: m.isSVG(e), isAnimating: !1, computedStyle: null, tweensContainer: null, rootPropertyValueCache: {}, transformCache: {} }); + }, hook: null, mock: !1, version: { major: 1, minor: 2, patch: 2 }, debug: !1 };t.pageYOffset !== a ? (b.State.scrollAnchor = t, b.State.scrollPropertyLeft = "pageXOffset", b.State.scrollPropertyTop = "pageYOffset") : (b.State.scrollAnchor = r.documentElement || r.body.parentNode || r.body, b.State.scrollPropertyLeft = "scrollLeft", b.State.scrollPropertyTop = "scrollTop");var x = function () { + function e(e) { + return -e.tension * e.x - e.friction * e.v; + }function t(t, r, a) { + var n = { x: t.x + a.dx * r, v: t.v + a.dv * r, tension: t.tension, friction: t.friction };return { dx: n.v, dv: e(n) }; + }function r(r, a) { + var n = { dx: r.v, dv: e(r) }, + o = t(r, .5 * a, n), + i = t(r, .5 * a, o), + s = t(r, a, i), + l = 1 / 6 * (n.dx + 2 * (o.dx + i.dx) + s.dx), + u = 1 / 6 * (n.dv + 2 * (o.dv + i.dv) + s.dv);return r.x = r.x + l * a, r.v = r.v + u * a, r; + }return function a(e, t, n) { + var o, + i, + s, + l = { x: -1, v: 0, tension: null, friction: null }, + u = [0], + c = 0, + p = 1e-4, + f = .016;for (e = parseFloat(e) || 500, t = parseFloat(t) || 20, n = n || null, l.tension = e, l.friction = t, o = null !== n, o ? (c = a(e, t), i = c / n * f) : i = f; s = r(s || l, i), u.push(1 + s.x), c += 16, Math.abs(s.x) > p && Math.abs(s.v) > p;) {}return o ? function (e) { + return u[e * (u.length - 1) | 0]; + } : c; + }; + }();b.Easings = { linear: function (e) { + return e; + }, swing: function (e) { + return .5 - Math.cos(e * Math.PI) / 2; + }, spring: function (e) { + return 1 - Math.cos(4.5 * e * Math.PI) * Math.exp(6 * -e); + } }, f.each([["ease", [.25, .1, .25, 1]], ["ease-in", [.42, 0, 1, 1]], ["ease-out", [0, 0, .58, 1]], ["ease-in-out", [.42, 0, .58, 1]], ["easeInSine", [.47, 0, .745, .715]], ["easeOutSine", [.39, .575, .565, 1]], ["easeInOutSine", [.445, .05, .55, .95]], ["easeInQuad", [.55, .085, .68, .53]], ["easeOutQuad", [.25, .46, .45, .94]], ["easeInOutQuad", [.455, .03, .515, .955]], ["easeInCubic", [.55, .055, .675, .19]], ["easeOutCubic", [.215, .61, .355, 1]], ["easeInOutCubic", [.645, .045, .355, 1]], ["easeInQuart", [.895, .03, .685, .22]], ["easeOutQuart", [.165, .84, .44, 1]], ["easeInOutQuart", [.77, 0, .175, 1]], ["easeInQuint", [.755, .05, .855, .06]], ["easeOutQuint", [.23, 1, .32, 1]], ["easeInOutQuint", [.86, 0, .07, 1]], ["easeInExpo", [.95, .05, .795, .035]], ["easeOutExpo", [.19, 1, .22, 1]], ["easeInOutExpo", [1, 0, 0, 1]], ["easeInCirc", [.6, .04, .98, .335]], ["easeOutCirc", [.075, .82, .165, 1]], ["easeInOutCirc", [.785, .135, .15, .86]]], function (e, t) { + b.Easings[t[0]] = l.apply(null, t[1]); + });var S = b.CSS = { RegEx: { isHex: /^#([A-f\d]{3}){1,2}$/i, valueUnwrap: /^[A-z]+\((.*)\)$/i, wrappedValueAlreadyExtracted: /[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/, valueSplit: /([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi }, Lists: { colors: ["fill", "stroke", "stopColor", "color", "backgroundColor", "borderColor", "borderTopColor", "borderRightColor", "borderBottomColor", "borderLeftColor", "outlineColor"], transformsBase: ["translateX", "translateY", "scale", "scaleX", "scaleY", "skewX", "skewY", "rotateZ"], transforms3D: ["transformPerspective", "translateZ", "scaleZ", "rotateX", "rotateY"] }, Hooks: { templates: { textShadow: ["Color X Y Blur", "black 0px 0px 0px"], boxShadow: ["Color X Y Blur Spread", "black 0px 0px 0px 0px"], clip: ["Top Right Bottom Left", "0px 0px 0px 0px"], backgroundPosition: ["X Y", "0% 0%"], transformOrigin: ["X Y Z", "50% 50% 0px"], perspectiveOrigin: ["X Y", "50% 50%"] }, registered: {}, register: function () { + for (var e = 0; e < S.Lists.colors.length; e++) { + var t = "color" === S.Lists.colors[e] ? "0 0 0 1" : "255 255 255 1";S.Hooks.templates[S.Lists.colors[e]] = ["Red Green Blue Alpha", t]; + }var r, a, n;if (d) for (r in S.Hooks.templates) { + a = S.Hooks.templates[r], n = a[0].split(" ");var o = a[1].match(S.RegEx.valueSplit);"Color" === n[0] && (n.push(n.shift()), o.push(o.shift()), S.Hooks.templates[r] = [n.join(" "), o.join(" ")]); + }for (r in S.Hooks.templates) { + a = S.Hooks.templates[r], n = a[0].split(" ");for (var e in n) { + var i = r + n[e], + s = e;S.Hooks.registered[i] = [r, s]; + } + } + }, getRoot: function (e) { + var t = S.Hooks.registered[e];return t ? t[0] : e; + }, cleanRootPropertyValue: function (e, t) { + return S.RegEx.valueUnwrap.test(t) && (t = t.match(S.RegEx.valueUnwrap)[1]), S.Values.isCSSNullValue(t) && (t = S.Hooks.templates[e][1]), t; + }, extractValue: function (e, t) { + var r = S.Hooks.registered[e];if (r) { + var a = r[0], + n = r[1];return t = S.Hooks.cleanRootPropertyValue(a, t), t.toString().match(S.RegEx.valueSplit)[n]; + }return t; + }, injectValue: function (e, t, r) { + var a = S.Hooks.registered[e];if (a) { + var n, + o, + i = a[0], + s = a[1];return r = S.Hooks.cleanRootPropertyValue(i, r), n = r.toString().match(S.RegEx.valueSplit), n[s] = t, o = n.join(" "); + }return r; + } }, Normalizations: { registered: { clip: function (e, t, r) { + switch (e) {case "name": + return "clip";case "extract": + var a;return S.RegEx.wrappedValueAlreadyExtracted.test(r) ? a = r : (a = r.toString().match(S.RegEx.valueUnwrap), a = a ? a[1].replace(/,(\s+)?/g, " ") : r), a;case "inject": + return "rect(" + r + ")";} + }, blur: function (e, t, r) { + switch (e) {case "name": + return b.State.isFirefox ? "filter" : "-webkit-filter";case "extract": + var a = parseFloat(r);if (!a && 0 !== a) { + var n = r.toString().match(/blur\(([0-9]+[A-z]+)\)/i);a = n ? n[1] : 0; + }return a;case "inject": + return parseFloat(r) ? "blur(" + r + ")" : "none";} + }, opacity: function (e, t, r) { + if (8 >= d) switch (e) {case "name": + return "filter";case "extract": + var a = r.toString().match(/alpha\(opacity=(.*)\)/i);return r = a ? a[1] / 100 : 1;case "inject": + return t.style.zoom = 1, parseFloat(r) >= 1 ? "" : "alpha(opacity=" + parseInt(100 * parseFloat(r), 10) + ")";} else switch (e) {case "name": + return "opacity";case "extract": + return r;case "inject": + return r;} + } }, register: function () { + 9 >= d || b.State.isGingerbread || (S.Lists.transformsBase = S.Lists.transformsBase.concat(S.Lists.transforms3D));for (var e = 0; e < S.Lists.transformsBase.length; e++) { + !function () { + var t = S.Lists.transformsBase[e];S.Normalizations.registered[t] = function (e, r, n) { + switch (e) {case "name": + return "transform";case "extract": + return i(r) === a || i(r).transformCache[t] === a ? /^scale/i.test(t) ? 1 : 0 : i(r).transformCache[t].replace(/[()]/g, "");case "inject": + var o = !1;switch (t.substr(0, t.length - 1)) {case "translate": + o = !/(%|px|em|rem|vw|vh|\d)$/i.test(n);break;case "scal":case "scale": + b.State.isAndroid && i(r).transformCache[t] === a && 1 > n && (n = 1), o = !/(\d)$/i.test(n);break;case "skew": + o = !/(deg|\d)$/i.test(n);break;case "rotate": + o = !/(deg|\d)$/i.test(n);}return o || (i(r).transformCache[t] = "(" + n + ")"), i(r).transformCache[t];} + }; + }(); + }for (var e = 0; e < S.Lists.colors.length; e++) { + !function () { + var t = S.Lists.colors[e];S.Normalizations.registered[t] = function (e, r, n) { + switch (e) {case "name": + return t;case "extract": + var o;if (S.RegEx.wrappedValueAlreadyExtracted.test(n)) o = n;else { + var i, + s = { black: "rgb(0, 0, 0)", blue: "rgb(0, 0, 255)", gray: "rgb(128, 128, 128)", green: "rgb(0, 128, 0)", red: "rgb(255, 0, 0)", white: "rgb(255, 255, 255)" };/^[A-z]+$/i.test(n) ? i = s[n] !== a ? s[n] : s.black : S.RegEx.isHex.test(n) ? i = "rgb(" + S.Values.hexToRgb(n).join(" ") + ")" : /^rgba?\(/i.test(n) || (i = s.black), o = (i || n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g, " "); + }return 8 >= d || 3 !== o.split(" ").length || (o += " 1"), o;case "inject": + return 8 >= d ? 4 === n.split(" ").length && (n = n.split(/\s+/).slice(0, 3).join(" ")) : 3 === n.split(" ").length && (n += " 1"), (8 >= d ? "rgb" : "rgba") + "(" + n.replace(/\s+/g, ",").replace(/\.(\d)+(?=,)/g, "") + ")";} + }; + }(); + } + } }, Names: { camelCase: function (e) { + return e.replace(/-(\w)/g, function (e, t) { + return t.toUpperCase(); + }); + }, SVGAttribute: function (e) { + var t = "width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return (d || b.State.isAndroid && !b.State.isChrome) && (t += "|transform"), new RegExp("^(" + t + ")$", "i").test(e); + }, prefixCheck: function (e) { + if (b.State.prefixMatches[e]) return [b.State.prefixMatches[e], !0];for (var t = ["", "Webkit", "Moz", "ms", "O"], r = 0, a = t.length; a > r; r++) { + var n;if (n = 0 === r ? e : t[r] + e.replace(/^\w/, function (e) { + return e.toUpperCase(); + }), m.isString(b.State.prefixElement.style[n])) return b.State.prefixMatches[e] = n, [n, !0]; + }return [e, !1]; + } }, Values: { hexToRgb: function (e) { + var t, + r = /^#?([a-f\d])([a-f\d])([a-f\d])$/i, + a = /^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return e = e.replace(r, function (e, t, r, a) { + return t + t + r + r + a + a; + }), t = a.exec(e), t ? [parseInt(t[1], 16), parseInt(t[2], 16), parseInt(t[3], 16)] : [0, 0, 0]; + }, isCSSNullValue: function (e) { + return 0 == e || /^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e); + }, getUnitType: function (e) { + return (/^(rotate|skew)/i.test(e) ? "deg" : /(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e) ? "" : "px" + ); + }, getDisplayType: function (e) { + var t = e && e.tagName.toString().toLowerCase();return (/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t) ? "inline" : /^(li)$/i.test(t) ? "list-item" : /^(tr)$/i.test(t) ? "table-row" : /^(table)$/i.test(t) ? "table" : /^(tbody)$/i.test(t) ? "table-row-group" : "block" + ); + }, addClass: function (e, t) { + e.classList ? e.classList.add(t) : e.className += (e.className.length ? " " : "") + t; + }, removeClass: function (e, t) { + e.classList ? e.classList.remove(t) : e.className = e.className.toString().replace(new RegExp("(^|\\s)" + t.split(" ").join("|") + "(\\s|$)", "gi"), " "); + } }, getPropertyValue: function (e, r, n, o) { + function s(e, r) { + function n() { + u && S.setPropertyValue(e, "display", "none"); + }var l = 0;if (8 >= d) l = f.css(e, r);else { + var u = !1;if (/^(width|height)$/.test(r) && 0 === S.getPropertyValue(e, "display") && (u = !0, S.setPropertyValue(e, "display", S.Values.getDisplayType(e))), !o) { + if ("height" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) { + var c = e.offsetHeight - (parseFloat(S.getPropertyValue(e, "borderTopWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderBottomWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingTop")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingBottom")) || 0);return n(), c; + }if ("width" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) { + var p = e.offsetWidth - (parseFloat(S.getPropertyValue(e, "borderLeftWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderRightWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingLeft")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingRight")) || 0);return n(), p; + } + }var g;g = i(e) === a ? t.getComputedStyle(e, null) : i(e).computedStyle ? i(e).computedStyle : i(e).computedStyle = t.getComputedStyle(e, null), "borderColor" === r && (r = "borderTopColor"), l = 9 === d && "filter" === r ? g.getPropertyValue(r) : g[r], ("" === l || null === l) && (l = e.style[r]), n(); + }if ("auto" === l && /^(top|right|bottom|left)$/i.test(r)) { + var m = s(e, "position");("fixed" === m || "absolute" === m && /top|left/i.test(r)) && (l = f(e).position()[r] + "px"); + }return l; + }var l;if (S.Hooks.registered[r]) { + var u = r, + c = S.Hooks.getRoot(u);n === a && (n = S.getPropertyValue(e, S.Names.prefixCheck(c)[0])), S.Normalizations.registered[c] && (n = S.Normalizations.registered[c]("extract", e, n)), l = S.Hooks.extractValue(u, n); + } else if (S.Normalizations.registered[r]) { + var p, g;p = S.Normalizations.registered[r]("name", e), "transform" !== p && (g = s(e, S.Names.prefixCheck(p)[0]), S.Values.isCSSNullValue(g) && S.Hooks.templates[r] && (g = S.Hooks.templates[r][1])), l = S.Normalizations.registered[r]("extract", e, g); + }if (!/^[\d-]/.test(l)) if (i(e) && i(e).isSVG && S.Names.SVGAttribute(r)) { + if (/^(height|width)$/i.test(r)) try { + l = e.getBBox()[r]; + } catch (m) { + l = 0; + } else l = e.getAttribute(r); + } else l = s(e, S.Names.prefixCheck(r)[0]);return S.Values.isCSSNullValue(l) && (l = 0), b.debug >= 2 && console.log("Get " + r + ": " + l), l; + }, setPropertyValue: function (e, r, a, n, o) { + var s = r;if ("scroll" === r) o.container ? o.container["scroll" + o.direction] = a : "Left" === o.direction ? t.scrollTo(a, o.alternateValue) : t.scrollTo(o.alternateValue, a);else if (S.Normalizations.registered[r] && "transform" === S.Normalizations.registered[r]("name", e)) S.Normalizations.registered[r]("inject", e, a), s = "transform", a = i(e).transformCache[r];else { + if (S.Hooks.registered[r]) { + var l = r, + u = S.Hooks.getRoot(r);n = n || S.getPropertyValue(e, u), a = S.Hooks.injectValue(l, a, n), r = u; + }if (S.Normalizations.registered[r] && (a = S.Normalizations.registered[r]("inject", e, a), r = S.Normalizations.registered[r]("name", e)), s = S.Names.prefixCheck(r)[0], 8 >= d) try { + e.style[s] = a; + } catch (c) { + b.debug && console.log("Browser does not support [" + a + "] for [" + s + "]"); + } else i(e) && i(e).isSVG && S.Names.SVGAttribute(r) ? e.setAttribute(r, a) : e.style[s] = a;b.debug >= 2 && console.log("Set " + r + " (" + s + "): " + a); + }return [s, a]; + }, flushTransformCache: function (e) { + function t(t) { + return parseFloat(S.getPropertyValue(e, t)); + }var r = "";if ((d || b.State.isAndroid && !b.State.isChrome) && i(e).isSVG) { + var a = { translate: [t("translateX"), t("translateY")], skewX: [t("skewX")], skewY: [t("skewY")], scale: 1 !== t("scale") ? [t("scale"), t("scale")] : [t("scaleX"), t("scaleY")], rotate: [t("rotateZ"), 0, 0] };f.each(i(e).transformCache, function (e) { + /^translate/i.test(e) ? e = "translate" : /^scale/i.test(e) ? e = "scale" : /^rotate/i.test(e) && (e = "rotate"), a[e] && (r += e + "(" + a[e].join(" ") + ") ", delete a[e]); + }); + } else { + var n, o;f.each(i(e).transformCache, function (t) { + return n = i(e).transformCache[t], "transformPerspective" === t ? (o = n, !0) : (9 === d && "rotateZ" === t && (t = "rotate"), void (r += t + n + " ")); + }), o && (r = "perspective" + o + " " + r); + }S.setPropertyValue(e, "transform", r); + } };S.Hooks.register(), S.Normalizations.register(), b.hook = function (e, t, r) { + var n = a;return e = o(e), f.each(e, function (e, o) { + if (i(o) === a && b.init(o), r === a) n === a && (n = b.CSS.getPropertyValue(o, t));else { + var s = b.CSS.setPropertyValue(o, t, r);"transform" === s[0] && b.CSS.flushTransformCache(o), n = s; + } + }), n; + };var P = function () { + function e() { + return s ? k.promise || null : l; + }function n() { + function e(e) { + function p(e, t) { + var r = a, + n = a, + i = a;return m.isArray(e) ? (r = e[0], !m.isArray(e[1]) && /^[\d-]/.test(e[1]) || m.isFunction(e[1]) || S.RegEx.isHex.test(e[1]) ? i = e[1] : (m.isString(e[1]) && !S.RegEx.isHex.test(e[1]) || m.isArray(e[1])) && (n = t ? e[1] : u(e[1], s.duration), e[2] !== a && (i = e[2]))) : r = e, t || (n = n || s.easing), m.isFunction(r) && (r = r.call(o, V, w)), m.isFunction(i) && (i = i.call(o, V, w)), [r || 0, n, i]; + }function d(e, t) { + var r, a;return a = (t || "0").toString().toLowerCase().replace(/[%A-z]+$/, function (e) { + return r = e, ""; + }), r || (r = S.Values.getUnitType(e)), [a, r]; + }function h() { + var e = { myParent: o.parentNode || r.body, position: S.getPropertyValue(o, "position"), fontSize: S.getPropertyValue(o, "fontSize") }, + a = e.position === L.lastPosition && e.myParent === L.lastParent, + n = e.fontSize === L.lastFontSize;L.lastParent = e.myParent, L.lastPosition = e.position, L.lastFontSize = e.fontSize;var s = 100, + l = {};if (n && a) l.emToPx = L.lastEmToPx, l.percentToPxWidth = L.lastPercentToPxWidth, l.percentToPxHeight = L.lastPercentToPxHeight;else { + var u = i(o).isSVG ? r.createElementNS("http://www.w3.org/2000/svg", "rect") : r.createElement("div");b.init(u), e.myParent.appendChild(u), f.each(["overflow", "overflowX", "overflowY"], function (e, t) { + b.CSS.setPropertyValue(u, t, "hidden"); + }), b.CSS.setPropertyValue(u, "position", e.position), b.CSS.setPropertyValue(u, "fontSize", e.fontSize), b.CSS.setPropertyValue(u, "boxSizing", "content-box"), f.each(["minWidth", "maxWidth", "width", "minHeight", "maxHeight", "height"], function (e, t) { + b.CSS.setPropertyValue(u, t, s + "%"); + }), b.CSS.setPropertyValue(u, "paddingLeft", s + "em"), l.percentToPxWidth = L.lastPercentToPxWidth = (parseFloat(S.getPropertyValue(u, "width", null, !0)) || 1) / s, l.percentToPxHeight = L.lastPercentToPxHeight = (parseFloat(S.getPropertyValue(u, "height", null, !0)) || 1) / s, l.emToPx = L.lastEmToPx = (parseFloat(S.getPropertyValue(u, "paddingLeft")) || 1) / s, e.myParent.removeChild(u); + }return null === L.remToPx && (L.remToPx = parseFloat(S.getPropertyValue(r.body, "fontSize")) || 16), null === L.vwToPx && (L.vwToPx = parseFloat(t.innerWidth) / 100, L.vhToPx = parseFloat(t.innerHeight) / 100), l.remToPx = L.remToPx, l.vwToPx = L.vwToPx, l.vhToPx = L.vhToPx, b.debug >= 1 && console.log("Unit ratios: " + JSON.stringify(l), o), l; + }if (s.begin && 0 === V) try { + s.begin.call(g, g); + } catch (x) { + setTimeout(function () { + throw x; + }, 1); + }if ("scroll" === A) { + var P, + C, + T, + F = /^x$/i.test(s.axis) ? "Left" : "Top", + j = parseFloat(s.offset) || 0;s.container ? m.isWrapped(s.container) || m.isNode(s.container) ? (s.container = s.container[0] || s.container, P = s.container["scroll" + F], T = P + f(o).position()[F.toLowerCase()] + j) : s.container = null : (P = b.State.scrollAnchor[b.State["scrollProperty" + F]], C = b.State.scrollAnchor[b.State["scrollProperty" + ("Left" === F ? "Top" : "Left")]], T = f(o).offset()[F.toLowerCase()] + j), l = { scroll: { rootPropertyValue: !1, startValue: P, currentValue: P, endValue: T, unitType: "", easing: s.easing, scrollData: { container: s.container, direction: F, alternateValue: C } }, element: o }, b.debug && console.log("tweensContainer (scroll): ", l.scroll, o); + } else if ("reverse" === A) { + if (!i(o).tweensContainer) return void f.dequeue(o, s.queue);"none" === i(o).opts.display && (i(o).opts.display = "auto"), "hidden" === i(o).opts.visibility && (i(o).opts.visibility = "visible"), i(o).opts.loop = !1, i(o).opts.begin = null, i(o).opts.complete = null, v.easing || delete s.easing, v.duration || delete s.duration, s = f.extend({}, i(o).opts, s);var E = f.extend(!0, {}, i(o).tweensContainer);for (var H in E) { + if ("element" !== H) { + var N = E[H].startValue;E[H].startValue = E[H].currentValue = E[H].endValue, E[H].endValue = N, m.isEmptyObject(v) || (E[H].easing = s.easing), b.debug && console.log("reverse tweensContainer (" + H + "): " + JSON.stringify(E[H]), o); + } + }l = E; + } else if ("start" === A) { + var E;i(o).tweensContainer && i(o).isAnimating === !0 && (E = i(o).tweensContainer), f.each(y, function (e, t) { + if (RegExp("^" + S.Lists.colors.join("$|^") + "$").test(e)) { + var r = p(t, !0), + n = r[0], + o = r[1], + i = r[2];if (S.RegEx.isHex.test(n)) { + for (var s = ["Red", "Green", "Blue"], l = S.Values.hexToRgb(n), u = i ? S.Values.hexToRgb(i) : a, c = 0; c < s.length; c++) { + var f = [l[c]];o && f.push(o), u !== a && f.push(u[c]), y[e + s[c]] = f; + }delete y[e]; + } + } + });for (var z in y) { + var O = p(y[z]), + q = O[0], + $ = O[1], + M = O[2];z = S.Names.camelCase(z);var I = S.Hooks.getRoot(z), + B = !1;if (i(o).isSVG || "tween" === I || S.Names.prefixCheck(I)[1] !== !1 || S.Normalizations.registered[I] !== a) { + (s.display !== a && null !== s.display && "none" !== s.display || s.visibility !== a && "hidden" !== s.visibility) && /opacity|filter/.test(z) && !M && 0 !== q && (M = 0), s._cacheValues && E && E[z] ? (M === a && (M = E[z].endValue + E[z].unitType), B = i(o).rootPropertyValueCache[I]) : S.Hooks.registered[z] ? M === a ? (B = S.getPropertyValue(o, I), M = S.getPropertyValue(o, z, B)) : B = S.Hooks.templates[I][1] : M === a && (M = S.getPropertyValue(o, z));var W, + G, + Y, + D = !1;if (W = d(z, M), M = W[0], Y = W[1], W = d(z, q), q = W[0].replace(/^([+-\/*])=/, function (e, t) { + return D = t, ""; + }), G = W[1], M = parseFloat(M) || 0, q = parseFloat(q) || 0, "%" === G && (/^(fontSize|lineHeight)$/.test(z) ? (q /= 100, G = "em") : /^scale/.test(z) ? (q /= 100, G = "") : /(Red|Green|Blue)$/i.test(z) && (q = q / 100 * 255, G = "")), /[\/*]/.test(D)) G = Y;else if (Y !== G && 0 !== M) if (0 === q) G = Y;else { + n = n || h();var Q = /margin|padding|left|right|width|text|word|letter/i.test(z) || /X$/.test(z) || "x" === z ? "x" : "y";switch (Y) {case "%": + M *= "x" === Q ? n.percentToPxWidth : n.percentToPxHeight;break;case "px": + break;default: + M *= n[Y + "ToPx"];}switch (G) {case "%": + M *= 1 / ("x" === Q ? n.percentToPxWidth : n.percentToPxHeight);break;case "px": + break;default: + M *= 1 / n[G + "ToPx"];} + }switch (D) {case "+": + q = M + q;break;case "-": + q = M - q;break;case "*": + q = M * q;break;case "/": + q = M / q;}l[z] = { rootPropertyValue: B, startValue: M, currentValue: M, endValue: q, unitType: G, easing: $ }, b.debug && console.log("tweensContainer (" + z + "): " + JSON.stringify(l[z]), o); + } else b.debug && console.log("Skipping [" + I + "] due to a lack of browser support."); + }l.element = o; + }l.element && (S.Values.addClass(o, "velocity-animating"), R.push(l), "" === s.queue && (i(o).tweensContainer = l, i(o).opts = s), i(o).isAnimating = !0, V === w - 1 ? (b.State.calls.push([R, g, s, null, k.resolver]), b.State.isTicking === !1 && (b.State.isTicking = !0, c())) : V++); + }var n, + o = this, + s = f.extend({}, b.defaults, v), + l = {};switch (i(o) === a && b.init(o), parseFloat(s.delay) && s.queue !== !1 && f.queue(o, s.queue, function (e) { + b.velocityQueueEntryFlag = !0, i(o).delayTimer = { setTimeout: setTimeout(e, parseFloat(s.delay)), next: e }; + }), s.duration.toString().toLowerCase()) {case "fast": + s.duration = 200;break;case "normal": + s.duration = h;break;case "slow": + s.duration = 600;break;default: + s.duration = parseFloat(s.duration) || 1;}b.mock !== !1 && (b.mock === !0 ? s.duration = s.delay = 1 : (s.duration *= parseFloat(b.mock) || 1, s.delay *= parseFloat(b.mock) || 1)), s.easing = u(s.easing, s.duration), s.begin && !m.isFunction(s.begin) && (s.begin = null), s.progress && !m.isFunction(s.progress) && (s.progress = null), s.complete && !m.isFunction(s.complete) && (s.complete = null), s.display !== a && null !== s.display && (s.display = s.display.toString().toLowerCase(), "auto" === s.display && (s.display = b.CSS.Values.getDisplayType(o))), s.visibility !== a && null !== s.visibility && (s.visibility = s.visibility.toString().toLowerCase()), s.mobileHA = s.mobileHA && b.State.isMobile && !b.State.isGingerbread, s.queue === !1 ? s.delay ? setTimeout(e, s.delay) : e() : f.queue(o, s.queue, function (t, r) { + return r === !0 ? (k.promise && k.resolver(g), !0) : (b.velocityQueueEntryFlag = !0, void e(t)); + }), "" !== s.queue && "fx" !== s.queue || "inprogress" === f.queue(o)[0] || f.dequeue(o); + }var s, + l, + d, + g, + y, + v, + x = arguments[0] && (arguments[0].p || f.isPlainObject(arguments[0].properties) && !arguments[0].properties.names || m.isString(arguments[0].properties));if (m.isWrapped(this) ? (s = !1, d = 0, g = this, l = this) : (s = !0, d = 1, g = x ? arguments[0].elements || arguments[0].e : arguments[0]), g = o(g)) { + x ? (y = arguments[0].properties || arguments[0].p, v = arguments[0].options || arguments[0].o) : (y = arguments[d], v = arguments[d + 1]);var w = g.length, + V = 0;if (!/^(stop|finish)$/i.test(y) && !f.isPlainObject(v)) { + var C = d + 1;v = {};for (var T = C; T < arguments.length; T++) { + m.isArray(arguments[T]) || !/^(fast|normal|slow)$/i.test(arguments[T]) && !/^\d/.test(arguments[T]) ? m.isString(arguments[T]) || m.isArray(arguments[T]) ? v.easing = arguments[T] : m.isFunction(arguments[T]) && (v.complete = arguments[T]) : v.duration = arguments[T]; + } + }var k = { promise: null, resolver: null, rejecter: null };s && b.Promise && (k.promise = new b.Promise(function (e, t) { + k.resolver = e, k.rejecter = t; + }));var A;switch (y) {case "scroll": + A = "scroll";break;case "reverse": + A = "reverse";break;case "finish":case "stop": + f.each(g, function (e, t) { + i(t) && i(t).delayTimer && (clearTimeout(i(t).delayTimer.setTimeout), i(t).delayTimer.next && i(t).delayTimer.next(), delete i(t).delayTimer); + });var F = [];return f.each(b.State.calls, function (e, t) { + t && f.each(t[1], function (r, n) { + var o = v === a ? "" : v;return o === !0 || t[2].queue === o || v === a && t[2].queue === !1 ? void f.each(g, function (r, a) { + a === n && ((v === !0 || m.isString(v)) && (f.each(f.queue(a, m.isString(v) ? v : ""), function (e, t) { + m.isFunction(t) && t(null, !0); + }), f.queue(a, m.isString(v) ? v : "", [])), "stop" === y ? (i(a) && i(a).tweensContainer && o !== !1 && f.each(i(a).tweensContainer, function (e, t) { + t.endValue = t.currentValue; + }), F.push(e)) : "finish" === y && (t[2].duration = 1)); + }) : !0; + }); + }), "stop" === y && (f.each(F, function (e, t) { + p(t, !0); + }), k.promise && k.resolver(g)), e();default: + if (!f.isPlainObject(y) || m.isEmptyObject(y)) { + if (m.isString(y) && b.Redirects[y]) { + var j = f.extend({}, v), + E = j.duration, + H = j.delay || 0;return j.backwards === !0 && (g = f.extend(!0, [], g).reverse()), f.each(g, function (e, t) { + parseFloat(j.stagger) ? j.delay = H + parseFloat(j.stagger) * e : m.isFunction(j.stagger) && (j.delay = H + j.stagger.call(t, e, w)), j.drag && (j.duration = parseFloat(E) || (/^(callout|transition)/.test(y) ? 1e3 : h), j.duration = Math.max(j.duration * (j.backwards ? 1 - e / w : (e + 1) / w), .75 * j.duration, 200)), b.Redirects[y].call(t, t, j || {}, e, w, g, k.promise ? k : a); + }), e(); + }var N = "Velocity: First argument (" + y + ") was not a property map, a known action, or a registered redirect. Aborting.";return k.promise ? k.rejecter(new Error(N)) : console.log(N), e(); + }A = "start";}var L = { lastParent: null, lastPosition: null, lastFontSize: null, lastPercentToPxWidth: null, lastPercentToPxHeight: null, lastEmToPx: null, remToPx: null, vwToPx: null, vhToPx: null }, + R = [];f.each(g, function (e, t) { + m.isNode(t) && n.call(t); + });var z, + j = f.extend({}, b.defaults, v);if (j.loop = parseInt(j.loop), z = 2 * j.loop - 1, j.loop) for (var O = 0; z > O; O++) { + var q = { delay: j.delay, progress: j.progress };O === z - 1 && (q.display = j.display, q.visibility = j.visibility, q.complete = j.complete), P(g, "reverse", q); + }return e(); + } + };b = f.extend(P, b), b.animate = P;var w = t.requestAnimationFrame || g;return b.State.isMobile || r.hidden === a || r.addEventListener("visibilitychange", function () { + r.hidden ? (w = function (e) { + return setTimeout(function () { + e(!0); + }, 16); + }, c()) : w = t.requestAnimationFrame || g; + }), e.Velocity = b, e !== t && (e.fn.velocity = P, e.fn.velocity.defaults = b.defaults), f.each(["Down", "Up"], function (e, t) { + b.Redirects["slide" + t] = function (e, r, n, o, i, s) { + var l = f.extend({}, r), + u = l.begin, + c = l.complete, + p = { height: "", marginTop: "", marginBottom: "", paddingTop: "", paddingBottom: "" }, + d = {};l.display === a && (l.display = "Down" === t ? "inline" === b.CSS.Values.getDisplayType(e) ? "inline-block" : "block" : "none"), l.begin = function () { + u && u.call(i, i);for (var r in p) { + d[r] = e.style[r];var a = b.CSS.getPropertyValue(e, r);p[r] = "Down" === t ? [a, 0] : [0, a]; + }d.overflow = e.style.overflow, e.style.overflow = "hidden"; + }, l.complete = function () { + for (var t in d) { + e.style[t] = d[t]; + }c && c.call(i, i), s && s.resolver(i); + }, b(e, p, l); + }; + }), f.each(["In", "Out"], function (e, t) { + b.Redirects["fade" + t] = function (e, r, n, o, i, s) { + var l = f.extend({}, r), + u = { opacity: "In" === t ? 1 : 0 }, + c = l.complete;l.complete = n !== o - 1 ? l.begin = null : function () { + c && c.call(i, i), s && s.resolver(i); + }, l.display === a && (l.display = "In" === t ? "auto" : "none"), b(this, u, l); + }; + }), b; + }(window.jQuery || window.Zepto || window, window, document); +})); +;!function (a, b, c, d) { + "use strict"; + function k(a, b, c) { + return setTimeout(q(a, c), b); + }function l(a, b, c) { + return Array.isArray(a) ? (m(a, c[b], c), !0) : !1; + }function m(a, b, c) { + var e;if (a) if (a.forEach) a.forEach(b, c);else if (a.length !== d) for (e = 0; e < a.length;) { + b.call(c, a[e], e, a), e++; + } else for (e in a) { + a.hasOwnProperty(e) && b.call(c, a[e], e, a); + } + }function n(a, b, c) { + for (var e = Object.keys(b), f = 0; f < e.length;) { + (!c || c && a[e[f]] === d) && (a[e[f]] = b[e[f]]), f++; + }return a; + }function o(a, b) { + return n(a, b, !0); + }function p(a, b, c) { + var e, + d = b.prototype;e = a.prototype = Object.create(d), e.constructor = a, e._super = d, c && n(e, c); + }function q(a, b) { + return function () { + return a.apply(b, arguments); + }; + }function r(a, b) { + return typeof a == g ? a.apply(b ? b[0] || d : d, b) : a; + }function s(a, b) { + return a === d ? b : a; + }function t(a, b, c) { + m(x(b), function (b) { + a.addEventListener(b, c, !1); + }); + }function u(a, b, c) { + m(x(b), function (b) { + a.removeEventListener(b, c, !1); + }); + }function v(a, b) { + for (; a;) { + if (a == b) return !0;a = a.parentNode; + }return !1; + }function w(a, b) { + return a.indexOf(b) > -1; + }function x(a) { + return a.trim().split(/\s+/g); + }function y(a, b, c) { + if (a.indexOf && !c) return a.indexOf(b);for (var d = 0; d < a.length;) { + if (c && a[d][c] == b || !c && a[d] === b) return d;d++; + }return -1; + }function z(a) { + return Array.prototype.slice.call(a, 0); + }function A(a, b, c) { + for (var d = [], e = [], f = 0; f < a.length;) { + var g = b ? a[f][b] : a[f];y(e, g) < 0 && d.push(a[f]), e[f] = g, f++; + }return c && (d = b ? d.sort(function (a, c) { + return a[b] > c[b]; + }) : d.sort()), d; + }function B(a, b) { + for (var c, f, g = b[0].toUpperCase() + b.slice(1), h = 0; h < e.length;) { + if (c = e[h], f = c ? c + g : b, f in a) return f;h++; + }return d; + }function D() { + return C++; + }function E(a) { + var b = a.ownerDocument;return b.defaultView || b.parentWindow; + }function ab(a, b) { + var c = this;this.manager = a, this.callback = b, this.element = a.element, this.target = a.options.inputTarget, this.domHandler = function (b) { + r(a.options.enable, [a]) && c.handler(b); + }, this.init(); + }function bb(a) { + var b, + c = a.options.inputClass;return b = c ? c : H ? wb : I ? Eb : G ? Gb : rb, new b(a, cb); + }function cb(a, b, c) { + var d = c.pointers.length, + e = c.changedPointers.length, + f = b & O && 0 === d - e, + g = b & (Q | R) && 0 === d - e;c.isFirst = !!f, c.isFinal = !!g, f && (a.session = {}), c.eventType = b, db(a, c), a.emit("hammer.input", c), a.recognize(c), a.session.prevInput = c; + }function db(a, b) { + var c = a.session, + d = b.pointers, + e = d.length;c.firstInput || (c.firstInput = gb(b)), e > 1 && !c.firstMultiple ? c.firstMultiple = gb(b) : 1 === e && (c.firstMultiple = !1);var f = c.firstInput, + g = c.firstMultiple, + h = g ? g.center : f.center, + i = b.center = hb(d);b.timeStamp = j(), b.deltaTime = b.timeStamp - f.timeStamp, b.angle = lb(h, i), b.distance = kb(h, i), eb(c, b), b.offsetDirection = jb(b.deltaX, b.deltaY), b.scale = g ? nb(g.pointers, d) : 1, b.rotation = g ? mb(g.pointers, d) : 0, fb(c, b);var k = a.element;v(b.srcEvent.target, k) && (k = b.srcEvent.target), b.target = k; + }function eb(a, b) { + var c = b.center, + d = a.offsetDelta || {}, + e = a.prevDelta || {}, + f = a.prevInput || {};(b.eventType === O || f.eventType === Q) && (e = a.prevDelta = { x: f.deltaX || 0, y: f.deltaY || 0 }, d = a.offsetDelta = { x: c.x, y: c.y }), b.deltaX = e.x + (c.x - d.x), b.deltaY = e.y + (c.y - d.y); + }function fb(a, b) { + var f, + g, + h, + j, + c = a.lastInterval || b, + e = b.timeStamp - c.timeStamp;if (b.eventType != R && (e > N || c.velocity === d)) { + var k = c.deltaX - b.deltaX, + l = c.deltaY - b.deltaY, + m = ib(e, k, l);g = m.x, h = m.y, f = i(m.x) > i(m.y) ? m.x : m.y, j = jb(k, l), a.lastInterval = b; + } else f = c.velocity, g = c.velocityX, h = c.velocityY, j = c.direction;b.velocity = f, b.velocityX = g, b.velocityY = h, b.direction = j; + }function gb(a) { + for (var b = [], c = 0; c < a.pointers.length;) { + b[c] = { clientX: h(a.pointers[c].clientX), clientY: h(a.pointers[c].clientY) }, c++; + }return { timeStamp: j(), pointers: b, center: hb(b), deltaX: a.deltaX, deltaY: a.deltaY }; + }function hb(a) { + var b = a.length;if (1 === b) return { x: h(a[0].clientX), y: h(a[0].clientY) };for (var c = 0, d = 0, e = 0; b > e;) { + c += a[e].clientX, d += a[e].clientY, e++; + }return { x: h(c / b), y: h(d / b) }; + }function ib(a, b, c) { + return { x: b / a || 0, y: c / a || 0 }; + }function jb(a, b) { + return a === b ? S : i(a) >= i(b) ? a > 0 ? T : U : b > 0 ? V : W; + }function kb(a, b, c) { + c || (c = $);var d = b[c[0]] - a[c[0]], + e = b[c[1]] - a[c[1]];return Math.sqrt(d * d + e * e); + }function lb(a, b, c) { + c || (c = $);var d = b[c[0]] - a[c[0]], + e = b[c[1]] - a[c[1]];return 180 * Math.atan2(e, d) / Math.PI; + }function mb(a, b) { + return lb(b[1], b[0], _) - lb(a[1], a[0], _); + }function nb(a, b) { + return kb(b[0], b[1], _) / kb(a[0], a[1], _); + }function rb() { + this.evEl = pb, this.evWin = qb, this.allow = !0, this.pressed = !1, ab.apply(this, arguments); + }function wb() { + this.evEl = ub, this.evWin = vb, ab.apply(this, arguments), this.store = this.manager.session.pointerEvents = []; + }function Ab() { + this.evTarget = yb, this.evWin = zb, this.started = !1, ab.apply(this, arguments); + }function Bb(a, b) { + var c = z(a.touches), + d = z(a.changedTouches);return b & (Q | R) && (c = A(c.concat(d), "identifier", !0)), [c, d]; + }function Eb() { + this.evTarget = Db, this.targetIds = {}, ab.apply(this, arguments); + }function Fb(a, b) { + var c = z(a.touches), + d = this.targetIds;if (b & (O | P) && 1 === c.length) return d[c[0].identifier] = !0, [c, c];var e, + f, + g = z(a.changedTouches), + h = [], + i = this.target;if (f = c.filter(function (a) { + return v(a.target, i); + }), b === O) for (e = 0; e < f.length;) { + d[f[e].identifier] = !0, e++; + }for (e = 0; e < g.length;) { + d[g[e].identifier] && h.push(g[e]), b & (Q | R) && delete d[g[e].identifier], e++; + }return h.length ? [A(f.concat(h), "identifier", !0), h] : void 0; + }function Gb() { + ab.apply(this, arguments);var a = q(this.handler, this);this.touch = new Eb(this.manager, a), this.mouse = new rb(this.manager, a); + }function Pb(a, b) { + this.manager = a, this.set(b); + }function Qb(a) { + if (w(a, Mb)) return Mb;var b = w(a, Nb), + c = w(a, Ob);return b && c ? Nb + " " + Ob : b || c ? b ? Nb : Ob : w(a, Lb) ? Lb : Kb; + }function Yb(a) { + this.id = D(), this.manager = null, this.options = o(a || {}, this.defaults), this.options.enable = s(this.options.enable, !0), this.state = Rb, this.simultaneous = {}, this.requireFail = []; + }function Zb(a) { + return a & Wb ? "cancel" : a & Ub ? "end" : a & Tb ? "move" : a & Sb ? "start" : ""; + }function $b(a) { + return a == W ? "down" : a == V ? "up" : a == T ? "left" : a == U ? "right" : ""; + }function _b(a, b) { + var c = b.manager;return c ? c.get(a) : a; + }function ac() { + Yb.apply(this, arguments); + }function bc() { + ac.apply(this, arguments), this.pX = null, this.pY = null; + }function cc() { + ac.apply(this, arguments); + }function dc() { + Yb.apply(this, arguments), this._timer = null, this._input = null; + }function ec() { + ac.apply(this, arguments); + }function fc() { + ac.apply(this, arguments); + }function gc() { + Yb.apply(this, arguments), this.pTime = !1, this.pCenter = !1, this._timer = null, this._input = null, this.count = 0; + }function hc(a, b) { + return b = b || {}, b.recognizers = s(b.recognizers, hc.defaults.preset), new kc(a, b); + }function kc(a, b) { + b = b || {}, this.options = o(b, hc.defaults), this.options.inputTarget = this.options.inputTarget || a, this.handlers = {}, this.session = {}, this.recognizers = [], this.element = a, this.input = bb(this), this.touchAction = new Pb(this, this.options.touchAction), lc(this, !0), m(b.recognizers, function (a) { + var b = this.add(new a[0](a[1]));a[2] && b.recognizeWith(a[2]), a[3] && b.requireFailure(a[3]); + }, this); + }function lc(a, b) { + var c = a.element;m(a.options.cssProps, function (a, d) { + c.style[B(c.style, d)] = b ? a : ""; + }); + }function mc(a, c) { + var d = b.createEvent("Event");d.initEvent(a, !0, !0), d.gesture = c, c.target.dispatchEvent(d); + }var e = ["", "webkit", "moz", "MS", "ms", "o"], + f = b.createElement("div"), + g = "function", + h = Math.round, + i = Math.abs, + j = Date.now, + C = 1, + F = /mobile|tablet|ip(ad|hone|od)|android/i, + G = "ontouchstart" in a, + H = B(a, "PointerEvent") !== d, + I = G && F.test(navigator.userAgent), + J = "touch", + K = "pen", + L = "mouse", + M = "kinect", + N = 25, + O = 1, + P = 2, + Q = 4, + R = 8, + S = 1, + T = 2, + U = 4, + V = 8, + W = 16, + X = T | U, + Y = V | W, + Z = X | Y, + $ = ["x", "y"], + _ = ["clientX", "clientY"];ab.prototype = { handler: function () {}, init: function () { + this.evEl && t(this.element, this.evEl, this.domHandler), this.evTarget && t(this.target, this.evTarget, this.domHandler), this.evWin && t(E(this.element), this.evWin, this.domHandler); + }, destroy: function () { + this.evEl && u(this.element, this.evEl, this.domHandler), this.evTarget && u(this.target, this.evTarget, this.domHandler), this.evWin && u(E(this.element), this.evWin, this.domHandler); + } };var ob = { mousedown: O, mousemove: P, mouseup: Q }, + pb = "mousedown", + qb = "mousemove mouseup";p(rb, ab, { handler: function (a) { + var b = ob[a.type];b & O && 0 === a.button && (this.pressed = !0), b & P && 1 !== a.which && (b = Q), this.pressed && this.allow && (b & Q && (this.pressed = !1), this.callback(this.manager, b, { pointers: [a], changedPointers: [a], pointerType: L, srcEvent: a })); + } });var sb = { pointerdown: O, pointermove: P, pointerup: Q, pointercancel: R, pointerout: R }, + tb = { 2: J, 3: K, 4: L, 5: M }, + ub = "pointerdown", + vb = "pointermove pointerup pointercancel";a.MSPointerEvent && (ub = "MSPointerDown", vb = "MSPointerMove MSPointerUp MSPointerCancel"), p(wb, ab, { handler: function (a) { + var b = this.store, + c = !1, + d = a.type.toLowerCase().replace("ms", ""), + e = sb[d], + f = tb[a.pointerType] || a.pointerType, + g = f == J, + h = y(b, a.pointerId, "pointerId");e & O && (0 === a.button || g) ? 0 > h && (b.push(a), h = b.length - 1) : e & (Q | R) && (c = !0), 0 > h || (b[h] = a, this.callback(this.manager, e, { pointers: b, changedPointers: [a], pointerType: f, srcEvent: a }), c && b.splice(h, 1)); + } });var xb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R }, + yb = "touchstart", + zb = "touchstart touchmove touchend touchcancel";p(Ab, ab, { handler: function (a) { + var b = xb[a.type];if (b === O && (this.started = !0), this.started) { + var c = Bb.call(this, a, b);b & (Q | R) && 0 === c[0].length - c[1].length && (this.started = !1), this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a }); + } + } });var Cb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R }, + Db = "touchstart touchmove touchend touchcancel";p(Eb, ab, { handler: function (a) { + var b = Cb[a.type], + c = Fb.call(this, a, b);c && this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a }); + } }), p(Gb, ab, { handler: function (a, b, c) { + var d = c.pointerType == J, + e = c.pointerType == L;if (d) this.mouse.allow = !1;else if (e && !this.mouse.allow) return;b & (Q | R) && (this.mouse.allow = !0), this.callback(a, b, c); + }, destroy: function () { + this.touch.destroy(), this.mouse.destroy(); + } });var Hb = B(f.style, "touchAction"), + Ib = Hb !== d, + Jb = "compute", + Kb = "auto", + Lb = "manipulation", + Mb = "none", + Nb = "pan-x", + Ob = "pan-y";Pb.prototype = { set: function (a) { + a == Jb && (a = this.compute()), Ib && (this.manager.element.style[Hb] = a), this.actions = a.toLowerCase().trim(); + }, update: function () { + this.set(this.manager.options.touchAction); + }, compute: function () { + var a = [];return m(this.manager.recognizers, function (b) { + r(b.options.enable, [b]) && (a = a.concat(b.getTouchAction())); + }), Qb(a.join(" ")); + }, preventDefaults: function (a) { + if (!Ib) { + var b = a.srcEvent, + c = a.offsetDirection;if (this.manager.session.prevented) return b.preventDefault(), void 0;var d = this.actions, + e = w(d, Mb), + f = w(d, Ob), + g = w(d, Nb);return e || f && c & X || g && c & Y ? this.preventSrc(b) : void 0; + } + }, preventSrc: function (a) { + this.manager.session.prevented = !0, a.preventDefault(); + } };var Rb = 1, + Sb = 2, + Tb = 4, + Ub = 8, + Vb = Ub, + Wb = 16, + Xb = 32;Yb.prototype = { defaults: {}, set: function (a) { + return n(this.options, a), this.manager && this.manager.touchAction.update(), this; + }, recognizeWith: function (a) { + if (l(a, "recognizeWith", this)) return this;var b = this.simultaneous;return a = _b(a, this), b[a.id] || (b[a.id] = a, a.recognizeWith(this)), this; + }, dropRecognizeWith: function (a) { + return l(a, "dropRecognizeWith", this) ? this : (a = _b(a, this), delete this.simultaneous[a.id], this); + }, requireFailure: function (a) { + if (l(a, "requireFailure", this)) return this;var b = this.requireFail;return a = _b(a, this), -1 === y(b, a) && (b.push(a), a.requireFailure(this)), this; + }, dropRequireFailure: function (a) { + if (l(a, "dropRequireFailure", this)) return this;a = _b(a, this);var b = y(this.requireFail, a);return b > -1 && this.requireFail.splice(b, 1), this; + }, hasRequireFailures: function () { + return this.requireFail.length > 0; + }, canRecognizeWith: function (a) { + return !!this.simultaneous[a.id]; + }, emit: function (a) { + function d(d) { + b.manager.emit(b.options.event + (d ? Zb(c) : ""), a); + }var b = this, + c = this.state;Ub > c && d(!0), d(), c >= Ub && d(!0); + }, tryEmit: function (a) { + return this.canEmit() ? this.emit(a) : (this.state = Xb, void 0); + }, canEmit: function () { + for (var a = 0; a < this.requireFail.length;) { + if (!(this.requireFail[a].state & (Xb | Rb))) return !1;a++; + }return !0; + }, recognize: function (a) { + var b = n({}, a);return r(this.options.enable, [this, b]) ? (this.state & (Vb | Wb | Xb) && (this.state = Rb), this.state = this.process(b), this.state & (Sb | Tb | Ub | Wb) && this.tryEmit(b), void 0) : (this.reset(), this.state = Xb, void 0); + }, process: function () {}, getTouchAction: function () {}, reset: function () {} }, p(ac, Yb, { defaults: { pointers: 1 }, attrTest: function (a) { + var b = this.options.pointers;return 0 === b || a.pointers.length === b; + }, process: function (a) { + var b = this.state, + c = a.eventType, + d = b & (Sb | Tb), + e = this.attrTest(a);return d && (c & R || !e) ? b | Wb : d || e ? c & Q ? b | Ub : b & Sb ? b | Tb : Sb : Xb; + } }), p(bc, ac, { defaults: { event: "pan", threshold: 10, pointers: 1, direction: Z }, getTouchAction: function () { + var a = this.options.direction, + b = [];return a & X && b.push(Ob), a & Y && b.push(Nb), b; + }, directionTest: function (a) { + var b = this.options, + c = !0, + d = a.distance, + e = a.direction, + f = a.deltaX, + g = a.deltaY;return e & b.direction || (b.direction & X ? (e = 0 === f ? S : 0 > f ? T : U, c = f != this.pX, d = Math.abs(a.deltaX)) : (e = 0 === g ? S : 0 > g ? V : W, c = g != this.pY, d = Math.abs(a.deltaY))), a.direction = e, c && d > b.threshold && e & b.direction; + }, attrTest: function (a) { + return ac.prototype.attrTest.call(this, a) && (this.state & Sb || !(this.state & Sb) && this.directionTest(a)); + }, emit: function (a) { + this.pX = a.deltaX, this.pY = a.deltaY;var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this._super.emit.call(this, a); + } }), p(cc, ac, { defaults: { event: "pinch", threshold: 0, pointers: 2 }, getTouchAction: function () { + return [Mb]; + }, attrTest: function (a) { + return this._super.attrTest.call(this, a) && (Math.abs(a.scale - 1) > this.options.threshold || this.state & Sb); + }, emit: function (a) { + if (this._super.emit.call(this, a), 1 !== a.scale) { + var b = a.scale < 1 ? "in" : "out";this.manager.emit(this.options.event + b, a); + } + } }), p(dc, Yb, { defaults: { event: "press", pointers: 1, time: 500, threshold: 5 }, getTouchAction: function () { + return [Kb]; + }, process: function (a) { + var b = this.options, + c = a.pointers.length === b.pointers, + d = a.distance < b.threshold, + e = a.deltaTime > b.time;if (this._input = a, !d || !c || a.eventType & (Q | R) && !e) this.reset();else if (a.eventType & O) this.reset(), this._timer = k(function () { + this.state = Vb, this.tryEmit(); + }, b.time, this);else if (a.eventType & Q) return Vb;return Xb; + }, reset: function () { + clearTimeout(this._timer); + }, emit: function (a) { + this.state === Vb && (a && a.eventType & Q ? this.manager.emit(this.options.event + "up", a) : (this._input.timeStamp = j(), this.manager.emit(this.options.event, this._input))); + } }), p(ec, ac, { defaults: { event: "rotate", threshold: 0, pointers: 2 }, getTouchAction: function () { + return [Mb]; + }, attrTest: function (a) { + return this._super.attrTest.call(this, a) && (Math.abs(a.rotation) > this.options.threshold || this.state & Sb); + } }), p(fc, ac, { defaults: { event: "swipe", threshold: 10, velocity: .65, direction: X | Y, pointers: 1 }, getTouchAction: function () { + return bc.prototype.getTouchAction.call(this); + }, attrTest: function (a) { + var c, + b = this.options.direction;return b & (X | Y) ? c = a.velocity : b & X ? c = a.velocityX : b & Y && (c = a.velocityY), this._super.attrTest.call(this, a) && b & a.direction && a.distance > this.options.threshold && i(c) > this.options.velocity && a.eventType & Q; + }, emit: function (a) { + var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this.manager.emit(this.options.event, a); + } }), p(gc, Yb, { defaults: { event: "tap", pointers: 1, taps: 1, interval: 300, time: 250, threshold: 2, posThreshold: 10 }, getTouchAction: function () { + return [Lb]; + }, process: function (a) { + var b = this.options, + c = a.pointers.length === b.pointers, + d = a.distance < b.threshold, + e = a.deltaTime < b.time;if (this.reset(), a.eventType & O && 0 === this.count) return this.failTimeout();if (d && e && c) { + if (a.eventType != Q) return this.failTimeout();var f = this.pTime ? a.timeStamp - this.pTime < b.interval : !0, + g = !this.pCenter || kb(this.pCenter, a.center) < b.posThreshold;this.pTime = a.timeStamp, this.pCenter = a.center, g && f ? this.count += 1 : this.count = 1, this._input = a;var h = this.count % b.taps;if (0 === h) return this.hasRequireFailures() ? (this._timer = k(function () { + this.state = Vb, this.tryEmit(); + }, b.interval, this), Sb) : Vb; + }return Xb; + }, failTimeout: function () { + return this._timer = k(function () { + this.state = Xb; + }, this.options.interval, this), Xb; + }, reset: function () { + clearTimeout(this._timer); + }, emit: function () { + this.state == Vb && (this._input.tapCount = this.count, this.manager.emit(this.options.event, this._input)); + } }), hc.VERSION = "2.0.4", hc.defaults = { domEvents: !1, touchAction: Jb, enable: !0, inputTarget: null, inputClass: null, preset: [[ec, { enable: !1 }], [cc, { enable: !1 }, ["rotate"]], [fc, { direction: X }], [bc, { direction: X }, ["swipe"]], [gc], [gc, { event: "doubletap", taps: 2 }, ["tap"]], [dc]], cssProps: { userSelect: "default", touchSelect: "none", touchCallout: "none", contentZooming: "none", userDrag: "none", tapHighlightColor: "rgba(0,0,0,0)" } };var ic = 1, + jc = 2;kc.prototype = { set: function (a) { + return n(this.options, a), a.touchAction && this.touchAction.update(), a.inputTarget && (this.input.destroy(), this.input.target = a.inputTarget, this.input.init()), this; + }, stop: function (a) { + this.session.stopped = a ? jc : ic; + }, recognize: function (a) { + var b = this.session;if (!b.stopped) { + this.touchAction.preventDefaults(a);var c, + d = this.recognizers, + e = b.curRecognizer;(!e || e && e.state & Vb) && (e = b.curRecognizer = null);for (var f = 0; f < d.length;) { + c = d[f], b.stopped === jc || e && c != e && !c.canRecognizeWith(e) ? c.reset() : c.recognize(a), !e && c.state & (Sb | Tb | Ub) && (e = b.curRecognizer = c), f++; + } + } + }, get: function (a) { + if (a instanceof Yb) return a;for (var b = this.recognizers, c = 0; c < b.length; c++) { + if (b[c].options.event == a) return b[c]; + }return null; + }, add: function (a) { + if (l(a, "add", this)) return this;var b = this.get(a.options.event);return b && this.remove(b), this.recognizers.push(a), a.manager = this, this.touchAction.update(), a; + }, remove: function (a) { + if (l(a, "remove", this)) return this;var b = this.recognizers;return a = this.get(a), b.splice(y(b, a), 1), this.touchAction.update(), this; + }, on: function (a, b) { + var c = this.handlers;return m(x(a), function (a) { + c[a] = c[a] || [], c[a].push(b); + }), this; + }, off: function (a, b) { + var c = this.handlers;return m(x(a), function (a) { + b ? c[a].splice(y(c[a], b), 1) : delete c[a]; + }), this; + }, emit: function (a, b) { + this.options.domEvents && mc(a, b);var c = this.handlers[a] && this.handlers[a].slice();if (c && c.length) { + b.type = a, b.preventDefault = function () { + b.srcEvent.preventDefault(); + };for (var d = 0; d < c.length;) { + c[d](b), d++; + } + } + }, destroy: function () { + this.element && lc(this, !1), this.handlers = {}, this.session = {}, this.input.destroy(), this.element = null; + } }, n(hc, { INPUT_START: O, INPUT_MOVE: P, INPUT_END: Q, INPUT_CANCEL: R, STATE_POSSIBLE: Rb, STATE_BEGAN: Sb, STATE_CHANGED: Tb, STATE_ENDED: Ub, STATE_RECOGNIZED: Vb, STATE_CANCELLED: Wb, STATE_FAILED: Xb, DIRECTION_NONE: S, DIRECTION_LEFT: T, DIRECTION_RIGHT: U, DIRECTION_UP: V, DIRECTION_DOWN: W, DIRECTION_HORIZONTAL: X, DIRECTION_VERTICAL: Y, DIRECTION_ALL: Z, Manager: kc, Input: ab, TouchAction: Pb, TouchInput: Eb, MouseInput: rb, PointerEventInput: wb, TouchMouseInput: Gb, SingleTouchInput: Ab, Recognizer: Yb, AttrRecognizer: ac, Tap: gc, Pan: bc, Swipe: fc, Pinch: cc, Rotate: ec, Press: dc, on: t, off: u, each: m, merge: o, extend: n, inherit: p, bindFn: q, prefixed: B }), typeof define == g && define.amd ? define(function () { + return hc; + }) : "undefined" != typeof module && module.exports ? module.exports = hc : a[c] = hc; +}(window, document, "Hammer");;(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['jquery', 'hammerjs'], factory); + } else if (typeof exports === 'object') { + factory(require('jquery'), require('hammerjs')); + } else { + factory(jQuery, Hammer); + } +})(function ($, Hammer) { + function hammerify(el, options) { + var $el = $(el); + if (!$el.data("hammer")) { + $el.data("hammer", new Hammer($el[0], options)); + } + } + + $.fn.hammer = function (options) { + return this.each(function () { + hammerify(this, options); + }); + }; + + // extend the emit method to also trigger jQuery events + Hammer.Manager.prototype.emit = function (originalEmit) { + return function (type, data) { + originalEmit.call(this, type, data); + $(this.element).trigger({ + type: type, + gesture: data + }); + }; + }(Hammer.Manager.prototype.emit); +}); +; // Required for Meteor package, the use of window prevents export by Meteor +(function (window) { + if (window.Package) { + Materialize = {}; + } else { + window.Materialize = {}; + } +})(window); + +if (typeof exports !== 'undefined' && !exports.nodeType) { + if (typeof module !== 'undefined' && !module.nodeType && module.exports) { + exports = module.exports = Materialize; + } + exports.default = Materialize; +} + +/* + * raf.js + * https://github.com/ngryman/raf.js + * + * original requestAnimationFrame polyfill by Erik Möller + * inspired from paul_irish gist and post + * + * Copyright (c) 2013 ngryman + * Licensed under the MIT license. + */ +(function (window) { + var lastTime = 0, + vendors = ['webkit', 'moz'], + requestAnimationFrame = window.requestAnimationFrame, + cancelAnimationFrame = window.cancelAnimationFrame, + i = vendors.length; + + // try to un-prefix existing raf + while (--i >= 0 && !requestAnimationFrame) { + requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame']; + cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame']; + } + + // polyfill with setTimeout fallback + // heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945 + if (!requestAnimationFrame || !cancelAnimationFrame) { + requestAnimationFrame = function (callback) { + var now = +Date.now(), + nextTime = Math.max(lastTime + 16, now); + return setTimeout(function () { + callback(lastTime = nextTime); + }, nextTime - now); + }; + + cancelAnimationFrame = clearTimeout; + } + + // export to window + window.requestAnimationFrame = requestAnimationFrame; + window.cancelAnimationFrame = cancelAnimationFrame; +})(window); + +/** + * Generate approximated selector string for a jQuery object + * @param {jQuery} obj jQuery object to be parsed + * @returns {string} + */ +Materialize.objectSelectorString = function (obj) { + var tagStr = obj.prop('tagName') || ''; + var idStr = obj.attr('id') || ''; + var classStr = obj.attr('class') || ''; + return (tagStr + idStr + classStr).replace(/\s/g, ''); +}; + +// Unique Random ID +Materialize.guid = function () { + function s4() { + return Math.floor((1 + Math.random()) * 0x10000).toString(16).substring(1); + } + return function () { + return s4() + s4() + '-' + s4() + '-' + s4() + '-' + s4() + '-' + s4() + s4() + s4(); + }; +}(); + +/** + * Escapes hash from special characters + * @param {string} hash String returned from this.hash + * @returns {string} + */ +Materialize.escapeHash = function (hash) { + return hash.replace(/(:|\.|\[|\]|,|=)/g, "\\$1"); +}; + +Materialize.elementOrParentIsFixed = function (element) { + var $element = $(element); + var $checkElements = $element.add($element.parents()); + var isFixed = false; + $checkElements.each(function () { + if ($(this).css("position") === "fixed") { + isFixed = true; + return false; + } + }); + return isFixed; +}; + +/** + * Get time in ms + * @license https://raw.github.com/jashkenas/underscore/master/LICENSE + * @type {function} + * @return {number} + */ +var getTime = Date.now || function () { + return new Date().getTime(); +}; + +/** + * Returns a function, that, when invoked, will only be triggered at most once + * during a given window of time. Normally, the throttled function will run + * as much as it can, without ever going more than once per `wait` duration; + * but if you'd like to disable the execution on the leading edge, pass + * `{leading: false}`. To disable execution on the trailing edge, ditto. + * @license https://raw.github.com/jashkenas/underscore/master/LICENSE + * @param {function} func + * @param {number} wait + * @param {Object=} options + * @returns {Function} + */ +Materialize.throttle = function (func, wait, options) { + var context, args, result; + var timeout = null; + var previous = 0; + options || (options = {}); + var later = function () { + previous = options.leading === false ? 0 : getTime(); + timeout = null; + result = func.apply(context, args); + context = args = null; + }; + return function () { + var now = getTime(); + if (!previous && options.leading === false) previous = now; + var remaining = wait - (now - previous); + context = this; + args = arguments; + if (remaining <= 0) { + clearTimeout(timeout); + timeout = null; + previous = now; + result = func.apply(context, args); + context = args = null; + } else if (!timeout && options.trailing !== false) { + timeout = setTimeout(later, remaining); + } + return result; + }; +}; + +// Velocity has conflicts when loaded with jQuery, this will check for it +// First, check if in noConflict mode +var Vel; +if (jQuery) { + Vel = jQuery.Velocity; +} else if ($) { + Vel = $.Velocity; +} else { + Vel = Velocity; +} + +if (Vel) { + Materialize.Vel = Vel; +} else { + Materialize.Vel = Velocity; +} +;(function ($) { + $.fn.collapsible = function (options, methodParam) { + var defaults = { + accordion: undefined, + onOpen: undefined, + onClose: undefined + }; + + var methodName = options; + options = $.extend(defaults, options); + + return this.each(function () { + + var $this = $(this); + + var $panel_headers = $(this).find('> li > .collapsible-header'); + + var collapsible_type = $this.data("collapsible"); + + /**************** + Helper Functions + ****************/ + + // Accordion Open + function accordionOpen(object) { + $panel_headers = $this.find('> li > .collapsible-header'); + if (object.hasClass('active')) { + object.parent().addClass('active'); + } else { + object.parent().removeClass('active'); + } + if (object.parent().hasClass('active')) { + object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () { + $(this).css('height', ''); + } }); + } else { + object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () { + $(this).css('height', ''); + } }); + } + + $panel_headers.not(object).removeClass('active').parent().removeClass('active'); + + // Close previously open accordion elements. + $panel_headers.not(object).parent().children('.collapsible-body').stop(true, false).each(function () { + if ($(this).is(':visible')) { + $(this).slideUp({ + duration: 350, + easing: "easeOutQuart", + queue: false, + complete: function () { + $(this).css('height', ''); + execCallbacks($(this).siblings('.collapsible-header')); + } + }); + } + }); + } + + // Expandable Open + function expandableOpen(object) { + if (object.hasClass('active')) { + object.parent().addClass('active'); + } else { + object.parent().removeClass('active'); + } + if (object.parent().hasClass('active')) { + object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () { + $(this).css('height', ''); + } }); + } else { + object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () { + $(this).css('height', ''); + } }); + } + } + + // Open collapsible. object: .collapsible-header + function collapsibleOpen(object, noToggle) { + if (!noToggle) { + object.toggleClass('active'); + } + + if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { + // Handle Accordion + accordionOpen(object); + } else { + // Handle Expandables + expandableOpen(object); + } + + execCallbacks(object); + } + + // Handle callbacks + function execCallbacks(object) { + if (object.hasClass('active')) { + if (typeof options.onOpen === "function") { + options.onOpen.call(this, object.parent()); + } + } else { + if (typeof options.onClose === "function") { + options.onClose.call(this, object.parent()); + } + } + } + + /** + * Check if object is children of panel header + * @param {Object} object Jquery object + * @return {Boolean} true if it is children + */ + function isChildrenOfPanelHeader(object) { + + var panelHeader = getPanelHeader(object); + + return panelHeader.length > 0; + } + + /** + * Get panel header from a children element + * @param {Object} object Jquery object + * @return {Object} panel header object + */ + function getPanelHeader(object) { + + return object.closest('li > .collapsible-header'); + } + + // Turn off any existing event handlers + function removeEventHandlers() { + $this.off('click.collapse', '> li > .collapsible-header'); + } + + /***** End Helper Functions *****/ + + // Methods + if (methodName === 'destroy') { + removeEventHandlers(); + return; + } else if (methodParam >= 0 && methodParam < $panel_headers.length) { + var $curr_header = $panel_headers.eq(methodParam); + if ($curr_header.length && (methodName === 'open' || methodName === 'close' && $curr_header.hasClass('active'))) { + collapsibleOpen($curr_header); + } + return; + } + + removeEventHandlers(); + + // Add click handler to only direct collapsible header children + $this.on('click.collapse', '> li > .collapsible-header', function (e) { + var element = $(e.target); + + if (isChildrenOfPanelHeader(element)) { + element = getPanelHeader(element); + } + + collapsibleOpen(element); + }); + + // Open first active + if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { + // Handle Accordion + collapsibleOpen($panel_headers.filter('.active').first(), true); + } else { + // Handle Expandables + $panel_headers.filter('.active').each(function () { + collapsibleOpen($(this), true); + }); + } + }); + }; + + $(document).ready(function () { + $('.collapsible').collapsible(); + }); +})(jQuery);;(function ($) { + + // Add posibility to scroll to selected option + // usefull for select for example + $.fn.scrollTo = function (elem) { + $(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top); + return this; + }; + + $.fn.dropdown = function (options) { + var defaults = { + inDuration: 300, + outDuration: 225, + constrainWidth: true, // Constrains width of dropdown to the activator + hover: false, + gutter: 0, // Spacing from edge + belowOrigin: false, + alignment: 'left', + stopPropagation: false + }; + + // Open dropdown. + if (options === "open") { + this.each(function () { + $(this).trigger('open'); + }); + return false; + } + + // Close dropdown. + if (options === "close") { + this.each(function () { + $(this).trigger('close'); + }); + return false; + } + + this.each(function () { + var origin = $(this); + var curr_options = $.extend({}, defaults, options); + var isFocused = false; + + // Dropdown menu + var activates = $("#" + origin.attr('data-activates')); + + function updateOptions() { + if (origin.data('induration') !== undefined) curr_options.inDuration = origin.data('induration'); + if (origin.data('outduration') !== undefined) curr_options.outDuration = origin.data('outduration'); + if (origin.data('constrainwidth') !== undefined) curr_options.constrainWidth = origin.data('constrainwidth'); + if (origin.data('hover') !== undefined) curr_options.hover = origin.data('hover'); + if (origin.data('gutter') !== undefined) curr_options.gutter = origin.data('gutter'); + if (origin.data('beloworigin') !== undefined) curr_options.belowOrigin = origin.data('beloworigin'); + if (origin.data('alignment') !== undefined) curr_options.alignment = origin.data('alignment'); + if (origin.data('stoppropagation') !== undefined) curr_options.stopPropagation = origin.data('stoppropagation'); + } + + updateOptions(); + + // Attach dropdown to its activator + origin.after(activates); + + /* + Helper function to position and resize dropdown. + Used in hover and click handler. + */ + function placeDropdown(eventType) { + // Check for simultaneous focus and click events. + if (eventType === 'focus') { + isFocused = true; + } + + // Check html data attributes + updateOptions(); + + // Set Dropdown state + activates.addClass('active'); + origin.addClass('active'); + + var originWidth = origin[0].getBoundingClientRect().width; + + // Constrain width + if (curr_options.constrainWidth === true) { + activates.css('width', originWidth); + } else { + activates.css('white-space', 'nowrap'); + } + + // Offscreen detection + var windowHeight = window.innerHeight; + var originHeight = origin.innerHeight(); + var offsetLeft = origin.offset().left; + var offsetTop = origin.offset().top - $(window).scrollTop(); + var currAlignment = curr_options.alignment; + var gutterSpacing = 0; + var leftPosition = 0; + + // Below Origin + var verticalOffset = 0; + if (curr_options.belowOrigin === true) { + verticalOffset = originHeight; + } + + // Check for scrolling positioned container. + var scrollYOffset = 0; + var scrollXOffset = 0; + var wrapper = origin.parent(); + if (!wrapper.is('body')) { + if (wrapper[0].scrollHeight > wrapper[0].clientHeight) { + scrollYOffset = wrapper[0].scrollTop; + } + if (wrapper[0].scrollWidth > wrapper[0].clientWidth) { + scrollXOffset = wrapper[0].scrollLeft; + } + } + + if (offsetLeft + activates.innerWidth() > $(window).width()) { + // Dropdown goes past screen on right, force right alignment + currAlignment = 'right'; + } else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) { + // Dropdown goes past screen on left, force left alignment + currAlignment = 'left'; + } + // Vertical bottom offscreen detection + if (offsetTop + activates.innerHeight() > windowHeight) { + // If going upwards still goes offscreen, just crop height of dropdown. + if (offsetTop + originHeight - activates.innerHeight() < 0) { + var adjustedHeight = windowHeight - offsetTop - verticalOffset; + activates.css('max-height', adjustedHeight); + } else { + // Flow upwards. + if (!verticalOffset) { + verticalOffset += originHeight; + } + verticalOffset -= activates.innerHeight(); + } + } + + // Handle edge alignment + if (currAlignment === 'left') { + gutterSpacing = curr_options.gutter; + leftPosition = origin.position().left + gutterSpacing; + } else if (currAlignment === 'right') { + // Material icons fix + activates.stop(true, true).css({ + opacity: 0, + left: 0 + }); + + var offsetRight = origin.position().left + originWidth - activates.width(); + gutterSpacing = -curr_options.gutter; + leftPosition = offsetRight + gutterSpacing; + } + + // Position dropdown + activates.css({ + position: 'absolute', + top: origin.position().top + verticalOffset + scrollYOffset, + left: leftPosition + scrollXOffset + }); + + // Show dropdown + activates.slideDown({ + queue: false, + duration: curr_options.inDuration, + easing: 'easeOutCubic', + complete: function () { + $(this).css('height', ''); + } + }).animate({ opacity: 1 }, { queue: false, duration: curr_options.inDuration, easing: 'easeOutSine' }); + + // Add click close handler to document + setTimeout(function () { + $(document).on('click.' + activates.attr('id'), function (e) { + hideDropdown(); + $(document).off('click.' + activates.attr('id')); + }); + }, 0); + } + + function hideDropdown() { + // Check for simultaneous focus and click events. + isFocused = false; + activates.fadeOut(curr_options.outDuration); + activates.removeClass('active'); + origin.removeClass('active'); + $(document).off('click.' + activates.attr('id')); + setTimeout(function () { + activates.css('max-height', ''); + }, curr_options.outDuration); + } + + // Hover + if (curr_options.hover) { + var open = false; + origin.off('click.' + origin.attr('id')); + // Hover handler to show dropdown + origin.on('mouseenter', function (e) { + // Mouse over + if (open === false) { + placeDropdown(); + open = true; + } + }); + origin.on('mouseleave', function (e) { + // If hover on origin then to something other than dropdown content, then close + var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element + if (!$(toEl).closest('.dropdown-content').is(activates)) { + activates.stop(true, true); + hideDropdown(); + open = false; + } + }); + + activates.on('mouseleave', function (e) { + // Mouse out + var toEl = e.toElement || e.relatedTarget; + if (!$(toEl).closest('.dropdown-button').is(origin)) { + activates.stop(true, true); + hideDropdown(); + open = false; + } + }); + + // Click + } else { + // Click handler to show dropdown + origin.off('click.' + origin.attr('id')); + origin.on('click.' + origin.attr('id'), function (e) { + if (!isFocused) { + if (origin[0] == e.currentTarget && !origin.hasClass('active') && $(e.target).closest('.dropdown-content').length === 0) { + e.preventDefault(); // Prevents button click from moving window + if (curr_options.stopPropagation) { + e.stopPropagation(); + } + placeDropdown('click'); + } + // If origin is clicked and menu is open, close menu + else if (origin.hasClass('active')) { + hideDropdown(); + $(document).off('click.' + activates.attr('id')); + } + } + }); + } // End else + + // Listen to open and close event - useful for select component + origin.on('open', function (e, eventType) { + placeDropdown(eventType); + }); + origin.on('close', hideDropdown); + }); + }; // End dropdown plugin + + $(document).ready(function () { + $('.dropdown-button').dropdown(); + }); +})(jQuery); +;(function ($, Vel) { + 'use strict'; + + var _defaults = { + opacity: 0.5, + inDuration: 250, + outDuration: 250, + ready: undefined, + complete: undefined, + dismissible: true, + startingTop: '4%', + endingTop: '10%' + }; + + /** + * @class + * + */ + + var Modal = function () { + /** + * Construct Modal instance and set up overlay + * @constructor + * @param {jQuery} $el + * @param {Object} options + */ + function Modal($el, options) { + _classCallCheck(this, Modal); + + // If exists, destroy and reinitialize + if (!!$el[0].M_Modal) { + $el[0].M_Modal.destroy(); + } + + /** + * The jQuery element + * @type {jQuery} + */ + this.$el = $el; + + /** + * Options for the modal + * @member Modal#options + * @prop {Number} [opacity=0.5] - Opacity of the modal overlay + * @prop {Number} [inDuration=250] - Length in ms of enter transition + * @prop {Number} [outDuration=250] - Length in ms of exit transition + * @prop {Function} ready - Callback function called when modal is finished entering + * @prop {Function} complete - Callback function called when modal is finished exiting + * @prop {Boolean} [dismissible=true] - Allow modal to be dismissed by keyboard or overlay click + * @prop {String} [startingTop='4%'] - startingTop + * @prop {String} [endingTop='10%'] - endingTop + */ + this.options = $.extend({}, Modal.defaults, options); + + /** + * Describes open/close state of modal + * @type {Boolean} + */ + this.isOpen = false; + + this.$el[0].M_Modal = this; + this.id = $el.attr('id'); + this.openingTrigger = undefined; + this.$overlay = $(''); + + Modal._increment++; + Modal._count++; + this.$overlay[0].style.zIndex = 1000 + Modal._increment * 2; + this.$el[0].style.zIndex = 1000 + Modal._increment * 2 + 1; + this.setupEventHandlers(); + } + + _createClass(Modal, [{ + key: 'getInstance', + + + /** + * Get Instance + */ + value: function getInstance() { + return this; + } + + /** + * Teardown component + */ + + }, { + key: 'destroy', + value: function destroy() { + this.removeEventHandlers(); + this.$el[0].removeAttribute('style'); + if (!!this.$overlay[0].parentNode) { + this.$overlay[0].parentNode.removeChild(this.$overlay[0]); + } + this.$el[0].M_Modal = undefined; + Modal._count--; + } + + /** + * Setup Event Handlers + */ + + }, { + key: 'setupEventHandlers', + value: function setupEventHandlers() { + this.handleOverlayClickBound = this.handleOverlayClick.bind(this); + this.handleModalCloseClickBound = this.handleModalCloseClick.bind(this); + + if (Modal._count === 1) { + document.body.addEventListener('click', this.handleTriggerClick); + } + this.$overlay[0].addEventListener('click', this.handleOverlayClickBound); + this.$el[0].addEventListener('click', this.handleModalCloseClickBound); + } + + /** + * Remove Event Handlers + */ + + }, { + key: 'removeEventHandlers', + value: function removeEventHandlers() { + if (Modal._count === 0) { + document.body.removeEventListener('click', this.handleTriggerClick); + } + this.$overlay[0].removeEventListener('click', this.handleOverlayClickBound); + this.$el[0].removeEventListener('click', this.handleModalCloseClickBound); + } + + /** + * Handle Trigger Click + * @param {Event} e + */ + + }, { + key: 'handleTriggerClick', + value: function handleTriggerClick(e) { + var $trigger = $(e.target).closest('.modal-trigger'); + if (e.target && $trigger.length) { + var modalId = $trigger[0].getAttribute('href'); + if (modalId) { + modalId = modalId.slice(1); + } else { + modalId = $trigger[0].getAttribute('data-target'); + } + var modalInstance = document.getElementById(modalId).M_Modal; + if (modalInstance) { + modalInstance.open($trigger); + } + e.preventDefault(); + } + } + + /** + * Handle Overlay Click + */ + + }, { + key: 'handleOverlayClick', + value: function handleOverlayClick() { + if (this.options.dismissible) { + this.close(); + } + } + + /** + * Handle Modal Close Click + * @param {Event} e + */ + + }, { + key: 'handleModalCloseClick', + value: function handleModalCloseClick(e) { + var $closeTrigger = $(e.target).closest('.modal-close'); + if (e.target && $closeTrigger.length) { + this.close(); + } + } + + /** + * Handle Keydown + * @param {Event} e + */ + + }, { + key: 'handleKeydown', + value: function handleKeydown(e) { + // ESC key + if (e.keyCode === 27 && this.options.dismissible) { + this.close(); + } + } + + /** + * Animate in modal + */ + + }, { + key: 'animateIn', + value: function animateIn() { + var _this = this; + + // Set initial styles + $.extend(this.$el[0].style, { + display: 'block', + opacity: 0 + }); + $.extend(this.$overlay[0].style, { + display: 'block', + opacity: 0 + }); + + // Animate overlay + Vel(this.$overlay[0], { opacity: this.options.opacity }, { duration: this.options.inDuration, queue: false, ease: 'easeOutCubic' }); + + // Define modal animation options + var enterVelocityOptions = { + duration: this.options.inDuration, + queue: false, + ease: 'easeOutCubic', + // Handle modal ready callback + complete: function () { + if (typeof _this.options.ready === 'function') { + _this.options.ready.call(_this, _this.$el, _this.openingTrigger); + } + } + }; + + // Bottom sheet animation + if (this.$el[0].classList.contains('bottom-sheet')) { + Vel(this.$el[0], { bottom: 0, opacity: 1 }, enterVelocityOptions); + + // Normal modal animation + } else { + Vel.hook(this.$el[0], 'scaleX', 0.7); + this.$el[0].style.top = this.options.startingTop; + Vel(this.$el[0], { top: this.options.endingTop, opacity: 1, scaleX: 1 }, enterVelocityOptions); + } + } + + /** + * Animate out modal + */ + + }, { + key: 'animateOut', + value: function animateOut() { + var _this2 = this; + + // Animate overlay + Vel(this.$overlay[0], { opacity: 0 }, { duration: this.options.outDuration, queue: false, ease: 'easeOutQuart' }); + + // Define modal animation options + var exitVelocityOptions = { + duration: this.options.outDuration, + queue: false, + ease: 'easeOutCubic', + // Handle modal ready callback + complete: function () { + _this2.$el[0].style.display = 'none'; + // Call complete callback + if (typeof _this2.options.complete === 'function') { + _this2.options.complete.call(_this2, _this2.$el); + } + _this2.$overlay[0].parentNode.removeChild(_this2.$overlay[0]); + } + }; + + // Bottom sheet animation + if (this.$el[0].classList.contains('bottom-sheet')) { + Vel(this.$el[0], { bottom: '-100%', opacity: 0 }, exitVelocityOptions); + + // Normal modal animation + } else { + Vel(this.$el[0], { top: this.options.startingTop, opacity: 0, scaleX: 0.7 }, exitVelocityOptions); + } + } + + /** + * Open Modal + * @param {jQuery} [$trigger] + */ + + }, { + key: 'open', + value: function open($trigger) { + if (this.isOpen) { + return; + } + + this.isOpen = true; + var body = document.body; + body.style.overflow = 'hidden'; + this.$el[0].classList.add('open'); + body.appendChild(this.$overlay[0]); + + // Set opening trigger, undefined indicates modal was opened by javascript + this.openingTrigger = !!$trigger ? $trigger : undefined; + + if (this.options.dismissible) { + this.handleKeydownBound = this.handleKeydown.bind(this); + document.addEventListener('keydown', this.handleKeydownBound); + } + + this.animateIn(); + + return this; + } + + /** + * Close Modal + */ + + }, { + key: 'close', + value: function close() { + if (!this.isOpen) { + return; + } + + this.isOpen = false; + this.$el[0].classList.remove('open'); + document.body.style.overflow = ''; + + if (this.options.dismissible) { + document.removeEventListener('keydown', this.handleKeydownBound); + } + + this.animateOut(); + + return this; + } + }], [{ + key: 'init', + value: function init($els, options) { + var arr = []; + $els.each(function () { + arr.push(new Modal($(this), options)); + }); + return arr; + } + }, { + key: 'defaults', + get: function () { + return _defaults; + } + }]); + + return Modal; + }(); + + /** + * @static + * @memberof Modal + */ + + + Modal._increment = 0; + + /** + * @static + * @memberof Modal + */ + Modal._count = 0; + + Materialize.Modal = Modal; + + $.fn.modal = function (methodOrOptions) { + // Call plugin method if valid method name is passed in + if (Modal.prototype[methodOrOptions]) { + // Getter methods + if (methodOrOptions.slice(0, 3) === 'get') { + return this.first()[0].M_Modal[methodOrOptions](); + + // Void methods + } else { + return this.each(function () { + this.M_Modal[methodOrOptions](); + }); + } + + // Initialize plugin if options or no argument is passed in + } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { + Modal.init(this, arguments[0]); + return this; + + // Return error if an unrecognized method name is passed in + } else { + $.error('Method ' + methodOrOptions + ' does not exist on jQuery.modal'); + } + }; +})(jQuery, Materialize.Vel); +;(function ($) { + + $.fn.materialbox = function () { + + return this.each(function () { + + if ($(this).hasClass('initialized')) { + return; + } + + $(this).addClass('initialized'); + + var overlayActive = false; + var doneAnimating = true; + var inDuration = 275; + var outDuration = 200; + var origin = $(this); + var placeholder = $('
').addClass('material-placeholder'); + var originalWidth = 0; + var originalHeight = 0; + var ancestorsChanged; + var ancestor; + var originInlineStyles = origin.attr('style'); + origin.wrap(placeholder); + + // Start click handler + origin.on('click', function () { + var placeholder = origin.parent('.material-placeholder'); + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var originalWidth = origin.width(); + var originalHeight = origin.height(); + + // If already modal, return to original + if (doneAnimating === false) { + returnToOriginal(); + return false; + } else if (overlayActive && doneAnimating === true) { + returnToOriginal(); + return false; + } + + // Set states + doneAnimating = false; + origin.addClass('active'); + overlayActive = true; + + // Set positioning for placeholder + placeholder.css({ + width: placeholder[0].getBoundingClientRect().width, + height: placeholder[0].getBoundingClientRect().height, + position: 'relative', + top: 0, + left: 0 + }); + + // Find ancestor with overflow: hidden; and remove it + ancestorsChanged = undefined; + ancestor = placeholder[0].parentNode; + var count = 0; + while (ancestor !== null && !$(ancestor).is(document)) { + var curr = $(ancestor); + if (curr.css('overflow') !== 'visible') { + curr.css('overflow', 'visible'); + if (ancestorsChanged === undefined) { + ancestorsChanged = curr; + } else { + ancestorsChanged = ancestorsChanged.add(curr); + } + } + ancestor = ancestor.parentNode; + } + + // Set css on origin + origin.css({ + position: 'absolute', + 'z-index': 1000, + 'will-change': 'left, top, width, height' + }).data('width', originalWidth).data('height', originalHeight); + + // Add overlay + var overlay = $('
').css({ + opacity: 0 + }).click(function () { + if (doneAnimating === true) returnToOriginal(); + }); + + // Put before in origin image to preserve z-index layering. + origin.before(overlay); + + // Set dimensions if needed + var overlayOffset = overlay[0].getBoundingClientRect(); + overlay.css({ + width: windowWidth, + height: windowHeight, + left: -1 * overlayOffset.left, + top: -1 * overlayOffset.top + }); + + // Animate Overlay + overlay.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' }); + + // Add and animate caption if it exists + if (origin.data('caption') !== "") { + var $photo_caption = $('
'); + $photo_caption.text(origin.data('caption')); + $('body').append($photo_caption); + $photo_caption.css({ "display": "inline" }); + $photo_caption.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' }); + } + + // Resize Image + var ratio = 0; + var widthPercent = originalWidth / windowWidth; + var heightPercent = originalHeight / windowHeight; + var newWidth = 0; + var newHeight = 0; + + if (widthPercent > heightPercent) { + ratio = originalHeight / originalWidth; + newWidth = windowWidth * 0.9; + newHeight = windowWidth * 0.9 * ratio; + } else { + ratio = originalWidth / originalHeight; + newWidth = windowHeight * 0.9 * ratio; + newHeight = windowHeight * 0.9; + } + + // Animate image + set z-index + if (origin.hasClass('responsive-img')) { + origin.velocity({ 'max-width': newWidth, 'width': originalWidth }, { duration: 0, queue: false, + complete: function () { + origin.css({ left: 0, top: 0 }).velocity({ + height: newHeight, + width: newWidth, + left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2, + top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2 + }, { + duration: inDuration, + queue: false, + easing: 'easeOutQuad', + complete: function () { + doneAnimating = true; + } + }); + } // End Complete + }); // End Velocity + } else { + origin.css('left', 0).css('top', 0).velocity({ + height: newHeight, + width: newWidth, + left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2, + top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2 + }, { + duration: inDuration, + queue: false, + easing: 'easeOutQuad', + complete: function () { + doneAnimating = true; + } + }); // End Velocity + } + + // Handle Exit triggers + $(window).on('scroll.materialbox', function () { + if (overlayActive) { + returnToOriginal(); + } + }); + + $(window).on('resize.materialbox', function () { + if (overlayActive) { + returnToOriginal(); + } + }); + + $(document).on('keyup.materialbox', function (e) { + // ESC key + if (e.keyCode === 27 && doneAnimating === true && overlayActive) { + returnToOriginal(); + } + }); + }); // End click handler + + + // This function returns the modaled image to the original spot + function returnToOriginal() { + + doneAnimating = false; + + var placeholder = origin.parent('.material-placeholder'); + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var originalWidth = origin.data('width'); + var originalHeight = origin.data('height'); + + origin.velocity("stop", true); + $('#materialbox-overlay').velocity("stop", true); + $('.materialbox-caption').velocity("stop", true); + + // disable exit handlers + $(window).off('scroll.materialbox'); + $(document).off('keyup.materialbox'); + $(window).off('resize.materialbox'); + + $('#materialbox-overlay').velocity({ opacity: 0 }, { + duration: outDuration, // Delay prevents animation overlapping + queue: false, easing: 'easeOutQuad', + complete: function () { + // Remove Overlay + overlayActive = false; + $(this).remove(); + } + }); + + // Resize Image + origin.velocity({ + width: originalWidth, + height: originalHeight, + left: 0, + top: 0 + }, { + duration: outDuration, + queue: false, easing: 'easeOutQuad', + complete: function () { + placeholder.css({ + height: '', + width: '', + position: '', + top: '', + left: '' + }); + + origin.removeAttr('style'); + origin.attr('style', originInlineStyles); + + // Remove class + origin.removeClass('active'); + doneAnimating = true; + + // Remove overflow overrides on ancestors + if (ancestorsChanged) { + ancestorsChanged.css('overflow', ''); + } + } + }); + + // Remove Caption + reset css settings on image + $('.materialbox-caption').velocity({ opacity: 0 }, { + duration: outDuration, // Delay prevents animation overlapping + queue: false, easing: 'easeOutQuad', + complete: function () { + $(this).remove(); + } + }); + } + }); + }; + + $(document).ready(function () { + $('.materialboxed').materialbox(); + }); +})(jQuery); +;(function ($) { + + $.fn.parallax = function () { + var window_width = $(window).width(); + // Parallax Scripts + return this.each(function (i) { + var $this = $(this); + $this.addClass('parallax'); + + function updateParallax(initial) { + var container_height; + if (window_width < 601) { + container_height = $this.height() > 0 ? $this.height() : $this.children("img").height(); + } else { + container_height = $this.height() > 0 ? $this.height() : 500; + } + var $img = $this.children("img").first(); + var img_height = $img.height(); + var parallax_dist = img_height - container_height; + var bottom = $this.offset().top + container_height; + var top = $this.offset().top; + var scrollTop = $(window).scrollTop(); + var windowHeight = window.innerHeight; + var windowBottom = scrollTop + windowHeight; + var percentScrolled = (windowBottom - top) / (container_height + windowHeight); + var parallax = Math.round(parallax_dist * percentScrolled); + + if (initial) { + $img.css('display', 'block'); + } + if (bottom > scrollTop && top < scrollTop + windowHeight) { + $img.css('transform', "translate3D(-50%," + parallax + "px, 0)"); + } + } + + // Wait for image load + $this.children("img").one("load", function () { + updateParallax(true); + }).each(function () { + if (this.complete) $(this).trigger("load"); + }); + + $(window).scroll(function () { + window_width = $(window).width(); + updateParallax(false); + }); + + $(window).resize(function () { + window_width = $(window).width(); + updateParallax(false); + }); + }); + }; +})(jQuery); +;(function ($) { + + var methods = { + init: function (options) { + var defaults = { + onShow: null, + swipeable: false, + responsiveThreshold: Infinity // breakpoint for swipeable + }; + options = $.extend(defaults, options); + var namespace = Materialize.objectSelectorString($(this)); + + return this.each(function (i) { + + var uniqueNamespace = namespace + i; + + // For each set of tabs, we want to keep track of + // which tab is active and its associated content + var $this = $(this), + window_width = $(window).width(); + + var $active, + $content, + $links = $this.find('li.tab a'), + $tabs_width = $this.width(), + $tabs_content = $(), + $tabs_wrapper, + $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length, + $indicator, + index = 0, + prev_index = 0, + clicked = false, + clickedTimeout, + transition = 300; + + // Finds right attribute for indicator based on active tab. + // el: jQuery Object + var calcRightPos = function (el) { + return Math.ceil($tabs_width - el.position().left - el[0].getBoundingClientRect().width - $this.scrollLeft()); + }; + + // Finds left attribute for indicator based on active tab. + // el: jQuery Object + var calcLeftPos = function (el) { + return Math.floor(el.position().left + $this.scrollLeft()); + }; + + // Animates Indicator to active tab. + // prev_index: Number + var animateIndicator = function (prev_index) { + if (index - prev_index >= 0) { + $indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' }); + $indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 }); + } else { + $indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' }); + $indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 }); + } + }; + + // Change swipeable according to responsive threshold + if (options.swipeable) { + if (window_width > options.responsiveThreshold) { + options.swipeable = false; + } + } + + // If the location.hash matches one of the links, use that as the active tab. + $active = $($links.filter('[href="' + location.hash + '"]')); + + // If no match is found, use the first link or any with class 'active' as the initial active tab. + if ($active.length === 0) { + $active = $(this).find('li.tab a.active').first(); + } + if ($active.length === 0) { + $active = $(this).find('li.tab a').first(); + } + + $active.addClass('active'); + index = $links.index($active); + if (index < 0) { + index = 0; + } + + if ($active[0] !== undefined) { + $content = $($active[0].hash); + $content.addClass('active'); + } + + // append indicator then set indicator width to tab width + if (!$this.find('.indicator').length) { + $this.append('
  • '); + } + $indicator = $this.find('.indicator'); + + // we make sure that the indicator is at the end of the tabs + $this.append($indicator); + + if ($this.is(":visible")) { + // $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)}); + // $indicator.css({"left": index * $tab_width}); + setTimeout(function () { + $indicator.css({ "right": calcRightPos($active) }); + $indicator.css({ "left": calcLeftPos($active) }); + }, 0); + } + $(window).off('resize.tabs-' + uniqueNamespace).on('resize.tabs-' + uniqueNamespace, function () { + $tabs_width = $this.width(); + $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length; + if (index < 0) { + index = 0; + } + if ($tab_width !== 0 && $tabs_width !== 0) { + $indicator.css({ "right": calcRightPos($active) }); + $indicator.css({ "left": calcLeftPos($active) }); + } + }); + + // Initialize Tabs Content. + if (options.swipeable) { + // TODO: Duplicate calls with swipeable? handle multiple div wrapping. + $links.each(function () { + var $curr_content = $(Materialize.escapeHash(this.hash)); + $curr_content.addClass('carousel-item'); + $tabs_content = $tabs_content.add($curr_content); + }); + $tabs_wrapper = $tabs_content.wrapAll(''); + $tabs_content.css('display', ''); + $('.tabs-content.carousel').carousel({ + fullWidth: true, + noWrap: true, + onCycleTo: function (item) { + if (!clicked) { + var prev_index = index; + index = $tabs_wrapper.index(item); + $active.removeClass('active'); + $active = $links.eq(index); + $active.addClass('active'); + animateIndicator(prev_index); + if (typeof options.onShow === "function") { + options.onShow.call($this[0], $content); + } + } + } + }); + } else { + // Hide the remaining content + $links.not($active).each(function () { + $(Materialize.escapeHash(this.hash)).hide(); + }); + } + + // Bind the click event handler + $this.off('click.tabs').on('click.tabs', 'a', function (e) { + if ($(this).parent().hasClass('disabled')) { + e.preventDefault(); + return; + } + + // Act as regular link if target attribute is specified. + if (!!$(this).attr("target")) { + return; + } + + clicked = true; + $tabs_width = $this.width(); + $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length; + + // Make the old tab inactive. + $active.removeClass('active'); + var $oldContent = $content; + + // Update the variables with the new link and content + $active = $(this); + $content = $(Materialize.escapeHash(this.hash)); + $links = $this.find('li.tab a'); + var activeRect = $active.position(); + + // Make the tab active. + $active.addClass('active'); + prev_index = index; + index = $links.index($(this)); + if (index < 0) { + index = 0; + } + // Change url to current tab + // window.location.hash = $active.attr('href'); + + // Swap content + if (options.swipeable) { + if ($tabs_content.length) { + $tabs_content.carousel('set', index, function () { + if (typeof options.onShow === "function") { + options.onShow.call($this[0], $content); + } + }); + } + } else { + if ($content !== undefined) { + $content.show(); + $content.addClass('active'); + if (typeof options.onShow === "function") { + options.onShow.call(this, $content); + } + } + + if ($oldContent !== undefined && !$oldContent.is($content)) { + $oldContent.hide(); + $oldContent.removeClass('active'); + } + } + + // Reset clicked state + clickedTimeout = setTimeout(function () { + clicked = false; + }, transition); + + // Update indicator + animateIndicator(prev_index); + + // Prevent the anchor's default click action + e.preventDefault(); + }); + }); + }, + select_tab: function (id) { + this.find('a[href="#' + id + '"]').trigger('click'); + } + }; + + $.fn.tabs = function (methodOrOptions) { + if (methods[methodOrOptions]) { + return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1)); + } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { + // Default to "init" + return methods.init.apply(this, arguments); + } else { + $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tabs'); + } + }; + + $(document).ready(function () { + $('ul.tabs').tabs(); + }); +})(jQuery); +;(function ($) { + $.fn.tooltip = function (options) { + var timeout = null, + margin = 5; + + // Defaults + var defaults = { + delay: 350, + tooltip: '', + position: 'bottom', + html: false + }; + + // Remove tooltip from the activator + if (options === "remove") { + this.each(function () { + $('#' + $(this).attr('data-tooltip-id')).remove(); + $(this).removeAttr('data-tooltip-id'); + $(this).off('mouseenter.tooltip mouseleave.tooltip'); + }); + return false; + } + + options = $.extend(defaults, options); + + return this.each(function () { + var tooltipId = Materialize.guid(); + var origin = $(this); + + // Destroy old tooltip + if (origin.attr('data-tooltip-id')) { + $('#' + origin.attr('data-tooltip-id')).remove(); + } + + origin.attr('data-tooltip-id', tooltipId); + + // Get attributes. + var allowHtml, tooltipDelay, tooltipPosition, tooltipText, tooltipEl, backdrop; + var setAttributes = function () { + allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html; + tooltipDelay = origin.attr('data-delay'); + tooltipDelay = tooltipDelay === undefined || tooltipDelay === '' ? options.delay : tooltipDelay; + tooltipPosition = origin.attr('data-position'); + tooltipPosition = tooltipPosition === undefined || tooltipPosition === '' ? options.position : tooltipPosition; + tooltipText = origin.attr('data-tooltip'); + tooltipText = tooltipText === undefined || tooltipText === '' ? options.tooltip : tooltipText; + }; + setAttributes(); + + var renderTooltipEl = function () { + var tooltip = $('
    '); + + // Create Text span + if (allowHtml) { + tooltipText = $('').html(tooltipText); + } else { + tooltipText = $('').text(tooltipText); + } + + // Create tooltip + tooltip.append(tooltipText).appendTo($('body')).attr('id', tooltipId); + + // Create backdrop + backdrop = $('
    '); + backdrop.appendTo(tooltip); + return tooltip; + }; + tooltipEl = renderTooltipEl(); + + // Destroy previously binded events + origin.off('mouseenter.tooltip mouseleave.tooltip'); + // Mouse In + var started = false, + timeoutRef; + origin.on({ 'mouseenter.tooltip': function (e) { + var showTooltip = function () { + setAttributes(); + started = true; + tooltipEl.velocity('stop'); + backdrop.velocity('stop'); + tooltipEl.css({ visibility: 'visible', left: '0px', top: '0px' }); + + // Tooltip positioning + var originWidth = origin.outerWidth(); + var originHeight = origin.outerHeight(); + var tooltipHeight = tooltipEl.outerHeight(); + var tooltipWidth = tooltipEl.outerWidth(); + var tooltipVerticalMovement = '0px'; + var tooltipHorizontalMovement = '0px'; + var backdropOffsetWidth = backdrop[0].offsetWidth; + var backdropOffsetHeight = backdrop[0].offsetHeight; + var scaleXFactor = 8; + var scaleYFactor = 8; + var scaleFactor = 0; + var targetTop, targetLeft, newCoordinates; + + if (tooltipPosition === "top") { + // Top Position + targetTop = origin.offset().top - tooltipHeight - margin; + targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + tooltipVerticalMovement = '-10px'; + backdrop.css({ + bottom: 0, + left: 0, + borderRadius: '14px 14px 0 0', + transformOrigin: '50% 100%', + marginTop: tooltipHeight, + marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2 + }); + } + // Left Position + else if (tooltipPosition === "left") { + targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2; + targetLeft = origin.offset().left - tooltipWidth - margin; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + + tooltipHorizontalMovement = '-10px'; + backdrop.css({ + top: '-7px', + right: 0, + width: '14px', + height: '14px', + borderRadius: '14px 0 0 14px', + transformOrigin: '95% 50%', + marginTop: tooltipHeight / 2, + marginLeft: tooltipWidth + }); + } + // Right Position + else if (tooltipPosition === "right") { + targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2; + targetLeft = origin.offset().left + originWidth + margin; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + + tooltipHorizontalMovement = '+10px'; + backdrop.css({ + top: '-7px', + left: 0, + width: '14px', + height: '14px', + borderRadius: '0 14px 14px 0', + transformOrigin: '5% 50%', + marginTop: tooltipHeight / 2, + marginLeft: '0px' + }); + } else { + // Bottom Position + targetTop = origin.offset().top + origin.outerHeight() + margin; + targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + tooltipVerticalMovement = '+10px'; + backdrop.css({ + top: 0, + left: 0, + marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2 + }); + } + + // Set tooptip css placement + tooltipEl.css({ + top: newCoordinates.y, + left: newCoordinates.x + }); + + // Calculate Scale to fill + scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth); + scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight); + scaleFactor = Math.max(scaleXFactor, scaleYFactor); + + tooltipEl.velocity({ translateY: tooltipVerticalMovement, translateX: tooltipHorizontalMovement }, { duration: 350, queue: false }).velocity({ opacity: 1 }, { duration: 300, delay: 50, queue: false }); + backdrop.css({ visibility: 'visible' }).velocity({ opacity: 1 }, { duration: 55, delay: 0, queue: false }).velocity({ scaleX: scaleFactor, scaleY: scaleFactor }, { duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad' }); + }; + + timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval + + // Mouse Out + }, + 'mouseleave.tooltip': function () { + // Reset State + started = false; + clearTimeout(timeoutRef); + + // Animate back + setTimeout(function () { + if (started !== true) { + tooltipEl.velocity({ + opacity: 0, translateY: 0, translateX: 0 }, { duration: 225, queue: false }); + backdrop.velocity({ opacity: 0, scaleX: 1, scaleY: 1 }, { + duration: 225, + queue: false, + complete: function () { + backdrop.css({ visibility: 'hidden' }); + tooltipEl.css({ visibility: 'hidden' }); + started = false; + } + }); + } + }, 225); + } + }); + }); + }; + + var repositionWithinScreen = function (x, y, width, height) { + var newX = x; + var newY = y; + + if (newX < 0) { + newX = 4; + } else if (newX + width > window.innerWidth) { + newX -= newX + width - window.innerWidth; + } + + if (newY < 0) { + newY = 4; + } else if (newY + height > window.innerHeight + $(window).scrollTop) { + newY -= newY + height - window.innerHeight; + } + + return { x: newX, y: newY }; + }; + + $(document).ready(function () { + $('.tooltipped').tooltip(); + }); +})(jQuery); +; /*! + * Waves v0.6.4 + * http://fian.my.id/Waves + * + * Copyright 2014 Alfiana E. Sibuea and other contributors + * Released under the MIT license + * https://github.com/fians/Waves/blob/master/LICENSE + */ + +;(function (window) { + 'use strict'; + + var Waves = Waves || {}; + var $$ = document.querySelectorAll.bind(document); + + // Find exact position of element + function isWindow(obj) { + return obj !== null && obj === obj.window; + } + + function getWindow(elem) { + return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView; + } + + function offset(elem) { + var docElem, + win, + box = { top: 0, left: 0 }, + doc = elem && elem.ownerDocument; + + docElem = doc.documentElement; + + if (typeof elem.getBoundingClientRect !== typeof undefined) { + box = elem.getBoundingClientRect(); + } + win = getWindow(doc); + return { + top: box.top + win.pageYOffset - docElem.clientTop, + left: box.left + win.pageXOffset - docElem.clientLeft + }; + } + + function convertStyle(obj) { + var style = ''; + + for (var a in obj) { + if (obj.hasOwnProperty(a)) { + style += a + ':' + obj[a] + ';'; + } + } + + return style; + } + + var Effect = { + + // Effect delay + duration: 750, + + show: function (e, element) { + + // Disable right click + if (e.button === 2) { + return false; + } + + var el = element || this; + + // Create ripple + var ripple = document.createElement('div'); + ripple.className = 'waves-ripple'; + el.appendChild(ripple); + + // Get click coordinate and element witdh + var pos = offset(el); + var relativeY = e.pageY - pos.top; + var relativeX = e.pageX - pos.left; + var scale = 'scale(' + el.clientWidth / 100 * 10 + ')'; + + // Support for touch devices + if ('touches' in e) { + relativeY = e.touches[0].pageY - pos.top; + relativeX = e.touches[0].pageX - pos.left; + } + + // Attach data to element + ripple.setAttribute('data-hold', Date.now()); + ripple.setAttribute('data-scale', scale); + ripple.setAttribute('data-x', relativeX); + ripple.setAttribute('data-y', relativeY); + + // Set ripple position + var rippleStyle = { + 'top': relativeY + 'px', + 'left': relativeX + 'px' + }; + + ripple.className = ripple.className + ' waves-notransition'; + ripple.setAttribute('style', convertStyle(rippleStyle)); + ripple.className = ripple.className.replace('waves-notransition', ''); + + // Scale the ripple + rippleStyle['-webkit-transform'] = scale; + rippleStyle['-moz-transform'] = scale; + rippleStyle['-ms-transform'] = scale; + rippleStyle['-o-transform'] = scale; + rippleStyle.transform = scale; + rippleStyle.opacity = '1'; + + rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms'; + rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms'; + rippleStyle['-o-transition-duration'] = Effect.duration + 'ms'; + rippleStyle['transition-duration'] = Effect.duration + 'ms'; + + rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + + ripple.setAttribute('style', convertStyle(rippleStyle)); + }, + + hide: function (e) { + TouchHandler.touchup(e); + + var el = this; + var width = el.clientWidth * 1.4; + + // Get first ripple + var ripple = null; + var ripples = el.getElementsByClassName('waves-ripple'); + if (ripples.length > 0) { + ripple = ripples[ripples.length - 1]; + } else { + return false; + } + + var relativeX = ripple.getAttribute('data-x'); + var relativeY = ripple.getAttribute('data-y'); + var scale = ripple.getAttribute('data-scale'); + + // Get delay beetween mousedown and mouse leave + var diff = Date.now() - Number(ripple.getAttribute('data-hold')); + var delay = 350 - diff; + + if (delay < 0) { + delay = 0; + } + + // Fade out ripple after delay + setTimeout(function () { + var style = { + 'top': relativeY + 'px', + 'left': relativeX + 'px', + 'opacity': '0', + + // Duration + '-webkit-transition-duration': Effect.duration + 'ms', + '-moz-transition-duration': Effect.duration + 'ms', + '-o-transition-duration': Effect.duration + 'ms', + 'transition-duration': Effect.duration + 'ms', + '-webkit-transform': scale, + '-moz-transform': scale, + '-ms-transform': scale, + '-o-transform': scale, + 'transform': scale + }; + + ripple.setAttribute('style', convertStyle(style)); + + setTimeout(function () { + try { + el.removeChild(ripple); + } catch (e) { + return false; + } + }, Effect.duration); + }, delay); + }, + + // Little hack to make can perform waves effect + wrapInput: function (elements) { + for (var a = 0; a < elements.length; a++) { + var el = elements[a]; + + if (el.tagName.toLowerCase() === 'input') { + var parent = el.parentNode; + + // If input already have parent just pass through + if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) { + continue; + } + + // Put element class and style to the specified parent + var wrapper = document.createElement('i'); + wrapper.className = el.className + ' waves-input-wrapper'; + + var elementStyle = el.getAttribute('style'); + + if (!elementStyle) { + elementStyle = ''; + } + + wrapper.setAttribute('style', elementStyle); + + el.className = 'waves-button-input'; + el.removeAttribute('style'); + + // Put element as child + parent.replaceChild(wrapper, el); + wrapper.appendChild(el); + } + } + } + }; + + /** + * Disable mousedown event for 500ms during and after touch + */ + var TouchHandler = { + /* uses an integer rather than bool so there's no issues with + * needing to clear timeouts if another touch event occurred + * within the 500ms. Cannot mouseup between touchstart and + * touchend, nor in the 500ms after touchend. */ + touches: 0, + allowEvent: function (e) { + var allow = true; + + if (e.type === 'touchstart') { + TouchHandler.touches += 1; //push + } else if (e.type === 'touchend' || e.type === 'touchcancel') { + setTimeout(function () { + if (TouchHandler.touches > 0) { + TouchHandler.touches -= 1; //pop after 500ms + } + }, 500); + } else if (e.type === 'mousedown' && TouchHandler.touches > 0) { + allow = false; + } + + return allow; + }, + touchup: function (e) { + TouchHandler.allowEvent(e); + } + }; + + /** + * Delegated click handler for .waves-effect element. + * returns null when .waves-effect element not in "click tree" + */ + function getWavesEffectElement(e) { + if (TouchHandler.allowEvent(e) === false) { + return null; + } + + var element = null; + var target = e.target || e.srcElement; + + while (target.parentNode !== null) { + if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) { + element = target; + break; + } + target = target.parentNode; + } + return element; + } + + /** + * Bubble the click and show effect if .waves-effect elem was found + */ + function showEffect(e) { + var element = getWavesEffectElement(e); + + if (element !== null) { + Effect.show(e, element); + + if ('ontouchstart' in window) { + element.addEventListener('touchend', Effect.hide, false); + element.addEventListener('touchcancel', Effect.hide, false); + } + + element.addEventListener('mouseup', Effect.hide, false); + element.addEventListener('mouseleave', Effect.hide, false); + element.addEventListener('dragend', Effect.hide, false); + } + } + + Waves.displayEffect = function (options) { + options = options || {}; + + if ('duration' in options) { + Effect.duration = options.duration; + } + + //Wrap input inside tag + Effect.wrapInput($$('.waves-effect')); + + if ('ontouchstart' in window) { + document.body.addEventListener('touchstart', showEffect, false); + } + + document.body.addEventListener('mousedown', showEffect, false); + }; + + /** + * Attach Waves to an input element (or any element which doesn't + * bubble mouseup/mousedown events). + * Intended to be used with dynamically loaded forms/inputs, or + * where the user doesn't want a delegated click handler. + */ + Waves.attach = function (element) { + //FUTURE: automatically add waves classes and allow users + // to specify them with an options param? Eg. light/classic/button + if (element.tagName.toLowerCase() === 'input') { + Effect.wrapInput([element]); + element = element.parentNode; + } + + if ('ontouchstart' in window) { + element.addEventListener('touchstart', showEffect, false); + } + + element.addEventListener('mousedown', showEffect, false); + }; + + window.Waves = Waves; + + document.addEventListener('DOMContentLoaded', function () { + Waves.displayEffect(); + }, false); +})(window); +;(function ($, Vel) { + 'use strict'; + + var _defaults = { + displayLength: Infinity, + inDuration: 300, + outDuration: 375, + className: undefined, + completeCallback: undefined, + activationPercent: 0.8 + }; + + var Toast = function () { + function Toast(message, displayLength, className, completeCallback) { + _classCallCheck(this, Toast); + + if (!message) { + return; + } + + /** + * Options for the toast + * @member Toast#options + */ + this.options = { + displayLength: displayLength, + className: className, + completeCallback: completeCallback + }; + + this.options = $.extend({}, Toast.defaults, this.options); + this.message = message; + + /** + * Describes current pan state toast + * @type {Boolean} + */ + this.panning = false; + + /** + * Time remaining until toast is removed + */ + this.timeRemaining = this.options.displayLength; + + if (Toast._toasts.length === 0) { + Toast._createContainer(); + } + + // Create new toast + Toast._toasts.push(this); + var toastElement = this.createToast(); + toastElement.M_Toast = this; + this.el = toastElement; + this._animateIn(); + this.setTimer(); + } + + _createClass(Toast, [{ + key: 'createToast', + + + /** + * Create toast and append it to toast container + */ + value: function createToast() { + var toast = document.createElement('div'); + toast.classList.add('toast'); + + // Add custom classes onto toast + if (this.options.className) { + var classes = this.options.className.split(' '); + var i = void 0, + count = void 0; + for (i = 0, count = classes.length; i < count; i++) { + toast.classList.add(classes[i]); + } + } + + // Set content + if (typeof HTMLElement === 'object' ? this.message instanceof HTMLElement : this.message && typeof this.message === 'object' && this.message !== null && this.message.nodeType === 1 && typeof this.message.nodeName === 'string') { + toast.appendChild(this.message); + + // Check if it is jQuery object + } else if (this.message instanceof jQuery) { + $(toast).append(this.message); + + // Insert as text; + } else { + toast.innerHTML = this.message; + } + + // Append toasft + Toast._container.appendChild(toast); + return toast; + } + + /** + * Animate in toast + */ + + }, { + key: '_animateIn', + value: function _animateIn() { + // Animate toast in + Vel(this.el, { top: 0, opacity: 1 }, { + duration: 300, + easing: 'easeOutCubic', + queue: false + }); + } + + /** + * Create setInterval which automatically removes toast when timeRemaining >= 0 + * has been reached + */ + + }, { + key: 'setTimer', + value: function setTimer() { + var _this3 = this; + + if (this.timeRemaining !== Infinity) { + this.counterInterval = setInterval(function () { + // If toast is not being dragged, decrease its time remaining + if (!_this3.panning) { + _this3.timeRemaining -= 20; + } + + // Animate toast out + if (_this3.timeRemaining <= 0) { + _this3.remove(); + } + }, 20); + } + } + + /** + * Dismiss toast with animation + */ + + }, { + key: 'remove', + value: function remove() { + var _this4 = this; + + window.clearInterval(this.counterInterval); + var activationDistance = this.el.offsetWidth * this.options.activationPercent; + + if (this.wasSwiped) { + this.el.style.transition = 'transform .05s, opacity .05s'; + this.el.style.transform = 'translateX(' + activationDistance + 'px)'; + this.el.style.opacity = 0; + } + + Vel(this.el, { opacity: 0, marginTop: '-40px' }, { + duration: this.options.outDuration, + easing: 'easeOutExpo', + queue: false, + complete: function () { + // Call the optional callback + if (typeof _this4.options.completeCallback === 'function') { + _this4.options.completeCallback(); + } + // Remove toast from DOM + _this4.el.parentNode.removeChild(_this4.el); + Toast._toasts.splice(Toast._toasts.indexOf(_this4), 1); + if (Toast._toasts.length === 0) { + Toast._removeContainer(); + } + } + }); + } + }], [{ + key: '_createContainer', + + + /** + * Append toast container and add event handlers + */ + value: function _createContainer() { + var container = document.createElement('div'); + container.setAttribute('id', 'toast-container'); + + // Add event handler + container.addEventListener('touchstart', Toast._onDragStart); + container.addEventListener('touchmove', Toast._onDragMove); + container.addEventListener('touchend', Toast._onDragEnd); + + container.addEventListener('mousedown', Toast._onDragStart); + document.addEventListener('mousemove', Toast._onDragMove); + document.addEventListener('mouseup', Toast._onDragEnd); + + document.body.appendChild(container); + Toast._container = container; + } + + /** + * Remove toast container and event handlers + */ + + }, { + key: '_removeContainer', + value: function _removeContainer() { + // Add event handler + document.removeEventListener('mousemove', Toast._onDragMove); + document.removeEventListener('mouseup', Toast._onDragEnd); + + Toast._container.parentNode.removeChild(Toast._container); + Toast._container = null; + } + + /** + * Begin drag handler + * @param {Event} e + */ + + }, { + key: '_onDragStart', + value: function _onDragStart(e) { + if (e.target && $(e.target).closest('.toast').length) { + var $toast = $(e.target).closest('.toast'); + var toast = $toast[0].M_Toast; + toast.panning = true; + Toast._draggedToast = toast; + toast.el.classList.add('panning'); + toast.el.style.transition = ''; + toast.startingXPos = Toast._xPos(e); + toast.time = Date.now(); + toast.xPos = Toast._xPos(e); + } + } + + /** + * Drag move handler + * @param {Event} e + */ + + }, { + key: '_onDragMove', + value: function _onDragMove(e) { + if (!!Toast._draggedToast) { + e.preventDefault(); + var toast = Toast._draggedToast; + toast.deltaX = Math.abs(toast.xPos - Toast._xPos(e)); + toast.xPos = Toast._xPos(e); + toast.velocityX = toast.deltaX / (Date.now() - toast.time); + toast.time = Date.now(); + + var totalDeltaX = toast.xPos - toast.startingXPos; + var activationDistance = toast.el.offsetWidth * toast.options.activationPercent; + toast.el.style.transform = 'translateX(' + totalDeltaX + 'px)'; + toast.el.style.opacity = 1 - Math.abs(totalDeltaX / activationDistance); + } + } + + /** + * End drag handler + * @param {Event} e + */ + + }, { + key: '_onDragEnd', + value: function _onDragEnd(e) { + if (!!Toast._draggedToast) { + var toast = Toast._draggedToast; + toast.panning = false; + toast.el.classList.remove('panning'); + + var totalDeltaX = toast.xPos - toast.startingXPos; + var activationDistance = toast.el.offsetWidth * toast.options.activationPercent; + var shouldBeDismissed = Math.abs(totalDeltaX) > activationDistance || toast.velocityX > 1; + + // Remove toast + if (shouldBeDismissed) { + toast.wasSwiped = true; + toast.remove(); + + // Animate toast back to original position + } else { + toast.el.style.transition = 'transform .2s, opacity .2s'; + toast.el.style.transform = ''; + toast.el.style.opacity = ''; + } + Toast._draggedToast = null; + } + } + + /** + * Get x position of mouse or touch event + * @param {Event} e + */ + + }, { + key: '_xPos', + value: function _xPos(e) { + if (e.targetTouches && e.targetTouches.length >= 1) { + return e.targetTouches[0].clientX; + } + // mouse event + return e.clientX; + } + + /** + * Remove all toasts + */ + + }, { + key: 'removeAll', + value: function removeAll() { + for (var toastIndex in Toast._toasts) { + Toast._toasts[toastIndex].remove(); + } + } + }, { + key: 'defaults', + get: function () { + return _defaults; + } + }]); + + return Toast; + }(); + + /** + * @static + * @memberof Toast + * @type {Array.} + */ + + + Toast._toasts = []; + + /** + * @static + * @memberof Toast + */ + Toast._container = null; + + /** + * @static + * @memberof Toast + * @type {Toast} + */ + Toast._draggedToast = null; + + Materialize.Toast = Toast; + Materialize.toast = function (message, displayLength, className, completeCallback) { + return new Toast(message, displayLength, className, completeCallback); + }; +})(jQuery, Materialize.Vel); +;(function ($) { + + var methods = { + init: function (options) { + var defaults = { + menuWidth: 300, + edge: 'left', + closeOnClick: false, + draggable: true, + onOpen: null, + onClose: null + }; + options = $.extend(defaults, options); + + $(this).each(function () { + var $this = $(this); + var menuId = $this.attr('data-activates'); + var menu = $("#" + menuId); + + // Set to width + if (options.menuWidth != 300) { + menu.css('width', options.menuWidth); + } + + // Add Touch Area + var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]'); + if (options.draggable) { + // Regenerate dragTarget + if ($dragTarget.length) { + $dragTarget.remove(); + } + + $dragTarget = $('
    ').attr('data-sidenav', menuId); + $('body').append($dragTarget); + } else { + $dragTarget = $(); + } + + if (options.edge == 'left') { + menu.css('transform', 'translateX(-100%)'); + $dragTarget.css({ 'left': 0 }); // Add Touch Area + } else { + menu.addClass('right-aligned') // Change text-alignment to right + .css('transform', 'translateX(100%)'); + $dragTarget.css({ 'right': 0 }); // Add Touch Area + } + + // If fixed sidenav, bring menu out + if (menu.hasClass('fixed')) { + if (window.innerWidth > 992) { + menu.css('transform', 'translateX(0)'); + } + } + + // Window resize to reset on large screens fixed + if (menu.hasClass('fixed')) { + $(window).resize(function () { + if (window.innerWidth > 992) { + // Close menu if window is resized bigger than 992 and user has fixed sidenav + if ($('#sidenav-overlay').length !== 0 && menuOut) { + removeMenu(true); + } else { + // menu.removeAttr('style'); + menu.css('transform', 'translateX(0%)'); + // menu.css('width', options.menuWidth); + } + } else if (menuOut === false) { + if (options.edge === 'left') { + menu.css('transform', 'translateX(-100%)'); + } else { + menu.css('transform', 'translateX(100%)'); + } + } + }); + } + + // if closeOnClick, then add close event for all a tags in side sideNav + if (options.closeOnClick === true) { + menu.on("click.itemclick", "a:not(.collapsible-header)", function () { + if (!(window.innerWidth > 992 && menu.hasClass('fixed'))) { + removeMenu(); + } + }); + } + + var removeMenu = function (restoreNav) { + panning = false; + menuOut = false; + // Reenable scrolling + $('body').css({ + overflow: '', + width: '' + }); + + $('#sidenav-overlay').velocity({ opacity: 0 }, { duration: 200, + queue: false, easing: 'easeOutQuad', + complete: function () { + $(this).remove(); + } }); + if (options.edge === 'left') { + // Reset phantom div + $dragTarget.css({ width: '', right: '', left: '0' }); + menu.velocity({ 'translateX': '-100%' }, { duration: 200, + queue: false, + easing: 'easeOutCubic', + complete: function () { + if (restoreNav === true) { + // Restore Fixed sidenav + menu.removeAttr('style'); + menu.css('width', options.menuWidth); + } + } + + }); + } else { + // Reset phantom div + $dragTarget.css({ width: '', right: '0', left: '' }); + menu.velocity({ 'translateX': '100%' }, { duration: 200, + queue: false, + easing: 'easeOutCubic', + complete: function () { + if (restoreNav === true) { + // Restore Fixed sidenav + menu.removeAttr('style'); + menu.css('width', options.menuWidth); + } + } + }); + } + + // Callback + if (typeof options.onClose === 'function') { + options.onClose.call(this, menu); + } + }; + + // Touch Event + var panning = false; + var menuOut = false; + + if (options.draggable) { + $dragTarget.on('click', function () { + if (menuOut) { + removeMenu(); + } + }); + + $dragTarget.hammer({ + prevent_default: false + }).on('pan', function (e) { + + if (e.gesture.pointerType == "touch") { + + var direction = e.gesture.direction; + var x = e.gesture.center.x; + var y = e.gesture.center.y; + var velocityX = e.gesture.velocityX; + + // Vertical scroll bugfix + if (x === 0 && y === 0) { + return; + } + + // Disable Scrolling + var $body = $('body'); + var $overlay = $('#sidenav-overlay'); + var oldWidth = $body.innerWidth(); + $body.css('overflow', 'hidden'); + $body.width(oldWidth); + + // If overlay does not exist, create one and if it is clicked, close menu + if ($overlay.length === 0) { + $overlay = $('
    '); + $overlay.css('opacity', 0).click(function () { + removeMenu(); + }); + + // Run 'onOpen' when sidenav is opened via touch/swipe if applicable + if (typeof options.onOpen === 'function') { + options.onOpen.call(this, menu); + } + + $('body').append($overlay); + } + + // Keep within boundaries + if (options.edge === 'left') { + if (x > options.menuWidth) { + x = options.menuWidth; + } else if (x < 0) { + x = 0; + } + } + + if (options.edge === 'left') { + // Left Direction + if (x < options.menuWidth / 2) { + menuOut = false; + } + // Right Direction + else if (x >= options.menuWidth / 2) { + menuOut = true; + } + menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)'); + } else { + // Left Direction + if (x < window.innerWidth - options.menuWidth / 2) { + menuOut = true; + } + // Right Direction + else if (x >= window.innerWidth - options.menuWidth / 2) { + menuOut = false; + } + var rightPos = x - options.menuWidth / 2; + if (rightPos < 0) { + rightPos = 0; + } + + menu.css('transform', 'translateX(' + rightPos + 'px)'); + } + + // Percentage overlay + var overlayPerc; + if (options.edge === 'left') { + overlayPerc = x / options.menuWidth; + $overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' }); + } else { + overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth); + $overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' }); + } + } + }).on('panend', function (e) { + + if (e.gesture.pointerType == "touch") { + var $overlay = $('#sidenav-overlay'); + var velocityX = e.gesture.velocityX; + var x = e.gesture.center.x; + var leftPos = x - options.menuWidth; + var rightPos = x - options.menuWidth / 2; + if (leftPos > 0) { + leftPos = 0; + } + if (rightPos < 0) { + rightPos = 0; + } + panning = false; + + if (options.edge === 'left') { + // If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut + if (menuOut && velocityX <= 0.3 || velocityX < -0.5) { + // Return menu to open + if (leftPos !== 0) { + menu.velocity({ 'translateX': [0, leftPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' }); + } + + $overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' }); + $dragTarget.css({ width: '50%', right: 0, left: '' }); + menuOut = true; + } else if (!menuOut || velocityX > 0.3) { + // Enable Scrolling + $('body').css({ + overflow: '', + width: '' + }); + // Slide menu closed + menu.velocity({ 'translateX': [-1 * options.menuWidth - 10, leftPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' }); + $overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad', + complete: function () { + // Run 'onClose' when sidenav is closed via touch/swipe if applicable + if (typeof options.onClose === 'function') { + options.onClose.call(this, menu); + } + + $(this).remove(); + } }); + $dragTarget.css({ width: '10px', right: '', left: 0 }); + } + } else { + if (menuOut && velocityX >= -0.3 || velocityX > 0.5) { + // Return menu to open + if (rightPos !== 0) { + menu.velocity({ 'translateX': [0, rightPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' }); + } + + $overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' }); + $dragTarget.css({ width: '50%', right: '', left: 0 }); + menuOut = true; + } else if (!menuOut || velocityX < -0.3) { + // Enable Scrolling + $('body').css({ + overflow: '', + width: '' + }); + + // Slide menu closed + menu.velocity({ 'translateX': [options.menuWidth + 10, rightPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' }); + $overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad', + complete: function () { + // Run 'onClose' when sidenav is closed via touch/swipe if applicable + if (typeof options.onClose === 'function') { + options.onClose.call(this, menu); + } + + $(this).remove(); + } }); + $dragTarget.css({ width: '10px', right: 0, left: '' }); + } + } + } + }); + } + + $this.off('click.sidenav').on('click.sidenav', function () { + if (menuOut === true) { + menuOut = false; + panning = false; + removeMenu(); + } else { + + // Disable Scrolling + var $body = $('body'); + var $overlay = $('
    '); + var oldWidth = $body.innerWidth(); + $body.css('overflow', 'hidden'); + $body.width(oldWidth); + + // Push current drag target on top of DOM tree + $('body').append($dragTarget); + + if (options.edge === 'left') { + $dragTarget.css({ width: '50%', right: 0, left: '' }); + menu.velocity({ 'translateX': [0, -1 * options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' }); + } else { + $dragTarget.css({ width: '50%', right: '', left: 0 }); + menu.velocity({ 'translateX': [0, options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' }); + } + + // Overlay close on click + $overlay.css('opacity', 0).click(function () { + menuOut = false; + panning = false; + removeMenu(); + $overlay.velocity({ opacity: 0 }, { duration: 300, queue: false, easing: 'easeOutQuad', + complete: function () { + $(this).remove(); + } + }); + }); + + // Append body + $('body').append($overlay); + $overlay.velocity({ opacity: 1 }, { duration: 300, queue: false, easing: 'easeOutQuad', + complete: function () { + menuOut = true; + panning = false; + } + }); + + // Callback + if (typeof options.onOpen === 'function') { + options.onOpen.call(this, menu); + } + } + + return false; + }); + }); + }, + destroy: function () { + var $overlay = $('#sidenav-overlay'); + var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]'); + $overlay.trigger('click'); + $dragTarget.remove(); + $(this).off('click'); + $overlay.remove(); + }, + show: function () { + this.trigger('click'); + }, + hide: function () { + $('#sidenav-overlay').trigger('click'); + } + }; + + $.fn.sideNav = function (methodOrOptions) { + if (methods[methodOrOptions]) { + return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1)); + } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { + // Default to "init" + return methods.init.apply(this, arguments); + } else { + $.error('Method ' + methodOrOptions + ' does not exist on jQuery.sideNav'); + } + }; // Plugin end +})(jQuery); +; /** + * Extend jquery with a scrollspy plugin. + * This watches the window scroll and fires events when elements are scrolled into viewport. + * + * throttle() and getTime() taken from Underscore.js + * https://github.com/jashkenas/underscore + * + * @author Copyright 2013 John Smart + * @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE + * @see https://github.com/thesmart + * @version 0.1.2 + */ +(function ($) { + + var jWindow = $(window); + var elements = []; + var elementsInView = []; + var isSpying = false; + var ticks = 0; + var unique_id = 1; + var offset = { + top: 0, + right: 0, + bottom: 0, + left: 0 + + /** + * Find elements that are within the boundary + * @param {number} top + * @param {number} right + * @param {number} bottom + * @param {number} left + * @return {jQuery} A collection of elements + */ + };function findElements(top, right, bottom, left) { + var hits = $(); + $.each(elements, function (i, element) { + if (element.height() > 0) { + var elTop = element.offset().top, + elLeft = element.offset().left, + elRight = elLeft + element.width(), + elBottom = elTop + element.height(); + + var isIntersect = !(elLeft > right || elRight < left || elTop > bottom || elBottom < top); + + if (isIntersect) { + hits.push(element); + } + } + }); + + return hits; + } + + /** + * Called when the user scrolls the window + */ + function onScroll(scrollOffset) { + // unique tick id + ++ticks; + + // viewport rectangle + var top = jWindow.scrollTop(), + left = jWindow.scrollLeft(), + right = left + jWindow.width(), + bottom = top + jWindow.height(); + + // determine which elements are in view + var intersections = findElements(top + offset.top + scrollOffset || 200, right + offset.right, bottom + offset.bottom, left + offset.left); + $.each(intersections, function (i, element) { + + var lastTick = element.data('scrollSpy:ticks'); + if (typeof lastTick != 'number') { + // entered into view + element.triggerHandler('scrollSpy:enter'); + } + + // update tick id + element.data('scrollSpy:ticks', ticks); + }); + + // determine which elements are no longer in view + $.each(elementsInView, function (i, element) { + var lastTick = element.data('scrollSpy:ticks'); + if (typeof lastTick == 'number' && lastTick !== ticks) { + // exited from view + element.triggerHandler('scrollSpy:exit'); + element.data('scrollSpy:ticks', null); + } + }); + + // remember elements in view for next tick + elementsInView = intersections; + } + + /** + * Called when window is resized + */ + function onWinSize() { + jWindow.trigger('scrollSpy:winSize'); + } + + /** + * Enables ScrollSpy using a selector + * @param {jQuery|string} selector The elements collection, or a selector + * @param {Object=} options Optional. + throttle : number -> scrollspy throttling. Default: 100 ms + offsetTop : number -> offset from top. Default: 0 + offsetRight : number -> offset from right. Default: 0 + offsetBottom : number -> offset from bottom. Default: 0 + offsetLeft : number -> offset from left. Default: 0 + activeClass : string -> Class name to be added to the active link. Default: active + * @returns {jQuery} + */ + $.scrollSpy = function (selector, options) { + var defaults = { + throttle: 100, + scrollOffset: 200, // offset - 200 allows elements near bottom of page to scroll + activeClass: 'active', + getActiveElement: function (id) { + return 'a[href="#' + id + '"]'; + } + }; + options = $.extend(defaults, options); + + var visible = []; + selector = $(selector); + selector.each(function (i, element) { + elements.push($(element)); + $(element).data("scrollSpy:id", i); + // Smooth scroll to section + $('a[href="#' + $(element).attr('id') + '"]').click(function (e) { + e.preventDefault(); + var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1; + $('html, body').animate({ scrollTop: offset - options.scrollOffset }, { duration: 400, queue: false, easing: 'easeOutCubic' }); + }); + }); + + offset.top = options.offsetTop || 0; + offset.right = options.offsetRight || 0; + offset.bottom = options.offsetBottom || 0; + offset.left = options.offsetLeft || 0; + + var throttledScroll = Materialize.throttle(function () { + onScroll(options.scrollOffset); + }, options.throttle || 100); + var readyScroll = function () { + $(document).ready(throttledScroll); + }; + + if (!isSpying) { + jWindow.on('scroll', readyScroll); + jWindow.on('resize', readyScroll); + isSpying = true; + } + + // perform a scan once, after current execution context, and after dom is ready + setTimeout(readyScroll, 0); + + selector.on('scrollSpy:enter', function () { + visible = $.grep(visible, function (value) { + return value.height() != 0; + }); + + var $this = $(this); + + if (visible[0]) { + $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass); + if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) { + visible.unshift($(this)); + } else { + visible.push($(this)); + } + } else { + visible.push($(this)); + } + + $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass); + }); + selector.on('scrollSpy:exit', function () { + visible = $.grep(visible, function (value) { + return value.height() != 0; + }); + + if (visible[0]) { + $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass); + var $this = $(this); + visible = $.grep(visible, function (value) { + return value.attr('id') != $this.attr('id'); + }); + if (visible[0]) { + // Check if empty + $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass); + } + } + }); + + return selector; + }; + + /** + * Listen for window resize events + * @param {Object=} options Optional. Set { throttle: number } to change throttling. Default: 100 ms + * @returns {jQuery} $(window) + */ + $.winSizeSpy = function (options) { + $.winSizeSpy = function () { + return jWindow; + }; // lock from multiple calls + options = options || { + throttle: 100 + }; + return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100)); + }; + + /** + * Enables ScrollSpy on a collection of elements + * e.g. $('.scrollSpy').scrollSpy() + * @param {Object=} options Optional. + throttle : number -> scrollspy throttling. Default: 100 ms + offsetTop : number -> offset from top. Default: 0 + offsetRight : number -> offset from right. Default: 0 + offsetBottom : number -> offset from bottom. Default: 0 + offsetLeft : number -> offset from left. Default: 0 + * @returns {jQuery} + */ + $.fn.scrollSpy = function (options) { + return $.scrollSpy($(this), options); + }; +})(jQuery); +;(function ($) { + $(document).ready(function () { + + // Function to update labels of text fields + Materialize.updateTextFields = function () { + var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea'; + $(input_selector).each(function (index, element) { + var $this = $(this); + if ($(element).val().length > 0 || $(element).is(':focus') || element.autofocus || $this.attr('placeholder') !== undefined) { + $this.siblings('label').addClass('active'); + } else if ($(element)[0].validity) { + $this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true); + } else { + $this.siblings('label').removeClass('active'); + } + }); + }; + + // Text based inputs + var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea'; + + // Add active if form auto complete + $(document).on('change', input_selector, function () { + if ($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) { + $(this).siblings('label').addClass('active'); + } + validate_field($(this)); + }); + + // Add active if input element has been pre-populated on document ready + $(document).ready(function () { + Materialize.updateTextFields(); + }); + + // HTML DOM FORM RESET handling + $(document).on('reset', function (e) { + var formReset = $(e.target); + if (formReset.is('form')) { + formReset.find(input_selector).removeClass('valid').removeClass('invalid'); + formReset.find(input_selector).each(function () { + if ($(this).attr('value') === '') { + $(this).siblings('label').removeClass('active'); + } + }); + + // Reset select + formReset.find('select.initialized').each(function () { + var reset_text = formReset.find('option[selected]').text(); + formReset.siblings('input.select-dropdown').val(reset_text); + }); + } + }); + + // Add active when element has focus + $(document).on('focus', input_selector, function () { + $(this).siblings('label, .prefix').addClass('active'); + }); + + $(document).on('blur', input_selector, function () { + var $inputElement = $(this); + var selector = ".prefix"; + + if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) { + selector += ", label"; + } + + $inputElement.siblings(selector).removeClass('active'); + + validate_field($inputElement); + }); + + window.validate_field = function (object) { + var hasLength = object.attr('data-length') !== undefined; + var lenAttr = parseInt(object.attr('data-length')); + var len = object.val().length; + + if (object.val().length === 0 && object[0].validity.badInput === false && !object.is(':required')) { + if (object.hasClass('validate')) { + object.removeClass('valid'); + object.removeClass('invalid'); + } + } else { + if (object.hasClass('validate')) { + // Check for character counter attributes + if (object.is(':valid') && hasLength && len <= lenAttr || object.is(':valid') && !hasLength) { + object.removeClass('invalid'); + object.addClass('valid'); + } else { + object.removeClass('valid'); + object.addClass('invalid'); + } + } + } + }; + + // Radio and Checkbox focus class + var radio_checkbox = 'input[type=radio], input[type=checkbox]'; + $(document).on('keyup.radio', radio_checkbox, function (e) { + // TAB, check if tabbing to radio or checkbox. + if (e.which === 9) { + $(this).addClass('tabbed'); + var $this = $(this); + $this.one('blur', function (e) { + + $(this).removeClass('tabbed'); + }); + return; + } + }); + + // Textarea Auto Resize + var hiddenDiv = $('.hiddendiv').first(); + if (!hiddenDiv.length) { + hiddenDiv = $('
    '); + $('body').append(hiddenDiv); + } + var text_area_selector = '.materialize-textarea'; + + function textareaAutoResize($textarea) { + // Set font properties of hiddenDiv + + var fontFamily = $textarea.css('font-family'); + var fontSize = $textarea.css('font-size'); + var lineHeight = $textarea.css('line-height'); + var padding = $textarea.css('padding'); + + if (fontSize) { + hiddenDiv.css('font-size', fontSize); + } + if (fontFamily) { + hiddenDiv.css('font-family', fontFamily); + } + if (lineHeight) { + hiddenDiv.css('line-height', lineHeight); + } + if (padding) { + hiddenDiv.css('padding', padding); + } + + // Set original-height, if none + if (!$textarea.data('original-height')) { + $textarea.data('original-height', $textarea.height()); + } + + if ($textarea.attr('wrap') === 'off') { + hiddenDiv.css('overflow-wrap', 'normal').css('white-space', 'pre'); + } + + hiddenDiv.text($textarea.val() + '\n'); + var content = hiddenDiv.html().replace(/\n/g, '
    '); + hiddenDiv.html(content); + + // When textarea is hidden, width goes crazy. + // Approximate with half of window size + + if ($textarea.is(':visible')) { + hiddenDiv.css('width', $textarea.width()); + } else { + hiddenDiv.css('width', $(window).width() / 2); + } + + /** + * Resize if the new height is greater than the + * original height of the textarea + */ + if ($textarea.data('original-height') <= hiddenDiv.height()) { + $textarea.css('height', hiddenDiv.height()); + } else if ($textarea.val().length < $textarea.data('previous-length')) { + /** + * In case the new height is less than original height, it + * means the textarea has less text than before + * So we set the height to the original one + */ + $textarea.css('height', $textarea.data('original-height')); + } + $textarea.data('previous-length', $textarea.val().length); + } + + $(text_area_selector).each(function () { + var $textarea = $(this); + /** + * Instead of resizing textarea on document load, + * store the original height and the original length + */ + $textarea.data('original-height', $textarea.height()); + $textarea.data('previous-length', $textarea.val().length); + }); + + $('body').on('keyup keydown autoresize', text_area_selector, function () { + textareaAutoResize($(this)); + }); + + // File Input Path + $(document).on('change', '.file-field input[type="file"]', function () { + var file_field = $(this).closest('.file-field'); + var path_input = file_field.find('input.file-path'); + var files = $(this)[0].files; + var file_names = []; + for (var i = 0; i < files.length; i++) { + file_names.push(files[i].name); + } + path_input.val(file_names.join(", ")); + path_input.trigger('change'); + }); + + /**************** + * Range Input * + ****************/ + + var range_type = 'input[type=range]'; + var range_mousedown = false; + var left; + + $(range_type).each(function () { + var thumb = $(''); + $(this).after(thumb); + }); + + var showRangeBubble = function (thumb) { + var paddingLeft = parseInt(thumb.parent().css('padding-left')); + var marginLeft = -7 + paddingLeft + 'px'; + thumb.velocity({ height: "30px", width: "30px", top: "-30px", marginLeft: marginLeft }, { duration: 300, easing: 'easeOutExpo' }); + }; + + var calcRangeOffset = function (range) { + var width = range.width() - 15; + var max = parseFloat(range.attr('max')); + var min = parseFloat(range.attr('min')); + var percent = (parseFloat(range.val()) - min) / (max - min); + return percent * width; + }; + + var range_wrapper = '.range-field'; + $(document).on('change', range_type, function (e) { + var thumb = $(this).siblings('.thumb'); + thumb.find('.value').html($(this).val()); + + if (!thumb.hasClass('active')) { + showRangeBubble(thumb); + } + + var offsetLeft = calcRangeOffset($(this)); + thumb.addClass('active').css('left', offsetLeft); + }); + + $(document).on('mousedown touchstart', range_type, function (e) { + var thumb = $(this).siblings('.thumb'); + + // If thumb indicator does not exist yet, create it + if (thumb.length <= 0) { + thumb = $(''); + $(this).after(thumb); + } + + // Set indicator value + thumb.find('.value').html($(this).val()); + + range_mousedown = true; + $(this).addClass('active'); + + if (!thumb.hasClass('active')) { + showRangeBubble(thumb); + } + + if (e.type !== 'input') { + var offsetLeft = calcRangeOffset($(this)); + thumb.addClass('active').css('left', offsetLeft); + } + }); + + $(document).on('mouseup touchend', range_wrapper, function () { + range_mousedown = false; + $(this).removeClass('active'); + }); + + $(document).on('input mousemove touchmove', range_wrapper, function (e) { + var thumb = $(this).children('.thumb'); + var left; + var input = $(this).find(range_type); + + if (range_mousedown) { + if (!thumb.hasClass('active')) { + showRangeBubble(thumb); + } + + var offsetLeft = calcRangeOffset(input); + thumb.addClass('active').css('left', offsetLeft); + thumb.find('.value').html(thumb.siblings(range_type).val()); + } + }); + + $(document).on('mouseout touchleave', range_wrapper, function () { + if (!range_mousedown) { + + var thumb = $(this).children('.thumb'); + var paddingLeft = parseInt($(this).css('padding-left')); + var marginLeft = 7 + paddingLeft + 'px'; + + if (thumb.hasClass('active')) { + thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: marginLeft }, { duration: 100 }); + } + thumb.removeClass('active'); + } + }); + + /************************** + * Auto complete plugin * + *************************/ + $.fn.autocomplete = function (options) { + // Defaults + var defaults = { + data: {}, + limit: Infinity, + onAutocomplete: null, + minLength: 1 + }; + + options = $.extend(defaults, options); + + return this.each(function () { + var $input = $(this); + var data = options.data, + count = 0, + activeIndex = -1, + oldVal, + $inputDiv = $input.closest('.input-field'); // Div to append on + + // Check if data isn't empty + if (!$.isEmptyObject(data)) { + var $autocomplete = $(''); + var $oldAutocomplete; + + // Append autocomplete element. + // Prevent double structure init. + if ($inputDiv.length) { + $oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first(); + if (!$oldAutocomplete.length) { + $inputDiv.append($autocomplete); // Set ul in body + } + } else { + $oldAutocomplete = $input.next('.autocomplete-content.dropdown-content'); + if (!$oldAutocomplete.length) { + $input.after($autocomplete); + } + } + if ($oldAutocomplete.length) { + $autocomplete = $oldAutocomplete; + } + + // Highlight partial match. + var highlight = function (string, $el) { + var img = $el.find('img'); + var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""), + matchEnd = matchStart + string.length - 1, + beforeMatch = $el.text().slice(0, matchStart), + matchText = $el.text().slice(matchStart, matchEnd + 1), + afterMatch = $el.text().slice(matchEnd + 1); + $el.html("" + beforeMatch + "" + matchText + "" + afterMatch + ""); + if (img.length) { + $el.prepend(img); + } + }; + + // Reset current element position + var resetCurrentElement = function () { + activeIndex = -1; + $autocomplete.find('.active').removeClass('active'); + }; + + // Remove autocomplete elements + var removeAutocomplete = function () { + $autocomplete.empty(); + resetCurrentElement(); + oldVal = undefined; + }; + + $input.off('blur.autocomplete').on('blur.autocomplete', function () { + removeAutocomplete(); + }); + + // Perform search + $input.off('keyup.autocomplete focus.autocomplete').on('keyup.autocomplete focus.autocomplete', function (e) { + // Reset count. + count = 0; + var val = $input.val().toLowerCase(); + + // Don't capture enter or arrow key usage. + if (e.which === 13 || e.which === 38 || e.which === 40) { + return; + } + + // Check if the input isn't empty + if (oldVal !== val) { + removeAutocomplete(); + + if (val.length >= options.minLength) { + for (var key in data) { + if (data.hasOwnProperty(key) && key.toLowerCase().indexOf(val) !== -1) { + // Break if past limit + if (count >= options.limit) { + break; + } + + var autocompleteOption = $('
  • '); + if (!!data[key]) { + autocompleteOption.append('' + key + ''); + } else { + autocompleteOption.append('' + key + ''); + } + + $autocomplete.append(autocompleteOption); + highlight(val, autocompleteOption); + count++; + } + } + } + } + + // Update oldVal + oldVal = val; + }); + + $input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) { + // Arrow keys and enter key usage + var keyCode = e.which, + liElement, + numItems = $autocomplete.children('li').length, + $active = $autocomplete.children('.active').first(); + + // select element on Enter + if (keyCode === 13 && activeIndex >= 0) { + liElement = $autocomplete.children('li').eq(activeIndex); + if (liElement.length) { + liElement.trigger('mousedown.autocomplete'); + e.preventDefault(); + } + return; + } + + // Capture up and down key + if (keyCode === 38 || keyCode === 40) { + e.preventDefault(); + + if (keyCode === 38 && activeIndex > 0) { + activeIndex--; + } + + if (keyCode === 40 && activeIndex < numItems - 1) { + activeIndex++; + } + + $active.removeClass('active'); + if (activeIndex >= 0) { + $autocomplete.children('li').eq(activeIndex).addClass('active'); + } + } + }); + + // Set input value + $autocomplete.off('mousedown.autocomplete touchstart.autocomplete').on('mousedown.autocomplete touchstart.autocomplete', 'li', function () { + var text = $(this).text().trim(); + $input.val(text); + $input.trigger('change'); + removeAutocomplete(); + + // Handle onAutocomplete callback. + if (typeof options.onAutocomplete === "function") { + options.onAutocomplete.call(this, text); + } + }); + + // Empty data + } else { + $input.off('keyup.autocomplete focus.autocomplete'); + } + }); + }; + }); // End of $(document).ready + + /******************* + * Select Plugin * + ******************/ + $.fn.material_select = function (callback) { + $(this).each(function () { + var $select = $(this); + + if ($select.hasClass('browser-default')) { + return; // Continue to next (return false breaks out of entire loop) + } + + var multiple = $select.attr('multiple') ? true : false, + lastID = $select.attr('data-select-id'); // Tear down structure if Select needs to be rebuilt + + if (lastID) { + $select.parent().find('span.caret').remove(); + $select.parent().find('input').remove(); + + $select.unwrap(); + $('ul#select-options-' + lastID).remove(); + } + + // If destroying the select, remove the selelct-id and reset it to it's uninitialized state. + if (callback === 'destroy') { + $select.removeAttr('data-select-id').removeClass('initialized'); + $(window).off('click.select'); + return; + } + + var uniqueID = Materialize.guid(); + $select.attr('data-select-id', uniqueID); + var wrapper = $('
    '); + wrapper.addClass($select.attr('class')); + if ($select.is(':disabled')) wrapper.addClass('disabled'); + var options = $(''), + selectChildren = $select.children('option, optgroup'), + valuesSelected = [], + optionsHover = false; + + var label = $select.find('option:selected').html() || $select.find('option:first').html() || ""; + + // Function that renders and appends the option taking into + // account type and possible image icon. + var appendOptionWithIcon = function (select, option, type) { + // Add disabled attr if disabled + var disabledClass = option.is(':disabled') ? 'disabled ' : ''; + var optgroupClass = type === 'optgroup-option' ? 'optgroup-option ' : ''; + var multipleCheckbox = multiple ? '' : ''; + + // add icons + var icon_url = option.data('icon'); + var classes = option.attr('class'); + if (!!icon_url) { + var classString = ''; + if (!!classes) classString = ' class="' + classes + '"'; + + // Check for multiple type. + options.append($('
  • ' + multipleCheckbox + option.html() + '
  • ')); + return true; + } + + // Check for multiple type. + options.append($('
  • ' + multipleCheckbox + option.html() + '
  • ')); + }; + + /* Create dropdown structure. */ + if (selectChildren.length) { + selectChildren.each(function () { + if ($(this).is('option')) { + // Direct descendant option. + if (multiple) { + appendOptionWithIcon($select, $(this), 'multiple'); + } else { + appendOptionWithIcon($select, $(this)); + } + } else if ($(this).is('optgroup')) { + // Optgroup. + var selectOptions = $(this).children('option'); + options.append($('
  • ' + $(this).attr('label') + '
  • ')); + + selectOptions.each(function () { + appendOptionWithIcon($select, $(this), 'optgroup-option'); + }); + } + }); + } + + options.find('li:not(.optgroup)').each(function (i) { + $(this).click(function (e) { + // Check if option element is disabled + if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) { + var selected = true; + + if (multiple) { + $('input[type="checkbox"]', this).prop('checked', function (i, v) { + return !v; + }); + selected = toggleEntryFromArray(valuesSelected, i, $select); + $newSelect.trigger('focus'); + } else { + options.find('li').removeClass('active'); + $(this).toggleClass('active'); + $newSelect.val($(this).text()); + } + + activateOption(options, $(this)); + $select.find('option').eq(i).prop('selected', selected); + // Trigger onchange() event + $select.trigger('change'); + if (typeof callback !== 'undefined') callback(); + } + + e.stopPropagation(); + }); + }); + + // Wrap Elements + $select.wrap(wrapper); + // Add Select Display Element + var dropdownIcon = $(''); + + // escape double quotes + var sanitizedLabelHtml = label.replace(/"/g, '"'); + + var $newSelect = $(''); + $select.before($newSelect); + $newSelect.before(dropdownIcon); + + $newSelect.after(options); + // Check if section element is disabled + if (!$select.is(':disabled')) { + $newSelect.dropdown({ 'hover': false }); + } + + // Copy tabindex + if ($select.attr('tabindex')) { + $($newSelect[0]).attr('tabindex', $select.attr('tabindex')); + } + + $select.addClass('initialized'); + + $newSelect.on({ + 'focus': function () { + if ($('ul.select-dropdown').not(options[0]).is(':visible')) { + $('input.select-dropdown').trigger('close'); + $(window).off('click.select'); + } + if (!options.is(':visible')) { + $(this).trigger('open', ['focus']); + var label = $(this).val(); + if (multiple && label.indexOf(',') >= 0) { + label = label.split(',')[0]; + } + + var selectedOption = options.find('li').filter(function () { + return $(this).text().toLowerCase() === label.toLowerCase(); + })[0]; + activateOption(options, selectedOption, true); + + $(window).off('click.select').on('click.select', function () { + multiple && (optionsHover || $newSelect.trigger('close')); + $(window).off('click.select'); + }); + } + }, + 'click': function (e) { + e.stopPropagation(); + } + }); + + $newSelect.on('blur', function () { + if (!multiple) { + $(this).trigger('close'); + $(window).off('click.select'); + } + options.find('li.selected').removeClass('selected'); + }); + + options.hover(function () { + optionsHover = true; + }, function () { + optionsHover = false; + }); + + // Add initial multiple selections. + if (multiple) { + $select.find("option:selected:not(:disabled)").each(function () { + var index = this.index; + + toggleEntryFromArray(valuesSelected, index, $select); + options.find("li:not(.optgroup)").eq(index).find(":checkbox").prop("checked", true); + }); + } + + /** + * Make option as selected and scroll to selected position + * @param {jQuery} collection Select options jQuery element + * @param {Element} newOption element of the new option + * @param {Boolean} firstActivation If on first activation of select + */ + var activateOption = function (collection, newOption, firstActivation) { + if (newOption) { + collection.find('li.selected').removeClass('selected'); + var option = $(newOption); + option.addClass('selected'); + if (!multiple || !!firstActivation) { + options.scrollTo(option); + } + } + }; + + // Allow user to search by typing + // this array is cleared after 1 second + var filterQuery = [], + onKeyDown = function (e) { + // TAB - switch to another input + if (e.which == 9) { + $newSelect.trigger('close'); + return; + } + + // ARROW DOWN WHEN SELECT IS CLOSED - open select options + if (e.which == 40 && !options.is(':visible')) { + $newSelect.trigger('open'); + return; + } + + // ENTER WHEN SELECT IS CLOSED - submit form + if (e.which == 13 && !options.is(':visible')) { + return; + } + + e.preventDefault(); + + // CASE WHEN USER TYPE LETTERS + var letter = String.fromCharCode(e.which).toLowerCase(), + nonLetters = [9, 13, 27, 38, 40]; + if (letter && nonLetters.indexOf(e.which) === -1) { + filterQuery.push(letter); + + var string = filterQuery.join(''), + newOption = options.find('li').filter(function () { + return $(this).text().toLowerCase().indexOf(string) === 0; + })[0]; + + if (newOption) { + activateOption(options, newOption); + } + } + + // ENTER - select option and close when select options are opened + if (e.which == 13) { + var activeOption = options.find('li.selected:not(.disabled)')[0]; + if (activeOption) { + $(activeOption).trigger('click'); + if (!multiple) { + $newSelect.trigger('close'); + } + } + } + + // ARROW DOWN - move to next not disabled option + if (e.which == 40) { + if (options.find('li.selected').length) { + newOption = options.find('li.selected').next('li:not(.disabled)')[0]; + } else { + newOption = options.find('li:not(.disabled)')[0]; + } + activateOption(options, newOption); + } + + // ESC - close options + if (e.which == 27) { + $newSelect.trigger('close'); + } + + // ARROW UP - move to previous not disabled option + if (e.which == 38) { + newOption = options.find('li.selected').prev('li:not(.disabled)')[0]; + if (newOption) activateOption(options, newOption); + } + + // Automaticaly clean filter query so user can search again by starting letters + setTimeout(function () { + filterQuery = []; + }, 1000); + }; + + $newSelect.on('keydown', onKeyDown); + }); + + function toggleEntryFromArray(entriesArray, entryIndex, select) { + var index = entriesArray.indexOf(entryIndex), + notAdded = index === -1; + + if (notAdded) { + entriesArray.push(entryIndex); + } else { + entriesArray.splice(index, 1); + } + + select.siblings('ul.dropdown-content').find('li:not(.optgroup)').eq(entryIndex).toggleClass('active'); + + // use notAdded instead of true (to detect if the option is selected or not) + select.find('option').eq(entryIndex).prop('selected', notAdded); + setValueToInput(entriesArray, select); + + return notAdded; + } + + function setValueToInput(entriesArray, select) { + var value = ''; + + for (var i = 0, count = entriesArray.length; i < count; i++) { + var text = select.find('option').eq(entriesArray[i]).text(); + + i === 0 ? value += text : value += ', ' + text; + } + + if (value === '') { + value = select.find('option:disabled').eq(0).text(); + } + + select.siblings('input.select-dropdown').val(value); + } + }; +})(jQuery); +;(function ($) { + + var methods = { + + init: function (options) { + var defaults = { + indicators: true, + height: 400, + transition: 500, + interval: 6000 + }; + options = $.extend(defaults, options); + + return this.each(function () { + + // For each slider, we want to keep track of + // which slide is active and its associated content + var $this = $(this); + var $slider = $this.find('ul.slides').first(); + var $slides = $slider.find('> li'); + var $active_index = $slider.find('.active').index(); + var $active, $indicators, $interval; + if ($active_index != -1) { + $active = $slides.eq($active_index); + } + + // Transitions the caption depending on alignment + function captionTransition(caption, duration) { + if (caption.hasClass("center-align")) { + caption.velocity({ opacity: 0, translateY: -100 }, { duration: duration, queue: false }); + } else if (caption.hasClass("right-align")) { + caption.velocity({ opacity: 0, translateX: 100 }, { duration: duration, queue: false }); + } else if (caption.hasClass("left-align")) { + caption.velocity({ opacity: 0, translateX: -100 }, { duration: duration, queue: false }); + } + } + + // This function will transition the slide to any index of the next slide + function moveToSlide(index) { + // Wrap around indices. + if (index >= $slides.length) index = 0;else if (index < 0) index = $slides.length - 1; + + $active_index = $slider.find('.active').index(); + + // Only do if index changes + if ($active_index != index) { + $active = $slides.eq($active_index); + $caption = $active.find('.caption'); + + $active.removeClass('active'); + $active.velocity({ opacity: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad', + complete: function () { + $slides.not('.active').velocity({ opacity: 0, translateX: 0, translateY: 0 }, { duration: 0, queue: false }); + } }); + captionTransition($caption, options.transition); + + // Update indicators + if (options.indicators) { + $indicators.eq($active_index).removeClass('active'); + } + + $slides.eq(index).velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' }); + $slides.eq(index).find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad' }); + $slides.eq(index).addClass('active'); + + // Update indicators + if (options.indicators) { + $indicators.eq(index).addClass('active'); + } + } + } + + // Set height of slider + // If fullscreen, do nothing + if (!$this.hasClass('fullscreen')) { + if (options.indicators) { + // Add height if indicators are present + $this.height(options.height + 40); + } else { + $this.height(options.height); + } + $slider.height(options.height); + } + + // Set initial positions of captions + $slides.find('.caption').each(function () { + captionTransition($(this), 0); + }); + + // Move img src into background-image + $slides.find('img').each(function () { + var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw=='; + if ($(this).attr('src') !== placeholderBase64) { + $(this).css('background-image', 'url("' + $(this).attr('src') + '")'); + $(this).attr('src', placeholderBase64); + } + }); + + // dynamically add indicators + if (options.indicators) { + $indicators = $('
      '); + $slides.each(function (index) { + var $indicator = $('
    • '); + + // Handle clicks on indicators + $indicator.click(function () { + var $parent = $slider.parent(); + var curr_index = $parent.find($(this)).index(); + moveToSlide(curr_index); + + // reset interval + clearInterval($interval); + $interval = setInterval(function () { + $active_index = $slider.find('.active').index(); + if ($slides.length == $active_index + 1) $active_index = 0; // loop to start + else $active_index += 1; + + moveToSlide($active_index); + }, options.transition + options.interval); + }); + $indicators.append($indicator); + }); + $this.append($indicators); + $indicators = $this.find('ul.indicators').find('li.indicator-item'); + } + + if ($active) { + $active.show(); + } else { + $slides.first().addClass('active').velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' }); + + $active_index = 0; + $active = $slides.eq($active_index); + + // Update indicators + if (options.indicators) { + $indicators.eq($active_index).addClass('active'); + } + } + + // Adjust height to current slide + $active.find('img').each(function () { + $active.find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' }); + }); + + // auto scroll + $interval = setInterval(function () { + $active_index = $slider.find('.active').index(); + moveToSlide($active_index + 1); + }, options.transition + options.interval); + + // HammerJS, Swipe navigation + + // Touch Event + var panning = false; + var swipeLeft = false; + var swipeRight = false; + + $this.hammer({ + prevent_default: false + }).on('pan', function (e) { + if (e.gesture.pointerType === "touch") { + + // reset interval + clearInterval($interval); + + var direction = e.gesture.direction; + var x = e.gesture.deltaX; + var velocityX = e.gesture.velocityX; + var velocityY = e.gesture.velocityY; + + $curr_slide = $slider.find('.active'); + if (Math.abs(velocityX) > Math.abs(velocityY)) { + $curr_slide.velocity({ translateX: x + }, { duration: 50, queue: false, easing: 'easeOutQuad' }); + } + + // Swipe Left + if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.65)) { + swipeRight = true; + } + // Swipe Right + else if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.65)) { + swipeLeft = true; + } + + // Make Slide Behind active slide visible + var next_slide; + if (swipeLeft) { + next_slide = $curr_slide.next(); + if (next_slide.length === 0) { + next_slide = $slides.first(); + } + next_slide.velocity({ opacity: 1 + }, { duration: 300, queue: false, easing: 'easeOutQuad' }); + } + if (swipeRight) { + next_slide = $curr_slide.prev(); + if (next_slide.length === 0) { + next_slide = $slides.last(); + } + next_slide.velocity({ opacity: 1 + }, { duration: 300, queue: false, easing: 'easeOutQuad' }); + } + } + }).on('panend', function (e) { + if (e.gesture.pointerType === "touch") { + + $curr_slide = $slider.find('.active'); + panning = false; + curr_index = $slider.find('.active').index(); + + if (!swipeRight && !swipeLeft || $slides.length <= 1) { + // Return to original spot + $curr_slide.velocity({ translateX: 0 + }, { duration: 300, queue: false, easing: 'easeOutQuad' }); + } else if (swipeLeft) { + moveToSlide(curr_index + 1); + $curr_slide.velocity({ translateX: -1 * $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad', + complete: function () { + $curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false }); + } }); + } else if (swipeRight) { + moveToSlide(curr_index - 1); + $curr_slide.velocity({ translateX: $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad', + complete: function () { + $curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false }); + } }); + } + swipeLeft = false; + swipeRight = false; + + // Restart interval + clearInterval($interval); + $interval = setInterval(function () { + $active_index = $slider.find('.active').index(); + if ($slides.length == $active_index + 1) $active_index = 0; // loop to start + else $active_index += 1; + + moveToSlide($active_index); + }, options.transition + options.interval); + } + }); + + $this.on('sliderPause', function () { + clearInterval($interval); + }); + + $this.on('sliderStart', function () { + clearInterval($interval); + $interval = setInterval(function () { + $active_index = $slider.find('.active').index(); + if ($slides.length == $active_index + 1) $active_index = 0; // loop to start + else $active_index += 1; + + moveToSlide($active_index); + }, options.transition + options.interval); + }); + + $this.on('sliderNext', function () { + $active_index = $slider.find('.active').index(); + moveToSlide($active_index + 1); + }); + + $this.on('sliderPrev', function () { + $active_index = $slider.find('.active').index(); + moveToSlide($active_index - 1); + }); + }); + }, + pause: function () { + $(this).trigger('sliderPause'); + }, + start: function () { + $(this).trigger('sliderStart'); + }, + next: function () { + $(this).trigger('sliderNext'); + }, + prev: function () { + $(this).trigger('sliderPrev'); + } + }; + + $.fn.slider = function (methodOrOptions) { + if (methods[methodOrOptions]) { + return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1)); + } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { + // Default to "init" + return methods.init.apply(this, arguments); + } else { + $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tooltip'); + } + }; // Plugin end +})(jQuery); +;(function ($) { + $(document).ready(function () { + + $(document).on('click.card', '.card', function (e) { + if ($(this).find('> .card-reveal').length) { + var $card = $(e.target).closest('.card'); + if ($card.data('initialOverflow') === undefined) { + $card.data('initialOverflow', $card.css('overflow') === undefined ? '' : $card.css('overflow')); + } + if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) { + // Make Reveal animate down and display none + $(this).find('.card-reveal').velocity({ translateY: 0 }, { + duration: 225, + queue: false, + easing: 'easeInOutQuad', + complete: function () { + $(this).css({ display: 'none' }); + $card.css('overflow', $card.data('initialOverflow')); + } + }); + } else if ($(e.target).is($('.card .activator')) || $(e.target).is($('.card .activator i'))) { + $card.css('overflow', 'hidden'); + $(this).find('.card-reveal').css({ display: 'block' }).velocity("stop", false).velocity({ translateY: '-100%' }, { duration: 300, queue: false, easing: 'easeInOutQuad' }); + } + } + }); + }); +})(jQuery); +;(function ($) { + var materialChipsDefaults = { + data: [], + placeholder: '', + secondaryPlaceholder: '', + autocompleteOptions: {} + }; + + $(document).ready(function () { + // Handle removal of static chips. + $(document).on('click', '.chip .close', function (e) { + var $chips = $(this).closest('.chips'); + if ($chips.attr('data-initialized')) { + return; + } + $(this).closest('.chip').remove(); + }); + }); + + $.fn.material_chip = function (options) { + var self = this; + this.$el = $(this); + this.$document = $(document); + this.SELS = { + CHIPS: '.chips', + CHIP: '.chip', + INPUT: 'input', + DELETE: '.material-icons', + SELECTED_CHIP: '.selected' + }; + + if ('data' === options) { + return this.$el.data('chips'); + } + + var curr_options = $.extend({}, materialChipsDefaults, options); + self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteOptions.data); + + // Initialize + this.init = function () { + var i = 0; + var chips; + self.$el.each(function () { + var $chips = $(this); + var chipId = Materialize.guid(); + self.chipId = chipId; + + if (!curr_options.data || !(curr_options.data instanceof Array)) { + curr_options.data = []; + } + $chips.data('chips', curr_options.data); + $chips.attr('data-index', i); + $chips.attr('data-initialized', true); + + if (!$chips.hasClass(self.SELS.CHIPS)) { + $chips.addClass('chips'); + } + + self.chips($chips, chipId); + i++; + }); + }; + + this.handleEvents = function () { + var SELS = self.SELS; + + self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function (e) { + $(e.target).find(SELS.INPUT).focus(); + }); + + self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function (e) { + var $chip = $(e.target); + if ($chip.length) { + var wasSelected = $chip.hasClass('selected'); + var $chips = $chip.closest(SELS.CHIPS); + $(SELS.CHIP).removeClass('selected'); + + if (!wasSelected) { + self.selectChip($chip.index(), $chips); + } + } + }); + + self.$document.off('keydown.chips').on('keydown.chips', function (e) { + if ($(e.target).is('input, textarea')) { + return; + } + + // delete + var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP); + var $chips = $chip.closest(SELS.CHIPS); + var length = $chip.siblings(SELS.CHIP).length; + var index; + + if (!$chip.length) { + return; + } + + if (e.which === 8 || e.which === 46) { + e.preventDefault(); + + index = $chip.index(); + self.deleteChip(index, $chips); + + var selectIndex = null; + if (index + 1 < length) { + selectIndex = index; + } else if (index === length || index + 1 === length) { + selectIndex = length - 1; + } + + if (selectIndex < 0) selectIndex = null; + + if (null !== selectIndex) { + self.selectChip(selectIndex, $chips); + } + if (!length) $chips.find('input').focus(); + + // left + } else if (e.which === 37) { + index = $chip.index() - 1; + if (index < 0) { + return; + } + $(SELS.CHIP).removeClass('selected'); + self.selectChip(index, $chips); + + // right + } else if (e.which === 39) { + index = $chip.index() + 1; + $(SELS.CHIP).removeClass('selected'); + if (index > length) { + $chips.find('input').focus(); + return; + } + self.selectChip(index, $chips); + } + }); + + self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) { + var $currChips = $(e.target).closest(SELS.CHIPS); + $currChips.addClass('focus'); + $currChips.siblings('label, .prefix').addClass('active'); + $(SELS.CHIP).removeClass('selected'); + }); + + self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) { + var $currChips = $(e.target).closest(SELS.CHIPS); + $currChips.removeClass('focus'); + + // Remove active if empty + if ($currChips.data('chips') === undefined || !$currChips.data('chips').length) { + $currChips.siblings('label').removeClass('active'); + } + $currChips.siblings('.prefix').removeClass('active'); + }); + + self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function (e) { + var $target = $(e.target); + var $chips = $target.closest(SELS.CHIPS); + var chipsLength = $chips.children(SELS.CHIP).length; + + // enter + if (13 === e.which) { + // Override enter if autocompleting. + if (self.hasAutocomplete && $chips.find('.autocomplete-content.dropdown-content').length && $chips.find('.autocomplete-content.dropdown-content').children().length) { + return; + } + + e.preventDefault(); + self.addChip({ tag: $target.val() }, $chips); + $target.val(''); + return; + } + + // delete or left + if ((8 === e.keyCode || 37 === e.keyCode) && '' === $target.val() && chipsLength) { + e.preventDefault(); + self.selectChip(chipsLength - 1, $chips); + $target.blur(); + return; + } + }); + + // Click on delete icon in chip. + self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function (e) { + var $target = $(e.target); + var $chips = $target.closest(SELS.CHIPS); + var $chip = $target.closest(SELS.CHIP); + e.stopPropagation(); + self.deleteChip($chip.index(), $chips); + $chips.find('input').focus(); + }); + }; + + this.chips = function ($chips, chipId) { + $chips.empty(); + $chips.data('chips').forEach(function (elem) { + $chips.append(self.renderChip(elem)); + }); + $chips.append($('')); + self.setPlaceholder($chips); + + // Set for attribute for label + var label = $chips.next('label'); + if (label.length) { + label.attr('for', chipId); + + if ($chips.data('chips') !== undefined && $chips.data('chips').length) { + label.addClass('active'); + } + } + + // Setup autocomplete if needed. + var input = $('#' + chipId); + if (self.hasAutocomplete) { + curr_options.autocompleteOptions.onAutocomplete = function (val) { + self.addChip({ tag: val }, $chips); + input.val(''); + input.focus(); + }; + input.autocomplete(curr_options.autocompleteOptions); + } + }; + + /** + * Render chip jQuery element. + * @param {Object} elem + * @return {jQuery} + */ + this.renderChip = function (elem) { + if (!elem.tag) return; + + var $renderedChip = $('
      '); + $renderedChip.text(elem.tag); + if (elem.image) { + $renderedChip.prepend($('').attr('src', elem.image)); + } + $renderedChip.append($('close')); + return $renderedChip; + }; + + this.setPlaceholder = function ($chips) { + if ($chips.data('chips') !== undefined && !$chips.data('chips').length && curr_options.placeholder) { + $chips.find('input').prop('placeholder', curr_options.placeholder); + } else if (($chips.data('chips') === undefined || !!$chips.data('chips').length) && curr_options.secondaryPlaceholder) { + $chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder); + } + }; + + this.isValid = function ($chips, elem) { + var chips = $chips.data('chips'); + var exists = false; + for (var i = 0; i < chips.length; i++) { + if (chips[i].tag === elem.tag) { + exists = true; + return; + } + } + return '' !== elem.tag && !exists; + }; + + this.addChip = function (elem, $chips) { + if (!self.isValid($chips, elem)) { + return; + } + var $renderedChip = self.renderChip(elem); + var newData = []; + var oldData = $chips.data('chips'); + for (var i = 0; i < oldData.length; i++) { + newData.push(oldData[i]); + } + newData.push(elem); + + $chips.data('chips', newData); + $renderedChip.insertBefore($chips.find('input')); + $chips.trigger('chip.add', elem); + self.setPlaceholder($chips); + }; + + this.deleteChip = function (chipIndex, $chips) { + var chip = $chips.data('chips')[chipIndex]; + $chips.find('.chip').eq(chipIndex).remove(); + + var newData = []; + var oldData = $chips.data('chips'); + for (var i = 0; i < oldData.length; i++) { + if (i !== chipIndex) { + newData.push(oldData[i]); + } + } + + $chips.data('chips', newData); + $chips.trigger('chip.delete', chip); + self.setPlaceholder($chips); + }; + + this.selectChip = function (chipIndex, $chips) { + var $chip = $chips.find('.chip').eq(chipIndex); + if ($chip && false === $chip.hasClass('selected')) { + $chip.addClass('selected'); + $chips.trigger('chip.select', $chips.data('chips')[chipIndex]); + } + }; + + this.getChipsElement = function (index, $chips) { + return $chips.eq(index); + }; + + // init + this.init(); + + this.handleEvents(); + }; +})(jQuery); +;(function ($) { + $.fn.pushpin = function (options) { + // Defaults + var defaults = { + top: 0, + bottom: Infinity, + offset: 0 + }; + + // Remove pushpin event and classes + if (options === "remove") { + this.each(function () { + if (id = $(this).data('pushpin-id')) { + $(window).off('scroll.' + id); + $(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style'); + } + }); + return false; + } + + options = $.extend(defaults, options); + + $index = 0; + return this.each(function () { + var $uniqueId = Materialize.guid(), + $this = $(this), + $original_offset = $(this).offset().top; + + function removePinClasses(object) { + object.removeClass('pin-top'); + object.removeClass('pinned'); + object.removeClass('pin-bottom'); + } + + function updateElements(objects, scrolled) { + objects.each(function () { + // Add position fixed (because its between top and bottom) + if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) { + removePinClasses($(this)); + $(this).css('top', options.offset); + $(this).addClass('pinned'); + } + + // Add pin-top (when scrolled position is above top) + if (scrolled < options.top && !$(this).hasClass('pin-top')) { + removePinClasses($(this)); + $(this).css('top', 0); + $(this).addClass('pin-top'); + } + + // Add pin-bottom (when scrolled position is below bottom) + if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) { + removePinClasses($(this)); + $(this).addClass('pin-bottom'); + $(this).css('top', options.bottom - $original_offset); + } + }); + } + + $(this).data('pushpin-id', $uniqueId); + updateElements($this, $(window).scrollTop()); + $(window).on('scroll.' + $uniqueId, function () { + var $scrolled = $(window).scrollTop() + options.offset; + updateElements($this, $scrolled); + }); + }); + }; +})(jQuery);;(function ($) { + $(document).ready(function () { + + // jQuery reverse + $.fn.reverse = [].reverse; + + // Hover behaviour: make sure this doesn't work on .click-to-toggle FABs! + $(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) { + var $this = $(this); + openFABMenu($this); + }); + $(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) { + var $this = $(this); + closeFABMenu($this); + }); + + // Toggle-on-click behaviour. + $(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function (e) { + var $this = $(this); + var $menu = $this.parent(); + if ($menu.hasClass('active')) { + closeFABMenu($menu); + } else { + openFABMenu($menu); + } + }); + + // Toolbar transition behaviour. + $(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function (e) { + var $this = $(this); + var $menu = $this.parent(); + FABtoToolbar($menu); + }); + }); + + $.fn.extend({ + openFAB: function () { + openFABMenu($(this)); + }, + closeFAB: function () { + closeFABMenu($(this)); + }, + openToolbar: function () { + FABtoToolbar($(this)); + }, + closeToolbar: function () { + toolbarToFAB($(this)); + } + }); + + var openFABMenu = function (btn) { + var $this = btn; + if ($this.hasClass('active') === false) { + + // Get direction option + var horizontal = $this.hasClass('horizontal'); + var offsetY, offsetX; + + if (horizontal === true) { + offsetX = 40; + } else { + offsetY = 40; + } + + $this.addClass('active'); + $this.find('ul .btn-floating').velocity({ scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 0 }); + + var time = 0; + $this.find('ul .btn-floating').reverse().each(function () { + $(this).velocity({ opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0' }, { duration: 80, delay: time }); + time += 40; + }); + } + }; + + var closeFABMenu = function (btn) { + var $this = btn; + // Get direction option + var horizontal = $this.hasClass('horizontal'); + var offsetY, offsetX; + + if (horizontal === true) { + offsetX = 40; + } else { + offsetY = 40; + } + + $this.removeClass('active'); + var time = 0; + $this.find('ul .btn-floating').velocity("stop", true); + $this.find('ul .btn-floating').velocity({ opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 80 }); + }; + + /** + * Transform FAB into toolbar + * @param {Object} object jQuery object + */ + var FABtoToolbar = function (btn) { + if (btn.attr('data-open') === "true") { + return; + } + + var offsetX, offsetY, scaleFactor; + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var btnRect = btn[0].getBoundingClientRect(); + var anchor = btn.find('> a').first(); + var menu = btn.find('> ul').first(); + var backdrop = $('
      '); + var fabColor = anchor.css('background-color'); + anchor.append(backdrop); + + offsetX = btnRect.left - windowWidth / 2 + btnRect.width / 2; + offsetY = windowHeight - btnRect.bottom; + scaleFactor = windowWidth / backdrop.width(); + btn.attr('data-origin-bottom', btnRect.bottom); + btn.attr('data-origin-left', btnRect.left); + btn.attr('data-origin-width', btnRect.width); + + // Set initial state + btn.addClass('active'); + btn.attr('data-open', true); + btn.css({ + 'text-align': 'center', + width: '100%', + bottom: 0, + left: 0, + transform: 'translateX(' + offsetX + 'px)', + transition: 'none' + }); + anchor.css({ + transform: 'translateY(' + -offsetY + 'px)', + transition: 'none' + }); + backdrop.css({ + 'background-color': fabColor + }); + + setTimeout(function () { + btn.css({ + transform: '', + transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s' + }); + anchor.css({ + overflow: 'visible', + transform: '', + transition: 'transform .2s' + }); + + setTimeout(function () { + btn.css({ + overflow: 'hidden', + 'background-color': fabColor + }); + backdrop.css({ + transform: 'scale(' + scaleFactor + ')', + transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)' + }); + menu.find('> li > a').css({ + opacity: 1 + }); + + // Scroll to close. + $(window).on('scroll.fabToolbarClose', function () { + toolbarToFAB(btn); + $(window).off('scroll.fabToolbarClose'); + $(document).off('click.fabToolbarClose'); + }); + + $(document).on('click.fabToolbarClose', function (e) { + if (!$(e.target).closest(menu).length) { + toolbarToFAB(btn); + $(window).off('scroll.fabToolbarClose'); + $(document).off('click.fabToolbarClose'); + } + }); + }, 100); + }, 0); + }; + + /** + * Transform toolbar back into FAB + * @param {Object} object jQuery object + */ + var toolbarToFAB = function (btn) { + if (btn.attr('data-open') !== "true") { + return; + } + + var offsetX, offsetY, scaleFactor; + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var btnWidth = btn.attr('data-origin-width'); + var btnBottom = btn.attr('data-origin-bottom'); + var btnLeft = btn.attr('data-origin-left'); + var anchor = btn.find('> .btn-floating').first(); + var menu = btn.find('> ul').first(); + var backdrop = btn.find('.fab-backdrop'); + var fabColor = anchor.css('background-color'); + + offsetX = btnLeft - windowWidth / 2 + btnWidth / 2; + offsetY = windowHeight - btnBottom; + scaleFactor = windowWidth / backdrop.width(); + + // Hide backdrop + btn.removeClass('active'); + btn.attr('data-open', false); + btn.css({ + 'background-color': 'transparent', + transition: 'none' + }); + anchor.css({ + transition: 'none' + }); + backdrop.css({ + transform: 'scale(0)', + 'background-color': fabColor + }); + menu.find('> li > a').css({ + opacity: '' + }); + + setTimeout(function () { + backdrop.remove(); + + // Set initial state. + btn.css({ + 'text-align': '', + width: '', + bottom: '', + left: '', + overflow: '', + 'background-color': '', + transform: 'translate3d(' + -offsetX + 'px,0,0)' + }); + anchor.css({ + overflow: '', + transform: 'translate3d(0,' + offsetY + 'px,0)' + }); + + setTimeout(function () { + btn.css({ + transform: 'translate3d(0,0,0)', + transition: 'transform .2s' + }); + anchor.css({ + transform: 'translate3d(0,0,0)', + transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)' + }); + }, 20); + }, 200); + }; +})(jQuery); +;(function ($) { + // Image transition function + Materialize.fadeInImage = function (selectorOrEl) { + var element; + if (typeof selectorOrEl === 'string') { + element = $(selectorOrEl); + } else if (typeof selectorOrEl === 'object') { + element = selectorOrEl; + } else { + return; + } + element.css({ opacity: 0 }); + $(element).velocity({ opacity: 1 }, { + duration: 650, + queue: false, + easing: 'easeOutSine' + }); + $(element).velocity({ opacity: 1 }, { + duration: 1300, + queue: false, + easing: 'swing', + step: function (now, fx) { + fx.start = 100; + var grayscale_setting = now / 100; + var brightness_setting = 150 - (100 - now) / 1.75; + + if (brightness_setting < 100) { + brightness_setting = 100; + } + if (now >= 0) { + $(this).css({ + "-webkit-filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)", + "filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)" + }); + } + } + }); + }; + + // Horizontal staggered list + Materialize.showStaggeredList = function (selectorOrEl) { + var element; + if (typeof selectorOrEl === 'string') { + element = $(selectorOrEl); + } else if (typeof selectorOrEl === 'object') { + element = selectorOrEl; + } else { + return; + } + var time = 0; + element.find('li').velocity({ translateX: "-100px" }, { duration: 0 }); + + element.find('li').each(function () { + $(this).velocity({ opacity: "1", translateX: "0" }, { duration: 800, delay: time, easing: [60, 10] }); + time += 120; + }); + }; + + $(document).ready(function () { + // Hardcoded .staggered-list scrollFire + // var staggeredListOptions = []; + // $('ul.staggered-list').each(function (i) { + + // var label = 'scrollFire-' + i; + // $(this).addClass(label); + // staggeredListOptions.push( + // {selector: 'ul.staggered-list.' + label, + // offset: 200, + // callback: 'showStaggeredList("ul.staggered-list.' + label + '")'}); + // }); + // scrollFire(staggeredListOptions); + + // HammerJS, Swipe navigation + + // Touch Event + var swipeLeft = false; + var swipeRight = false; + + // Dismissible Collections + $('.dismissable').each(function () { + $(this).hammer({ + prevent_default: false + }).on('pan', function (e) { + if (e.gesture.pointerType === "touch") { + var $this = $(this); + var direction = e.gesture.direction; + var x = e.gesture.deltaX; + var velocityX = e.gesture.velocityX; + + $this.velocity({ translateX: x + }, { duration: 50, queue: false, easing: 'easeOutQuad' }); + + // Swipe Left + if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.75)) { + swipeLeft = true; + } + + // Swipe Right + if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.75)) { + swipeRight = true; + } + } + }).on('panend', function (e) { + // Reset if collection is moved back into original position + if (Math.abs(e.gesture.deltaX) < $(this).innerWidth() / 2) { + swipeRight = false; + swipeLeft = false; + } + + if (e.gesture.pointerType === "touch") { + var $this = $(this); + if (swipeLeft || swipeRight) { + var fullWidth; + if (swipeLeft) { + fullWidth = $this.innerWidth(); + } else { + fullWidth = -1 * $this.innerWidth(); + } + + $this.velocity({ translateX: fullWidth + }, { duration: 100, queue: false, easing: 'easeOutQuad', complete: function () { + $this.css('border', 'none'); + $this.velocity({ height: 0, padding: 0 + }, { duration: 200, queue: false, easing: 'easeOutQuad', complete: function () { + $this.remove(); + } + }); + } + }); + } else { + $this.velocity({ translateX: 0 + }, { duration: 100, queue: false, easing: 'easeOutQuad' }); + } + swipeLeft = false; + swipeRight = false; + } + }); + }); + + // time = 0 + // // Vertical Staggered list + // $('ul.staggered-list.vertical li').velocity( + // { translateY: "100px"}, + // { duration: 0 }); + + // $('ul.staggered-list.vertical li').each(function() { + // $(this).velocity( + // { opacity: "1", translateY: "0"}, + // { duration: 800, delay: time, easing: [60, 25] }); + // time += 120; + // }); + + // // Fade in and Scale + // $('.fade-in.scale').velocity( + // { scaleX: .4, scaleY: .4, translateX: -600}, + // { duration: 0}); + // $('.fade-in').each(function() { + // $(this).velocity( + // { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0}, + // { duration: 800, easing: [60, 10] }); + // }); + }); +})(jQuery); +;(function ($) { + + var scrollFireEventsHandled = false; + + // Input: Array of JSON objects {selector, offset, callback} + Materialize.scrollFire = function (options) { + var onScroll = function () { + var windowScroll = window.pageYOffset + window.innerHeight; + + for (var i = 0; i < options.length; i++) { + // Get options from each line + var value = options[i]; + var selector = value.selector, + offset = value.offset, + callback = value.callback; + + var currentElement = document.querySelector(selector); + if (currentElement !== null) { + var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset; + + if (windowScroll > elementOffset + offset) { + if (value.done !== true) { + if (typeof callback === 'function') { + callback.call(this, currentElement); + } else if (typeof callback === 'string') { + var callbackFunc = new Function(callback); + callbackFunc(currentElement); + } + value.done = true; + } + } + } + } + }; + + var throttledScroll = Materialize.throttle(function () { + onScroll(); + }, options.throttle || 100); + + if (!scrollFireEventsHandled) { + window.addEventListener("scroll", throttledScroll); + window.addEventListener("resize", throttledScroll); + scrollFireEventsHandled = true; + } + + // perform a scan once, after current execution context, and after dom is ready + setTimeout(throttledScroll, 0); + }; +})(jQuery); +; /*! + * pickadate.js v3.5.0, 2014/04/13 + * By Amsul, http://amsul.ca + * Hosted on http://amsul.github.io/pickadate.js + * Licensed under MIT + */ + +(function (factory) { + + Materialize.Picker = factory(jQuery); +})(function ($) { + + var $window = $(window); + var $document = $(document); + var $html = $(document.documentElement); + + /** + * The picker constructor that creates a blank picker. + */ + function PickerConstructor(ELEMENT, NAME, COMPONENT, OPTIONS) { + + // If there’s no element, return the picker constructor. + if (!ELEMENT) return PickerConstructor; + + var IS_DEFAULT_THEME = false, + + + // The state of the picker. + STATE = { + id: ELEMENT.id || 'P' + Math.abs(~~(Math.random() * new Date())) + }, + + + // Merge the defaults and options passed. + SETTINGS = COMPONENT ? $.extend(true, {}, COMPONENT.defaults, OPTIONS) : OPTIONS || {}, + + + // Merge the default classes with the settings classes. + CLASSES = $.extend({}, PickerConstructor.klasses(), SETTINGS.klass), + + + // The element node wrapper into a jQuery object. + $ELEMENT = $(ELEMENT), + + + // Pseudo picker constructor. + PickerInstance = function () { + return this.start(); + }, + + + // The picker prototype. + P = PickerInstance.prototype = { + + constructor: PickerInstance, + + $node: $ELEMENT, + + /** + * Initialize everything + */ + start: function () { + + // If it’s already started, do nothing. + if (STATE && STATE.start) return P; + + // Update the picker states. + STATE.methods = {}; + STATE.start = true; + STATE.open = false; + STATE.type = ELEMENT.type; + + // Confirm focus state, convert into text input to remove UA stylings, + // and set as readonly to prevent keyboard popup. + ELEMENT.autofocus = ELEMENT == getActiveElement(); + ELEMENT.readOnly = !SETTINGS.editable; + ELEMENT.id = ELEMENT.id || STATE.id; + if (ELEMENT.type != 'text') { + ELEMENT.type = 'text'; + } + + // Create a new picker component with the settings. + P.component = new COMPONENT(P, SETTINGS); + + // Create the picker root with a holder and then prepare it. + P.$root = $(PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"')); + prepareElementRoot(); + + // If there’s a format for the hidden input element, create the element. + if (SETTINGS.formatSubmit) { + prepareElementHidden(); + } + + // Prepare the input element. + prepareElement(); + + // Insert the root as specified in the settings. + if (SETTINGS.container) $(SETTINGS.container).append(P.$root);else $ELEMENT.before(P.$root); + + // Bind the default component and settings events. + P.on({ + start: P.component.onStart, + render: P.component.onRender, + stop: P.component.onStop, + open: P.component.onOpen, + close: P.component.onClose, + set: P.component.onSet + }).on({ + start: SETTINGS.onStart, + render: SETTINGS.onRender, + stop: SETTINGS.onStop, + open: SETTINGS.onOpen, + close: SETTINGS.onClose, + set: SETTINGS.onSet + }); + + // Once we’re all set, check the theme in use. + IS_DEFAULT_THEME = isUsingDefaultTheme(P.$root.children()[0]); + + // If the element has autofocus, open the picker. + if (ELEMENT.autofocus) { + P.open(); + } + + // Trigger queued the “start” and “render” events. + return P.trigger('start').trigger('render'); + }, //start + + + /** + * Render a new picker + */ + render: function (entireComponent) { + + // Insert a new component holder in the root or box. + if (entireComponent) P.$root.html(createWrappedComponent());else P.$root.find('.' + CLASSES.box).html(P.component.nodes(STATE.open)); + + // Trigger the queued “render” events. + return P.trigger('render'); + }, //render + + + /** + * Destroy everything + */ + stop: function () { + + // If it’s already stopped, do nothing. + if (!STATE.start) return P; + + // Then close the picker. + P.close(); + + // Remove the hidden field. + if (P._hidden) { + P._hidden.parentNode.removeChild(P._hidden); + } + + // Remove the root. + P.$root.remove(); + + // Remove the input class, remove the stored data, and unbind + // the events (after a tick for IE - see `P.close`). + $ELEMENT.removeClass(CLASSES.input).removeData(NAME); + setTimeout(function () { + $ELEMENT.off('.' + STATE.id); + }, 0); + + // Restore the element state + ELEMENT.type = STATE.type; + ELEMENT.readOnly = false; + + // Trigger the queued “stop” events. + P.trigger('stop'); + + // Reset the picker states. + STATE.methods = {}; + STATE.start = false; + + return P; + }, //stop + + + /** + * Open up the picker + */ + open: function (dontGiveFocus) { + + // If it’s already open, do nothing. + if (STATE.open) return P; + + // Add the “active” class. + $ELEMENT.addClass(CLASSES.active); + aria(ELEMENT, 'expanded', true); + + // * A Firefox bug, when `html` has `overflow:hidden`, results in + // killing transitions :(. So add the “opened” state on the next tick. + // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289 + setTimeout(function () { + + // Add the “opened” class to the picker root. + P.$root.addClass(CLASSES.opened); + aria(P.$root[0], 'hidden', false); + }, 0); + + // If we have to give focus, bind the element and doc events. + if (dontGiveFocus !== false) { + + // Set it as open. + STATE.open = true; + + // Prevent the page from scrolling. + if (IS_DEFAULT_THEME) { + $html.css('overflow', 'hidden').css('padding-right', '+=' + getScrollbarWidth()); + } + + // Pass focus to the root element’s jQuery object. + // * Workaround for iOS8 to bring the picker’s root into view. + P.$root.eq(0).focus(); + + // Bind the document events. + $document.on('click.' + STATE.id + ' focusin.' + STATE.id, function (event) { + + var target = event.target; + + // If the target of the event is not the element, close the picker picker. + // * Don’t worry about clicks or focusins on the root because those don’t bubble up. + // Also, for Firefox, a click on an `option` element bubbles up directly + // to the doc. So make sure the target wasn't the doc. + // * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling, + // which causes the picker to unexpectedly close when right-clicking it. So make + // sure the event wasn’t a right-click. + if (target != ELEMENT && target != document && event.which != 3) { + + // If the target was the holder that covers the screen, + // keep the element focused to maintain tabindex. + P.close(target === P.$root.children()[0]); + } + }).on('keydown.' + STATE.id, function (event) { + + var + // Get the keycode. + keycode = event.keyCode, + + + // Translate that to a selection change. + keycodeToMove = P.component.key[keycode], + + + // Grab the target. + target = event.target; + + // On escape, close the picker and give focus. + if (keycode == 27) { + P.close(true); + } + + // Check if there is a key movement or “enter” keypress on the element. + else if (target == P.$root[0] && (keycodeToMove || keycode == 13)) { + + // Prevent the default action to stop page movement. + event.preventDefault(); + + // Trigger the key movement action. + if (keycodeToMove) { + PickerConstructor._.trigger(P.component.key.go, P, [PickerConstructor._.trigger(keycodeToMove)]); + } + + // On “enter”, if the highlighted item isn’t disabled, set the value and close. + else if (!P.$root.find('.' + CLASSES.highlighted).hasClass(CLASSES.disabled)) { + P.set('select', P.component.item.highlight); + if (SETTINGS.closeOnSelect) { + P.close(true); + } + } + } + + // If the target is within the root and “enter” is pressed, + // prevent the default action and trigger a click on the target instead. + else if ($.contains(P.$root[0], target) && keycode == 13) { + event.preventDefault(); + target.click(); + } + }); + } + + // Trigger the queued “open” events. + return P.trigger('open'); + }, //open + + + /** + * Close the picker + */ + close: function (giveFocus) { + + // If we need to give focus, do it before changing states. + if (giveFocus) { + // ....ah yes! It would’ve been incomplete without a crazy workaround for IE :| + // The focus is triggered *after* the close has completed - causing it + // to open again. So unbind and rebind the event at the next tick. + P.$root.off('focus.toOpen').eq(0).focus(); + setTimeout(function () { + P.$root.on('focus.toOpen', handleFocusToOpenEvent); + }, 0); + } + + // Remove the “active” class. + $ELEMENT.removeClass(CLASSES.active); + aria(ELEMENT, 'expanded', false); + + // * A Firefox bug, when `html` has `overflow:hidden`, results in + // killing transitions :(. So remove the “opened” state on the next tick. + // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289 + setTimeout(function () { + + // Remove the “opened” and “focused” class from the picker root. + P.$root.removeClass(CLASSES.opened + ' ' + CLASSES.focused); + aria(P.$root[0], 'hidden', true); + }, 0); + + // If it’s already closed, do nothing more. + if (!STATE.open) return P; + + // Set it as closed. + STATE.open = false; + + // Allow the page to scroll. + if (IS_DEFAULT_THEME) { + $html.css('overflow', '').css('padding-right', '-=' + getScrollbarWidth()); + } + + // Unbind the document events. + $document.off('.' + STATE.id); + + // Trigger the queued “close” events. + return P.trigger('close'); + }, //close + + + /** + * Clear the values + */ + clear: function (options) { + return P.set('clear', null, options); + }, //clear + + + /** + * Set something + */ + set: function (thing, value, options) { + + var thingItem, + thingValue, + thingIsObject = $.isPlainObject(thing), + thingObject = thingIsObject ? thing : {}; + + // Make sure we have usable options. + options = thingIsObject && $.isPlainObject(value) ? value : options || {}; + + if (thing) { + + // If the thing isn’t an object, make it one. + if (!thingIsObject) { + thingObject[thing] = value; + } + + // Go through the things of items to set. + for (thingItem in thingObject) { + + // Grab the value of the thing. + thingValue = thingObject[thingItem]; + + // First, if the item exists and there’s a value, set it. + if (thingItem in P.component.item) { + if (thingValue === undefined) thingValue = null; + P.component.set(thingItem, thingValue, options); + } + + // Then, check to update the element value and broadcast a change. + if (thingItem == 'select' || thingItem == 'clear') { + $ELEMENT.val(thingItem == 'clear' ? '' : P.get(thingItem, SETTINGS.format)).trigger('change'); + } + } + + // Render a new picker. + P.render(); + } + + // When the method isn’t muted, trigger queued “set” events and pass the `thingObject`. + return options.muted ? P : P.trigger('set', thingObject); + }, //set + + + /** + * Get something + */ + get: function (thing, format) { + + // Make sure there’s something to get. + thing = thing || 'value'; + + // If a picker state exists, return that. + if (STATE[thing] != null) { + return STATE[thing]; + } + + // Return the submission value, if that. + if (thing == 'valueSubmit') { + if (P._hidden) { + return P._hidden.value; + } + thing = 'value'; + } + + // Return the value, if that. + if (thing == 'value') { + return ELEMENT.value; + } + + // Check if a component item exists, return that. + if (thing in P.component.item) { + if (typeof format == 'string') { + var thingValue = P.component.get(thing); + return thingValue ? PickerConstructor._.trigger(P.component.formats.toString, P.component, [format, thingValue]) : ''; + } + return P.component.get(thing); + } + }, //get + + + /** + * Bind events on the things. + */ + on: function (thing, method, internal) { + + var thingName, + thingMethod, + thingIsObject = $.isPlainObject(thing), + thingObject = thingIsObject ? thing : {}; + + if (thing) { + + // If the thing isn’t an object, make it one. + if (!thingIsObject) { + thingObject[thing] = method; + } + + // Go through the things to bind to. + for (thingName in thingObject) { + + // Grab the method of the thing. + thingMethod = thingObject[thingName]; + + // If it was an internal binding, prefix it. + if (internal) { + thingName = '_' + thingName; + } + + // Make sure the thing methods collection exists. + STATE.methods[thingName] = STATE.methods[thingName] || []; + + // Add the method to the relative method collection. + STATE.methods[thingName].push(thingMethod); + } + } + + return P; + }, //on + + + /** + * Unbind events on the things. + */ + off: function () { + var i, + thingName, + names = arguments; + for (i = 0, namesCount = names.length; i < namesCount; i += 1) { + thingName = names[i]; + if (thingName in STATE.methods) { + delete STATE.methods[thingName]; + } + } + return P; + }, + + /** + * Fire off method events. + */ + trigger: function (name, data) { + var _trigger = function (name) { + var methodList = STATE.methods[name]; + if (methodList) { + methodList.map(function (method) { + PickerConstructor._.trigger(method, P, [data]); + }); + } + }; + _trigger('_' + name); + _trigger(name); + return P; + } //trigger + //PickerInstance.prototype + + + /** + * Wrap the picker holder components together. + */ + };function createWrappedComponent() { + + // Create a picker wrapper holder + return PickerConstructor._.node('div', + + // Create a picker wrapper node + PickerConstructor._.node('div', + + // Create a picker frame + PickerConstructor._.node('div', + + // Create a picker box node + PickerConstructor._.node('div', + + // Create the components nodes. + P.component.nodes(STATE.open), + + // The picker box class + CLASSES.box), + + // Picker wrap class + CLASSES.wrap), + + // Picker frame class + CLASSES.frame), + + // Picker holder class + CLASSES.holder); //endreturn + } //createWrappedComponent + + + /** + * Prepare the input element with all bindings. + */ + function prepareElement() { + + $ELEMENT. + + // Store the picker data by component name. + data(NAME, P). + + // Add the “input” class name. + addClass(CLASSES.input). + + // Remove the tabindex. + attr('tabindex', -1). + + // If there’s a `data-value`, update the value of the element. + val($ELEMENT.data('value') ? P.get('select', SETTINGS.format) : ELEMENT.value); + + // Only bind keydown events if the element isn’t editable. + if (!SETTINGS.editable) { + + $ELEMENT. + + // On focus/click, focus onto the root to open it up. + on('focus.' + STATE.id + ' click.' + STATE.id, function (event) { + event.preventDefault(); + P.$root.eq(0).focus(); + }). + + // Handle keyboard event based on the picker being opened or not. + on('keydown.' + STATE.id, handleKeydownEvent); + } + + // Update the aria attributes. + aria(ELEMENT, { + haspopup: true, + expanded: false, + readonly: false, + owns: ELEMENT.id + '_root' + }); + } + + /** + * Prepare the root picker element with all bindings. + */ + function prepareElementRoot() { + + P.$root.on({ + + // For iOS8. + keydown: handleKeydownEvent, + + // When something within the root is focused, stop from bubbling + // to the doc and remove the “focused” state from the root. + focusin: function (event) { + P.$root.removeClass(CLASSES.focused); + event.stopPropagation(); + }, + + // When something within the root holder is clicked, stop it + // from bubbling to the doc. + 'mousedown click': function (event) { + + var target = event.target; + + // Make sure the target isn’t the root holder so it can bubble up. + if (target != P.$root.children()[0]) { + + event.stopPropagation(); + + // * For mousedown events, cancel the default action in order to + // prevent cases where focus is shifted onto external elements + // when using things like jQuery mobile or MagnificPopup (ref: #249 & #120). + // Also, for Firefox, don’t prevent action on the `option` element. + if (event.type == 'mousedown' && !$(target).is('input, select, textarea, button, option')) { + + event.preventDefault(); + + // Re-focus onto the root so that users can click away + // from elements focused within the picker. + P.$root.eq(0).focus(); + } + } + } + }). + + // Add/remove the “target” class on focus and blur. + on({ + focus: function () { + $ELEMENT.addClass(CLASSES.target); + }, + blur: function () { + $ELEMENT.removeClass(CLASSES.target); + } + }). + + // Open the picker and adjust the root “focused” state + on('focus.toOpen', handleFocusToOpenEvent). + + // If there’s a click on an actionable element, carry out the actions. + on('click', '[data-pick], [data-nav], [data-clear], [data-close]', function () { + + var $target = $(this), + targetData = $target.data(), + targetDisabled = $target.hasClass(CLASSES.navDisabled) || $target.hasClass(CLASSES.disabled), + + + // * For IE, non-focusable elements can be active elements as well + // (http://stackoverflow.com/a/2684561). + activeElement = getActiveElement(); + activeElement = activeElement && (activeElement.type || activeElement.href) && activeElement; + + // If it’s disabled or nothing inside is actively focused, re-focus the element. + if (targetDisabled || activeElement && !$.contains(P.$root[0], activeElement)) { + P.$root.eq(0).focus(); + } + + // If something is superficially changed, update the `highlight` based on the `nav`. + if (!targetDisabled && targetData.nav) { + P.set('highlight', P.component.item.highlight, { nav: targetData.nav }); + } + + // If something is picked, set `select` then close with focus. + else if (!targetDisabled && 'pick' in targetData) { + P.set('select', targetData.pick); + if (SETTINGS.closeOnSelect) { + P.close(true); + } + } + + // If a “clear” button is pressed, empty the values and close with focus. + else if (targetData.clear) { + P.clear(); + if (SETTINGS.closeOnSelect) { + P.close(true); + } + } else if (targetData.close) { + P.close(true); + } + }); //P.$root + + aria(P.$root[0], 'hidden', true); + } + + /** + * Prepare the hidden input element along with all bindings. + */ + function prepareElementHidden() { + + var name; + + if (SETTINGS.hiddenName === true) { + name = ELEMENT.name; + ELEMENT.name = ''; + } else { + name = [typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : '', typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit']; + name = name[0] + ELEMENT.name + name[1]; + } + + P._hidden = $('')[0]; + + $ELEMENT. + + // If the value changes, update the hidden input with the correct format. + on('change.' + STATE.id, function () { + P._hidden.value = ELEMENT.value ? P.get('select', SETTINGS.formatSubmit) : ''; + }); + + // Insert the hidden input as specified in the settings. + if (SETTINGS.container) $(SETTINGS.container).append(P._hidden);else $ELEMENT.before(P._hidden); + } + + // For iOS8. + function handleKeydownEvent(event) { + + var keycode = event.keyCode, + + + // Check if one of the delete keys was pressed. + isKeycodeDelete = /^(8|46)$/.test(keycode); + + // For some reason IE clears the input value on “escape”. + if (keycode == 27) { + P.close(); + return false; + } + + // Check if `space` or `delete` was pressed or the picker is closed with a key movement. + if (keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode]) { + + // Prevent it from moving the page and bubbling to doc. + event.preventDefault(); + event.stopPropagation(); + + // If `delete` was pressed, clear the values and close the picker. + // Otherwise open the picker. + if (isKeycodeDelete) { + P.clear().close(); + } else { + P.open(); + } + } + } + + // Separated for IE + function handleFocusToOpenEvent(event) { + + // Stop the event from propagating to the doc. + event.stopPropagation(); + + // If it’s a focus event, add the “focused” class to the root. + if (event.type == 'focus') { + P.$root.addClass(CLASSES.focused); + } + + // And then finally open the picker. + P.open(); + } + + // Return a new picker instance. + return new PickerInstance(); + } //PickerConstructor + + + /** + * The default classes and prefix to use for the HTML classes. + */ + PickerConstructor.klasses = function (prefix) { + prefix = prefix || 'picker'; + return { + + picker: prefix, + opened: prefix + '--opened', + focused: prefix + '--focused', + + input: prefix + '__input', + active: prefix + '__input--active', + target: prefix + '__input--target', + + holder: prefix + '__holder', + + frame: prefix + '__frame', + wrap: prefix + '__wrap', + + box: prefix + '__box' + }; + }; //PickerConstructor.klasses + + + /** + * Check if the default theme is being used. + */ + function isUsingDefaultTheme(element) { + + var theme, + prop = 'position'; + + // For IE. + if (element.currentStyle) { + theme = element.currentStyle[prop]; + } + + // For normal browsers. + else if (window.getComputedStyle) { + theme = getComputedStyle(element)[prop]; + } + + return theme == 'fixed'; + } + + /** + * Get the width of the browser’s scrollbar. + * Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js + */ + function getScrollbarWidth() { + + if ($html.height() <= $window.height()) { + return 0; + } + + var $outer = $('
      ').appendTo('body'); + + // Get the width without scrollbars. + var widthWithoutScroll = $outer[0].offsetWidth; + + // Force adding scrollbars. + $outer.css('overflow', 'scroll'); + + // Add the inner div. + var $inner = $('
      ').appendTo($outer); + + // Get the width with scrollbars. + var widthWithScroll = $inner[0].offsetWidth; + + // Remove the divs. + $outer.remove(); + + // Return the difference between the widths. + return widthWithoutScroll - widthWithScroll; + } + + /** + * PickerConstructor helper methods. + */ + PickerConstructor._ = { + + /** + * Create a group of nodes. Expects: + * ` + { + min: {Integer}, + max: {Integer}, + i: {Integer}, + node: {String}, + item: {Function} + } + * ` + */ + group: function (groupObject) { + + var + // Scope for the looped object + loopObjectScope, + + + // Create the nodes list + nodesList = '', + + + // The counter starts from the `min` + counter = PickerConstructor._.trigger(groupObject.min, groupObject); + + // Loop from the `min` to `max`, incrementing by `i` + for (; counter <= PickerConstructor._.trigger(groupObject.max, groupObject, [counter]); counter += groupObject.i) { + + // Trigger the `item` function within scope of the object + loopObjectScope = PickerConstructor._.trigger(groupObject.item, groupObject, [counter]); + + // Splice the subgroup and create nodes out of the sub nodes + nodesList += PickerConstructor._.node(groupObject.node, loopObjectScope[0], // the node + loopObjectScope[1], // the classes + loopObjectScope[2] // the attributes + ); + } + + // Return the list of nodes + return nodesList; + }, //group + + + /** + * Create a dom node string + */ + node: function (wrapper, item, klass, attribute) { + + // If the item is false-y, just return an empty string + if (!item) return ''; + + // If the item is an array, do a join + item = $.isArray(item) ? item.join('') : item; + + // Check for the class + klass = klass ? ' class="' + klass + '"' : ''; + + // Check for any attributes + attribute = attribute ? ' ' + attribute : ''; + + // Return the wrapped item + return '<' + wrapper + klass + attribute + '>' + item + ''; + }, //node + + + /** + * Lead numbers below 10 with a zero. + */ + lead: function (number) { + return (number < 10 ? '0' : '') + number; + }, + + /** + * Trigger a function otherwise return the value. + */ + trigger: function (callback, scope, args) { + return typeof callback == 'function' ? callback.apply(scope, args || []) : callback; + }, + + /** + * If the second character is a digit, length is 2 otherwise 1. + */ + digits: function (string) { + return (/\d/.test(string[1]) ? 2 : 1 + ); + }, + + /** + * Tell if something is a date object. + */ + isDate: function (value) { + return {}.toString.call(value).indexOf('Date') > -1 && this.isInteger(value.getDate()); + }, + + /** + * Tell if something is an integer. + */ + isInteger: function (value) { + return {}.toString.call(value).indexOf('Number') > -1 && value % 1 === 0; + }, + + /** + * Create ARIA attribute strings. + */ + ariaAttr: ariaAttr //PickerConstructor._ + + + /** + * Extend the picker with a component and defaults. + */ + };PickerConstructor.extend = function (name, Component) { + + // Extend jQuery. + $.fn[name] = function (options, action) { + + // Grab the component data. + var componentData = this.data(name); + + // If the picker is requested, return the data object. + if (options == 'picker') { + return componentData; + } + + // If the component data exists and `options` is a string, carry out the action. + if (componentData && typeof options == 'string') { + return PickerConstructor._.trigger(componentData[options], componentData, [action]); + } + + // Otherwise go through each matched element and if the component + // doesn’t exist, create a new picker using `this` element + // and merging the defaults and options with a deep copy. + return this.each(function () { + var $this = $(this); + if (!$this.data(name)) { + new PickerConstructor(this, name, Component, options); + } + }); + }; + + // Set the defaults. + $.fn[name].defaults = Component.defaults; + }; //PickerConstructor.extend + + + function aria(element, attribute, value) { + if ($.isPlainObject(attribute)) { + for (var key in attribute) { + ariaSet(element, key, attribute[key]); + } + } else { + ariaSet(element, attribute, value); + } + } + function ariaSet(element, attribute, value) { + element.setAttribute((attribute == 'role' ? '' : 'aria-') + attribute, value); + } + function ariaAttr(attribute, data) { + if (!$.isPlainObject(attribute)) { + attribute = { attribute: data }; + } + data = ''; + for (var key in attribute) { + var attr = (key == 'role' ? '' : 'aria-') + key, + attrVal = attribute[key]; + data += attrVal == null ? '' : attr + '="' + attribute[key] + '"'; + } + return data; + } + + // IE8 bug throws an error for activeElements within iframes. + function getActiveElement() { + try { + return document.activeElement; + } catch (err) {} + } + + // Expose the picker constructor. + return PickerConstructor; +}); +; /*! + * Date picker for pickadate.js v3.5.0 + * http://amsul.github.io/pickadate.js/date.htm + */ + +(function (factory) { + factory(Materialize.Picker, jQuery); +})(function (Picker, $) { + + /** + * Globals and constants + */ + var DAYS_IN_WEEK = 7, + WEEKS_IN_CALENDAR = 6, + _ = Picker._; + + /** + * The date picker constructor + */ + function DatePicker(picker, settings) { + + var calendar = this, + element = picker.$node[0], + elementValue = element.value, + elementDataValue = picker.$node.data('value'), + valueString = elementDataValue || elementValue, + formatString = elementDataValue ? settings.formatSubmit : settings.format, + isRTL = function () { + + return element.currentStyle ? + + // For IE. + element.currentStyle.direction == 'rtl' : + + // For normal browsers. + getComputedStyle(picker.$root[0]).direction == 'rtl'; + }; + + calendar.settings = settings; + calendar.$node = picker.$node; + + // The queue of methods that will be used to build item objects. + calendar.queue = { + min: 'measure create', + max: 'measure create', + now: 'now create', + select: 'parse create validate', + highlight: 'parse navigate create validate', + view: 'parse create validate viewset', + disable: 'deactivate', + enable: 'activate' + + // The component's item object. + };calendar.item = {}; + + calendar.item.clear = null; + calendar.item.disable = (settings.disable || []).slice(0); + calendar.item.enable = -function (collectionDisabled) { + return collectionDisabled[0] === true ? collectionDisabled.shift() : -1; + }(calendar.item.disable); + + calendar.set('min', settings.min).set('max', settings.max).set('now'); + + // When there’s a value, set the `select`, which in turn + // also sets the `highlight` and `view`. + if (valueString) { + calendar.set('select', valueString, { format: formatString }); + } + + // If there’s no value, default to highlighting “today”. + else { + calendar.set('select', null).set('highlight', calendar.item.now); + } + + // The keycode to movement mapping. + calendar.key = { + 40: 7, // Down + 38: -7, // Up + 39: function () { + return isRTL() ? -1 : 1; + }, // Right + 37: function () { + return isRTL() ? 1 : -1; + }, // Left + go: function (timeChange) { + var highlightedObject = calendar.item.highlight, + targetDate = new Date(highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange); + calendar.set('highlight', targetDate, { interval: timeChange }); + this.render(); + } + + // Bind some picker events. + };picker.on('render', function () { + picker.$root.find('.' + settings.klass.selectMonth).on('change', function () { + var value = this.value; + if (value) { + picker.set('highlight', [picker.get('view').year, value, picker.get('highlight').date]); + picker.$root.find('.' + settings.klass.selectMonth).trigger('focus'); + } + }); + picker.$root.find('.' + settings.klass.selectYear).on('change', function () { + var value = this.value; + if (value) { + picker.set('highlight', [value, picker.get('view').month, picker.get('highlight').date]); + picker.$root.find('.' + settings.klass.selectYear).trigger('focus'); + } + }); + }, 1).on('open', function () { + var includeToday = ''; + if (calendar.disabled(calendar.get('now'))) { + includeToday = ':not(.' + settings.klass.buttonToday + ')'; + } + picker.$root.find('button' + includeToday + ', select').attr('disabled', false); + }, 1).on('close', function () { + picker.$root.find('button, select').attr('disabled', true); + }, 1); + } //DatePicker + + + /** + * Set a datepicker item object. + */ + DatePicker.prototype.set = function (type, value, options) { + + var calendar = this, + calendarItem = calendar.item; + + // If the value is `null` just set it immediately. + if (value === null) { + if (type == 'clear') type = 'select'; + calendarItem[type] = value; + return calendar; + } + + // Otherwise go through the queue of methods, and invoke the functions. + // Update this as the time unit, and set the final value as this item. + // * In the case of `enable`, keep the queue but set `disable` instead. + // And in the case of `flip`, keep the queue but set `enable` instead. + calendarItem[type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type] = calendar.queue[type].split(' ').map(function (method) { + value = calendar[method](type, value, options); + return value; + }).pop(); + + // Check if we need to cascade through more updates. + if (type == 'select') { + calendar.set('highlight', calendarItem.select, options); + } else if (type == 'highlight') { + calendar.set('view', calendarItem.highlight, options); + } else if (type.match(/^(flip|min|max|disable|enable)$/)) { + if (calendarItem.select && calendar.disabled(calendarItem.select)) { + calendar.set('select', calendarItem.select, options); + } + if (calendarItem.highlight && calendar.disabled(calendarItem.highlight)) { + calendar.set('highlight', calendarItem.highlight, options); + } + } + + return calendar; + }; //DatePicker.prototype.set + + + /** + * Get a datepicker item object. + */ + DatePicker.prototype.get = function (type) { + return this.item[type]; + }; //DatePicker.prototype.get + + + /** + * Create a picker date object. + */ + DatePicker.prototype.create = function (type, value, options) { + + var isInfiniteValue, + calendar = this; + + // If there’s no value, use the type as the value. + value = value === undefined ? type : value; + + // If it’s infinity, update the value. + if (value == -Infinity || value == Infinity) { + isInfiniteValue = value; + } + + // If it’s an object, use the native date object. + else if ($.isPlainObject(value) && _.isInteger(value.pick)) { + value = value.obj; + } + + // If it’s an array, convert it into a date and make sure + // that it’s a valid date – otherwise default to today. + else if ($.isArray(value)) { + value = new Date(value[0], value[1], value[2]); + value = _.isDate(value) ? value : calendar.create().obj; + } + + // If it’s a number or date object, make a normalized date. + else if (_.isInteger(value) || _.isDate(value)) { + value = calendar.normalize(new Date(value), options); + } + + // If it’s a literal true or any other case, set it to now. + else /*if ( value === true )*/{ + value = calendar.now(type, value, options); + } + + // Return the compiled object. + return { + year: isInfiniteValue || value.getFullYear(), + month: isInfiniteValue || value.getMonth(), + date: isInfiniteValue || value.getDate(), + day: isInfiniteValue || value.getDay(), + obj: isInfiniteValue || value, + pick: isInfiniteValue || value.getTime() + }; + }; //DatePicker.prototype.create + + + /** + * Create a range limit object using an array, date object, + * literal “true”, or integer relative to another time. + */ + DatePicker.prototype.createRange = function (from, to) { + + var calendar = this, + createDate = function (date) { + if (date === true || $.isArray(date) || _.isDate(date)) { + return calendar.create(date); + } + return date; + }; + + // Create objects if possible. + if (!_.isInteger(from)) { + from = createDate(from); + } + if (!_.isInteger(to)) { + to = createDate(to); + } + + // Create relative dates. + if (_.isInteger(from) && $.isPlainObject(to)) { + from = [to.year, to.month, to.date + from]; + } else if (_.isInteger(to) && $.isPlainObject(from)) { + to = [from.year, from.month, from.date + to]; + } + + return { + from: createDate(from), + to: createDate(to) + }; + }; //DatePicker.prototype.createRange + + + /** + * Check if a date unit falls within a date range object. + */ + DatePicker.prototype.withinRange = function (range, dateUnit) { + range = this.createRange(range.from, range.to); + return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick; + }; + + /** + * Check if two date range objects overlap. + */ + DatePicker.prototype.overlapRanges = function (one, two) { + + var calendar = this; + + // Convert the ranges into comparable dates. + one = calendar.createRange(one.from, one.to); + two = calendar.createRange(two.from, two.to); + + return calendar.withinRange(one, two.from) || calendar.withinRange(one, two.to) || calendar.withinRange(two, one.from) || calendar.withinRange(two, one.to); + }; + + /** + * Get the date today. + */ + DatePicker.prototype.now = function (type, value, options) { + value = new Date(); + if (options && options.rel) { + value.setDate(value.getDate() + options.rel); + } + return this.normalize(value, options); + }; + + /** + * Navigate to next/prev month. + */ + DatePicker.prototype.navigate = function (type, value, options) { + + var targetDateObject, + targetYear, + targetMonth, + targetDate, + isTargetArray = $.isArray(value), + isTargetObject = $.isPlainObject(value), + viewsetObject = this.item.view; /*, + safety = 100*/ + + if (isTargetArray || isTargetObject) { + + if (isTargetObject) { + targetYear = value.year; + targetMonth = value.month; + targetDate = value.date; + } else { + targetYear = +value[0]; + targetMonth = +value[1]; + targetDate = +value[2]; + } + + // If we’re navigating months but the view is in a different + // month, navigate to the view’s year and month. + if (options && options.nav && viewsetObject && viewsetObject.month !== targetMonth) { + targetYear = viewsetObject.year; + targetMonth = viewsetObject.month; + } + + // Figure out the expected target year and month. + targetDateObject = new Date(targetYear, targetMonth + (options && options.nav ? options.nav : 0), 1); + targetYear = targetDateObject.getFullYear(); + targetMonth = targetDateObject.getMonth(); + + // If the month we’re going to doesn’t have enough days, + // keep decreasing the date until we reach the month’s last date. + while ( /*safety &&*/new Date(targetYear, targetMonth, targetDate).getMonth() !== targetMonth) { + targetDate -= 1; + /*safety -= 1 + if ( !safety ) { + throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.' + }*/ + } + + value = [targetYear, targetMonth, targetDate]; + } + + return value; + }; //DatePicker.prototype.navigate + + + /** + * Normalize a date by setting the hours to midnight. + */ + DatePicker.prototype.normalize = function (value /*, options*/) { + value.setHours(0, 0, 0, 0); + return value; + }; + + /** + * Measure the range of dates. + */ + DatePicker.prototype.measure = function (type, value /*, options*/) { + + var calendar = this; + + // If it’s anything false-y, remove the limits. + if (!value) { + value = type == 'min' ? -Infinity : Infinity; + } + + // If it’s a string, parse it. + else if (typeof value == 'string') { + value = calendar.parse(type, value); + } + + // If it's an integer, get a date relative to today. + else if (_.isInteger(value)) { + value = calendar.now(type, value, { rel: value }); + } + + return value; + }; ///DatePicker.prototype.measure + + + /** + * Create a viewset object based on navigation. + */ + DatePicker.prototype.viewset = function (type, dateObject /*, options*/) { + return this.create([dateObject.year, dateObject.month, 1]); + }; + + /** + * Validate a date as enabled and shift if needed. + */ + DatePicker.prototype.validate = function (type, dateObject, options) { + + var calendar = this, + + + // Keep a reference to the original date. + originalDateObject = dateObject, + + + // Make sure we have an interval. + interval = options && options.interval ? options.interval : 1, + + + // Check if the calendar enabled dates are inverted. + isFlippedBase = calendar.item.enable === -1, + + + // Check if we have any enabled dates after/before now. + hasEnabledBeforeTarget, + hasEnabledAfterTarget, + + + // The min & max limits. + minLimitObject = calendar.item.min, + maxLimitObject = calendar.item.max, + + + // Check if we’ve reached the limit during shifting. + reachedMin, + reachedMax, + + + // Check if the calendar is inverted and at least one weekday is enabled. + hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter(function (value) { + + // If there’s a date, check where it is relative to the target. + if ($.isArray(value)) { + var dateTime = calendar.create(value).pick; + if (dateTime < dateObject.pick) hasEnabledBeforeTarget = true;else if (dateTime > dateObject.pick) hasEnabledAfterTarget = true; + } + + // Return only integers for enabled weekdays. + return _.isInteger(value); + }).length; /*, + safety = 100*/ + + // Cases to validate for: + // [1] Not inverted and date disabled. + // [2] Inverted and some dates enabled. + // [3] Not inverted and out of range. + // + // Cases to **not** validate for: + // • Navigating months. + // • Not inverted and date enabled. + // • Inverted and all dates disabled. + // • ..and anything else. + if (!options || !options.nav) if ( + /* 1 */!isFlippedBase && calendar.disabled(dateObject) || + /* 2 */isFlippedBase && calendar.disabled(dateObject) && (hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget) || + /* 3 */!isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick)) { + + // When inverted, flip the direction if there aren’t any enabled weekdays + // and there are no enabled dates in the direction of the interval. + if (isFlippedBase && !hasEnabledWeekdays && (!hasEnabledAfterTarget && interval > 0 || !hasEnabledBeforeTarget && interval < 0)) { + interval *= -1; + } + + // Keep looping until we reach an enabled date. + while ( /*safety &&*/calendar.disabled(dateObject)) { + + /*safety -= 1 + if ( !safety ) { + throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.' + }*/ + + // If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval. + if (Math.abs(interval) > 1 && (dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month)) { + dateObject = originalDateObject; + interval = interval > 0 ? 1 : -1; + } + + // If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit. + if (dateObject.pick <= minLimitObject.pick) { + reachedMin = true; + interval = 1; + dateObject = calendar.create([minLimitObject.year, minLimitObject.month, minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1)]); + } else if (dateObject.pick >= maxLimitObject.pick) { + reachedMax = true; + interval = -1; + dateObject = calendar.create([maxLimitObject.year, maxLimitObject.month, maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1)]); + } + + // If we’ve reached both limits, just break out of the loop. + if (reachedMin && reachedMax) { + break; + } + + // Finally, create the shifted date using the interval and keep looping. + dateObject = calendar.create([dateObject.year, dateObject.month, dateObject.date + interval]); + } + } //endif + + + // Return the date object settled on. + return dateObject; + }; //DatePicker.prototype.validate + + + /** + * Check if a date is disabled. + */ + DatePicker.prototype.disabled = function (dateToVerify) { + + var calendar = this, + + + // Filter through the disabled dates to check if this is one. + isDisabledMatch = calendar.item.disable.filter(function (dateToDisable) { + + // If the date is a number, match the weekday with 0index and `firstDay` check. + if (_.isInteger(dateToDisable)) { + return dateToVerify.day === (calendar.settings.firstDay ? dateToDisable : dateToDisable - 1) % 7; + } + + // If it’s an array or a native JS date, create and match the exact date. + if ($.isArray(dateToDisable) || _.isDate(dateToDisable)) { + return dateToVerify.pick === calendar.create(dateToDisable).pick; + } + + // If it’s an object, match a date within the “from” and “to” range. + if ($.isPlainObject(dateToDisable)) { + return calendar.withinRange(dateToDisable, dateToVerify); + } + }); + + // If this date matches a disabled date, confirm it’s not inverted. + isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function (dateToDisable) { + return $.isArray(dateToDisable) && dateToDisable[3] == 'inverted' || $.isPlainObject(dateToDisable) && dateToDisable.inverted; + }).length; + + // Check the calendar “enabled” flag and respectively flip the + // disabled state. Then also check if it’s beyond the min/max limits. + return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch || dateToVerify.pick < calendar.item.min.pick || dateToVerify.pick > calendar.item.max.pick; + }; //DatePicker.prototype.disabled + + + /** + * Parse a string into a usable type. + */ + DatePicker.prototype.parse = function (type, value, options) { + + var calendar = this, + parsingObject = {}; + + // If it’s already parsed, we’re good. + if (!value || typeof value != 'string') { + return value; + } + + // We need a `.format` to parse the value with. + if (!(options && options.format)) { + options = options || {}; + options.format = calendar.settings.format; + } + + // Convert the format into an array and then map through it. + calendar.formats.toArray(options.format).map(function (label) { + + var + // Grab the formatting label. + formattingLabel = calendar.formats[label], + + + // The format length is from the formatting label function or the + // label length without the escaping exclamation (!) mark. + formatLength = formattingLabel ? _.trigger(formattingLabel, calendar, [value, parsingObject]) : label.replace(/^!/, '').length; + + // If there's a format label, split the value up to the format length. + // Then add it to the parsing object with appropriate label. + if (formattingLabel) { + parsingObject[label] = value.substr(0, formatLength); + } + + // Update the value as the substring from format length to end. + value = value.substr(formatLength); + }); + + // Compensate for month 0index. + return [parsingObject.yyyy || parsingObject.yy, +(parsingObject.mm || parsingObject.m) - 1, parsingObject.dd || parsingObject.d]; + }; //DatePicker.prototype.parse + + + /** + * Various formats to display the object in. + */ + DatePicker.prototype.formats = function () { + + // Return the length of the first word in a collection. + function getWordLengthFromCollection(string, collection, dateObject) { + + // Grab the first word from the string. + var word = string.match(/\w+/)[0]; + + // If there's no month index, add it to the date object + if (!dateObject.mm && !dateObject.m) { + dateObject.m = collection.indexOf(word) + 1; + } + + // Return the length of the word. + return word.length; + } + + // Get the length of the first word in a string. + function getFirstWordLength(string) { + return string.match(/\w+/)[0].length; + } + + return { + + d: function (string, dateObject) { + + // If there's string, then get the digits length. + // Otherwise return the selected date. + return string ? _.digits(string) : dateObject.date; + }, + dd: function (string, dateObject) { + + // If there's a string, then the length is always 2. + // Otherwise return the selected date with a leading zero. + return string ? 2 : _.lead(dateObject.date); + }, + ddd: function (string, dateObject) { + + // If there's a string, then get the length of the first word. + // Otherwise return the short selected weekday. + return string ? getFirstWordLength(string) : this.settings.weekdaysShort[dateObject.day]; + }, + dddd: function (string, dateObject) { + + // If there's a string, then get the length of the first word. + // Otherwise return the full selected weekday. + return string ? getFirstWordLength(string) : this.settings.weekdaysFull[dateObject.day]; + }, + m: function (string, dateObject) { + + // If there's a string, then get the length of the digits + // Otherwise return the selected month with 0index compensation. + return string ? _.digits(string) : dateObject.month + 1; + }, + mm: function (string, dateObject) { + + // If there's a string, then the length is always 2. + // Otherwise return the selected month with 0index and leading zero. + return string ? 2 : _.lead(dateObject.month + 1); + }, + mmm: function (string, dateObject) { + + var collection = this.settings.monthsShort; + + // If there's a string, get length of the relevant month from the short + // months collection. Otherwise return the selected month from that collection. + return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month]; + }, + mmmm: function (string, dateObject) { + + var collection = this.settings.monthsFull; + + // If there's a string, get length of the relevant month from the full + // months collection. Otherwise return the selected month from that collection. + return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month]; + }, + yy: function (string, dateObject) { + + // If there's a string, then the length is always 2. + // Otherwise return the selected year by slicing out the first 2 digits. + return string ? 2 : ('' + dateObject.year).slice(2); + }, + yyyy: function (string, dateObject) { + + // If there's a string, then the length is always 4. + // Otherwise return the selected year. + return string ? 4 : dateObject.year; + }, + + // Create an array by splitting the formatting string passed. + toArray: function (formatString) { + return formatString.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g); + }, + + // Format an object into a string using the formatting options. + toString: function (formatString, itemObject) { + var calendar = this; + return calendar.formats.toArray(formatString).map(function (label) { + return _.trigger(calendar.formats[label], calendar, [0, itemObject]) || label.replace(/^!/, ''); + }).join(''); + } + }; + }(); //DatePicker.prototype.formats + + + /** + * Check if two date units are the exact. + */ + DatePicker.prototype.isDateExact = function (one, two) { + + var calendar = this; + + // When we’re working with weekdays, do a direct comparison. + if (_.isInteger(one) && _.isInteger(two) || typeof one == 'boolean' && typeof two == 'boolean') { + return one === two; + } + + // When we’re working with date representations, compare the “pick” value. + if ((_.isDate(one) || $.isArray(one)) && (_.isDate(two) || $.isArray(two))) { + return calendar.create(one).pick === calendar.create(two).pick; + } + + // When we’re working with range objects, compare the “from” and “to”. + if ($.isPlainObject(one) && $.isPlainObject(two)) { + return calendar.isDateExact(one.from, two.from) && calendar.isDateExact(one.to, two.to); + } + + return false; + }; + + /** + * Check if two date units overlap. + */ + DatePicker.prototype.isDateOverlap = function (one, two) { + + var calendar = this, + firstDay = calendar.settings.firstDay ? 1 : 0; + + // When we’re working with a weekday index, compare the days. + if (_.isInteger(one) && (_.isDate(two) || $.isArray(two))) { + one = one % 7 + firstDay; + return one === calendar.create(two).day + 1; + } + if (_.isInteger(two) && (_.isDate(one) || $.isArray(one))) { + two = two % 7 + firstDay; + return two === calendar.create(one).day + 1; + } + + // When we’re working with range objects, check if the ranges overlap. + if ($.isPlainObject(one) && $.isPlainObject(two)) { + return calendar.overlapRanges(one, two); + } + + return false; + }; + + /** + * Flip the “enabled” state. + */ + DatePicker.prototype.flipEnable = function (val) { + var itemObject = this.item; + itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1); + }; + + /** + * Mark a collection of dates as “disabled”. + */ + DatePicker.prototype.deactivate = function (type, datesToDisable) { + + var calendar = this, + disabledItems = calendar.item.disable.slice(0); + + // If we’re flipping, that’s all we need to do. + if (datesToDisable == 'flip') { + calendar.flipEnable(); + } else if (datesToDisable === false) { + calendar.flipEnable(1); + disabledItems = []; + } else if (datesToDisable === true) { + calendar.flipEnable(-1); + disabledItems = []; + } + + // Otherwise go through the dates to disable. + else { + + datesToDisable.map(function (unitToDisable) { + + var matchFound; + + // When we have disabled items, check for matches. + // If something is matched, immediately break out. + for (var index = 0; index < disabledItems.length; index += 1) { + if (calendar.isDateExact(unitToDisable, disabledItems[index])) { + matchFound = true; + break; + } + } + + // If nothing was found, add the validated unit to the collection. + if (!matchFound) { + if (_.isInteger(unitToDisable) || _.isDate(unitToDisable) || $.isArray(unitToDisable) || $.isPlainObject(unitToDisable) && unitToDisable.from && unitToDisable.to) { + disabledItems.push(unitToDisable); + } + } + }); + } + + // Return the updated collection. + return disabledItems; + }; //DatePicker.prototype.deactivate + + + /** + * Mark a collection of dates as “enabled”. + */ + DatePicker.prototype.activate = function (type, datesToEnable) { + + var calendar = this, + disabledItems = calendar.item.disable, + disabledItemsCount = disabledItems.length; + + // If we’re flipping, that’s all we need to do. + if (datesToEnable == 'flip') { + calendar.flipEnable(); + } else if (datesToEnable === true) { + calendar.flipEnable(1); + disabledItems = []; + } else if (datesToEnable === false) { + calendar.flipEnable(-1); + disabledItems = []; + } + + // Otherwise go through the disabled dates. + else { + + datesToEnable.map(function (unitToEnable) { + + var matchFound, disabledUnit, index, isExactRange; + + // Go through the disabled items and try to find a match. + for (index = 0; index < disabledItemsCount; index += 1) { + + disabledUnit = disabledItems[index]; + + // When an exact match is found, remove it from the collection. + if (calendar.isDateExact(disabledUnit, unitToEnable)) { + matchFound = disabledItems[index] = null; + isExactRange = true; + break; + } + + // When an overlapped match is found, add the “inverted” state to it. + else if (calendar.isDateOverlap(disabledUnit, unitToEnable)) { + if ($.isPlainObject(unitToEnable)) { + unitToEnable.inverted = true; + matchFound = unitToEnable; + } else if ($.isArray(unitToEnable)) { + matchFound = unitToEnable; + if (!matchFound[3]) matchFound.push('inverted'); + } else if (_.isDate(unitToEnable)) { + matchFound = [unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted']; + } + break; + } + } + + // If a match was found, remove a previous duplicate entry. + if (matchFound) for (index = 0; index < disabledItemsCount; index += 1) { + if (calendar.isDateExact(disabledItems[index], unitToEnable)) { + disabledItems[index] = null; + break; + } + } + + // In the event that we’re dealing with an exact range of dates, + // make sure there are no “inverted” dates because of it. + if (isExactRange) for (index = 0; index < disabledItemsCount; index += 1) { + if (calendar.isDateOverlap(disabledItems[index], unitToEnable)) { + disabledItems[index] = null; + break; + } + } + + // If something is still matched, add it into the collection. + if (matchFound) { + disabledItems.push(matchFound); + } + }); + } + + // Return the updated collection. + return disabledItems.filter(function (val) { + return val != null; + }); + }; //DatePicker.prototype.activate + + + /** + * Create a string for the nodes in the picker. + */ + DatePicker.prototype.nodes = function (isOpen) { + + var calendar = this, + settings = calendar.settings, + calendarItem = calendar.item, + nowObject = calendarItem.now, + selectedObject = calendarItem.select, + highlightedObject = calendarItem.highlight, + viewsetObject = calendarItem.view, + disabledCollection = calendarItem.disable, + minLimitObject = calendarItem.min, + maxLimitObject = calendarItem.max, + + + // Create the calendar table head using a copy of weekday labels collection. + // * We do a copy so we don't mutate the original array. + tableHead = function (collection, fullCollection) { + + // If the first day should be Monday, move Sunday to the end. + if (settings.firstDay) { + collection.push(collection.shift()); + fullCollection.push(fullCollection.shift()); + } + + // Create and return the table head group. + return _.node('thead', _.node('tr', _.group({ + min: 0, + max: DAYS_IN_WEEK - 1, + i: 1, + node: 'th', + item: function (counter) { + return [collection[counter], settings.klass.weekdays, 'scope=col title="' + fullCollection[counter] + '"']; + } + }))); //endreturn + + // Materialize modified + }((settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter).slice(0), settings.weekdaysFull.slice(0)), + //tableHead + + + // Create the nav for next/prev month. + createMonthNav = function (next) { + + // Otherwise, return the created month tag. + return _.node('div', ' ', settings.klass['nav' + (next ? 'Next' : 'Prev')] + ( + + // If the focused month is outside the range, disabled the button. + next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month || !next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month ? ' ' + settings.klass.navDisabled : ''), 'data-nav=' + (next || -1) + ' ' + _.ariaAttr({ + role: 'button', + controls: calendar.$node[0].id + '_table' + }) + ' ' + 'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev) + '"'); //endreturn + }, + //createMonthNav + + + // Create the month label. + //Materialize modified + createMonthLabel = function (override) { + + var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull; + + // Materialize modified + if (override == "short_months") { + monthsCollection = settings.monthsShort; + } + + // If there are months to select, add a dropdown menu. + if (settings.selectMonths && override == undefined) { + + return _.node('select', _.group({ + min: 0, + max: 11, + i: 1, + node: 'option', + item: function (loopedMonth) { + + return [ + + // The looped month and no classes. + monthsCollection[loopedMonth], 0, + + // Set the value and selected index. + 'value=' + loopedMonth + (viewsetObject.month == loopedMonth ? ' selected' : '') + (viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month || viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month ? ' disabled' : '')]; + } + }), settings.klass.selectMonth + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelMonthSelect + '"'); + } + + // Materialize modified + if (override == "short_months") if (selectedObject != null) return monthsCollection[selectedObject.month];else return monthsCollection[viewsetObject.month]; + + // If there's a need for a month selector + return _.node('div', monthsCollection[viewsetObject.month], settings.klass.month); + }, + //createMonthLabel + + + // Create the year label. + // Materialize modified + createYearLabel = function (override) { + + var focusedYear = viewsetObject.year, + + + // If years selector is set to a literal "true", set it to 5. Otherwise + // divide in half to get half before and half after focused year. + numberYears = settings.selectYears === true ? 5 : ~~(settings.selectYears / 2); + + // If there are years to select, add a dropdown menu. + if (numberYears) { + + var minYear = minLimitObject.year, + maxYear = maxLimitObject.year, + lowestYear = focusedYear - numberYears, + highestYear = focusedYear + numberYears; + + // If the min year is greater than the lowest year, increase the highest year + // by the difference and set the lowest year to the min year. + if (minYear > lowestYear) { + highestYear += minYear - lowestYear; + lowestYear = minYear; + } + + // If the max year is less than the highest year, decrease the lowest year + // by the lower of the two: available and needed years. Then set the + // highest year to the max year. + if (maxYear < highestYear) { + + var availableYears = lowestYear - minYear, + neededYears = highestYear - maxYear; + + lowestYear -= availableYears > neededYears ? neededYears : availableYears; + highestYear = maxYear; + } + + if (settings.selectYears && override == undefined) { + return _.node('select', _.group({ + min: lowestYear, + max: highestYear, + i: 1, + node: 'option', + item: function (loopedYear) { + return [ + + // The looped year and no classes. + loopedYear, 0, + + // Set the value and selected index. + 'value=' + loopedYear + (focusedYear == loopedYear ? ' selected' : '')]; + } + }), settings.klass.selectYear + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelYearSelect + '"'); + } + } + + // Materialize modified + if (override === 'raw' && selectedObject != null) { + return _.node('div', selectedObject.year); + } + + // Otherwise just return the year focused + return _.node('div', focusedYear, settings.klass.year); + }; //createYearLabel + + + // Materialize modified + createDayLabel = function () { + if (selectedObject != null) return selectedObject.date;else return nowObject.date; + }; + createWeekdayLabel = function () { + var display_day; + + if (selectedObject != null) display_day = selectedObject.day;else display_day = nowObject.day; + var weekday = settings.weekdaysShort[display_day]; + return weekday; + }; + + // Create and return the entire calendar. + + return _.node( + // Date presentation View + 'div', _.node( + // Div for Year + 'div', createYearLabel("raw"), settings.klass.year_display) + _.node('span', createWeekdayLabel() + ', ', "picker__weekday-display") + _.node( + // Div for short Month + 'span', createMonthLabel("short_months") + ' ', settings.klass.month_display) + _.node( + // Div for Day + 'span', createDayLabel(), settings.klass.day_display), settings.klass.date_display) + + // Calendar container + _.node('div', _.node('div', _.node('div', (settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel()) + createMonthNav() + createMonthNav(1), settings.klass.header) + _.node('table', tableHead + _.node('tbody', _.group({ + min: 0, + max: WEEKS_IN_CALENDAR - 1, + i: 1, + node: 'tr', + item: function (rowCounter) { + + // If Monday is the first day and the month starts on Sunday, shift the date back a week. + var shiftDateBy = settings.firstDay && calendar.create([viewsetObject.year, viewsetObject.month, 1]).day === 0 ? -7 : 0; + + return [_.group({ + min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index + max: function () { + return this.min + DAYS_IN_WEEK - 1; + }, + i: 1, + node: 'td', + item: function (targetDate) { + + // Convert the time date from a relative date to a target date. + targetDate = calendar.create([viewsetObject.year, viewsetObject.month, targetDate + (settings.firstDay ? 1 : 0)]); + + var isSelected = selectedObject && selectedObject.pick == targetDate.pick, + isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick, + isDisabled = disabledCollection && calendar.disabled(targetDate) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick, + formattedDate = _.trigger(calendar.formats.toString, calendar, [settings.format, targetDate]); + + return [_.node('div', targetDate.date, function (klasses) { + + // Add the `infocus` or `outfocus` classes based on month in view. + klasses.push(viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus); + + // Add the `today` class if needed. + if (nowObject.pick == targetDate.pick) { + klasses.push(settings.klass.now); + } + + // Add the `selected` class if something's selected and the time matches. + if (isSelected) { + klasses.push(settings.klass.selected); + } + + // Add the `highlighted` class if something's highlighted and the time matches. + if (isHighlighted) { + klasses.push(settings.klass.highlighted); + } + + // Add the `disabled` class if something's disabled and the object matches. + if (isDisabled) { + klasses.push(settings.klass.disabled); + } + + return klasses.join(' '); + }([settings.klass.day]), 'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({ + role: 'gridcell', + label: formattedDate, + selected: isSelected && calendar.$node.val() === formattedDate ? true : null, + activedescendant: isHighlighted ? true : null, + disabled: isDisabled ? true : null + }) + ' ' + (isDisabled ? '' : 'tabindex="0"')), '', _.ariaAttr({ role: 'presentation' })]; //endreturn + } + })]; //endreturn + } + })), settings.klass.table, 'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({ + role: 'grid', + controls: calendar.$node[0].id, + readonly: true + })), settings.klass.calendar_container) // end calendar + + + + + // * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”. + _.node('div', _.node('button', settings.today, "btn-flat picker__today waves-effect", 'type=button data-pick=' + nowObject.pick + (isOpen && !calendar.disabled(nowObject) ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.clear, "btn-flat picker__clear waves-effect", 'type=button data-clear=1' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.close, "btn-flat picker__close waves-effect", 'type=button data-close=true ' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })), settings.klass.footer), 'picker__container__wrapper'); //endreturn + }; //DatePicker.prototype.nodes + + + /** + * The date picker defaults. + */ + DatePicker.defaults = function (prefix) { + + return { + + // The title label to use for the month nav buttons + labelMonthNext: 'Next month', + labelMonthPrev: 'Previous month', + + // The title label to use for the dropdown selectors + labelMonthSelect: 'Select a month', + labelYearSelect: 'Select a year', + + // Months and weekdays + monthsFull: ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'], + monthsShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], + weekdaysFull: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], + weekdaysShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], + + // Materialize modified + weekdaysLetter: ['S', 'M', 'T', 'W', 'T', 'F', 'S'], + + // Today and clear + today: 'Today', + clear: 'Clear', + close: 'Ok', + + // Picker close behavior (Prevent a change in behaviour for backwards compatibility) + closeOnSelect: false, + + // The format to show on the `input` element + format: 'd mmmm, yyyy', + + // Classes + klass: { + + table: prefix + 'table', + + header: prefix + 'header', + + // Materialize Added klasses + date_display: prefix + 'date-display', + day_display: prefix + 'day-display', + month_display: prefix + 'month-display', + year_display: prefix + 'year-display', + calendar_container: prefix + 'calendar-container', + // end + + + navPrev: prefix + 'nav--prev', + navNext: prefix + 'nav--next', + navDisabled: prefix + 'nav--disabled', + + month: prefix + 'month', + year: prefix + 'year', + + selectMonth: prefix + 'select--month', + selectYear: prefix + 'select--year', + + weekdays: prefix + 'weekday', + + day: prefix + 'day', + disabled: prefix + 'day--disabled', + selected: prefix + 'day--selected', + highlighted: prefix + 'day--highlighted', + now: prefix + 'day--today', + infocus: prefix + 'day--infocus', + outfocus: prefix + 'day--outfocus', + + footer: prefix + 'footer', + + buttonClear: prefix + 'button--clear', + buttonToday: prefix + 'button--today', + buttonClose: prefix + 'button--close' + } + }; + }(Picker.klasses().picker + '__'); + + /** + * Extend the picker to add the date picker. + */ + Picker.extend('pickadate', DatePicker); +}); +; /*! + * ClockPicker v0.0.7 (http://weareoutman.github.io/clockpicker/) + * Copyright 2014 Wang Shenwei. + * Licensed under MIT (https://github.com/weareoutman/clockpicker/blob/gh-pages/LICENSE) + * + * Further modified + * Copyright 2015 Ching Yaw Hao. + */ + +(function ($) { + var $win = $(window), + $doc = $(document); + + // Can I use inline svg ? + var svgNS = 'http://www.w3.org/2000/svg', + svgSupported = 'SVGAngle' in window && function () { + var supported, + el = document.createElement('div'); + el.innerHTML = ''; + supported = (el.firstChild && el.firstChild.namespaceURI) == svgNS; + el.innerHTML = ''; + return supported; + }(); + + // Can I use transition ? + var transitionSupported = function () { + var style = document.createElement('div').style; + return 'transition' in style || 'WebkitTransition' in style || 'MozTransition' in style || 'msTransition' in style || 'OTransition' in style; + }(); + + // Listen touch events in touch screen device, instead of mouse events in desktop. + var touchSupported = 'ontouchstart' in window, + mousedownEvent = 'mousedown' + (touchSupported ? ' touchstart' : ''), + mousemoveEvent = 'mousemove.clockpicker' + (touchSupported ? ' touchmove.clockpicker' : ''), + mouseupEvent = 'mouseup.clockpicker' + (touchSupported ? ' touchend.clockpicker' : ''); + + // Vibrate the device if supported + var vibrate = navigator.vibrate ? 'vibrate' : navigator.webkitVibrate ? 'webkitVibrate' : null; + + function createSvgElement(name) { + return document.createElementNS(svgNS, name); + } + + function leadingZero(num) { + return (num < 10 ? '0' : '') + num; + } + + // Get a unique id + var idCounter = 0; + function uniqueId(prefix) { + var id = ++idCounter + ''; + return prefix ? prefix + id : id; + } + + // Clock size + var dialRadius = 135, + outerRadius = 105, + + // innerRadius = 80 on 12 hour clock + innerRadius = 70, + tickRadius = 20, + diameter = dialRadius * 2, + duration = transitionSupported ? 350 : 1; + + // Popover template + var tpl = ['
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '', ':', '', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '', '
      ', '
      ', '
      ', '
      ', '
      ', '
      '].join(''); + + // ClockPicker + function ClockPicker(element, options) { + var popover = $(tpl), + plate = popover.find('.clockpicker-plate'), + holder = popover.find('.picker__holder'), + hoursView = popover.find('.clockpicker-hours'), + minutesView = popover.find('.clockpicker-minutes'), + amPmBlock = popover.find('.clockpicker-am-pm-block'), + isInput = element.prop('tagName') === 'INPUT', + input = isInput ? element : element.find('input'), + label = $("label[for=" + input.attr("id") + "]"), + self = this; + + this.id = uniqueId('cp'); + this.element = element; + this.holder = holder; + this.options = options; + this.isAppended = false; + this.isShown = false; + this.currentView = 'hours'; + this.isInput = isInput; + this.input = input; + this.label = label; + this.popover = popover; + this.plate = plate; + this.hoursView = hoursView; + this.minutesView = minutesView; + this.amPmBlock = amPmBlock; + this.spanHours = popover.find('.clockpicker-span-hours'); + this.spanMinutes = popover.find('.clockpicker-span-minutes'); + this.spanAmPm = popover.find('.clockpicker-span-am-pm'); + this.footer = popover.find('.picker__footer'); + this.amOrPm = "PM"; + + // Setup for for 12 hour clock if option is selected + if (options.twelvehour) { + if (!options.ampmclickable) { + this.spanAmPm.empty(); + $('
      AM
      ').appendTo(this.spanAmPm); + $('
      PM
      ').appendTo(this.spanAmPm); + } else { + this.spanAmPm.empty(); + $('
      AM
      ').on("click", function () { + self.spanAmPm.children('#click-am').addClass("text-primary"); + self.spanAmPm.children('#click-pm').removeClass("text-primary"); + self.amOrPm = "AM"; + }).appendTo(this.spanAmPm); + $('
      PM
      ').on("click", function () { + self.spanAmPm.children('#click-pm').addClass("text-primary"); + self.spanAmPm.children('#click-am').removeClass("text-primary"); + self.amOrPm = 'PM'; + }).appendTo(this.spanAmPm); + } + } + + // Add buttons to footer + $('').click($.proxy(this.clear, this)).appendTo(this.footer); + $('').click($.proxy(this.hide, this)).appendTo(this.footer); + $('').click($.proxy(this.done, this)).appendTo(this.footer); + + this.spanHours.click($.proxy(this.toggleView, this, 'hours')); + this.spanMinutes.click($.proxy(this.toggleView, this, 'minutes')); + + // Show or toggle + input.on('focus.clockpicker click.clockpicker', $.proxy(this.show, this)); + + // Build ticks + var tickTpl = $('
      '), + i, + tick, + radian, + radius; + + // Hours view + if (options.twelvehour) { + for (i = 1; i < 13; i += 1) { + tick = tickTpl.clone(); + radian = i / 6 * Math.PI; + radius = outerRadius; + tick.css({ + left: dialRadius + Math.sin(radian) * radius - tickRadius, + top: dialRadius - Math.cos(radian) * radius - tickRadius + }); + tick.html(i === 0 ? '00' : i); + hoursView.append(tick); + tick.on(mousedownEvent, mousedown); + } + } else { + for (i = 0; i < 24; i += 1) { + tick = tickTpl.clone(); + radian = i / 6 * Math.PI; + var inner = i > 0 && i < 13; + radius = inner ? innerRadius : outerRadius; + tick.css({ + left: dialRadius + Math.sin(radian) * radius - tickRadius, + top: dialRadius - Math.cos(radian) * radius - tickRadius + }); + tick.html(i === 0 ? '00' : i); + hoursView.append(tick); + tick.on(mousedownEvent, mousedown); + } + } + + // Minutes view + for (i = 0; i < 60; i += 5) { + tick = tickTpl.clone(); + radian = i / 30 * Math.PI; + tick.css({ + left: dialRadius + Math.sin(radian) * outerRadius - tickRadius, + top: dialRadius - Math.cos(radian) * outerRadius - tickRadius + }); + tick.html(leadingZero(i)); + minutesView.append(tick); + tick.on(mousedownEvent, mousedown); + } + + // Clicking on minutes view space + plate.on(mousedownEvent, function (e) { + if ($(e.target).closest('.clockpicker-tick').length === 0) { + mousedown(e, true); + } + }); + + // Mousedown or touchstart + function mousedown(e, space) { + var offset = plate.offset(), + isTouch = /^touch/.test(e.type), + x0 = offset.left + dialRadius, + y0 = offset.top + dialRadius, + dx = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0, + dy = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0, + z = Math.sqrt(dx * dx + dy * dy), + moved = false; + + // When clicking on minutes view space, check the mouse position + if (space && (z < outerRadius - tickRadius || z > outerRadius + tickRadius)) { + return; + } + e.preventDefault(); + + // Set cursor style of body after 200ms + var movingTimer = setTimeout(function () { + self.popover.addClass('clockpicker-moving'); + }, 200); + + // Clock + self.setHand(dx, dy, !space, true); + + // Mousemove on document + $doc.off(mousemoveEvent).on(mousemoveEvent, function (e) { + e.preventDefault(); + var isTouch = /^touch/.test(e.type), + x = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0, + y = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0; + if (!moved && x === dx && y === dy) { + // Clicking in chrome on windows will trigger a mousemove event + return; + } + moved = true; + self.setHand(x, y, false, true); + }); + + // Mouseup on document + $doc.off(mouseupEvent).on(mouseupEvent, function (e) { + $doc.off(mouseupEvent); + e.preventDefault(); + var isTouch = /^touch/.test(e.type), + x = (isTouch ? e.originalEvent.changedTouches[0] : e).pageX - x0, + y = (isTouch ? e.originalEvent.changedTouches[0] : e).pageY - y0; + if ((space || moved) && x === dx && y === dy) { + self.setHand(x, y); + } + + if (self.currentView === 'hours') { + self.toggleView('minutes', duration / 2); + } else if (options.autoclose) { + self.minutesView.addClass('clockpicker-dial-out'); + setTimeout(function () { + self.done(); + }, duration / 2); + } + plate.prepend(canvas); + + // Reset cursor style of body + clearTimeout(movingTimer); + self.popover.removeClass('clockpicker-moving'); + + // Unbind mousemove event + $doc.off(mousemoveEvent); + }); + } + + if (svgSupported) { + // Draw clock hands and others + var canvas = popover.find('.clockpicker-canvas'), + svg = createSvgElement('svg'); + svg.setAttribute('class', 'clockpicker-svg'); + svg.setAttribute('width', diameter); + svg.setAttribute('height', diameter); + var g = createSvgElement('g'); + g.setAttribute('transform', 'translate(' + dialRadius + ',' + dialRadius + ')'); + var bearing = createSvgElement('circle'); + bearing.setAttribute('class', 'clockpicker-canvas-bearing'); + bearing.setAttribute('cx', 0); + bearing.setAttribute('cy', 0); + bearing.setAttribute('r', 4); + var hand = createSvgElement('line'); + hand.setAttribute('x1', 0); + hand.setAttribute('y1', 0); + var bg = createSvgElement('circle'); + bg.setAttribute('class', 'clockpicker-canvas-bg'); + bg.setAttribute('r', tickRadius); + g.appendChild(hand); + g.appendChild(bg); + g.appendChild(bearing); + svg.appendChild(g); + canvas.append(svg); + + this.hand = hand; + this.bg = bg; + this.bearing = bearing; + this.g = g; + this.canvas = canvas; + } + + raiseCallback(this.options.init); + } + + function raiseCallback(callbackFunction) { + if (callbackFunction && typeof callbackFunction === "function") callbackFunction(); + } + + // Default options + ClockPicker.DEFAULTS = { + 'default': '', // default time, 'now' or '13:14' e.g. + fromnow: 0, // set default time to * milliseconds from now (using with default = 'now') + donetext: 'Ok', // done button text + cleartext: 'Clear', + canceltext: 'Cancel', + autoclose: false, // auto close when minute is selected + ampmclickable: true, // set am/pm button on itself + darktheme: false, // set to dark theme + twelvehour: true, // change to 12 hour AM/PM clock from 24 hour + vibrate: true // vibrate the device when dragging clock hand + }; + + // Show or hide popover + ClockPicker.prototype.toggle = function () { + this[this.isShown ? 'hide' : 'show'](); + }; + + // Set popover position + ClockPicker.prototype.locate = function () { + var element = this.element, + popover = this.popover, + offset = element.offset(), + width = element.outerWidth(), + height = element.outerHeight(), + align = this.options.align, + self = this; + + popover.show(); + }; + + // Show popover + ClockPicker.prototype.show = function (e) { + // Not show again + if (this.isShown) { + return; + } + raiseCallback(this.options.beforeShow); + $(':input').each(function () { + $(this).attr('tabindex', -1); + }); + var self = this; + // Initialize + this.input.blur(); + this.popover.addClass('picker--opened'); + this.input.addClass('picker__input picker__input--active'); + $(document.body).css('overflow', 'hidden'); + // Get the time + var value = ((this.input.prop('value') || this.options['default'] || '') + '').split(':'); + if (this.options.twelvehour && !(typeof value[1] === 'undefined')) { + if (value[1].indexOf("AM") > 0) { + this.amOrPm = 'AM'; + } else { + this.amOrPm = 'PM'; + } + value[1] = value[1].replace("AM", "").replace("PM", ""); + } + if (value[0] === 'now') { + var now = new Date(+new Date() + this.options.fromnow); + value = [now.getHours(), now.getMinutes()]; + if (this.options.twelvehour) { + this.amOrPm = value[0] >= 12 && value[0] < 24 ? 'PM' : 'AM'; + } + } + this.hours = +value[0] || 0; + this.minutes = +value[1] || 0; + this.spanHours.html(this.hours); + this.spanMinutes.html(leadingZero(this.minutes)); + if (!this.isAppended) { + + // Append popover to input by default + var containerEl = document.querySelector(this.options.container); + if (this.options.container && containerEl) { + containerEl.appendChild(this.popover[0]); + } else { + this.popover.insertAfter(this.input); + } + + if (this.options.twelvehour) { + if (this.amOrPm === 'PM') { + this.spanAmPm.children('#click-pm').addClass("text-primary"); + this.spanAmPm.children('#click-am').removeClass("text-primary"); + } else { + this.spanAmPm.children('#click-am').addClass("text-primary"); + this.spanAmPm.children('#click-pm').removeClass("text-primary"); + } + } + // Reset position when resize + $win.on('resize.clockpicker' + this.id, function () { + if (self.isShown) { + self.locate(); + } + }); + this.isAppended = true; + } + // Toggle to hours view + this.toggleView('hours'); + // Set position + this.locate(); + this.isShown = true; + // Hide when clicking or tabbing on any element except the clock and input + $doc.on('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id, function (e) { + var target = $(e.target); + if (target.closest(self.popover.find('.picker__wrap')).length === 0 && target.closest(self.input).length === 0) { + self.hide(); + } + }); + // Hide when ESC is pressed + $doc.on('keyup.clockpicker.' + this.id, function (e) { + if (e.keyCode === 27) { + self.hide(); + } + }); + raiseCallback(this.options.afterShow); + }; + // Hide popover + ClockPicker.prototype.hide = function () { + raiseCallback(this.options.beforeHide); + this.input.removeClass('picker__input picker__input--active'); + this.popover.removeClass('picker--opened'); + $(document.body).css('overflow', 'visible'); + this.isShown = false; + $(':input').each(function (index) { + $(this).attr('tabindex', index + 1); + }); + // Unbinding events on document + $doc.off('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id); + $doc.off('keyup.clockpicker.' + this.id); + this.popover.hide(); + raiseCallback(this.options.afterHide); + }; + // Toggle to hours or minutes view + ClockPicker.prototype.toggleView = function (view, delay) { + var raiseAfterHourSelect = false; + if (view === 'minutes' && $(this.hoursView).css("visibility") === "visible") { + raiseCallback(this.options.beforeHourSelect); + raiseAfterHourSelect = true; + } + var isHours = view === 'hours', + nextView = isHours ? this.hoursView : this.minutesView, + hideView = isHours ? this.minutesView : this.hoursView; + this.currentView = view; + + this.spanHours.toggleClass('text-primary', isHours); + this.spanMinutes.toggleClass('text-primary', !isHours); + + // Let's make transitions + hideView.addClass('clockpicker-dial-out'); + nextView.css('visibility', 'visible').removeClass('clockpicker-dial-out'); + + // Reset clock hand + this.resetClock(delay); + + // After transitions ended + clearTimeout(this.toggleViewTimer); + this.toggleViewTimer = setTimeout(function () { + hideView.css('visibility', 'hidden'); + }, duration); + + if (raiseAfterHourSelect) { + raiseCallback(this.options.afterHourSelect); + } + }; + + // Reset clock hand + ClockPicker.prototype.resetClock = function (delay) { + var view = this.currentView, + value = this[view], + isHours = view === 'hours', + unit = Math.PI / (isHours ? 6 : 30), + radian = value * unit, + radius = isHours && value > 0 && value < 13 ? innerRadius : outerRadius, + x = Math.sin(radian) * radius, + y = -Math.cos(radian) * radius, + self = this; + + if (svgSupported && delay) { + self.canvas.addClass('clockpicker-canvas-out'); + setTimeout(function () { + self.canvas.removeClass('clockpicker-canvas-out'); + self.setHand(x, y); + }, delay); + } else this.setHand(x, y); + }; + + // Set clock hand to (x, y) + ClockPicker.prototype.setHand = function (x, y, roundBy5, dragging) { + var radian = Math.atan2(x, -y), + isHours = this.currentView === 'hours', + unit = Math.PI / (isHours || roundBy5 ? 6 : 30), + z = Math.sqrt(x * x + y * y), + options = this.options, + inner = isHours && z < (outerRadius + innerRadius) / 2, + radius = inner ? innerRadius : outerRadius, + value; + + if (options.twelvehour) { + radius = outerRadius; + } + + // Radian should in range [0, 2PI] + if (radian < 0) { + radian = Math.PI * 2 + radian; + } + + // Get the round value + value = Math.round(radian / unit); + + // Get the round radian + radian = value * unit; + + // Correct the hours or minutes + if (options.twelvehour) { + if (isHours) { + if (value === 0) value = 12; + } else { + if (roundBy5) value *= 5; + if (value === 60) value = 0; + } + } else { + if (isHours) { + if (value === 12) value = 0; + value = inner ? value === 0 ? 12 : value : value === 0 ? 0 : value + 12; + } else { + if (roundBy5) value *= 5; + if (value === 60) value = 0; + } + } + + // Once hours or minutes changed, vibrate the device + if (this[this.currentView] !== value) { + if (vibrate && this.options.vibrate) { + // Do not vibrate too frequently + if (!this.vibrateTimer) { + navigator[vibrate](10); + this.vibrateTimer = setTimeout($.proxy(function () { + this.vibrateTimer = null; + }, this), 100); + } + } + } + + this[this.currentView] = value; + if (isHours) { + this['spanHours'].html(value); + } else { + this['spanMinutes'].html(leadingZero(value)); + } + + // If svg is not supported, just add an active class to the tick + if (!svgSupported) { + this[isHours ? 'hoursView' : 'minutesView'].find('.clockpicker-tick').each(function () { + var tick = $(this); + tick.toggleClass('active', value === +tick.html()); + }); + return; + } + + // Set clock hand and others' position + var cx1 = Math.sin(radian) * (radius - tickRadius), + cy1 = -Math.cos(radian) * (radius - tickRadius), + cx2 = Math.sin(radian) * radius, + cy2 = -Math.cos(radian) * radius; + this.hand.setAttribute('x2', cx1); + this.hand.setAttribute('y2', cy1); + this.bg.setAttribute('cx', cx2); + this.bg.setAttribute('cy', cy2); + }; + + // Hours and minutes are selected + ClockPicker.prototype.done = function () { + raiseCallback(this.options.beforeDone); + this.hide(); + this.label.addClass('active'); + + var last = this.input.prop('value'), + value = leadingZero(this.hours) + ':' + leadingZero(this.minutes); + if (this.options.twelvehour) { + value = value + this.amOrPm; + } + + this.input.prop('value', value); + if (value !== last) { + this.input.triggerHandler('change'); + if (!this.isInput) { + this.element.trigger('change'); + } + } + + if (this.options.autoclose) this.input.trigger('blur'); + + raiseCallback(this.options.afterDone); + }; + + // Clear input field + ClockPicker.prototype.clear = function () { + this.hide(); + this.label.removeClass('active'); + + var last = this.input.prop('value'), + value = ''; + + this.input.prop('value', value); + if (value !== last) { + this.input.triggerHandler('change'); + if (!this.isInput) { + this.element.trigger('change'); + } + } + + if (this.options.autoclose) { + this.input.trigger('blur'); + } + }; + + // Remove clockpicker from input + ClockPicker.prototype.remove = function () { + this.element.removeData('clockpicker'); + this.input.off('focus.clockpicker click.clockpicker'); + if (this.isShown) { + this.hide(); + } + if (this.isAppended) { + $win.off('resize.clockpicker' + this.id); + this.popover.remove(); + } + }; + + // Extends $.fn.clockpicker + $.fn.pickatime = function (option) { + var args = Array.prototype.slice.call(arguments, 1); + return this.each(function () { + var $this = $(this), + data = $this.data('clockpicker'); + if (!data) { + var options = $.extend({}, ClockPicker.DEFAULTS, $this.data(), typeof option == 'object' && option); + $this.data('clockpicker', new ClockPicker($this, options)); + } else { + // Manual operatsions. show, hide, remove, e.g. + if (typeof data[option] === 'function') { + data[option].apply(data, args); + } + } + }); + }; +})(jQuery); +;(function ($) { + + $.fn.characterCounter = function () { + return this.each(function () { + var $input = $(this); + var $counterElement = $input.parent().find('span[class="character-counter"]'); + + // character counter has already been added appended to the parent container + if ($counterElement.length) { + return; + } + + var itHasLengthAttribute = $input.attr('data-length') !== undefined; + + if (itHasLengthAttribute) { + $input.on('input', updateCounter); + $input.on('focus', updateCounter); + $input.on('blur', removeCounterElement); + + addCounterElement($input); + } + }); + }; + + function updateCounter() { + var maxLength = +$(this).attr('data-length'), + actualLength = +$(this).val().length, + isValidLength = actualLength <= maxLength; + + $(this).parent().find('span[class="character-counter"]').html(actualLength + '/' + maxLength); + + addInputStyle(isValidLength, $(this)); + } + + function addCounterElement($input) { + var $counterElement = $input.parent().find('span[class="character-counter"]'); + + if ($counterElement.length) { + return; + } + + $counterElement = $('').addClass('character-counter').css('float', 'right').css('font-size', '12px').css('height', 1); + + $input.parent().append($counterElement); + } + + function removeCounterElement() { + $(this).parent().find('span[class="character-counter"]').html(''); + } + + function addInputStyle(isValidLength, $input) { + var inputHasInvalidClass = $input.hasClass('invalid'); + if (isValidLength && inputHasInvalidClass) { + $input.removeClass('invalid'); + } else if (!isValidLength && !inputHasInvalidClass) { + $input.removeClass('valid'); + $input.addClass('invalid'); + } + } + + $(document).ready(function () { + $('input, textarea').characterCounter(); + }); +})(jQuery); +;(function ($) { + + var methods = { + + init: function (options) { + var defaults = { + duration: 200, // ms + dist: -100, // zoom scale TODO: make this more intuitive as an option + shift: 0, // spacing for center image + padding: 0, // Padding between non center items + fullWidth: false, // Change to full width styles + indicators: false, // Toggle indicators + noWrap: false, // Don't wrap around and cycle through items. + onCycleTo: null // Callback for when a new slide is cycled to. + }; + options = $.extend(defaults, options); + var namespace = Materialize.objectSelectorString($(this)); + + return this.each(function (i) { + + var images, item_width, item_height, offset, center, pressed, dim, count, reference, referenceY, amplitude, target, velocity, scrolling, xform, frame, timestamp, ticker, dragged, vertical_dragged; + var $indicators = $('
        '); + var scrollingTimeout = null; + var oneTimeCallback = null; + + // Initialize + var view = $(this); + var hasMultipleSlides = view.find('.carousel-item').length > 1; + var showIndicators = (view.attr('data-indicators') || options.indicators) && hasMultipleSlides; + var noWrap = view.attr('data-no-wrap') || options.noWrap || !hasMultipleSlides; + var uniqueNamespace = view.attr('data-namespace') || namespace + i; + view.attr('data-namespace', uniqueNamespace); + + // Options + var setCarouselHeight = function (imageOnly) { + var firstSlide = view.find('.carousel-item.active').length ? view.find('.carousel-item.active').first() : view.find('.carousel-item').first(); + var firstImage = firstSlide.find('img').first(); + if (firstImage.length) { + if (firstImage[0].complete) { + // If image won't trigger the load event + var imageHeight = firstImage.height(); + if (imageHeight > 0) { + view.css('height', firstImage.height()); + } else { + // If image still has no height, use the natural dimensions to calculate + var naturalWidth = firstImage[0].naturalWidth; + var naturalHeight = firstImage[0].naturalHeight; + var adjustedHeight = view.width() / naturalWidth * naturalHeight; + view.css('height', adjustedHeight); + } + } else { + // Get height when image is loaded normally + firstImage.on('load', function () { + view.css('height', $(this).height()); + }); + } + } else if (!imageOnly) { + var slideHeight = firstSlide.height(); + view.css('height', slideHeight); + } + }; + + if (options.fullWidth) { + options.dist = 0; + setCarouselHeight(); + + // Offset fixed items when indicators. + if (showIndicators) { + view.find('.carousel-fixed-item').addClass('with-indicators'); + } + } + + // Don't double initialize. + if (view.hasClass('initialized')) { + // Recalculate variables + $(window).trigger('resize'); + + // Redraw carousel. + view.trigger('carouselNext', [0.000001]); + return true; + } + + view.addClass('initialized'); + pressed = false; + offset = target = 0; + images = []; + item_width = view.find('.carousel-item').first().innerWidth(); + item_height = view.find('.carousel-item').first().innerHeight(); + dim = item_width * 2 + options.padding; + + view.find('.carousel-item').each(function (i) { + images.push($(this)[0]); + if (showIndicators) { + var $indicator = $('
      • '); + + // Add active to first by default. + if (i === 0) { + $indicator.addClass('active'); + } + + // Handle clicks on indicators. + $indicator.click(function (e) { + e.stopPropagation(); + + var index = $(this).index(); + cycleTo(index); + }); + $indicators.append($indicator); + } + }); + + if (showIndicators) { + view.append($indicators); + } + count = images.length; + + function setupEvents() { + if (typeof window.ontouchstart !== 'undefined') { + view.on('touchstart.carousel', tap); + view.on('touchmove.carousel', drag); + view.on('touchend.carousel', release); + } + view.on('mousedown.carousel', tap); + view.on('mousemove.carousel', drag); + view.on('mouseup.carousel', release); + view.on('mouseleave.carousel', release); + view.on('click.carousel', click); + } + + function xpos(e) { + // touch event + if (e.targetTouches && e.targetTouches.length >= 1) { + return e.targetTouches[0].clientX; + } + + // mouse event + return e.clientX; + } + + function ypos(e) { + // touch event + if (e.targetTouches && e.targetTouches.length >= 1) { + return e.targetTouches[0].clientY; + } + + // mouse event + return e.clientY; + } + + function wrap(x) { + return x >= count ? x % count : x < 0 ? wrap(count + x % count) : x; + } + + function scroll(x) { + // Track scrolling state + scrolling = true; + if (!view.hasClass('scrolling')) { + view.addClass('scrolling'); + } + if (scrollingTimeout != null) { + window.clearTimeout(scrollingTimeout); + } + scrollingTimeout = window.setTimeout(function () { + scrolling = false; + view.removeClass('scrolling'); + }, options.duration); + + // Start actual scroll + var i, half, delta, dir, tween, el, alignment, xTranslation; + var lastCenter = center; + + offset = typeof x === 'number' ? x : offset; + center = Math.floor((offset + dim / 2) / dim); + delta = offset - center * dim; + dir = delta < 0 ? 1 : -1; + tween = -dir * delta * 2 / dim; + half = count >> 1; + + if (!options.fullWidth) { + alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) '; + alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)'; + } else { + alignment = 'translateX(0)'; + } + + // Set indicator active + if (showIndicators) { + var diff = center % count; + var activeIndicator = $indicators.find('.indicator-item.active'); + if (activeIndicator.index() !== diff) { + activeIndicator.removeClass('active'); + $indicators.find('.indicator-item').eq(diff).addClass('active'); + } + } + + // center + // Don't show wrapped items. + if (!noWrap || center >= 0 && center < count) { + el = images[wrap(center)]; + + // Add active class to center item. + if (!$(el).hasClass('active')) { + view.find('.carousel-item').removeClass('active'); + $(el).addClass('active'); + } + el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween * i + 'px)' + ' translateZ(' + options.dist * tween + 'px)'; + el.style.zIndex = 0; + if (options.fullWidth) { + tweenedOpacity = 1; + } else { + tweenedOpacity = 1 - 0.2 * tween; + } + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + + for (i = 1; i <= half; ++i) { + // right side + if (options.fullWidth) { + zTranslation = options.dist; + tweenedOpacity = i === half && delta < 0 ? 1 - tween : 1; + } else { + zTranslation = options.dist * (i * 2 + tween * dir); + tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir); + } + // Don't show wrapped items. + if (!noWrap || center + i < count) { + el = images[wrap(center + i)]; + el.style[xform] = alignment + ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)'; + el.style.zIndex = -i; + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + + // left side + if (options.fullWidth) { + zTranslation = options.dist; + tweenedOpacity = i === half && delta > 0 ? 1 - tween : 1; + } else { + zTranslation = options.dist * (i * 2 - tween * dir); + tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir); + } + // Don't show wrapped items. + if (!noWrap || center - i >= 0) { + el = images[wrap(center - i)]; + el.style[xform] = alignment + ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)'; + el.style.zIndex = -i; + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + } + + // center + // Don't show wrapped items. + if (!noWrap || center >= 0 && center < count) { + el = images[wrap(center)]; + el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween + 'px)' + ' translateZ(' + options.dist * tween + 'px)'; + el.style.zIndex = 0; + if (options.fullWidth) { + tweenedOpacity = 1; + } else { + tweenedOpacity = 1 - 0.2 * tween; + } + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + + // onCycleTo callback + if (lastCenter !== center && typeof options.onCycleTo === "function") { + var $curr_item = view.find('.carousel-item').eq(wrap(center)); + options.onCycleTo.call(this, $curr_item, dragged); + } + + // One time callback + if (typeof oneTimeCallback === "function") { + oneTimeCallback.call(this, $curr_item, dragged); + oneTimeCallback = null; + } + } + + function track() { + var now, elapsed, delta, v; + + now = Date.now(); + elapsed = now - timestamp; + timestamp = now; + delta = offset - frame; + frame = offset; + + v = 1000 * delta / (1 + elapsed); + velocity = 0.8 * v + 0.2 * velocity; + } + + function autoScroll() { + var elapsed, delta; + + if (amplitude) { + elapsed = Date.now() - timestamp; + delta = amplitude * Math.exp(-elapsed / options.duration); + if (delta > 2 || delta < -2) { + scroll(target - delta); + requestAnimationFrame(autoScroll); + } else { + scroll(target); + } + } + } + + function click(e) { + // Disable clicks if carousel was dragged. + if (dragged) { + e.preventDefault(); + e.stopPropagation(); + return false; + } else if (!options.fullWidth) { + var clickedIndex = $(e.target).closest('.carousel-item').index(); + var diff = wrap(center) - clickedIndex; + + // Disable clicks if carousel was shifted by click + if (diff !== 0) { + e.preventDefault(); + e.stopPropagation(); + } + cycleTo(clickedIndex); + } + } + + function cycleTo(n) { + var diff = center % count - n; + + // Account for wraparound. + if (!noWrap) { + if (diff < 0) { + if (Math.abs(diff + count) < Math.abs(diff)) { + diff += count; + } + } else if (diff > 0) { + if (Math.abs(diff - count) < diff) { + diff -= count; + } + } + } + + // Call prev or next accordingly. + if (diff < 0) { + view.trigger('carouselNext', [Math.abs(diff)]); + } else if (diff > 0) { + view.trigger('carouselPrev', [diff]); + } + } + + function tap(e) { + // Fixes firefox draggable image bug + if (e.type === 'mousedown' && $(e.target).is('img')) { + e.preventDefault(); + } + pressed = true; + dragged = false; + vertical_dragged = false; + reference = xpos(e); + referenceY = ypos(e); + + velocity = amplitude = 0; + frame = offset; + timestamp = Date.now(); + clearInterval(ticker); + ticker = setInterval(track, 100); + } + + function drag(e) { + var x, delta, deltaY; + if (pressed) { + x = xpos(e); + y = ypos(e); + delta = reference - x; + deltaY = Math.abs(referenceY - y); + if (deltaY < 30 && !vertical_dragged) { + // If vertical scrolling don't allow dragging. + if (delta > 2 || delta < -2) { + dragged = true; + reference = x; + scroll(offset + delta); + } + } else if (dragged) { + // If dragging don't allow vertical scroll. + e.preventDefault(); + e.stopPropagation(); + return false; + } else { + // Vertical scrolling. + vertical_dragged = true; + } + } + + if (dragged) { + // If dragging don't allow vertical scroll. + e.preventDefault(); + e.stopPropagation(); + return false; + } + } + + function release(e) { + if (pressed) { + pressed = false; + } else { + return; + } + + clearInterval(ticker); + target = offset; + if (velocity > 10 || velocity < -10) { + amplitude = 0.9 * velocity; + target = offset + amplitude; + } + target = Math.round(target / dim) * dim; + + // No wrap of items. + if (noWrap) { + if (target >= dim * (count - 1)) { + target = dim * (count - 1); + } else if (target < 0) { + target = 0; + } + } + amplitude = target - offset; + timestamp = Date.now(); + requestAnimationFrame(autoScroll); + + if (dragged) { + e.preventDefault(); + e.stopPropagation(); + } + return false; + } + + xform = 'transform'; + ['webkit', 'Moz', 'O', 'ms'].every(function (prefix) { + var e = prefix + 'Transform'; + if (typeof document.body.style[e] !== 'undefined') { + xform = e; + return false; + } + return true; + }); + + var throttledResize = Materialize.throttle(function () { + if (options.fullWidth) { + item_width = view.find('.carousel-item').first().innerWidth(); + var imageHeight = view.find('.carousel-item.active').height(); + dim = item_width * 2 + options.padding; + offset = center * 2 * item_width; + target = offset; + setCarouselHeight(true); + } else { + scroll(); + } + }, 200); + $(window).off('resize.carousel-' + uniqueNamespace).on('resize.carousel-' + uniqueNamespace, throttledResize); + + setupEvents(); + scroll(offset); + + $(this).on('carouselNext', function (e, n, callback) { + if (n === undefined) { + n = 1; + } + if (typeof callback === "function") { + oneTimeCallback = callback; + } + + target = dim * Math.round(offset / dim) + dim * n; + if (offset !== target) { + amplitude = target - offset; + timestamp = Date.now(); + requestAnimationFrame(autoScroll); + } + }); + + $(this).on('carouselPrev', function (e, n, callback) { + if (n === undefined) { + n = 1; + } + if (typeof callback === "function") { + oneTimeCallback = callback; + } + + target = dim * Math.round(offset / dim) - dim * n; + if (offset !== target) { + amplitude = target - offset; + timestamp = Date.now(); + requestAnimationFrame(autoScroll); + } + }); + + $(this).on('carouselSet', function (e, n, callback) { + if (n === undefined) { + n = 0; + } + if (typeof callback === "function") { + oneTimeCallback = callback; + } + + cycleTo(n); + }); + }); + }, + next: function (n, callback) { + $(this).trigger('carouselNext', [n, callback]); + }, + prev: function (n, callback) { + $(this).trigger('carouselPrev', [n, callback]); + }, + set: function (n, callback) { + $(this).trigger('carouselSet', [n, callback]); + }, + destroy: function () { + var uniqueNamespace = $(this).attr('data-namespace'); + $(this).removeAttr('data-namespace'); + $(this).removeClass('initialized'); + $(this).find('.indicators').remove(); + + // Remove event handlers + $(this).off('carouselNext carouselPrev carouselSet'); + $(window).off('resize.carousel-' + uniqueNamespace); + if (typeof window.ontouchstart !== 'undefined') { + $(this).off('touchstart.carousel touchmove.carousel touchend.carousel'); + } + $(this).off('mousedown.carousel mousemove.carousel mouseup.carousel mouseleave.carousel click.carousel'); + } + }; + + $.fn.carousel = function (methodOrOptions) { + if (methods[methodOrOptions]) { + return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1)); + } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { + // Default to "init" + return methods.init.apply(this, arguments); + } else { + $.error('Method ' + methodOrOptions + ' does not exist on jQuery.carousel'); + } + }; // Plugin end +})(jQuery); +;(function ($) { + + var methods = { + init: function (options) { + return this.each(function () { + var origin = $('#' + $(this).attr('data-activates')); + var screen = $('body'); + + // Creating tap target + var tapTargetEl = $(this); + var tapTargetWrapper = tapTargetEl.parent('.tap-target-wrapper'); + var tapTargetWave = tapTargetWrapper.find('.tap-target-wave'); + var tapTargetOriginEl = tapTargetWrapper.find('.tap-target-origin'); + var tapTargetContentEl = tapTargetEl.find('.tap-target-content'); + + // Creating wrapper + if (!tapTargetWrapper.length) { + tapTargetWrapper = tapTargetEl.wrap($('
        ')).parent(); + } + + // Creating content + if (!tapTargetContentEl.length) { + tapTargetContentEl = $('
        '); + tapTargetEl.append(tapTargetContentEl); + } + + // Creating foreground wave + if (!tapTargetWave.length) { + tapTargetWave = $('
        '); + + // Creating origin + if (!tapTargetOriginEl.length) { + tapTargetOriginEl = origin.clone(true, true); + tapTargetOriginEl.addClass('tap-target-origin'); + tapTargetOriginEl.removeAttr('id'); + tapTargetOriginEl.removeAttr('style'); + tapTargetWave.append(tapTargetOriginEl); + } + + tapTargetWrapper.append(tapTargetWave); + } + + // Open + var openTapTarget = function () { + if (tapTargetWrapper.is('.open')) { + return; + } + + // Adding open class + tapTargetWrapper.addClass('open'); + + setTimeout(function () { + tapTargetOriginEl.off('click.tapTarget').on('click.tapTarget', function (e) { + closeTapTarget(); + tapTargetOriginEl.off('click.tapTarget'); + }); + + $(document).off('click.tapTarget').on('click.tapTarget', function (e) { + closeTapTarget(); + $(document).off('click.tapTarget'); + }); + + var throttledCalc = Materialize.throttle(function () { + calculateTapTarget(); + }, 200); + $(window).off('resize.tapTarget').on('resize.tapTarget', throttledCalc); + }, 0); + }; + + // Close + var closeTapTarget = function () { + if (!tapTargetWrapper.is('.open')) { + return; + } + + tapTargetWrapper.removeClass('open'); + tapTargetOriginEl.off('click.tapTarget'); + $(document).off('click.tapTarget'); + $(window).off('resize.tapTarget'); + }; + + // Pre calculate + var calculateTapTarget = function () { + // Element or parent is fixed position? + var isFixed = origin.css('position') === 'fixed'; + if (!isFixed) { + var parents = origin.parents(); + for (var i = 0; i < parents.length; i++) { + isFixed = $(parents[i]).css('position') == 'fixed'; + if (isFixed) { + break; + } + } + } + + // Calculating origin + var originWidth = origin.outerWidth(); + var originHeight = origin.outerHeight(); + var originTop = isFixed ? origin.offset().top - $(document).scrollTop() : origin.offset().top; + var originLeft = isFixed ? origin.offset().left - $(document).scrollLeft() : origin.offset().left; + + // Calculating screen + var windowWidth = $(window).width(); + var windowHeight = $(window).height(); + var centerX = windowWidth / 2; + var centerY = windowHeight / 2; + var isLeft = originLeft <= centerX; + var isRight = originLeft > centerX; + var isTop = originTop <= centerY; + var isBottom = originTop > centerY; + var isCenterX = originLeft >= windowWidth * 0.25 && originLeft <= windowWidth * 0.75; + var isCenterY = originTop >= windowHeight * 0.25 && originTop <= windowHeight * 0.75; + + // Calculating tap target + var tapTargetWidth = tapTargetEl.outerWidth(); + var tapTargetHeight = tapTargetEl.outerHeight(); + var tapTargetTop = originTop + originHeight / 2 - tapTargetHeight / 2; + var tapTargetLeft = originLeft + originWidth / 2 - tapTargetWidth / 2; + var tapTargetPosition = isFixed ? 'fixed' : 'absolute'; + + // Calculating content + var tapTargetTextWidth = isCenterX ? tapTargetWidth : tapTargetWidth / 2 + originWidth; + var tapTargetTextHeight = tapTargetHeight / 2; + var tapTargetTextTop = isTop ? tapTargetHeight / 2 : 0; + var tapTargetTextBottom = 0; + var tapTargetTextLeft = isLeft && !isCenterX ? tapTargetWidth / 2 - originWidth : 0; + var tapTargetTextRight = 0; + var tapTargetTextPadding = originWidth; + var tapTargetTextAlign = isBottom ? 'bottom' : 'top'; + + // Calculating wave + var tapTargetWaveWidth = originWidth > originHeight ? originWidth * 2 : originWidth * 2; + var tapTargetWaveHeight = tapTargetWaveWidth; + var tapTargetWaveTop = tapTargetHeight / 2 - tapTargetWaveHeight / 2; + var tapTargetWaveLeft = tapTargetWidth / 2 - tapTargetWaveWidth / 2; + + // Setting tap target + var tapTargetWrapperCssObj = {}; + tapTargetWrapperCssObj.top = isTop ? tapTargetTop : ''; + tapTargetWrapperCssObj.right = isRight ? windowWidth - tapTargetLeft - tapTargetWidth : ''; + tapTargetWrapperCssObj.bottom = isBottom ? windowHeight - tapTargetTop - tapTargetHeight : ''; + tapTargetWrapperCssObj.left = isLeft ? tapTargetLeft : ''; + tapTargetWrapperCssObj.position = tapTargetPosition; + tapTargetWrapper.css(tapTargetWrapperCssObj); + + // Setting content + tapTargetContentEl.css({ + width: tapTargetTextWidth, + height: tapTargetTextHeight, + top: tapTargetTextTop, + right: tapTargetTextRight, + bottom: tapTargetTextBottom, + left: tapTargetTextLeft, + padding: tapTargetTextPadding, + verticalAlign: tapTargetTextAlign + }); + + // Setting wave + tapTargetWave.css({ + top: tapTargetWaveTop, + left: tapTargetWaveLeft, + width: tapTargetWaveWidth, + height: tapTargetWaveHeight + }); + }; + + if (options == 'open') { + calculateTapTarget(); + openTapTarget(); + } + + if (options == 'close') closeTapTarget(); + }); + }, + open: function () {}, + close: function () {} + }; + + $.fn.tapTarget = function (methodOrOptions) { + if (methods[methodOrOptions] || typeof methodOrOptions === 'object') return methods.init.apply(this, arguments); + + $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tap-target'); + }; +})(jQuery); diff --git a/src/main/webapp/js/materialize.min.js b/src/main/webapp/js/materialize.min.js new file mode 100644 index 0000000..c1a6d7e --- /dev/null +++ b/src/main/webapp/js/materialize.min.js @@ -0,0 +1,6 @@ +/*! + * Materialize v0.100.2 (http://materializecss.com) + * Copyright 2014-2017 Materialize + * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE) + */ +function _classCallCheck(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")}var _createClass=function(){function t(t,e){for(var i=0;i0&&e-1 in t))}if(!t.jQuery){var i=function(t,e){return new i.fn.init(t,e)};i.isWindow=function(t){return null!=t&&t==t.window},i.type=function(t){return null==t?t+"":"object"==typeof t||"function"==typeof t?o[r.call(t)]||"object":typeof t},i.isArray=Array.isArray||function(t){return"array"===i.type(t)},i.isPlainObject=function(t){var e;if(!t||"object"!==i.type(t)||t.nodeType||i.isWindow(t))return!1;try{if(t.constructor&&!a.call(t,"constructor")&&!a.call(t.constructor.prototype,"isPrototypeOf"))return!1}catch(t){return!1}for(e in t);return void 0===e||a.call(t,e)},i.each=function(t,i,n){var o=0,a=t.length,r=e(t);if(n){if(r)for(;a>o&&!1!==i.apply(t[o],n);o++);else for(o in t)if(!1===i.apply(t[o],n))break}else if(r)for(;a>o&&!1!==i.call(t[o],o,t[o]);o++);else for(o in t)if(!1===i.call(t[o],o,t[o]))break;return t},i.data=function(t,e,o){if(void 0===o){var a=(r=t[i.expando])&&n[r];if(void 0===e)return a;if(a&&e in a)return a[e]}else if(void 0!==e){var r=t[i.expando]||(t[i.expando]=++i.uuid);return n[r]=n[r]||{},n[r][e]=o,o}},i.removeData=function(t,e){var o=t[i.expando],a=o&&n[o];a&&i.each(e,function(t,e){delete a[e]})},i.extend=function(){var t,e,n,o,a,r,s=arguments[0]||{},l=1,c=arguments.length,u=!1;for("boolean"==typeof s&&(u=s,s=arguments[l]||{},l++),"object"!=typeof s&&"function"!==i.type(s)&&(s={}),l===c&&(s=this,l--);c>l;l++)if(null!=(a=arguments[l]))for(o in a)t=s[o],s!==(n=a[o])&&(u&&n&&(i.isPlainObject(n)||(e=i.isArray(n)))?(e?(e=!1,r=t&&i.isArray(t)?t:[]):r=t&&i.isPlainObject(t)?t:{},s[o]=i.extend(u,r,n)):void 0!==n&&(s[o]=n));return s},i.queue=function(t,n,o){if(t){n=(n||"fx")+"queue";var a=i.data(t,n);return o?(!a||i.isArray(o)?a=i.data(t,n,function(t,i){var n=i||[];return null!=t&&(e(Object(t))?function(t,e){for(var i=+e.length,n=0,o=t.length;i>n;)t[o++]=e[n++];if(i!==i)for(;void 0!==e[n];)t[o++]=e[n++];t.length=o}(n,"string"==typeof t?[t]:t):[].push.call(n,t)),n}(o)):a.push(o),a):a||[]}},i.dequeue=function(t,e){i.each(t.nodeType?[t]:t,function(t,n){e=e||"fx";var o=i.queue(n,e),a=o.shift();"inprogress"===a&&(a=o.shift()),a&&("fx"===e&&o.unshift("inprogress"),a.call(n,function(){i.dequeue(n,e)}))})},i.fn=i.prototype={init:function(t){if(t.nodeType)return this[0]=t,this;throw new Error("Not a DOM node.")},offset:function(){var e=this[0].getBoundingClientRect?this[0].getBoundingClientRect():{top:0,left:0};return{top:e.top+(t.pageYOffset||document.scrollTop||0)-(document.clientTop||0),left:e.left+(t.pageXOffset||document.scrollLeft||0)-(document.clientLeft||0)}},position:function(){function t(){for(var t=this.offsetParent||document;t&&"html"===!t.nodeType.toLowerCase&&"static"===t.style.position;)t=t.offsetParent;return t||document}var e=this[0],t=t.apply(e),n=this.offset(),o=/^(?:body|html)$/i.test(t.nodeName)?{top:0,left:0}:i(t).offset();return n.top-=parseFloat(e.style.marginTop)||0,n.left-=parseFloat(e.style.marginLeft)||0,t.style&&(o.top+=parseFloat(t.style.borderTopWidth)||0,o.left+=parseFloat(t.style.borderLeftWidth)||0),{top:n.top-o.top,left:n.left-o.left}}};var n={};i.expando="velocity"+(new Date).getTime(),i.uuid=0;for(var o={},a=o.hasOwnProperty,r=o.toString,s="Boolean Number String Function Array Date RegExp Object Error".split(" "),l=0;lo;++o){var a=c(i,t,n);if(0===a)return i;i-=(l(i,t,n)-e)/a}return i}function d(){for(var e=0;b>e;++e)C[e]=l(e*w,t,n)}function p(e,i,o){var a,r,s=0;do{(a=l(r=i+(o-i)/2,t,n)-e)>0?o=r:i=r}while(Math.abs(a)>g&&++s=m?u(e,r):0==s?r:p(e,i,i+w)}function f(){T=!0,(t!=i||n!=o)&&d()}var v=4,m=.001,g=1e-7,y=10,b=11,w=1/(b-1),k="Float32Array"in e;if(4!==arguments.length)return!1;for(var x=0;4>x;++x)if("number"!=typeof arguments[x]||isNaN(arguments[x])||!isFinite(arguments[x]))return!1;t=Math.min(t,1),n=Math.min(n,1),t=Math.max(t,0),n=Math.max(n,0);var C=k?new Float32Array(b):new Array(b),T=!1,S=function(e){return T||f(),t===i&&n===o?e:0===e?0:1===e?1:l(h(e),i,o)};S.getControlPoints=function(){return[{x:t,y:i},{x:n,y:o}]};var P="generateBezier("+[t,i,n,o]+")";return S.toString=function(){return P},S}function c(t,e){var i=t;return v.isString(t)?b.Easings[t]||(i=!1):i=v.isArray(t)&&1===t.length?s.apply(null,t):v.isArray(t)&&2===t.length?w.apply(null,t.concat([e])):!(!v.isArray(t)||4!==t.length)&&l.apply(null,t),!1===i&&(i=b.Easings[b.defaults.easing]?b.defaults.easing:y),i}function u(t){if(t){var e=(new Date).getTime(),i=b.State.calls.length;i>1e4&&(b.State.calls=o(b.State.calls));for(var a=0;i>a;a++)if(b.State.calls[a]){var s=b.State.calls[a],l=s[0],c=s[2],h=s[3],f=!!h,m=null;h||(h=b.State.calls[a][3]=e-16);for(var g=Math.min((e-h)/c.duration,1),y=0,w=l.length;w>y;y++){var x=l[y],T=x.element;if(r(T)){var S=!1;if(c.display!==n&&null!==c.display&&"none"!==c.display){if("flex"===c.display){var P=["-webkit-box","-moz-box","-ms-flexbox","-webkit-flex"];p.each(P,function(t,e){k.setPropertyValue(T,"display",e)})}k.setPropertyValue(T,"display",c.display)}c.visibility!==n&&"hidden"!==c.visibility&&k.setPropertyValue(T,"visibility",c.visibility);for(var A in x)if("element"!==A){var O,E=x[A],_=v.isString(E.easing)?b.Easings[E.easing]:E.easing;if(1===g)O=E.endValue;else{var M=E.endValue-E.startValue;if(O=E.startValue+M*_(g,c,M),!f&&O===E.currentValue)continue}if(E.currentValue=O,"tween"===A)m=O;else{if(k.Hooks.registered[A]){var I=k.Hooks.getRoot(A),D=r(T).rootPropertyValueCache[I];D&&(E.rootPropertyValue=D)}var q=k.setPropertyValue(T,A,E.currentValue+(0===parseFloat(O)?"":E.unitType),E.rootPropertyValue,E.scrollData);k.Hooks.registered[A]&&(r(T).rootPropertyValueCache[I]=k.Normalizations.registered[I]?k.Normalizations.registered[I]("extract",null,q[1]):q[1]),"transform"===q[0]&&(S=!0)}}c.mobileHA&&r(T).transformCache.translate3d===n&&(r(T).transformCache.translate3d="(0px, 0px, 0px)",S=!0),S&&k.flushTransformCache(T)}}c.display!==n&&"none"!==c.display&&(b.State.calls[a][2].display=!1),c.visibility!==n&&"hidden"!==c.visibility&&(b.State.calls[a][2].visibility=!1),c.progress&&c.progress.call(s[1],s[1],g,Math.max(0,h+c.duration-e),h,m),1===g&&d(a)}}b.State.isTicking&&C(u)}function d(t,e){if(!b.State.calls[t])return!1;for(var i=b.State.calls[t][0],o=b.State.calls[t][1],a=b.State.calls[t][2],s=b.State.calls[t][4],l=!1,c=0,u=i.length;u>c;c++){var d=i[c].element;if(e||a.loop||("none"===a.display&&k.setPropertyValue(d,"display",a.display),"hidden"===a.visibility&&k.setPropertyValue(d,"visibility",a.visibility)),!0!==a.loop&&(p.queue(d)[1]===n||!/\.velocityQueueEntryFlag/i.test(p.queue(d)[1]))&&r(d)){r(d).isAnimating=!1,r(d).rootPropertyValueCache={};var h=!1;p.each(k.Lists.transforms3D,function(t,e){var i=/^scale/.test(e)?1:0,o=r(d).transformCache[e];r(d).transformCache[e]!==n&&new RegExp("^\\("+i+"[^.]").test(o)&&(h=!0,delete r(d).transformCache[e])}),a.mobileHA&&(h=!0,delete r(d).transformCache.translate3d),h&&k.flushTransformCache(d),k.Values.removeClass(d,"velocity-animating")}if(!e&&a.complete&&!a.loop&&c===u-1)try{a.complete.call(o,o)}catch(t){setTimeout(function(){throw t},1)}s&&!0!==a.loop&&s(o),r(d)&&!0===a.loop&&!e&&(p.each(r(d).tweensContainer,function(t,e){/^rotate/.test(t)&&360===parseFloat(e.endValue)&&(e.endValue=0,e.startValue=360),/^backgroundPosition/.test(t)&&100===parseFloat(e.endValue)&&"%"===e.unitType&&(e.endValue=0,e.startValue=100)}),b(d,"reverse",{loop:!0,delay:a.delay})),!1!==a.queue&&p.dequeue(d,a.queue)}b.State.calls[t]=!1;for(var f=0,v=b.State.calls.length;v>f;f++)if(!1!==b.State.calls[f]){l=!0;break}!1===l&&(b.State.isTicking=!1,delete b.State.calls,b.State.calls=[])}var p,h=function(){if(i.documentMode)return i.documentMode;for(var t=7;t>4;t--){var e=i.createElement("div");if(e.innerHTML="\x3c!--[if IE "+t+"]>0)},isWrapped:function(t){return t&&(t.jquery||e.Zepto&&e.Zepto.zepto.isZ(t))},isSVG:function(t){return e.SVGElement&&t instanceof e.SVGElement},isEmptyObject:function(t){for(var e in t)return!1;return!0}},m=!1;if(t.fn&&t.fn.jquery?(p=t,m=!0):p=e.Velocity.Utilities,8>=h&&!m)throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");{if(!(7>=h)){var g=400,y="swing",b={State:{isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),isAndroid:/Android/i.test(navigator.userAgent),isGingerbread:/Android 2\.3\.[3-7]/i.test(navigator.userAgent),isChrome:e.chrome,isFirefox:/Firefox/i.test(navigator.userAgent),prefixElement:i.createElement("div"),prefixMatches:{},scrollAnchor:null,scrollPropertyLeft:null,scrollPropertyTop:null,isTicking:!1,calls:[]},CSS:{},Utilities:p,Redirects:{},Easings:{},Promise:e.Promise,defaults:{queue:"",duration:g,easing:y,begin:n,complete:n,progress:n,display:n,visibility:n,loop:!1,delay:!1,mobileHA:!0,_cacheValues:!0},init:function(t){p.data(t,"velocity",{isSVG:v.isSVG(t),isAnimating:!1,computedStyle:null,tweensContainer:null,rootPropertyValueCache:{},transformCache:{}})},hook:null,mock:!1,version:{major:1,minor:2,patch:2},debug:!1};e.pageYOffset!==n?(b.State.scrollAnchor=e,b.State.scrollPropertyLeft="pageXOffset",b.State.scrollPropertyTop="pageYOffset"):(b.State.scrollAnchor=i.documentElement||i.body.parentNode||i.body,b.State.scrollPropertyLeft="scrollLeft",b.State.scrollPropertyTop="scrollTop");var w=function(){function t(t){return-t.tension*t.x-t.friction*t.v}function e(e,i,n){var o={x:e.x+n.dx*i,v:e.v+n.dv*i,tension:e.tension,friction:e.friction};return{dx:o.v,dv:t(o)}}function i(i,n){var o={dx:i.v,dv:t(i)},a=e(i,.5*n,o),r=e(i,.5*n,a),s=e(i,n,r),l=1/6*(o.dx+2*(a.dx+r.dx)+s.dx),c=1/6*(o.dv+2*(a.dv+r.dv)+s.dv);return i.x=i.x+l*n,i.v=i.v+c*n,i}return function t(e,n,o){var a,r,s,l={x:-1,v:0,tension:null,friction:null},c=[0],u=0;for(e=parseFloat(e)||500,n=parseFloat(n)||20,o=o||null,l.tension=e,l.friction=n,(a=null!==o)?(u=t(e,n),r=u/o*.016):r=.016;s=i(s||l,r),c.push(1+s.x),u+=16,Math.abs(s.x)>1e-4&&Math.abs(s.v)>1e-4;);return a?function(t){return c[t*(c.length-1)|0]}:u}}();b.Easings={linear:function(t){return t},swing:function(t){return.5-Math.cos(t*Math.PI)/2},spring:function(t){return 1-Math.cos(4.5*t*Math.PI)*Math.exp(6*-t)}},p.each([["ease",[.25,.1,.25,1]],["ease-in",[.42,0,1,1]],["ease-out",[0,0,.58,1]],["ease-in-out",[.42,0,.58,1]],["easeInSine",[.47,0,.745,.715]],["easeOutSine",[.39,.575,.565,1]],["easeInOutSine",[.445,.05,.55,.95]],["easeInQuad",[.55,.085,.68,.53]],["easeOutQuad",[.25,.46,.45,.94]],["easeInOutQuad",[.455,.03,.515,.955]],["easeInCubic",[.55,.055,.675,.19]],["easeOutCubic",[.215,.61,.355,1]],["easeInOutCubic",[.645,.045,.355,1]],["easeInQuart",[.895,.03,.685,.22]],["easeOutQuart",[.165,.84,.44,1]],["easeInOutQuart",[.77,0,.175,1]],["easeInQuint",[.755,.05,.855,.06]],["easeOutQuint",[.23,1,.32,1]],["easeInOutQuint",[.86,0,.07,1]],["easeInExpo",[.95,.05,.795,.035]],["easeOutExpo",[.19,1,.22,1]],["easeInOutExpo",[1,0,0,1]],["easeInCirc",[.6,.04,.98,.335]],["easeOutCirc",[.075,.82,.165,1]],["easeInOutCirc",[.785,.135,.15,.86]]],function(t,e){b.Easings[e[0]]=l.apply(null,e[1])});var k=b.CSS={RegEx:{isHex:/^#([A-f\d]{3}){1,2}$/i,valueUnwrap:/^[A-z]+\((.*)\)$/i,wrappedValueAlreadyExtracted:/[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/,valueSplit:/([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi},Lists:{colors:["fill","stroke","stopColor","color","backgroundColor","borderColor","borderTopColor","borderRightColor","borderBottomColor","borderLeftColor","outlineColor"],transformsBase:["translateX","translateY","scale","scaleX","scaleY","skewX","skewY","rotateZ"],transforms3D:["transformPerspective","translateZ","scaleZ","rotateX","rotateY"]},Hooks:{templates:{textShadow:["Color X Y Blur","black 0px 0px 0px"],boxShadow:["Color X Y Blur Spread","black 0px 0px 0px 0px"],clip:["Top Right Bottom Left","0px 0px 0px 0px"],backgroundPosition:["X Y","0% 0%"],transformOrigin:["X Y Z","50% 50% 0px"],perspectiveOrigin:["X Y","50% 50%"]},registered:{},register:function(){for(a=0;a=h)switch(t){case"name":return"filter";case"extract":var n=i.toString().match(/alpha\(opacity=(.*)\)/i);return i=n?n[1]/100:1;case"inject":return e.style.zoom=1,parseFloat(i)>=1?"":"alpha(opacity="+parseInt(100*parseFloat(i),10)+")"}else switch(t){case"name":return"opacity";case"extract":case"inject":return i}}},register:function(){9>=h||b.State.isGingerbread||(k.Lists.transformsBase=k.Lists.transformsBase.concat(k.Lists.transforms3D));for(t=0;to&&(o=1),a=!/(\d)$/i.test(o);break;case"skew":a=!/(deg|\d)$/i.test(o);break;case"rotate":a=!/(deg|\d)$/i.test(o)}return a||(r(i).transformCache[e]="("+o+")"),r(i).transformCache[e]}}}();for(var t=0;t=h||3!==a.split(" ").length||(a+=" 1"),a;case"inject":return 8>=h?4===o.split(" ").length&&(o=o.split(/\s+/).slice(0,3).join(" ")):3===o.split(" ").length&&(o+=" 1"),(8>=h?"rgb":"rgba")+"("+o.replace(/\s+/g,",").replace(/\.(\d)+(?=,)/g,"")+")"}}}()}},Names:{camelCase:function(t){return t.replace(/-(\w)/g,function(t,e){return e.toUpperCase()})},SVGAttribute:function(t){var e="width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return(h||b.State.isAndroid&&!b.State.isChrome)&&(e+="|transform"),new RegExp("^("+e+")$","i").test(t)},prefixCheck:function(t){if(b.State.prefixMatches[t])return[b.State.prefixMatches[t],!0];for(var e=["","Webkit","Moz","ms","O"],i=0,n=e.length;n>i;i++){var o;if(o=0===i?t:e[i]+t.replace(/^\w/,function(t){return t.toUpperCase()}),v.isString(b.State.prefixElement.style[o]))return b.State.prefixMatches[t]=o,[o,!0]}return[t,!1]}},Values:{hexToRgb:function(t){var e,i=/^#?([a-f\d])([a-f\d])([a-f\d])$/i,n=/^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return t=t.replace(i,function(t,e,i,n){return e+e+i+i+n+n}),e=n.exec(t),e?[parseInt(e[1],16),parseInt(e[2],16),parseInt(e[3],16)]:[0,0,0]},isCSSNullValue:function(t){return 0==t||/^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(t)},getUnitType:function(t){return/^(rotate|skew)/i.test(t)?"deg":/(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(t)?"":"px"},getDisplayType:function(t){var e=t&&t.tagName.toString().toLowerCase();return/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(e)?"inline":/^(li)$/i.test(e)?"list-item":/^(tr)$/i.test(e)?"table-row":/^(table)$/i.test(e)?"table":/^(tbody)$/i.test(e)?"table-row-group":"block"},addClass:function(t,e){t.classList?t.classList.add(e):t.className+=(t.className.length?" ":"")+e},removeClass:function(t,e){t.classList?t.classList.remove(e):t.className=t.className.toString().replace(new RegExp("(^|\\s)"+e.split(" ").join("|")+"(\\s|$)","gi")," ")}},getPropertyValue:function(t,i,o,a){function s(t,i){function o(){c&&k.setPropertyValue(t,"display","none")}var l=0;if(8>=h)l=p.css(t,i);else{var c=!1;if(/^(width|height)$/.test(i)&&0===k.getPropertyValue(t,"display")&&(c=!0,k.setPropertyValue(t,"display",k.Values.getDisplayType(t))),!a){if("height"===i&&"border-box"!==k.getPropertyValue(t,"boxSizing").toString().toLowerCase()){var u=t.offsetHeight-(parseFloat(k.getPropertyValue(t,"borderTopWidth"))||0)-(parseFloat(k.getPropertyValue(t,"borderBottomWidth"))||0)-(parseFloat(k.getPropertyValue(t,"paddingTop"))||0)-(parseFloat(k.getPropertyValue(t,"paddingBottom"))||0);return o(),u}if("width"===i&&"border-box"!==k.getPropertyValue(t,"boxSizing").toString().toLowerCase()){var d=t.offsetWidth-(parseFloat(k.getPropertyValue(t,"borderLeftWidth"))||0)-(parseFloat(k.getPropertyValue(t,"borderRightWidth"))||0)-(parseFloat(k.getPropertyValue(t,"paddingLeft"))||0)-(parseFloat(k.getPropertyValue(t,"paddingRight"))||0);return o(),d}}var f;f=r(t)===n?e.getComputedStyle(t,null):r(t).computedStyle?r(t).computedStyle:r(t).computedStyle=e.getComputedStyle(t,null),"borderColor"===i&&(i="borderTopColor"),(""===(l=9===h&&"filter"===i?f.getPropertyValue(i):f[i])||null===l)&&(l=t.style[i]),o()}if("auto"===l&&/^(top|right|bottom|left)$/i.test(i)){var v=s(t,"position");("fixed"===v||"absolute"===v&&/top|left/i.test(i))&&(l=p(t).position()[i]+"px")}return l}var l;if(k.Hooks.registered[i]){var c=i,u=k.Hooks.getRoot(c);o===n&&(o=k.getPropertyValue(t,k.Names.prefixCheck(u)[0])),k.Normalizations.registered[u]&&(o=k.Normalizations.registered[u]("extract",t,o)),l=k.Hooks.extractValue(c,o)}else if(k.Normalizations.registered[i]){var d,f;"transform"!==(d=k.Normalizations.registered[i]("name",t))&&(f=s(t,k.Names.prefixCheck(d)[0]),k.Values.isCSSNullValue(f)&&k.Hooks.templates[i]&&(f=k.Hooks.templates[i][1])),l=k.Normalizations.registered[i]("extract",t,f)}if(!/^[\d-]/.test(l))if(r(t)&&r(t).isSVG&&k.Names.SVGAttribute(i))if(/^(height|width)$/i.test(i))try{l=t.getBBox()[i]}catch(t){l=0}else l=t.getAttribute(i);else l=s(t,k.Names.prefixCheck(i)[0]);return k.Values.isCSSNullValue(l)&&(l=0),b.debug>=2&&console.log("Get "+i+": "+l),l},setPropertyValue:function(t,i,n,o,a){var s=i;if("scroll"===i)a.container?a.container["scroll"+a.direction]=n:"Left"===a.direction?e.scrollTo(n,a.alternateValue):e.scrollTo(a.alternateValue,n);else if(k.Normalizations.registered[i]&&"transform"===k.Normalizations.registered[i]("name",t))k.Normalizations.registered[i]("inject",t,n),s="transform",n=r(t).transformCache[i];else{if(k.Hooks.registered[i]){var l=i,c=k.Hooks.getRoot(i);o=o||k.getPropertyValue(t,c),n=k.Hooks.injectValue(l,n,o),i=c}if(k.Normalizations.registered[i]&&(n=k.Normalizations.registered[i]("inject",t,n),i=k.Normalizations.registered[i]("name",t)),s=k.Names.prefixCheck(i)[0],8>=h)try{t.style[s]=n}catch(t){b.debug&&console.log("Browser does not support ["+n+"] for ["+s+"]")}else r(t)&&r(t).isSVG&&k.Names.SVGAttribute(i)?t.setAttribute(i,n):t.style[s]=n;b.debug>=2&&console.log("Set "+i+" ("+s+"): "+n)}return[s,n]},flushTransformCache:function(t){function e(e){return parseFloat(k.getPropertyValue(t,e))}var i="";if((h||b.State.isAndroid&&!b.State.isChrome)&&r(t).isSVG){var n={translate:[e("translateX"),e("translateY")],skewX:[e("skewX")],skewY:[e("skewY")],scale:1!==e("scale")?[e("scale"),e("scale")]:[e("scaleX"),e("scaleY")],rotate:[e("rotateZ"),0,0]};p.each(r(t).transformCache,function(t){/^translate/i.test(t)?t="translate":/^scale/i.test(t)?t="scale":/^rotate/i.test(t)&&(t="rotate"),n[t]&&(i+=t+"("+n[t].join(" ")+") ",delete n[t])})}else{var o,a;p.each(r(t).transformCache,function(e){return o=r(t).transformCache[e],"transformPerspective"===e?(a=o,!0):(9===h&&"rotateZ"===e&&(e="rotate"),void(i+=e+o+" "))}),a&&(i="perspective"+a+" "+i)}k.setPropertyValue(t,"transform",i)}};k.Hooks.register(),k.Normalizations.register(),b.hook=function(t,e,i){var o=n;return t=a(t),p.each(t,function(t,a){if(r(a)===n&&b.init(a),i===n)o===n&&(o=b.CSS.getPropertyValue(a,e));else{var s=b.CSS.setPropertyValue(a,e,i);"transform"===s[0]&&b.CSS.flushTransformCache(a),o=s}}),o};var x=function(){function t(){return s?P.promise||null:l}function o(){function t(t){function d(t,e){var i=n,o=n,r=n;return v.isArray(t)?(i=t[0],!v.isArray(t[1])&&/^[\d-]/.test(t[1])||v.isFunction(t[1])||k.RegEx.isHex.test(t[1])?r=t[1]:(v.isString(t[1])&&!k.RegEx.isHex.test(t[1])||v.isArray(t[1]))&&(o=e?t[1]:c(t[1],s.duration),t[2]!==n&&(r=t[2]))):i=t,e||(o=o||s.easing),v.isFunction(i)&&(i=i.call(a,T,C)),v.isFunction(r)&&(r=r.call(a,T,C)),[i||0,o,r]}function h(t,e){var i,n;return n=(e||"0").toString().toLowerCase().replace(/[%A-z]+$/,function(t){return i=t,""}),i||(i=k.Values.getUnitType(t)),[n,i]}if(s.begin&&0===T)try{s.begin.call(f,f)}catch(t){setTimeout(function(){throw t},1)}if("scroll"===A){var g,w,x,S=/^x$/i.test(s.axis)?"Left":"Top",O=parseFloat(s.offset)||0;s.container?v.isWrapped(s.container)||v.isNode(s.container)?(s.container=s.container[0]||s.container,g=s.container["scroll"+S],x=g+p(a).position()[S.toLowerCase()]+O):s.container=null:(g=b.State.scrollAnchor[b.State["scrollProperty"+S]],w=b.State.scrollAnchor[b.State["scrollProperty"+("Left"===S?"Top":"Left")]],x=p(a).offset()[S.toLowerCase()]+O),l={scroll:{rootPropertyValue:!1,startValue:g,currentValue:g,endValue:x,unitType:"",easing:s.easing,scrollData:{container:s.container,direction:S,alternateValue:w}},element:a},b.debug&&console.log("tweensContainer (scroll): ",l.scroll,a)}else if("reverse"===A){if(!r(a).tweensContainer)return void p.dequeue(a,s.queue);"none"===r(a).opts.display&&(r(a).opts.display="auto"),"hidden"===r(a).opts.visibility&&(r(a).opts.visibility="visible"),r(a).opts.loop=!1,r(a).opts.begin=null,r(a).opts.complete=null,y.easing||delete s.easing,y.duration||delete s.duration,s=p.extend({},r(a).opts,s);M=p.extend(!0,{},r(a).tweensContainer);for(var E in M)if("element"!==E){var _=M[E].startValue;M[E].startValue=M[E].currentValue=M[E].endValue,M[E].endValue=_,v.isEmptyObject(y)||(M[E].easing=s.easing),b.debug&&console.log("reverse tweensContainer ("+E+"): "+JSON.stringify(M[E]),a)}l=M}else if("start"===A){var M;r(a).tweensContainer&&!0===r(a).isAnimating&&(M=r(a).tweensContainer),p.each(m,function(t,e){if(RegExp("^"+k.Lists.colors.join("$|^")+"$").test(t)){var i=d(e,!0),o=i[0],a=i[1],r=i[2];if(k.RegEx.isHex.test(o)){for(var s=["Red","Green","Blue"],l=k.Values.hexToRgb(o),c=r?k.Values.hexToRgb(r):n,u=0;u=1&&console.log("Unit ratios: "+JSON.stringify(l),a),l}();var X=/margin|padding|left|right|width|text|word|letter/i.test(q)||/X$/.test(q)||"x"===q?"x":"y";switch(F){case"%":L*="x"===X?o.percentToPxWidth:o.percentToPxHeight;break;case"px":break;default:L*=o[F+"ToPx"]}switch(W){case"%":L*=1/("x"===X?o.percentToPxWidth:o.percentToPxHeight);break;case"px":break;default:L*=1/o[W+"ToPx"]}}switch(Q){case"+":V=L+V;break;case"-":V=L-V;break;case"*":V*=L;break;case"/":V=L/V}l[q]={rootPropertyValue:$,startValue:L,currentValue:L,endValue:V,unitType:W,easing:H},b.debug&&console.log("tweensContainer ("+q+"): "+JSON.stringify(l[q]),a)}else b.debug&&console.log("Skipping ["+j+"] due to a lack of browser support.")}l.element=a}l.element&&(k.Values.addClass(a,"velocity-animating"),D.push(l),""===s.queue&&(r(a).tweensContainer=l,r(a).opts=s),r(a).isAnimating=!0,T===C-1?(b.State.calls.push([D,f,s,null,P.resolver]),!1===b.State.isTicking&&(b.State.isTicking=!0,u())):T++)}var o,a=this,s=p.extend({},b.defaults,y),l={};switch(r(a)===n&&b.init(a),parseFloat(s.delay)&&!1!==s.queue&&p.queue(a,s.queue,function(t){b.velocityQueueEntryFlag=!0,r(a).delayTimer={setTimeout:setTimeout(t,parseFloat(s.delay)),next:t}}),s.duration.toString().toLowerCase()){case"fast":s.duration=200;break;case"normal":s.duration=g;break;case"slow":s.duration=600;break;default:s.duration=parseFloat(s.duration)||1}!1!==b.mock&&(!0===b.mock?s.duration=s.delay=1:(s.duration*=parseFloat(b.mock)||1,s.delay*=parseFloat(b.mock)||1)),s.easing=c(s.easing,s.duration),s.begin&&!v.isFunction(s.begin)&&(s.begin=null),s.progress&&!v.isFunction(s.progress)&&(s.progress=null),s.complete&&!v.isFunction(s.complete)&&(s.complete=null),s.display!==n&&null!==s.display&&(s.display=s.display.toString().toLowerCase(),"auto"===s.display&&(s.display=b.CSS.Values.getDisplayType(a))),s.visibility!==n&&null!==s.visibility&&(s.visibility=s.visibility.toString().toLowerCase()),s.mobileHA=s.mobileHA&&b.State.isMobile&&!b.State.isGingerbread,!1===s.queue?s.delay?setTimeout(t,s.delay):t():p.queue(a,s.queue,function(e,i){return!0===i?(P.promise&&P.resolver(f),!0):(b.velocityQueueEntryFlag=!0,void t(e))}),""!==s.queue&&"fx"!==s.queue||"inprogress"===p.queue(a)[0]||p.dequeue(a)}var s,l,h,f,m,y,w=arguments[0]&&(arguments[0].p||p.isPlainObject(arguments[0].properties)&&!arguments[0].properties.names||v.isString(arguments[0].properties));if(v.isWrapped(this)?(s=!1,h=0,f=this,l=this):(s=!0,h=1,f=w?arguments[0].elements||arguments[0].e:arguments[0]),f=a(f)){w?(m=arguments[0].properties||arguments[0].p,y=arguments[0].options||arguments[0].o):(m=arguments[h],y=arguments[h+1]);var C=f.length,T=0;if(!/^(stop|finish)$/i.test(m)&&!p.isPlainObject(y)){y={};for(var S=h+1;SV;V++){var H={delay:z.delay,progress:z.progress};V===q-1&&(H.display=z.display,H.visibility=z.visibility,H.complete=z.complete),x(f,"reverse",H)}return t()}};(b=p.extend(x,b)).animate=x;var C=e.requestAnimationFrame||f;return b.State.isMobile||i.hidden===n||i.addEventListener("visibilitychange",function(){i.hidden?(C=function(t){return setTimeout(function(){t(!0)},16)},u()):C=e.requestAnimationFrame||f}),t.Velocity=b,t!==e&&(t.fn.velocity=x,t.fn.velocity.defaults=b.defaults),p.each(["Down","Up"],function(t,e){b.Redirects["slide"+e]=function(t,i,o,a,r,s){var l=p.extend({},i),c=l.begin,u=l.complete,d={height:"",marginTop:"",marginBottom:"",paddingTop:"",paddingBottom:""},h={};l.display===n&&(l.display="Down"===e?"inline"===b.CSS.Values.getDisplayType(t)?"inline-block":"block":"none"),l.begin=function(){c&&c.call(r,r);for(var i in d){h[i]=t.style[i];var n=b.CSS.getPropertyValue(t,i);d[i]="Down"===e?[n,0]:[0,n]}h.overflow=t.style.overflow,t.style.overflow="hidden"},l.complete=function(){for(var e in h)t.style[e]=h[e];u&&u.call(r,r),s&&s.resolver(r)},b(t,d,l)}}),p.each(["In","Out"],function(t,e){b.Redirects["fade"+e]=function(t,i,o,a,r,s){var l=p.extend({},i),c={opacity:"In"===e?1:0},u=l.complete;l.complete=o!==a-1?l.begin=null:function(){u&&u.call(r,r),s&&s.resolver(r)},l.display===n&&(l.display="In"===e?"auto":"none"),b(this,c,l)}}),b}jQuery.fn.velocity=jQuery.fn.animate}}(window.jQuery||window.Zepto||window,window,document)})),function(t,e,i,n){"use strict";function o(t,e,i){return setTimeout(u(t,i),e)}function a(t,e,i){return!!Array.isArray(t)&&(r(t,i[e],i),!0)}function r(t,e,i){var o;if(t)if(t.forEach)t.forEach(e,i);else if(t.length!==n)for(o=0;o-1}function g(t){return t.trim().split(/\s+/g)}function y(t,e,i){if(t.indexOf&&!i)return t.indexOf(e);for(var n=0;ni[e]}):n.sort()),n}function k(t,e){for(var i,o,a=e[0].toUpperCase()+e.slice(1),r=0;r1&&!i.firstMultiple?i.firstMultiple=_(e):1===o&&(i.firstMultiple=!1);var a=i.firstInput,r=i.firstMultiple,s=r?r.center:a.center,l=e.center=M(n);e.timeStamp=ht(),e.deltaTime=e.timeStamp-a.timeStamp,e.angle=z(s,l),e.distance=q(s,l),O(i,e),e.offsetDirection=D(e.deltaX,e.deltaY),e.scale=r?H(r.pointers,n):1,e.rotation=r?V(r.pointers,n):0,E(i,e);var c=t.element;v(e.srcEvent.target,c)&&(c=e.srcEvent.target),e.target=c}function O(t,e){var i=e.center,n=t.offsetDelta||{},o=t.prevDelta||{},a=t.prevInput||{};(e.eventType===xt||a.eventType===Tt)&&(o=t.prevDelta={x:a.deltaX||0,y:a.deltaY||0},n=t.offsetDelta={x:i.x,y:i.y}),e.deltaX=o.x+(i.x-n.x),e.deltaY=o.y+(i.y-n.y)}function E(t,e){var i,o,a,r,s=t.lastInterval||e,l=e.timeStamp-s.timeStamp;if(e.eventType!=St&&(l>kt||s.velocity===n)){var c=s.deltaX-e.deltaX,u=s.deltaY-e.deltaY,d=I(l,c,u);o=d.x,a=d.y,i=pt(d.x)>pt(d.y)?d.x:d.y,r=D(c,u),t.lastInterval=e}else i=s.velocity,o=s.velocityX,a=s.velocityY,r=s.direction;e.velocity=i,e.velocityX=o,e.velocityY=a,e.direction=r}function _(t){for(var e=[],i=0;io;)i+=t[o].clientX,n+=t[o].clientY,o++;return{x:dt(i/e),y:dt(n/e)}}function I(t,e,i){return{x:e/t||0,y:i/t||0}}function D(t,e){return t===e?Pt:pt(t)>=pt(e)?t>0?At:Ot:e>0?Et:_t}function q(t,e,i){i||(i=qt);var n=e[i[0]]-t[i[0]],o=e[i[1]]-t[i[1]];return Math.sqrt(n*n+o*o)}function z(t,e,i){i||(i=qt);var n=e[i[0]]-t[i[0]],o=e[i[1]]-t[i[1]];return 180*Math.atan2(o,n)/Math.PI}function V(t,e){return z(e[1],e[0],zt)-z(t[1],t[0],zt)}function H(t,e){return q(e[0],e[1],zt)/q(t[0],t[1],zt)}function L(){this.evEl=Ht,this.evWin=Lt,this.allow=!0,this.pressed=!1,T.apply(this,arguments)}function j(){this.evEl=Nt,this.evWin=Wt,T.apply(this,arguments),this.store=this.manager.session.pointerEvents=[]}function $(){this.evTarget=Qt,this.evWin=Xt,this.started=!1,T.apply(this,arguments)}function N(t,e){var i=b(t.touches),n=b(t.changedTouches);return e&(Tt|St)&&(i=w(i.concat(n),"identifier",!0)),[i,n]}function W(){this.evTarget=Yt,this.targetIds={},T.apply(this,arguments)}function F(t,e){var i=b(t.touches),n=this.targetIds;if(e&(xt|Ct)&&1===i.length)return n[i[0].identifier]=!0,[i,i];var o,a,r=b(t.changedTouches),s=[],l=this.target;if(a=i.filter(function(t){return v(t.target,l)}),e===xt)for(o=0;os&&(e.push(t),s=e.length-1):o&(Tt|St)&&(i=!0),0>s||(e[s]=t,this.callback(this.manager,o,{pointers:e,changedPointers:[t],pointerType:a,srcEvent:t}),i&&e.splice(s,1))}});var Ft={touchstart:xt,touchmove:Ct,touchend:Tt,touchcancel:St},Qt="touchstart",Xt="touchstart touchmove touchend touchcancel";c($,T,{handler:function(t){var e=Ft[t.type];if(e===xt&&(this.started=!0),this.started){var i=N.call(this,t,e);e&(Tt|St)&&0==i[0].length-i[1].length&&(this.started=!1),this.callback(this.manager,e,{pointers:i[0],changedPointers:i[1],pointerType:bt,srcEvent:t})}}});var Rt={touchstart:xt,touchmove:Ct,touchend:Tt,touchcancel:St},Yt="touchstart touchmove touchend touchcancel";c(W,T,{handler:function(t){var e=Rt[t.type],i=F.call(this,t,e);i&&this.callback(this.manager,e,{pointers:i[0],changedPointers:i[1],pointerType:bt,srcEvent:t})}}),c(Q,T,{handler:function(t,e,i){var n=i.pointerType==bt,o=i.pointerType==wt;if(n)this.mouse.allow=!1;else if(o&&!this.mouse.allow)return;e&(Tt|St)&&(this.mouse.allow=!0),this.callback(t,e,i)},destroy:function(){this.touch.destroy(),this.mouse.destroy()}});var Bt=k(ct.style,"touchAction"),Ut=Bt!==n,Gt="compute",Zt="auto",Jt="manipulation",Kt="none",te="pan-x",ee="pan-y";X.prototype={set:function(t){t==Gt&&(t=this.compute()),Ut&&(this.manager.element.style[Bt]=t),this.actions=t.toLowerCase().trim()},update:function(){this.set(this.manager.options.touchAction)},compute:function(){var t=[];return r(this.manager.recognizers,function(e){d(e.options.enable,[e])&&(t=t.concat(e.getTouchAction()))}),R(t.join(" "))},preventDefaults:function(t){if(!Ut){var e=t.srcEvent,i=t.offsetDirection;if(this.manager.session.prevented)return void e.preventDefault();var n=this.actions,o=m(n,Kt),a=m(n,ee),r=m(n,te);return o||a&&i&Mt||r&&i&It?this.preventSrc(e):void 0}},preventSrc:function(t){this.manager.session.prevented=!0,t.preventDefault()}};var ie=1,ne=2,oe=4,ae=8,re=ae,se=16;Y.prototype={defaults:{},set:function(t){return s(this.options,t),this.manager&&this.manager.touchAction.update(),this},recognizeWith:function(t){if(a(t,"recognizeWith",this))return this;var e=this.simultaneous;return t=G(t,this),e[t.id]||(e[t.id]=t,t.recognizeWith(this)),this},dropRecognizeWith:function(t){return a(t,"dropRecognizeWith",this)?this:(t=G(t,this),delete this.simultaneous[t.id],this)},requireFailure:function(t){if(a(t,"requireFailure",this))return this;var e=this.requireFail;return t=G(t,this),-1===y(e,t)&&(e.push(t),t.requireFailure(this)),this},dropRequireFailure:function(t){if(a(t,"dropRequireFailure",this))return this;t=G(t,this);var e=y(this.requireFail,t);return e>-1&&this.requireFail.splice(e,1),this},hasRequireFailures:function(){return this.requireFail.length>0},canRecognizeWith:function(t){return!!this.simultaneous[t.id]},emit:function(t){function e(e){i.manager.emit(i.options.event+(e?B(n):""),t)}var i=this,n=this.state;ae>n&&e(!0),e(),n>=ae&&e(!0)},tryEmit:function(t){return this.canEmit()?this.emit(t):void(this.state=32)},canEmit:function(){for(var t=0;ta?At:Ot,i=a!=this.pX,n=Math.abs(t.deltaX)):(o=0===r?Pt:0>r?Et:_t,i=r!=this.pY,n=Math.abs(t.deltaY))),t.direction=o,i&&n>e.threshold&&o&e.direction},attrTest:function(t){return Z.prototype.attrTest.call(this,t)&&(this.state&ne||!(this.state&ne)&&this.directionTest(t))},emit:function(t){this.pX=t.deltaX,this.pY=t.deltaY;var e=U(t.direction);e&&this.manager.emit(this.options.event+e,t),this._super.emit.call(this,t)}}),c(K,Z,{defaults:{event:"pinch",threshold:0,pointers:2},getTouchAction:function(){return[Kt]},attrTest:function(t){return this._super.attrTest.call(this,t)&&(Math.abs(t.scale-1)>this.options.threshold||this.state&ne)},emit:function(t){if(this._super.emit.call(this,t),1!==t.scale){var e=t.scale<1?"in":"out";this.manager.emit(this.options.event+e,t)}}}),c(tt,Y,{defaults:{event:"press",pointers:1,time:500,threshold:5},getTouchAction:function(){return[Zt]},process:function(t){var e=this.options,i=t.pointers.length===e.pointers,n=t.distancee.time;if(this._input=t,!n||!i||t.eventType&(Tt|St)&&!a)this.reset();else if(t.eventType&xt)this.reset(),this._timer=o(function(){this.state=re,this.tryEmit()},e.time,this);else if(t.eventType&Tt)return re;return 32},reset:function(){clearTimeout(this._timer)},emit:function(t){this.state===re&&(t&&t.eventType&Tt?this.manager.emit(this.options.event+"up",t):(this._input.timeStamp=ht(),this.manager.emit(this.options.event,this._input)))}}),c(et,Z,{defaults:{event:"rotate",threshold:0,pointers:2},getTouchAction:function(){return[Kt]},attrTest:function(t){return this._super.attrTest.call(this,t)&&(Math.abs(t.rotation)>this.options.threshold||this.state&ne)}}),c(it,Z,{defaults:{event:"swipe",threshold:10,velocity:.65,direction:Mt|It,pointers:1},getTouchAction:function(){return J.prototype.getTouchAction.call(this)},attrTest:function(t){var e,i=this.options.direction;return i&(Mt|It)?e=t.velocity:i&Mt?e=t.velocityX:i&It&&(e=t.velocityY),this._super.attrTest.call(this,t)&&i&t.direction&&t.distance>this.options.threshold&&pt(e)>this.options.velocity&&t.eventType&Tt},emit:function(t){var e=U(t.direction);e&&this.manager.emit(this.options.event+e,t),this.manager.emit(this.options.event,t)}}),c(nt,Y,{defaults:{event:"tap",pointers:1,taps:1,interval:300,time:250,threshold:2,posThreshold:10},getTouchAction:function(){return[Jt]},process:function(t){var e=this.options,i=t.pointers.length===e.pointers,n=t.distance=0&&!n;)n=t[i[a]+"RequestAnimationFrame"],o=t[i[a]+"CancelRequestAnimationFrame"];n&&o||(n=function(t){var i=+Date.now(),n=Math.max(e+16,i);return setTimeout(function(){t(e=n)},n-i)},o=clearTimeout),t.requestAnimationFrame=n,t.cancelAnimationFrame=o}(window),Materialize.objectSelectorString=function(t){return((t.prop("tagName")||"")+(t.attr("id")||"")+(t.attr("class")||"")).replace(/\s/g,"")},Materialize.guid=function(){function t(){return Math.floor(65536*(1+Math.random())).toString(16).substring(1)}return function(){return t()+t()+"-"+t()+"-"+t()+"-"+t()+"-"+t()+t()+t()}}(),Materialize.escapeHash=function(t){return t.replace(/(:|\.|\[|\]|,|=)/g,"\\$1")},Materialize.elementOrParentIsFixed=function(t){var e=$(t),i=!1;return e.add(e.parents()).each(function(){if("fixed"===$(this).css("position"))return i=!0,!1}),i};var getTime=Date.now||function(){return(new Date).getTime()};Materialize.throttle=function(t,e,i){var n,o,a,r=null,s=0;i||(i={});var l=function(){s=!1===i.leading?0:getTime(),r=null,a=t.apply(n,o),n=o=null};return function(){var c=getTime();s||!1!==i.leading||(s=c);var u=e-(c-s);return n=this,o=arguments,u<=0?(clearTimeout(r),r=null,s=c,a=t.apply(n,o),n=o=null):r||!1===i.trailing||(r=setTimeout(l,u)),a}};var Vel;Vel=jQuery?jQuery.Velocity:$?$.Velocity:Velocity,Materialize.Vel=Vel||Velocity,function(t){t.fn.collapsible=function(e,i){var n={accordion:void 0,onOpen:void 0,onClose:void 0},o=e;return e=t.extend(n,e),this.each(function(){function n(e){p=d.find("> li > .collapsible-header"),e.hasClass("active")?e.parent().addClass("active"):e.parent().removeClass("active"),e.parent().hasClass("active")?e.siblings(".collapsible-body").stop(!0,!1).slideDown({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height","")}}):e.siblings(".collapsible-body").stop(!0,!1).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height","")}}),p.not(e).removeClass("active").parent().removeClass("active"),p.not(e).parent().children(".collapsible-body").stop(!0,!1).each(function(){t(this).is(":visible")&&t(this).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height",""),s(t(this).siblings(".collapsible-header"))}})})}function a(e){e.hasClass("active")?e.parent().addClass("active"):e.parent().removeClass("active"),e.parent().hasClass("active")?e.siblings(".collapsible-body").stop(!0,!1).slideDown({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height","")}}):e.siblings(".collapsible-body").stop(!0,!1).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height","")}})}function r(t,i){i||t.toggleClass("active"),e.accordion||"accordion"===h||void 0===h?n(t):a(t),s(t)}function s(t){t.hasClass("active")?"function"==typeof e.onOpen&&e.onOpen.call(this,t.parent()):"function"==typeof e.onClose&&e.onClose.call(this,t.parent())}function l(t){return c(t).length>0}function c(t){return t.closest("li > .collapsible-header")}function u(){d.off("click.collapse","> li > .collapsible-header")}var d=t(this),p=t(this).find("> li > .collapsible-header"),h=d.data("collapsible");if("destroy"!==o)if(i>=0&&i li > .collapsible-header",function(e){var i=t(e.target);l(i)&&(i=c(i)),r(i)}),e.accordion||"accordion"===h||void 0===h?r(p.filter(".active").first(),!0):p.filter(".active").each(function(){r(t(this),!0)});else u()})},t(document).ready(function(){t(".collapsible").collapsible()})}(jQuery),function(t){t.fn.scrollTo=function(e){return t(this).scrollTop(t(this).scrollTop()-t(this).offset().top+t(e).offset().top),this},t.fn.dropdown=function(e){var i={inDuration:300,outDuration:225,constrainWidth:!0,hover:!1,gutter:0,belowOrigin:!1,alignment:"left",stopPropagation:!1};return"open"===e?(this.each(function(){t(this).trigger("open")}),!1):"close"===e?(this.each(function(){t(this).trigger("close")}),!1):void this.each(function(){function n(){void 0!==r.data("induration")&&(s.inDuration=r.data("induration")),void 0!==r.data("outduration")&&(s.outDuration=r.data("outduration")),void 0!==r.data("constrainwidth")&&(s.constrainWidth=r.data("constrainwidth")),void 0!==r.data("hover")&&(s.hover=r.data("hover")),void 0!==r.data("gutter")&&(s.gutter=r.data("gutter")),void 0!==r.data("beloworigin")&&(s.belowOrigin=r.data("beloworigin")),void 0!==r.data("alignment")&&(s.alignment=r.data("alignment")),void 0!==r.data("stoppropagation")&&(s.stopPropagation=r.data("stoppropagation"))}function o(e){"focus"===e&&(l=!0),n(),c.addClass("active"),r.addClass("active");var i=r[0].getBoundingClientRect().width;!0===s.constrainWidth?c.css("width",i):c.css("white-space","nowrap");var o=window.innerHeight,u=r.innerHeight(),d=r.offset().left,p=r.offset().top-t(window).scrollTop(),h=s.alignment,f=0,v=0,m=0;!0===s.belowOrigin&&(m=u);var g=0,y=0,b=r.parent();if(b.is("body")||(b[0].scrollHeight>b[0].clientHeight&&(g=b[0].scrollTop),b[0].scrollWidth>b[0].clientWidth&&(y=b[0].scrollLeft)),d+c.innerWidth()>t(window).width()?h="right":d-c.innerWidth()+r.innerWidth()<0&&(h="left"),p+c.innerHeight()>o)if(p+u-c.innerHeight()<0){var w=o-p-m;c.css("max-height",w)}else m||(m+=u),m-=c.innerHeight();"left"===h?(f=s.gutter,v=r.position().left+f):"right"===h&&(c.stop(!0,!0).css({opacity:0,left:0}),v=r.position().left+i-c.width()+(f=-s.gutter)),c.css({position:"absolute",top:r.position().top+m+g,left:v+y}),c.slideDown({queue:!1,duration:s.inDuration,easing:"easeOutCubic",complete:function(){t(this).css("height","")}}).animate({opacity:1},{queue:!1,duration:s.inDuration,easing:"easeOutSine"}),setTimeout(function(){t(document).on("click."+c.attr("id"),function(e){a(),t(document).off("click."+c.attr("id"))})},0)}function a(){l=!1,c.fadeOut(s.outDuration),c.removeClass("active"),r.removeClass("active"),t(document).off("click."+c.attr("id")),setTimeout(function(){c.css("max-height","")},s.outDuration)}var r=t(this),s=t.extend({},i,e),l=!1,c=t("#"+r.attr("data-activates"));if(n(),r.after(c),s.hover){var u=!1;r.off("click."+r.attr("id")),r.on("mouseenter",function(t){!1===u&&(o(),u=!0)}),r.on("mouseleave",function(e){var i=e.toElement||e.relatedTarget;t(i).closest(".dropdown-content").is(c)||(c.stop(!0,!0),a(),u=!1)}),c.on("mouseleave",function(e){var i=e.toElement||e.relatedTarget;t(i).closest(".dropdown-button").is(r)||(c.stop(!0,!0),a(),u=!1)})}else r.off("click."+r.attr("id")),r.on("click."+r.attr("id"),function(e){l||(r[0]!=e.currentTarget||r.hasClass("active")||0!==t(e.target).closest(".dropdown-content").length?r.hasClass("active")&&(a(),t(document).off("click."+c.attr("id"))):(e.preventDefault(),s.stopPropagation&&e.stopPropagation(),o("click")))});r.on("open",function(t,e){o(e)}),r.on("close",a)})},t(document).ready(function(){t(".dropdown-button").dropdown()})}(jQuery),function(t,e){"use strict";var i={opacity:.5,inDuration:250,outDuration:250,ready:void 0,complete:void 0,dismissible:!0,startingTop:"4%",endingTop:"10%"},n=function(){function n(e,i){_classCallCheck(this,n),e[0].M_Modal&&e[0].M_Modal.destroy(),this.$el=e,this.options=t.extend({},n.defaults,i),this.isOpen=!1,this.$el[0].M_Modal=this,this.id=e.attr("id"),this.openingTrigger=void 0,this.$overlay=t(''),n._increment++,n._count++,this.$overlay[0].style.zIndex=1e3+2*n._increment,this.$el[0].style.zIndex=1e3+2*n._increment+1,this.setupEventHandlers()}return _createClass(n,[{key:"getInstance",value:function(){return this}},{key:"destroy",value:function(){this.removeEventHandlers(),this.$el[0].removeAttribute("style"),this.$overlay[0].parentNode&&this.$overlay[0].parentNode.removeChild(this.$overlay[0]),this.$el[0].M_Modal=void 0,n._count--}},{key:"setupEventHandlers",value:function(){this.handleOverlayClickBound=this.handleOverlayClick.bind(this),this.handleModalCloseClickBound=this.handleModalCloseClick.bind(this),1===n._count&&document.body.addEventListener("click",this.handleTriggerClick),this.$overlay[0].addEventListener("click",this.handleOverlayClickBound),this.$el[0].addEventListener("click",this.handleModalCloseClickBound)}},{key:"removeEventHandlers",value:function(){0===n._count&&document.body.removeEventListener("click",this.handleTriggerClick),this.$overlay[0].removeEventListener("click",this.handleOverlayClickBound),this.$el[0].removeEventListener("click",this.handleModalCloseClickBound)}},{key:"handleTriggerClick",value:function(e){var i=t(e.target).closest(".modal-trigger");if(e.target&&i.length){var n=i[0].getAttribute("href");n=n?n.slice(1):i[0].getAttribute("data-target");var o=document.getElementById(n).M_Modal;o&&o.open(i),e.preventDefault()}}},{key:"handleOverlayClick",value:function(){this.options.dismissible&&this.close()}},{key:"handleModalCloseClick",value:function(e){var i=t(e.target).closest(".modal-close");e.target&&i.length&&this.close()}},{key:"handleKeydown",value:function(t){27===t.keyCode&&this.options.dismissible&&this.close()}},{key:"animateIn",value:function(){var i=this;t.extend(this.$el[0].style,{display:"block",opacity:0}),t.extend(this.$overlay[0].style,{display:"block",opacity:0}),e(this.$overlay[0],{opacity:this.options.opacity},{duration:this.options.inDuration,queue:!1,ease:"easeOutCubic"});var n={duration:this.options.inDuration,queue:!1,ease:"easeOutCubic",complete:function(){"function"==typeof i.options.ready&&i.options.ready.call(i,i.$el,i.openingTrigger)}};this.$el[0].classList.contains("bottom-sheet")?e(this.$el[0],{bottom:0,opacity:1},n):(e.hook(this.$el[0],"scaleX",.7),this.$el[0].style.top=this.options.startingTop,e(this.$el[0],{top:this.options.endingTop,opacity:1,scaleX:1},n))}},{key:"animateOut",value:function(){var t=this;e(this.$overlay[0],{opacity:0},{duration:this.options.outDuration,queue:!1,ease:"easeOutQuart"});var i={duration:this.options.outDuration,queue:!1,ease:"easeOutCubic",complete:function(){t.$el[0].style.display="none","function"==typeof t.options.complete&&t.options.complete.call(t,t.$el),t.$overlay[0].parentNode.removeChild(t.$overlay[0])}};this.$el[0].classList.contains("bottom-sheet")?e(this.$el[0],{bottom:"-100%",opacity:0},i):e(this.$el[0],{top:this.options.startingTop,opacity:0,scaleX:.7},i)}},{key:"open",value:function(t){if(!this.isOpen){this.isOpen=!0;var e=document.body;return e.style.overflow="hidden",this.$el[0].classList.add("open"),e.appendChild(this.$overlay[0]),this.openingTrigger=t||void 0,this.options.dismissible&&(this.handleKeydownBound=this.handleKeydown.bind(this),document.addEventListener("keydown",this.handleKeydownBound)),this.animateIn(),this}}},{key:"close",value:function(){if(this.isOpen)return this.isOpen=!1,this.$el[0].classList.remove("open"),document.body.style.overflow="",this.options.dismissible&&document.removeEventListener("keydown",this.handleKeydownBound),this.animateOut(),this}}],[{key:"init",value:function(e,i){var o=[];return e.each(function(){o.push(new n(t(this),i))}),o}},{key:"defaults",get:function(){return i}}]),n}();n._increment=0,n._count=0,Materialize.Modal=n,t.fn.modal=function(e){return n.prototype[e]?"get"===e.slice(0,3)?this.first()[0].M_Modal[e]():this.each(function(){this.M_Modal[e]()}):"object"!=typeof e&&e?void t.error("Method "+e+" does not exist on jQuery.modal"):(n.init(this,arguments[0]),this)}}(jQuery,Materialize.Vel),function(t){t.fn.materialbox=function(){return this.each(function(){function e(){a=!1;var e=s.parent(".material-placeholder"),n=(window.innerWidth,window.innerHeight,s.data("width")),l=s.data("height");s.velocity("stop",!0),t("#materialbox-overlay").velocity("stop",!0),t(".materialbox-caption").velocity("stop",!0),t(window).off("scroll.materialbox"),t(document).off("keyup.materialbox"),t(window).off("resize.materialbox"),t("#materialbox-overlay").velocity({opacity:0},{duration:r,queue:!1,easing:"easeOutQuad",complete:function(){o=!1,t(this).remove()}}),s.velocity({width:n,height:l,left:0,top:0},{duration:r,queue:!1,easing:"easeOutQuad",complete:function(){e.css({height:"",width:"",position:"",top:"",left:""}),s.removeAttr("style"),s.attr("style",c),s.removeClass("active"),a=!0,i&&i.css("overflow","")}}),t(".materialbox-caption").velocity({opacity:0},{duration:r,queue:!1,easing:"easeOutQuad",complete:function(){t(this).remove()}})}if(!t(this).hasClass("initialized")){t(this).addClass("initialized");var i,n,o=!1,a=!0,r=200,s=t(this),l=t("
        ").addClass("material-placeholder"),c=s.attr("style");s.wrap(l),s.on("click",function(){var r=s.parent(".material-placeholder"),l=window.innerWidth,c=window.innerHeight,u=s.width(),d=s.height();if(!1===a)return e(),!1;if(o&&!0===a)return e(),!1;a=!1,s.addClass("active"),o=!0,r.css({width:r[0].getBoundingClientRect().width,height:r[0].getBoundingClientRect().height,position:"relative",top:0,left:0}),i=void 0,n=r[0].parentNode;for(;null!==n&&!t(n).is(document);){var p=t(n);"visible"!==p.css("overflow")&&(p.css("overflow","visible"),i=void 0===i?p:i.add(p)),n=n.parentNode}s.css({position:"absolute","z-index":1e3,"will-change":"left, top, width, height"}).data("width",u).data("height",d);var h=t('
        ').css({opacity:0}).click(function(){!0===a&&e()});s.before(h);var f=h[0].getBoundingClientRect();if(h.css({width:l,height:c,left:-1*f.left,top:-1*f.top}),h.velocity({opacity:1},{duration:275,queue:!1,easing:"easeOutQuad"}),""!==s.data("caption")){var v=t('
        ');v.text(s.data("caption")),t("body").append(v),v.css({display:"inline"}),v.velocity({opacity:1},{duration:275,queue:!1,easing:"easeOutQuad"})}var m=0,g=0;u/l>d/c?(m=.9*l,g=.9*l*(d/u)):(m=.9*c*(u/d),g=.9*c),s.hasClass("responsive-img")?s.velocity({"max-width":m,width:u},{duration:0,queue:!1,complete:function(){s.css({left:0,top:0}).velocity({height:g,width:m,left:t(document).scrollLeft()+l/2-s.parent(".material-placeholder").offset().left-m/2,top:t(document).scrollTop()+c/2-s.parent(".material-placeholder").offset().top-g/2},{duration:275,queue:!1,easing:"easeOutQuad",complete:function(){a=!0}})}}):s.css("left",0).css("top",0).velocity({height:g,width:m,left:t(document).scrollLeft()+l/2-s.parent(".material-placeholder").offset().left-m/2,top:t(document).scrollTop()+c/2-s.parent(".material-placeholder").offset().top-g/2},{duration:275,queue:!1,easing:"easeOutQuad",complete:function(){a=!0}}),t(window).on("scroll.materialbox",function(){o&&e()}),t(window).on("resize.materialbox",function(){o&&e()}),t(document).on("keyup.materialbox",function(t){27===t.keyCode&&!0===a&&o&&e()})})}})},t(document).ready(function(){t(".materialboxed").materialbox()})}(jQuery),function(t){t.fn.parallax=function(){var e=t(window).width();return this.each(function(i){function n(i){var n;n=e<601?o.height()>0?o.height():o.children("img").height():o.height()>0?o.height():500;var a=o.children("img").first(),r=a.height()-n,s=o.offset().top+n,l=o.offset().top,c=t(window).scrollTop(),u=window.innerHeight,d=(c+u-l)/(n+u),p=Math.round(r*d);i&&a.css("display","block"),s>c&&l=0?(s.velocity({right:b(o)},{duration:300,queue:!1,easing:"easeOutQuad"}),s.velocity({left:w(o)},{duration:300,queue:!1,easing:"easeOutQuad",delay:90})):(s.velocity({left:w(o)},{duration:300,queue:!1,easing:"easeOutQuad"}),s.velocity({right:b(o)},{duration:300,queue:!1,easing:"easeOutQuad",delay:90}))};e.swipeable&&d>e.responsiveThreshold&&(e.swipeable=!1),0===(o=t(p.filter('[href="'+location.hash+'"]'))).length&&(o=t(this).find("li.tab a.active").first()),0===o.length&&(o=t(this).find("li.tab a").first()),o.addClass("active"),(m=p.index(o))<0&&(m=0),void 0!==o[0]&&(a=t(o[0].hash)).addClass("active"),u.find(".indicator").length||u.append('
      • '),s=u.find(".indicator"),u.append(s),u.is(":visible")&&setTimeout(function(){s.css({right:b(o)}),s.css({left:w(o)})},0),t(window).off("resize.tabs-"+c).on("resize.tabs-"+c,function(){h=u.width(),v=Math.max(h,u[0].scrollWidth)/p.length,m<0&&(m=0),0!==v&&0!==h&&(s.css({right:b(o)}),s.css({left:w(o)}))}),e.swipeable?(p.each(function(){var e=t(Materialize.escapeHash(this.hash));e.addClass("carousel-item"),f=f.add(e)}),r=f.wrapAll(''),f.css("display",""),t(".tabs-content.carousel").carousel({fullWidth:!0,noWrap:!0,onCycleTo:function(t){if(!y){var i=m;m=r.index(t),o.removeClass("active"),(o=p.eq(m)).addClass("active"),k(i),"function"==typeof e.onShow&&e.onShow.call(u[0],a)}}})):p.not(o).each(function(){t(Materialize.escapeHash(this.hash)).hide()}),u.off("click.tabs").on("click.tabs","a",function(i){if(t(this).parent().hasClass("disabled"))i.preventDefault();else if(!t(this).attr("target")){y=!0,h=u.width(),v=Math.max(h,u[0].scrollWidth)/p.length,o.removeClass("active");var n=a;o=t(this),a=t(Materialize.escapeHash(this.hash)),p=u.find("li.tab a");o.position();o.addClass("active"),g=m,(m=p.index(t(this)))<0&&(m=0),e.swipeable?f.length&&f.carousel("set",m,function(){"function"==typeof e.onShow&&e.onShow.call(u[0],a)}):(void 0!==a&&(a.show(),a.addClass("active"),"function"==typeof e.onShow&&e.onShow.call(this,a)),void 0===n||n.is(a)||(n.hide(),n.removeClass("active"))),l=setTimeout(function(){y=!1},300),k(g),i.preventDefault()}})})},select_tab:function(t){this.find('a[href="#'+t+'"]').trigger("click")}};t.fn.tabs=function(i){return e[i]?e[i].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof i&&i?void t.error("Method "+i+" does not exist on jQuery.tabs"):e.init.apply(this,arguments)},t(document).ready(function(){t("ul.tabs").tabs()})}(jQuery),function(t){t.fn.tooltip=function(i){var n={delay:350,tooltip:"",position:"bottom",html:!1};return"remove"===i?(this.each(function(){t("#"+t(this).attr("data-tooltip-id")).remove(),t(this).removeAttr("data-tooltip-id"),t(this).off("mouseenter.tooltip mouseleave.tooltip")}),!1):(i=t.extend(n,i),this.each(function(){var n=Materialize.guid(),o=t(this);o.attr("data-tooltip-id")&&t("#"+o.attr("data-tooltip-id")).remove(),o.attr("data-tooltip-id",n);var a,r,s,l,c,u,d=function(){a=o.attr("data-html")?"true"===o.attr("data-html"):i.html,r=o.attr("data-delay"),r=void 0===r||""===r?i.delay:r,s=o.attr("data-position"),s=void 0===s||""===s?i.position:s,l=o.attr("data-tooltip"),l=void 0===l||""===l?i.tooltip:l};d();c=function(){var e=t('
        ');return l=a?t("").html(l):t("").text(l),e.append(l).appendTo(t("body")).attr("id",n),(u=t('
        ')).appendTo(e),e}(),o.off("mouseenter.tooltip mouseleave.tooltip");var p,h=!1;o.on({"mouseenter.tooltip":function(t){p=setTimeout(function(){d(),h=!0,c.velocity("stop"),u.velocity("stop"),c.css({visibility:"visible",left:"0px",top:"0px"});var t,i,n,a=o.outerWidth(),r=o.outerHeight(),l=c.outerHeight(),p=c.outerWidth(),f="0px",v="0px",m=u[0].offsetWidth,g=u[0].offsetHeight,y=8,b=8,w=0;"top"===s?(t=o.offset().top-l-5,i=o.offset().left+a/2-p/2,n=e(i,t,p,l),f="-10px",u.css({bottom:0,left:0,borderRadius:"14px 14px 0 0",transformOrigin:"50% 100%",marginTop:l,marginLeft:p/2-m/2})):"left"===s?(t=o.offset().top+r/2-l/2,i=o.offset().left-p-5,n=e(i,t,p,l),v="-10px",u.css({top:"-7px",right:0,width:"14px",height:"14px",borderRadius:"14px 0 0 14px",transformOrigin:"95% 50%",marginTop:l/2,marginLeft:p})):"right"===s?(t=o.offset().top+r/2-l/2,i=o.offset().left+a+5,n=e(i,t,p,l),v="+10px",u.css({top:"-7px",left:0,width:"14px",height:"14px",borderRadius:"0 14px 14px 0",transformOrigin:"5% 50%",marginTop:l/2,marginLeft:"0px"})):(t=o.offset().top+o.outerHeight()+5,i=o.offset().left+a/2-p/2,n=e(i,t,p,l),f="+10px",u.css({top:0,left:0,marginLeft:p/2-m/2})),c.css({top:n.y,left:n.x}),y=Math.SQRT2*p/parseInt(m),b=Math.SQRT2*l/parseInt(g),w=Math.max(y,b),c.velocity({translateY:f,translateX:v},{duration:350,queue:!1}).velocity({opacity:1},{duration:300,delay:50,queue:!1}),u.css({visibility:"visible"}).velocity({opacity:1},{duration:55,delay:0,queue:!1}).velocity({scaleX:w,scaleY:w},{duration:300,delay:0,queue:!1,easing:"easeInOutQuad"})},r)},"mouseleave.tooltip":function(){h=!1,clearTimeout(p),setTimeout(function(){!0!==h&&(c.velocity({opacity:0,translateY:0,translateX:0},{duration:225,queue:!1}),u.velocity({opacity:0,scaleX:1,scaleY:1},{duration:225,queue:!1,complete:function(){u.css({visibility:"hidden"}),c.css({visibility:"hidden"}),h=!1}}))},225)}})}))};var e=function(e,i,n,o){var a=e,r=i;return a<0?a=4:a+n>window.innerWidth&&(a-=a+n-window.innerWidth),r<0?r=4:r+o>window.innerHeight+t(window).scrollTop&&(r-=r+o-window.innerHeight),{x:a,y:r}};t(document).ready(function(){t(".tooltipped").tooltip()})}(jQuery),function(t){"use strict";function e(t){return null!==t&&t===t.window}function i(t){return e(t)?t:9===t.nodeType&&t.defaultView}function n(t){var e,n,o={top:0,left:0},a=t&&t.ownerDocument;return e=a.documentElement,void 0!==t.getBoundingClientRect&&(o=t.getBoundingClientRect()),n=i(a),{top:o.top+n.pageYOffset-e.clientTop,left:o.left+n.pageXOffset-e.clientLeft}}function o(t){var e="";for(var i in t)t.hasOwnProperty(i)&&(e+=i+":"+t[i]+";");return e}function a(t){if(!1===u.allowEvent(t))return null;for(var e=null,i=t.target||t.srcElement;null!==i.parentNode;){if(!(i instanceof SVGElement)&&-1!==i.className.indexOf("waves-effect")){e=i;break}i=i.parentNode}return e}function r(e){var i=a(e);null!==i&&(c.show(e,i),"ontouchstart"in t&&(i.addEventListener("touchend",c.hide,!1),i.addEventListener("touchcancel",c.hide,!1)),i.addEventListener("mouseup",c.hide,!1),i.addEventListener("mouseleave",c.hide,!1),i.addEventListener("dragend",c.hide,!1))}var s=s||{},l=document.querySelectorAll.bind(document),c={duration:750,show:function(t,e){if(2===t.button)return!1;var i=e||this,a=document.createElement("div");a.className="waves-ripple",i.appendChild(a);var r=n(i),s=t.pageY-r.top,l=t.pageX-r.left,u="scale("+i.clientWidth/100*10+")";"touches"in t&&(s=t.touches[0].pageY-r.top,l=t.touches[0].pageX-r.left),a.setAttribute("data-hold",Date.now()),a.setAttribute("data-scale",u),a.setAttribute("data-x",l),a.setAttribute("data-y",s);var d={top:s+"px",left:l+"px"};a.className=a.className+" waves-notransition",a.setAttribute("style",o(d)),a.className=a.className.replace("waves-notransition",""),d["-webkit-transform"]=u,d["-moz-transform"]=u,d["-ms-transform"]=u,d["-o-transform"]=u,d.transform=u,d.opacity="1",d["-webkit-transition-duration"]=c.duration+"ms",d["-moz-transition-duration"]=c.duration+"ms",d["-o-transition-duration"]=c.duration+"ms",d["transition-duration"]=c.duration+"ms",d["-webkit-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",d["-moz-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",d["-o-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",d["transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",a.setAttribute("style",o(d))},hide:function(t){u.touchup(t);var e=this,i=(e.clientWidth,null),n=e.getElementsByClassName("waves-ripple");if(!(n.length>0))return!1;var a=(i=n[n.length-1]).getAttribute("data-x"),r=i.getAttribute("data-y"),s=i.getAttribute("data-scale"),l=350-(Date.now()-Number(i.getAttribute("data-hold")));l<0&&(l=0),setTimeout(function(){var t={top:r+"px",left:a+"px",opacity:"0","-webkit-transition-duration":c.duration+"ms","-moz-transition-duration":c.duration+"ms","-o-transition-duration":c.duration+"ms","transition-duration":c.duration+"ms","-webkit-transform":s,"-moz-transform":s,"-ms-transform":s,"-o-transform":s,transform:s};i.setAttribute("style",o(t)),setTimeout(function(){try{e.removeChild(i)}catch(t){return!1}},c.duration)},l)},wrapInput:function(t){for(var e=0;e0&&(u.touches-=1)},500):"mousedown"===t.type&&u.touches>0&&(e=!1),e},touchup:function(t){u.allowEvent(t)}};s.displayEffect=function(e){"duration"in(e=e||{})&&(c.duration=e.duration),c.wrapInput(l(".waves-effect")),"ontouchstart"in t&&document.body.addEventListener("touchstart",r,!1),document.body.addEventListener("mousedown",r,!1)},s.attach=function(e){"input"===e.tagName.toLowerCase()&&(c.wrapInput([e]),e=e.parentNode),"ontouchstart"in t&&e.addEventListener("touchstart",r,!1),e.addEventListener("mousedown",r,!1)},t.Waves=s,document.addEventListener("DOMContentLoaded",function(){s.displayEffect()},!1)}(window),function(t,e){"use strict";var i={displayLength:1/0,inDuration:300,outDuration:375,className:void 0,completeCallback:void 0,activationPercent:.8},n=function(){function n(e,i,o,a){if(_classCallCheck(this,n),e){this.options={displayLength:i,className:o,completeCallback:a},this.options=t.extend({},n.defaults,this.options),this.message=e,this.panning=!1,this.timeRemaining=this.options.displayLength,0===n._toasts.length&&n._createContainer(),n._toasts.push(this);var r=this.createToast();r.M_Toast=this,this.el=r,this._animateIn(),this.setTimer()}}return _createClass(n,[{key:"createToast",value:function(){var e=document.createElement("div");if(e.classList.add("toast"),this.options.className){var i=this.options.className.split(" "),o=void 0,a=void 0;for(o=0,a=i.length;oo||e.velocityX>1?(e.wasSwiped=!0,e.remove()):(e.el.style.transition="transform .2s, opacity .2s",e.el.style.transform="",e.el.style.opacity=""),n._draggedToast=null}}},{key:"_xPos",value:function(t){return t.targetTouches&&t.targetTouches.length>=1?t.targetTouches[0].clientX:t.clientX}},{key:"removeAll",value:function(){for(var t in n._toasts)n._toasts[t].remove()}},{key:"defaults",get:function(){return i}}]),n}();n._toasts=[],n._container=null,n._draggedToast=null,Materialize.Toast=n,Materialize.toast=function(t,e,i,o){return new n(t,e,i,o)}}(jQuery,Materialize.Vel),function(t){var e={init:function(e){var i={menuWidth:300,edge:"left",closeOnClick:!1,draggable:!0,onOpen:null,onClose:null};e=t.extend(i,e),t(this).each(function(){var i=t(this),n=i.attr("data-activates"),o=t("#"+n);300!=e.menuWidth&&o.css("width",e.menuWidth);var a=t('.drag-target[data-sidenav="'+n+'"]');e.draggable?(a.length&&a.remove(),a=t('
        ').attr("data-sidenav",n),t("body").append(a)):a=t(),"left"==e.edge?(o.css("transform","translateX(-100%)"),a.css({left:0})):(o.addClass("right-aligned").css("transform","translateX(100%)"),a.css({right:0})),o.hasClass("fixed")&&window.innerWidth>992&&o.css("transform","translateX(0)"),o.hasClass("fixed")&&t(window).resize(function(){window.innerWidth>992?0!==t("#sidenav-overlay").length&&l?r(!0):o.css("transform","translateX(0%)"):!1===l&&("left"===e.edge?o.css("transform","translateX(-100%)"):o.css("transform","translateX(100%)"))}),!0===e.closeOnClick&&o.on("click.itemclick","a:not(.collapsible-header)",function(){window.innerWidth>992&&o.hasClass("fixed")||r()});var r=function(i){s=!1,l=!1,t("body").css({overflow:"",width:""}),t("#sidenav-overlay").velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){t(this).remove()}}),"left"===e.edge?(a.css({width:"",right:"",left:"0"}),o.velocity({translateX:"-100%"},{duration:200,queue:!1,easing:"easeOutCubic",complete:function(){!0===i&&(o.removeAttr("style"),o.css("width",e.menuWidth))}})):(a.css({width:"",right:"0",left:""}),o.velocity({translateX:"100%"},{duration:200,queue:!1,easing:"easeOutCubic",complete:function(){!0===i&&(o.removeAttr("style"),o.css("width",e.menuWidth))}})),"function"==typeof e.onClose&&e.onClose.call(this,o)},s=!1,l=!1;e.draggable&&(a.on("click",function(){l&&r()}),a.hammer({prevent_default:!1}).on("pan",function(i){if("touch"==i.gesture.pointerType){i.gesture.direction;var n=i.gesture.center.x,a=i.gesture.center.y;i.gesture.velocityX;if(0===n&&0===a)return;var s=t("body"),c=t("#sidenav-overlay"),u=s.innerWidth();if(s.css("overflow","hidden"),s.width(u),0===c.length&&((c=t('
        ')).css("opacity",0).click(function(){r()}),"function"==typeof e.onOpen&&e.onOpen.call(this,o),t("body").append(c)),"left"===e.edge&&(n>e.menuWidth?n=e.menuWidth:n<0&&(n=0)),"left"===e.edge)n=e.menuWidth/2&&(l=!0),o.css("transform","translateX("+(n-e.menuWidth)+"px)");else{n=window.innerWidth-e.menuWidth/2&&(l=!1);var d=n-e.menuWidth/2;d<0&&(d=0),o.css("transform","translateX("+d+"px)")}var p;"left"===e.edge?(p=n/e.menuWidth,c.velocity({opacity:p},{duration:10,queue:!1,easing:"easeOutQuad"})):(p=Math.abs((n-window.innerWidth)/e.menuWidth),c.velocity({opacity:p},{duration:10,queue:!1,easing:"easeOutQuad"}))}}).on("panend",function(i){if("touch"==i.gesture.pointerType){var n=t("#sidenav-overlay"),r=i.gesture.velocityX,c=i.gesture.center.x,u=c-e.menuWidth,d=c-e.menuWidth/2;u>0&&(u=0),d<0&&(d=0),s=!1,"left"===e.edge?l&&r<=.3||r<-.5?(0!==u&&o.velocity({translateX:[0,u]},{duration:300,queue:!1,easing:"easeOutQuad"}),n.velocity({opacity:1},{duration:50,queue:!1,easing:"easeOutQuad"}),a.css({width:"50%",right:0,left:""}),l=!0):(!l||r>.3)&&(t("body").css({overflow:"",width:""}),o.velocity({translateX:[-1*e.menuWidth-10,u]},{duration:200,queue:!1,easing:"easeOutQuad"}),n.velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){"function"==typeof e.onClose&&e.onClose.call(this,o),t(this).remove()}}),a.css({width:"10px",right:"",left:0})):l&&r>=-.3||r>.5?(0!==d&&o.velocity({translateX:[0,d]},{duration:300,queue:!1,easing:"easeOutQuad"}),n.velocity({opacity:1},{duration:50,queue:!1,easing:"easeOutQuad"}),a.css({width:"50%",right:"",left:0}),l=!0):(!l||r<-.3)&&(t("body").css({overflow:"",width:""}),o.velocity({translateX:[e.menuWidth+10,d]},{duration:200,queue:!1,easing:"easeOutQuad"}),n.velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){"function"==typeof e.onClose&&e.onClose.call(this,o),t(this).remove()}}),a.css({width:"10px",right:0,left:""}))}})),i.off("click.sidenav").on("click.sidenav",function(){if(!0===l)l=!1,s=!1,r();else{var i=t("body"),n=t('
        '),c=i.innerWidth();i.css("overflow","hidden"),i.width(c),t("body").append(a),"left"===e.edge?(a.css({width:"50%",right:0,left:""}),o.velocity({translateX:[0,-1*e.menuWidth]},{duration:300,queue:!1,easing:"easeOutQuad"})):(a.css({width:"50%",right:"",left:0}),o.velocity({translateX:[0,e.menuWidth]},{duration:300,queue:!1,easing:"easeOutQuad"})),n.css("opacity",0).click(function(){l=!1,s=!1,r(),n.velocity({opacity:0},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){t(this).remove()}})}),t("body").append(n),n.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){l=!0,s=!1}}),"function"==typeof e.onOpen&&e.onOpen.call(this,o)}return!1})})},destroy:function(){var e=t("#sidenav-overlay"),i=t('.drag-target[data-sidenav="'+t(this).attr("data-activates")+'"]');e.trigger("click"),i.remove(),t(this).off("click"),e.remove()},show:function(){this.trigger("click")},hide:function(){t("#sidenav-overlay").trigger("click")}};t.fn.sideNav=function(i){return e[i]?e[i].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof i&&i?void t.error("Method "+i+" does not exist on jQuery.sideNav"):e.init.apply(this,arguments)}}(jQuery),function(t){function e(e,i,n,o){var r=t();return t.each(a,function(t,a){if(a.height()>0){var s=a.offset().top,l=a.offset().left,c=l+a.width(),u=s+a.height();!(l>i||cn||u");n.html(s),e.is(":visible")?n.css("width",e.width()):n.css("width",t(window).width()/2),e.data("original-height")<=n.height()?e.css("height",n.height()):e.val().length0||t(i).is(":focus")||i.autofocus||void 0!==n.attr("placeholder")?n.siblings("label").addClass("active"):t(i)[0].validity?n.siblings("label").toggleClass("active",!0===t(i)[0].validity.badInput):n.siblings("label").removeClass("active")})};var i="input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea";t(document).on("change",i,function(){0===t(this).val().length&&void 0===t(this).attr("placeholder")||t(this).siblings("label").addClass("active"),validate_field(t(this))}),t(document).ready(function(){Materialize.updateTextFields()}),t(document).on("reset",function(e){var n=t(e.target);n.is("form")&&(n.find(i).removeClass("valid").removeClass("invalid"),n.find(i).each(function(){""===t(this).attr("value")&&t(this).siblings("label").removeClass("active")}),n.find("select.initialized").each(function(){var t=n.find("option[selected]").text();n.siblings("input.select-dropdown").val(t)}))}),t(document).on("focus",i,function(){t(this).siblings("label, .prefix").addClass("active")}),t(document).on("blur",i,function(){var e=t(this),i=".prefix";0===e.val().length&&!0!==e[0].validity.badInput&&void 0===e.attr("placeholder")&&(i+=", label"),e.siblings(i).removeClass("active"),validate_field(e)}),window.validate_field=function(t){var e=void 0!==t.attr("data-length"),i=parseInt(t.attr("data-length")),n=t.val().length;0!==t.val().length||!1!==t[0].validity.badInput||t.is(":required")?t.hasClass("validate")&&(t.is(":valid")&&e&&n<=i||t.is(":valid")&&!e?(t.removeClass("invalid"),t.addClass("valid")):(t.removeClass("valid"),t.addClass("invalid"))):t.hasClass("validate")&&(t.removeClass("valid"),t.removeClass("invalid"))};t(document).on("keyup.radio","input[type=radio], input[type=checkbox]",function(e){if(9===e.which)return t(this).addClass("tabbed"),void t(this).one("blur",function(e){t(this).removeClass("tabbed")})});var n=t(".hiddendiv").first();n.length||(n=t('
        '),t("body").append(n));t(".materialize-textarea").each(function(){var e=t(this);e.data("original-height",e.height()),e.data("previous-length",e.val().length)}),t("body").on("keyup keydown autoresize",".materialize-textarea",function(){e(t(this))}),t(document).on("change",'.file-field input[type="file"]',function(){for(var e=t(this).closest(".file-field").find("input.file-path"),i=t(this)[0].files,n=[],o=0;o
        ');t(this).after(e)});var r=function(t){var e=-7+parseInt(t.parent().css("padding-left"))+"px";t.velocity({height:"30px",width:"30px",top:"-30px",marginLeft:e},{duration:300,easing:"easeOutExpo"})},s=function(t){var e=t.width()-15,i=parseFloat(t.attr("max")),n=parseFloat(t.attr("min"));return(parseFloat(t.val())-n)/(i-n)*e};t(document).on("change",o,function(e){var i=t(this).siblings(".thumb");i.find(".value").html(t(this).val()),i.hasClass("active")||r(i);var n=s(t(this));i.addClass("active").css("left",n)}),t(document).on("mousedown touchstart",o,function(e){var i=t(this).siblings(".thumb");if(i.length<=0&&(i=t(''),t(this).after(i)),i.find(".value").html(t(this).val()),a=!0,t(this).addClass("active"),i.hasClass("active")||r(i),"input"!==e.type){var n=s(t(this));i.addClass("active").css("left",n)}}),t(document).on("mouseup touchend",".range-field",function(){a=!1,t(this).removeClass("active")}),t(document).on("input mousemove touchmove",".range-field",function(e){var i=t(this).children(".thumb"),n=t(this).find(o);if(a){i.hasClass("active")||r(i);var l=s(n);i.addClass("active").css("left",l),i.find(".value").html(i.siblings(o).val())}}),t(document).on("mouseout touchleave",".range-field",function(){if(!a){var e=t(this).children(".thumb"),i=7+parseInt(t(this).css("padding-left"))+"px";e.hasClass("active")&&e.velocity({height:"0",width:"0",top:"10px",marginLeft:i},{duration:100}),e.removeClass("active")}}),t.fn.autocomplete=function(e){var i={data:{},limit:1/0,onAutocomplete:null,minLength:1};return e=t.extend(i,e),this.each(function(){var i,n=t(this),o=e.data,a=0,r=-1,s=n.closest(".input-field");if(t.isEmptyObject(o))n.off("keyup.autocomplete focus.autocomplete");else{var l,c=t('');s.length?(l=s.children(".autocomplete-content.dropdown-content").first()).length||s.append(c):(l=n.next(".autocomplete-content.dropdown-content")).length||n.after(c),l.length&&(c=l);var u=function(t,e){var i=e.find("img"),n=e.text().toLowerCase().indexOf(""+t.toLowerCase()),o=n+t.length-1,a=e.text().slice(0,n),r=e.text().slice(n,o+1),s=e.text().slice(o+1);e.html(""+a+""+r+""+s+""),i.length&&e.prepend(i)},d=function(){r=-1,c.find(".active").removeClass("active")},p=function(){c.empty(),d(),i=void 0};n.off("blur.autocomplete").on("blur.autocomplete",function(){p()}),n.off("keyup.autocomplete focus.autocomplete").on("keyup.autocomplete focus.autocomplete",function(r){a=0;var s=n.val().toLowerCase();if(13!==r.which&&38!==r.which&&40!==r.which){if(i!==s&&(p(),s.length>=e.minLength))for(var l in o)if(o.hasOwnProperty(l)&&-1!==l.toLowerCase().indexOf(s)){if(a>=e.limit)break;var d=t("
      • ");o[l]?d.append(''+l+""):d.append(""+l+""),c.append(d),u(s,d),a++}i=s}}),n.off("keydown.autocomplete").on("keydown.autocomplete",function(t){var e,i=t.which,n=c.children("li").length,o=c.children(".active").first();13===i&&r>=0?(e=c.children("li").eq(r)).length&&(e.trigger("mousedown.autocomplete"),t.preventDefault()):38!==i&&40!==i||(t.preventDefault(),38===i&&r>0&&r--,40===i&&r=0&&c.children("li").eq(r).addClass("active"))}),c.off("mousedown.autocomplete touchstart.autocomplete").on("mousedown.autocomplete touchstart.autocomplete","li",function(){var i=t(this).text().trim();n.val(i),n.trigger("change"),p(),"function"==typeof e.onAutocomplete&&e.onAutocomplete.call(this,i)})}})}}),t.fn.material_select=function(e){function i(t,e,i){var o=t.indexOf(e),a=-1===o;return a?t.push(e):t.splice(o,1),i.siblings("ul.dropdown-content").find("li:not(.optgroup)").eq(e).toggleClass("active"),i.find("option").eq(e).prop("selected",a),n(t,i),a}function n(t,e){for(var i="",n=0,o=t.length;n
        ');s.addClass(n.attr("class")),n.is(":disabled")&&s.addClass("disabled");var l=t(''),c=n.children("option, optgroup"),u=[],d=!1,p=n.find("option:selected").html()||n.find("option:first").html()||"",h=function(e,i,n){var a=i.is(":disabled")?"disabled ":"",r="optgroup-option"===n?"optgroup-option ":"",s=o?'":"",c=i.data("icon"),u=i.attr("class");if(c){var d="";return u&&(d=' class="'+u+'"'),l.append(t('
      • "+s+i.html()+"
      • ")),!0}l.append(t('
      • '+s+i.html()+"
      • "))};c.length&&c.each(function(){if(t(this).is("option"))o?h(0,t(this),"multiple"):h(0,t(this));else if(t(this).is("optgroup")){var e=t(this).children("option");l.append(t('
      • '+t(this).attr("label")+"
      • ")),e.each(function(){h(0,t(this),"optgroup-option")})}}),l.find("li:not(.optgroup)").each(function(a){t(this).click(function(r){if(!t(this).hasClass("disabled")&&!t(this).hasClass("optgroup")){var s=!0;o?(t('input[type="checkbox"]',this).prop("checked",function(t,e){return!e}),s=i(u,a,n),m.trigger("focus")):(l.find("li").removeClass("active"),t(this).toggleClass("active"),m.val(t(this).text())),g(l,t(this)),n.find("option").eq(a).prop("selected",s),n.trigger("change"),void 0!==e&&e()}r.stopPropagation()})}),n.wrap(s);var f=t(''),v=p.replace(/"/g,"""),m=t('');n.before(m),m.before(f),m.after(l),n.is(":disabled")||m.dropdown({hover:!1}),n.attr("tabindex")&&t(m[0]).attr("tabindex",n.attr("tabindex")),n.addClass("initialized"),m.on({focus:function(){if(t("ul.select-dropdown").not(l[0]).is(":visible")&&(t("input.select-dropdown").trigger("close"),t(window).off("click.select")),!l.is(":visible")){t(this).trigger("open",["focus"]);var e=t(this).val();o&&e.indexOf(",")>=0&&(e=e.split(",")[0]);var i=l.find("li").filter(function(){return t(this).text().toLowerCase()===e.toLowerCase()})[0];g(l,i,!0),t(window).off("click.select").on("click.select",function(){o&&(d||m.trigger("close")),t(window).off("click.select")})}},click:function(t){t.stopPropagation()}}),m.on("blur",function(){o||(t(this).trigger("close"),t(window).off("click.select")),l.find("li.selected").removeClass("selected")}),l.hover(function(){d=!0},function(){d=!1}),o&&n.find("option:selected:not(:disabled)").each(function(){var t=this.index;i(u,t,n),l.find("li:not(.optgroup)").eq(t).find(":checkbox").prop("checked",!0)});var g=function(e,i,n){if(i){e.find("li.selected").removeClass("selected");var a=t(i);a.addClass("selected"),o&&!n||l.scrollTo(a)}},y=[];m.on("keydown",function(e){if(9!=e.which)if(40!=e.which||l.is(":visible")){if(13!=e.which||l.is(":visible")){e.preventDefault();var i=String.fromCharCode(e.which).toLowerCase(),n=[9,13,27,38,40];if(i&&-1===n.indexOf(e.which)){y.push(i);var a=y.join(""),r=l.find("li").filter(function(){return 0===t(this).text().toLowerCase().indexOf(a)})[0];r&&g(l,r)}if(13==e.which){var s=l.find("li.selected:not(.disabled)")[0];s&&(t(s).trigger("click"),o||m.trigger("close"))}40==e.which&&(r=l.find("li.selected").length?l.find("li.selected").next("li:not(.disabled)")[0]:l.find("li:not(.disabled)")[0],g(l,r)),27==e.which&&m.trigger("close"),38==e.which&&(r=l.find("li.selected").prev("li:not(.disabled)")[0])&&g(l,r),setTimeout(function(){y=[]},1e3)}}else m.trigger("open");else m.trigger("close")})}})}}(jQuery),function(t){var e={init:function(e){var i={indicators:!0,height:400,transition:500,interval:6e3};return e=t.extend(i,e),this.each(function(){function i(t,e){t.hasClass("center-align")?t.velocity({opacity:0,translateY:-100},{duration:e,queue:!1}):t.hasClass("right-align")?t.velocity({opacity:0,translateX:100},{duration:e,queue:!1}):t.hasClass("left-align")&&t.velocity({opacity:0,translateX:-100},{duration:e,queue:!1})}function n(t){t>=c.length?t=0:t<0&&(t=c.length-1),(u=l.find(".active").index())!=t&&(o=c.eq(u),$caption=o.find(".caption"),o.removeClass("active"),o.velocity({opacity:0},{duration:e.transition,queue:!1,easing:"easeOutQuad",complete:function(){c.not(".active").velocity({opacity:0,translateX:0,translateY:0},{duration:0,queue:!1})}}),i($caption,e.transition),e.indicators&&a.eq(u).removeClass("active"),c.eq(t).velocity({opacity:1},{duration:e.transition,queue:!1,easing:"easeOutQuad"}),c.eq(t).find(".caption").velocity({opacity:1,translateX:0,translateY:0},{duration:e.transition,delay:e.transition,queue:!1,easing:"easeOutQuad"}),c.eq(t).addClass("active"),e.indicators&&a.eq(t).addClass("active"))}var o,a,r,s=t(this),l=s.find("ul.slides").first(),c=l.find("> li"),u=l.find(".active").index();-1!=u&&(o=c.eq(u)),s.hasClass("fullscreen")||(e.indicators?s.height(e.height+40):s.height(e.height),l.height(e.height)),c.find(".caption").each(function(){i(t(this),0)}),c.find("img").each(function(){var e="data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==";t(this).attr("src")!==e&&(t(this).css("background-image",'url("'+t(this).attr("src")+'")'),t(this).attr("src",e))}),e.indicators&&(a=t('
          '),c.each(function(i){var o=t('
        • ');o.click(function(){n(l.parent().find(t(this)).index()),clearInterval(r),r=setInterval(function(){u=l.find(".active").index(),c.length==u+1?u=0:u+=1,n(u)},e.transition+e.interval)}),a.append(o)}),s.append(a),a=s.find("ul.indicators").find("li.indicator-item")),o?o.show():(c.first().addClass("active").velocity({opacity:1},{duration:e.transition,queue:!1,easing:"easeOutQuad"}),u=0,o=c.eq(u),e.indicators&&a.eq(u).addClass("active")),o.find("img").each(function(){o.find(".caption").velocity({opacity:1,translateX:0,translateY:0},{duration:e.transition,queue:!1,easing:"easeOutQuad"})}),r=setInterval(function(){n((u=l.find(".active").index())+1)},e.transition+e.interval);var d=!1,p=!1,h=!1;s.hammer({prevent_default:!1}).on("pan",function(t){if("touch"===t.gesture.pointerType){clearInterval(r);var e=t.gesture.direction,i=t.gesture.deltaX,n=t.gesture.velocityX,o=t.gesture.velocityY;$curr_slide=l.find(".active"),Math.abs(n)>Math.abs(o)&&$curr_slide.velocity({translateX:i},{duration:50,queue:!1,easing:"easeOutQuad"}),4===e&&(i>s.innerWidth()/2||n<-.65)?h=!0:2===e&&(i<-1*s.innerWidth()/2||n>.65)&&(p=!0);var a;p&&(0===(a=$curr_slide.next()).length&&(a=c.first()),a.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad"})),h&&(0===(a=$curr_slide.prev()).length&&(a=c.last()),a.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad"}))}}).on("panend",function(t){"touch"===t.gesture.pointerType&&($curr_slide=l.find(".active"),d=!1,curr_index=l.find(".active").index(),!h&&!p||c.length<=1?$curr_slide.velocity({translateX:0},{duration:300,queue:!1,easing:"easeOutQuad"}):p?(n(curr_index+1),$curr_slide.velocity({translateX:-1*s.innerWidth()},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){$curr_slide.velocity({opacity:0,translateX:0},{duration:0,queue:!1})}})):h&&(n(curr_index-1),$curr_slide.velocity({translateX:s.innerWidth()},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){$curr_slide.velocity({opacity:0,translateX:0},{duration:0,queue:!1})}})),p=!1,h=!1,clearInterval(r),r=setInterval(function(){u=l.find(".active").index(),c.length==u+1?u=0:u+=1,n(u)},e.transition+e.interval))}),s.on("sliderPause",function(){clearInterval(r)}),s.on("sliderStart",function(){clearInterval(r),r=setInterval(function(){u=l.find(".active").index(),c.length==u+1?u=0:u+=1,n(u)},e.transition+e.interval)}),s.on("sliderNext",function(){n((u=l.find(".active").index())+1)}),s.on("sliderPrev",function(){n((u=l.find(".active").index())-1)})})},pause:function(){t(this).trigger("sliderPause")},start:function(){t(this).trigger("sliderStart")},next:function(){t(this).trigger("sliderNext")},prev:function(){t(this).trigger("sliderPrev")}};t.fn.slider=function(i){return e[i]?e[i].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof i&&i?void t.error("Method "+i+" does not exist on jQuery.tooltip"):e.init.apply(this,arguments)}}(jQuery),function(t){t(document).ready(function(){t(document).on("click.card",".card",function(e){if(t(this).find("> .card-reveal").length){var i=t(e.target).closest(".card");void 0===i.data("initialOverflow")&&i.data("initialOverflow",void 0===i.css("overflow")?"":i.css("overflow")),t(e.target).is(t(".card-reveal .card-title"))||t(e.target).is(t(".card-reveal .card-title i"))?t(this).find(".card-reveal").velocity({translateY:0},{duration:225,queue:!1,easing:"easeInOutQuad",complete:function(){t(this).css({display:"none"}),i.css("overflow",i.data("initialOverflow"))}}):(t(e.target).is(t(".card .activator"))||t(e.target).is(t(".card .activator i")))&&(i.css("overflow","hidden"),t(this).find(".card-reveal").css({display:"block"}).velocity("stop",!1).velocity({translateY:"-100%"},{duration:300,queue:!1,easing:"easeInOutQuad"}))}})})}(jQuery),function(t){var e={data:[],placeholder:"",secondaryPlaceholder:"",autocompleteOptions:{}};t(document).ready(function(){t(document).on("click",".chip .close",function(e){t(this).closest(".chips").attr("data-initialized")||t(this).closest(".chip").remove()})}),t.fn.material_chip=function(i){var n=this;if(this.$el=t(this),this.$document=t(document),this.SELS={CHIPS:".chips",CHIP:".chip",INPUT:"input",DELETE:".material-icons",SELECTED_CHIP:".selected"},"data"===i)return this.$el.data("chips");var o=t.extend({},e,i);n.hasAutocomplete=!t.isEmptyObject(o.autocompleteOptions.data),this.init=function(){var e=0;n.$el.each(function(){var i=t(this),a=Materialize.guid();n.chipId=a,o.data&&o.data instanceof Array||(o.data=[]),i.data("chips",o.data),i.attr("data-index",e),i.attr("data-initialized",!0),i.hasClass(n.SELS.CHIPS)||i.addClass("chips"),n.chips(i,a),e++})},this.handleEvents=function(){var e=n.SELS;n.$document.off("click.chips-focus",e.CHIPS).on("click.chips-focus",e.CHIPS,function(i){t(i.target).find(e.INPUT).focus()}),n.$document.off("click.chips-select",e.CHIP).on("click.chips-select",e.CHIP,function(i){var o=t(i.target);if(o.length){var a=o.hasClass("selected"),r=o.closest(e.CHIPS);t(e.CHIP).removeClass("selected"),a||n.selectChip(o.index(),r)}}),n.$document.off("keydown.chips").on("keydown.chips",function(i){if(!t(i.target).is("input, textarea")){var o,a=n.$document.find(e.CHIP+e.SELECTED_CHIP),r=a.closest(e.CHIPS),s=a.siblings(e.CHIP).length;if(a.length)if(8===i.which||46===i.which){i.preventDefault(),o=a.index(),n.deleteChip(o,r);var l=null;o+1s)return void r.find("input").focus();n.selectChip(o,r)}}}),n.$document.off("focusin.chips",e.CHIPS+" "+e.INPUT).on("focusin.chips",e.CHIPS+" "+e.INPUT,function(i){var n=t(i.target).closest(e.CHIPS);n.addClass("focus"),n.siblings("label, .prefix").addClass("active"),t(e.CHIP).removeClass("selected")}),n.$document.off("focusout.chips",e.CHIPS+" "+e.INPUT).on("focusout.chips",e.CHIPS+" "+e.INPUT,function(i){var n=t(i.target).closest(e.CHIPS);n.removeClass("focus"),void 0!==n.data("chips")&&n.data("chips").length||n.siblings("label").removeClass("active"),n.siblings(".prefix").removeClass("active")}),n.$document.off("keydown.chips-add",e.CHIPS+" "+e.INPUT).on("keydown.chips-add",e.CHIPS+" "+e.INPUT,function(i){var o=t(i.target),a=o.closest(e.CHIPS),r=a.children(e.CHIP).length;if(13===i.which){if(n.hasAutocomplete&&a.find(".autocomplete-content.dropdown-content").length&&a.find(".autocomplete-content.dropdown-content").children().length)return;return i.preventDefault(),n.addChip({tag:o.val()},a),void o.val("")}if((8===i.keyCode||37===i.keyCode)&&""===o.val()&&r)return i.preventDefault(),n.selectChip(r-1,a),void o.blur()}),n.$document.off("click.chips-delete",e.CHIPS+" "+e.DELETE).on("click.chips-delete",e.CHIPS+" "+e.DELETE,function(i){var o=t(i.target),a=o.closest(e.CHIPS),r=o.closest(e.CHIP);i.stopPropagation(),n.deleteChip(r.index(),a),a.find("input").focus()})},this.chips=function(e,i){e.empty(),e.data("chips").forEach(function(t){e.append(n.renderChip(t))}),e.append(t('')),n.setPlaceholder(e);var a=e.next("label");a.length&&(a.attr("for",i),void 0!==e.data("chips")&&e.data("chips").length&&a.addClass("active"));var r=t("#"+i);n.hasAutocomplete&&(o.autocompleteOptions.onAutocomplete=function(t){n.addChip({tag:t},e),r.val(""),r.focus()},r.autocomplete(o.autocompleteOptions))},this.renderChip=function(e){if(e.tag){var i=t('
          ');return i.text(e.tag),e.image&&i.prepend(t("").attr("src",e.image)),i.append(t('close')),i}},this.setPlaceholder=function(t){void 0!==t.data("chips")&&!t.data("chips").length&&o.placeholder?t.find("input").prop("placeholder",o.placeholder):(void 0===t.data("chips")||t.data("chips").length)&&o.secondaryPlaceholder&&t.find("input").prop("placeholder",o.secondaryPlaceholder)},this.isValid=function(t,e){for(var i=t.data("chips"),n=!1,o=0;o=o&&!t(this).hasClass("pinned")&&(i(t(this)),t(this).css("top",e.offset),t(this).addClass("pinned")),oe.bottom&&!t(this).hasClass("pin-bottom")&&(i(t(this)),t(this).addClass("pin-bottom"),t(this).css("top",e.bottom-r))})}var o=Materialize.guid(),a=t(this),r=t(this).offset().top;t(this).data("pushpin-id",o),n(a,t(window).scrollTop()),t(window).on("scroll."+o,function(){var i=t(window).scrollTop()+e.offset;n(a,i)})}))}}(jQuery),function(t){t(document).ready(function(){t.fn.reverse=[].reverse,t(document).on("mouseenter.fixedActionBtn",".fixed-action-btn:not(.click-to-toggle):not(.toolbar)",function(i){var n=t(this);e(n)}),t(document).on("mouseleave.fixedActionBtn",".fixed-action-btn:not(.click-to-toggle):not(.toolbar)",function(e){var n=t(this);i(n)}),t(document).on("click.fabClickToggle",".fixed-action-btn.click-to-toggle > a",function(n){var o=t(this).parent();o.hasClass("active")?i(o):e(o)}),t(document).on("click.fabToolbar",".fixed-action-btn.toolbar > a",function(e){var i=t(this).parent();n(i)})}),t.fn.extend({openFAB:function(){e(t(this))},closeFAB:function(){i(t(this))},openToolbar:function(){n(t(this))},closeToolbar:function(){o(t(this))}});var e=function(e){var i=e;if(!1===i.hasClass("active")){var n,o;!0===i.hasClass("horizontal")?o=40:n=40,i.addClass("active"),i.find("ul .btn-floating").velocity({scaleY:".4",scaleX:".4",translateY:n+"px",translateX:o+"px"},{duration:0});var a=0;i.find("ul .btn-floating").reverse().each(function(){t(this).velocity({opacity:"1",scaleX:"1",scaleY:"1",translateY:"0",translateX:"0"},{duration:80,delay:a}),a+=40})}},i=function(t){var e,i,n=t;!0===n.hasClass("horizontal")?i=40:e=40,n.removeClass("active");n.find("ul .btn-floating").velocity("stop",!0),n.find("ul .btn-floating").velocity({opacity:"0",scaleX:".4",scaleY:".4",translateY:e+"px",translateX:i+"px"},{duration:80})},n=function(e){if("true"!==e.attr("data-open")){var i,n,a,r=window.innerWidth,s=window.innerHeight,l=e[0].getBoundingClientRect(),c=e.find("> a").first(),u=e.find("> ul").first(),d=t('
          '),p=c.css("background-color");c.append(d),i=l.left-r/2+l.width/2,n=s-l.bottom,a=r/d.width(),e.attr("data-origin-bottom",l.bottom),e.attr("data-origin-left",l.left),e.attr("data-origin-width",l.width),e.addClass("active"),e.attr("data-open",!0),e.css({"text-align":"center",width:"100%",bottom:0,left:0,transform:"translateX("+i+"px)",transition:"none"}),c.css({transform:"translateY("+-n+"px)",transition:"none"}),d.css({"background-color":p}),setTimeout(function(){e.css({transform:"",transition:"transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s"}),c.css({overflow:"visible",transform:"",transition:"transform .2s"}),setTimeout(function(){e.css({overflow:"hidden","background-color":p}),d.css({transform:"scale("+a+")",transition:"transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)"}),u.find("> li > a").css({opacity:1}),t(window).on("scroll.fabToolbarClose",function(){o(e),t(window).off("scroll.fabToolbarClose"),t(document).off("click.fabToolbarClose")}),t(document).on("click.fabToolbarClose",function(i){t(i.target).closest(u).length||(o(e),t(window).off("scroll.fabToolbarClose"),t(document).off("click.fabToolbarClose"))})},100)},0)}},o=function(t){if("true"===t.attr("data-open")){var e,i,n=window.innerWidth,o=window.innerHeight,a=t.attr("data-origin-width"),r=t.attr("data-origin-bottom"),s=t.attr("data-origin-left"),l=t.find("> .btn-floating").first(),c=t.find("> ul").first(),u=t.find(".fab-backdrop"),d=l.css("background-color");e=s-n/2+a/2,i=o-r,n/u.width(),t.removeClass("active"),t.attr("data-open",!1),t.css({"background-color":"transparent",transition:"none"}),l.css({transition:"none"}),u.css({transform:"scale(0)","background-color":d}),c.find("> li > a").css({opacity:""}),setTimeout(function(){u.remove(),t.css({"text-align":"",width:"",bottom:"",left:"",overflow:"","background-color":"",transform:"translate3d("+-e+"px,0,0)"}),l.css({overflow:"",transform:"translate3d(0,"+i+"px,0)"}),setTimeout(function(){t.css({transform:"translate3d(0,0,0)",transition:"transform .2s"}),l.css({transform:"translate3d(0,0,0)",transition:"transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)"})},20)},200)}}}(jQuery),function(t){Materialize.fadeInImage=function(e){var i;if("string"==typeof e)i=t(e);else{if("object"!=typeof e)return;i=e}i.css({opacity:0}),t(i).velocity({opacity:1},{duration:650,queue:!1,easing:"easeOutSine"}),t(i).velocity({opacity:1},{duration:1300,queue:!1,easing:"swing",step:function(e,i){i.start=100;var n=e/100,o=150-(100-e)/1.75;o<100&&(o=100),e>=0&&t(this).css({"-webkit-filter":"grayscale("+n+")brightness("+o+"%)",filter:"grayscale("+n+")brightness("+o+"%)"})}})},Materialize.showStaggeredList=function(e){var i;if("string"==typeof e)i=t(e);else{if("object"!=typeof e)return;i=e}var n=0;i.find("li").velocity({translateX:"-100px"},{duration:0}),i.find("li").each(function(){t(this).velocity({opacity:"1",translateX:"0"},{duration:800,delay:n,easing:[60,10]}),n+=120})},t(document).ready(function(){var e=!1,i=!1;t(".dismissable").each(function(){t(this).hammer({prevent_default:!1}).on("pan",function(n){if("touch"===n.gesture.pointerType){var o=t(this),a=n.gesture.direction,r=n.gesture.deltaX,s=n.gesture.velocityX;o.velocity({translateX:r},{duration:50,queue:!1,easing:"easeOutQuad"}),4===a&&(r>o.innerWidth()/2||s<-.75)&&(e=!0),2===a&&(r<-1*o.innerWidth()/2||s>.75)&&(i=!0)}}).on("panend",function(n){if(Math.abs(n.gesture.deltaX)s.getBoundingClientRect().top+window.pageYOffset+a&&!0!==n.done&&("function"==typeof r?r.call(this,s):"string"==typeof r&&new Function(r)(s),n.done=!0)}},n=Materialize.throttle(function(){i()},t.throttle||100);e||(window.addEventListener("scroll",n),window.addEventListener("resize",n),e=!0),setTimeout(n,0)}}(jQuery),function(t){Materialize.Picker=t(jQuery)}(function(t){function e(a,s,u,d){function p(){return e._.node("div",e._.node("div",e._.node("div",e._.node("div",T.component.nodes(b.open),k.box),k.wrap),k.frame),k.holder)}function h(){x.data(s,T).addClass(k.input).attr("tabindex",-1).val(x.data("value")?T.get("select",w.format):a.value),w.editable||x.on("focus."+b.id+" click."+b.id,function(t){t.preventDefault(),T.$root.eq(0).focus()}).on("keydown."+b.id,m),o(a,{haspopup:!0,expanded:!1,readonly:!1,owns:a.id+"_root"})}function f(){T.$root.on({keydown:m,focusin:function(t){T.$root.removeClass(k.focused),t.stopPropagation()},"mousedown click":function(e){var i=e.target;i!=T.$root.children()[0]&&(e.stopPropagation(),"mousedown"!=e.type||t(i).is("input, select, textarea, button, option")||(e.preventDefault(),T.$root.eq(0).focus()))}}).on({focus:function(){x.addClass(k.target)},blur:function(){x.removeClass(k.target)}}).on("focus.toOpen",g).on("click","[data-pick], [data-nav], [data-clear], [data-close]",function(){var e=t(this),i=e.data(),n=e.hasClass(k.navDisabled)||e.hasClass(k.disabled),o=r();o=o&&(o.type||o.href)&&o,(n||o&&!t.contains(T.$root[0],o))&&T.$root.eq(0).focus(),!n&&i.nav?T.set("highlight",T.component.item.highlight,{nav:i.nav}):!n&&"pick"in i?(T.set("select",i.pick),w.closeOnSelect&&T.close(!0)):i.clear?(T.clear(),w.closeOnSelect&&T.close(!0)):i.close&&T.close(!0)}),o(T.$root[0],"hidden",!0)}function v(){var e;!0===w.hiddenName?(e=a.name,a.name=""):e=(e=["string"==typeof w.hiddenPrefix?w.hiddenPrefix:"","string"==typeof w.hiddenSuffix?w.hiddenSuffix:"_submit"])[0]+a.name+e[1],T._hidden=t('")[0],x.on("change."+b.id,function(){T._hidden.value=a.value?T.get("select",w.formatSubmit):""}),w.container?t(w.container).append(T._hidden):x.before(T._hidden)}function m(t){var e=t.keyCode,i=/^(8|46)$/.test(e);if(27==e)return T.close(),!1;(32==e||i||!b.open&&T.component.key[e])&&(t.preventDefault(),t.stopPropagation(),i?T.clear().close():T.open())}function g(t){t.stopPropagation(),"focus"==t.type&&T.$root.addClass(k.focused),T.open()}if(!a)return e;var y=!1,b={id:a.id||"P"+Math.abs(~~(Math.random()*new Date))},w=u?t.extend(!0,{},u.defaults,d):d||{},k=t.extend({},e.klasses(),w.klass),x=t(a),C=function(){return this.start()},T=C.prototype={constructor:C,$node:x,start:function(){return b&&b.start?T:(b.methods={},b.start=!0,b.open=!1,b.type=a.type,a.autofocus=a==r(),a.readOnly=!w.editable,a.id=a.id||b.id,"text"!=a.type&&(a.type="text"),T.component=new u(T,w),T.$root=t(e._.node("div",p(),k.picker,'id="'+a.id+'_root" tabindex="0"')),f(),w.formatSubmit&&v(),h(),w.container?t(w.container).append(T.$root):x.before(T.$root),T.on({start:T.component.onStart,render:T.component.onRender,stop:T.component.onStop,open:T.component.onOpen,close:T.component.onClose,set:T.component.onSet}).on({start:w.onStart,render:w.onRender,stop:w.onStop,open:w.onOpen,close:w.onClose,set:w.onSet}),y=i(T.$root.children()[0]),a.autofocus&&T.open(),T.trigger("start").trigger("render"))},render:function(t){return t?T.$root.html(p()):T.$root.find("."+k.box).html(T.component.nodes(b.open)),T.trigger("render")},stop:function(){return b.start?(T.close(),T._hidden&&T._hidden.parentNode.removeChild(T._hidden),T.$root.remove(),x.removeClass(k.input).removeData(s),setTimeout(function(){x.off("."+b.id)},0),a.type=b.type,a.readOnly=!1,T.trigger("stop"),b.methods={},b.start=!1,T):T},open:function(i){return b.open?T:(x.addClass(k.active),o(a,"expanded",!0),setTimeout(function(){T.$root.addClass(k.opened),o(T.$root[0],"hidden",!1)},0),!1!==i&&(b.open=!0,y&&c.css("overflow","hidden").css("padding-right","+="+n()),T.$root.eq(0).focus(),l.on("click."+b.id+" focusin."+b.id,function(t){var e=t.target;e!=a&&e!=document&&3!=t.which&&T.close(e===T.$root.children()[0])}).on("keydown."+b.id,function(i){var n=i.keyCode,o=T.component.key[n],a=i.target;27==n?T.close(!0):a!=T.$root[0]||!o&&13!=n?t.contains(T.$root[0],a)&&13==n&&(i.preventDefault(),a.click()):(i.preventDefault(),o?e._.trigger(T.component.key.go,T,[e._.trigger(o)]):T.$root.find("."+k.highlighted).hasClass(k.disabled)||(T.set("select",T.component.item.highlight),w.closeOnSelect&&T.close(!0)))})),T.trigger("open"))},close:function(t){return t&&(T.$root.off("focus.toOpen").eq(0).focus(),setTimeout(function(){T.$root.on("focus.toOpen",g)},0)),x.removeClass(k.active),o(a,"expanded",!1),setTimeout(function(){T.$root.removeClass(k.opened+" "+k.focused),o(T.$root[0],"hidden",!0)},0),b.open?(b.open=!1,y&&c.css("overflow","").css("padding-right","-="+n()),l.off("."+b.id),T.trigger("close")):T},clear:function(t){return T.set("clear",null,t)},set:function(e,i,n){var o,a,r=t.isPlainObject(e),s=r?e:{};if(n=r&&t.isPlainObject(i)?i:n||{},e){r||(s[e]=i);for(o in s)a=s[o],o in T.component.item&&(void 0===a&&(a=null),T.component.set(o,a,n)),"select"!=o&&"clear"!=o||x.val("clear"==o?"":T.get(o,w.format)).trigger("change");T.render()}return n.muted?T:T.trigger("set",s)},get:function(t,i){if(t=t||"value",null!=b[t])return b[t];if("valueSubmit"==t){if(T._hidden)return T._hidden.value;t="value"}if("value"==t)return a.value;if(t in T.component.item){if("string"==typeof i){var n=T.component.get(t);return n?e._.trigger(T.component.formats.toString,T.component,[i,n]):""}return T.component.get(t)}},on:function(e,i,n){var o,a,r=t.isPlainObject(e),s=r?e:{};if(e){r||(s[e]=i);for(o in s)a=s[o],n&&(o="_"+o),b.methods[o]=b.methods[o]||[],b.methods[o].push(a)}return T},off:function(){var t,e,i=arguments;for(t=0,namesCount=i.length;t').appendTo("body"),i=e[0].offsetWidth;e.css("overflow","scroll");var n=t('
          ').appendTo(e)[0].offsetWidth;return e.remove(),i-n}function o(e,i,n){if(t.isPlainObject(i))for(var o in i)a(e,o,i[o]);else a(e,i,n)}function a(t,e,i){t.setAttribute(("role"==e?"":"aria-")+e,i)}function r(){try{return document.activeElement}catch(t){}}var s=t(window),l=t(document),c=t(document.documentElement);return e.klasses=function(t){return t=t||"picker",{picker:t,opened:t+"--opened",focused:t+"--focused",input:t+"__input",active:t+"__input--active",target:t+"__input--target",holder:t+"__holder",frame:t+"__frame",wrap:t+"__wrap",box:t+"__box"}},e._={group:function(t){for(var i,n="",o=e._.trigger(t.min,t);o<=e._.trigger(t.max,t,[o]);o+=t.i)i=e._.trigger(t.item,t,[o]),n+=e._.node(t.node,i[0],i[1],i[2]);return n},node:function(e,i,n,o){return i?(i=t.isArray(i)?i.join(""):i,n=n?' class="'+n+'"':"",o=o?" "+o:"","<"+e+n+o+">"+i+""):""},lead:function(t){return(t<10?"0":"")+t},trigger:function(t,e,i){return"function"==typeof t?t.apply(e,i||[]):t},digits:function(t){return/\d/.test(t[1])?2:1},isDate:function(t){return{}.toString.call(t).indexOf("Date")>-1&&this.isInteger(t.getDate())},isInteger:function(t){return{}.toString.call(t).indexOf("Number")>-1&&t%1==0},ariaAttr:function(e,i){t.isPlainObject(e)||(e={attribute:i}),i="";for(var n in e){var o=("role"==n?"":"aria-")+n;i+=null==e[n]?"":o+'="'+e[n]+'"'}return i}},e.extend=function(i,n){t.fn[i]=function(o,a){var r=this.data(i);return"picker"==o?r:r&&"string"==typeof o?e._.trigger(r[o],r,[a]):this.each(function(){t(this).data(i)||new e(this,i,n,o)})},t.fn[i].defaults=n.defaults},e}),function(t){t(Materialize.Picker,jQuery)}(function(t,e){function i(t,e){var i=this,n=t.$node[0],o=n.value,a=t.$node.data("value"),r=a||o,s=a?e.formatSubmit:e.format,l=function(){return n.currentStyle?"rtl"==n.currentStyle.direction:"rtl"==getComputedStyle(t.$root[0]).direction};i.settings=e,i.$node=t.$node,i.queue={min:"measure create",max:"measure create",now:"now create",select:"parse create validate",highlight:"parse navigate create validate",view:"parse create validate viewset",disable:"deactivate",enable:"activate"},i.item={},i.item.clear=null,i.item.disable=(e.disable||[]).slice(0),i.item.enable=-function(t){return!0===t[0]?t.shift():-1}(i.item.disable),i.set("min",e.min).set("max",e.max).set("now"),r?i.set("select",r,{format:s}):i.set("select",null).set("highlight",i.item.now),i.key={40:7,38:-7,39:function(){return l()?-1:1},37:function(){return l()?1:-1},go:function(t){var e=i.item.highlight,n=new Date(e.year,e.month,e.date+t);i.set("highlight",n,{interval:t}),this.render()}},t.on("render",function(){t.$root.find("."+e.klass.selectMonth).on("change",function(){var i=this.value;i&&(t.set("highlight",[t.get("view").year,i,t.get("highlight").date]),t.$root.find("."+e.klass.selectMonth).trigger("focus"))}),t.$root.find("."+e.klass.selectYear).on("change",function(){var i=this.value;i&&(t.set("highlight",[i,t.get("view").month,t.get("highlight").date]),t.$root.find("."+e.klass.selectYear).trigger("focus"))})},1).on("open",function(){var n="";i.disabled(i.get("now"))&&(n=":not(."+e.klass.buttonToday+")"),t.$root.find("button"+n+", select").attr("disabled",!1)},1).on("close",function(){t.$root.find("button, select").attr("disabled",!0)},1)}var n=t._;i.prototype.set=function(t,e,i){var n=this,o=n.item;return null===e?("clear"==t&&(t="select"),o[t]=e,n):(o["enable"==t?"disable":"flip"==t?"enable":t]=n.queue[t].split(" ").map(function(o){return e=n[o](t,e,i)}).pop(),"select"==t?n.set("highlight",o.select,i):"highlight"==t?n.set("view",o.highlight,i):t.match(/^(flip|min|max|disable|enable)$/)&&(o.select&&n.disabled(o.select)&&n.set("select",o.select,i),o.highlight&&n.disabled(o.highlight)&&n.set("highlight",o.highlight,i)),n)},i.prototype.get=function(t){return this.item[t]},i.prototype.create=function(t,i,o){var a,r=this;return i=void 0===i?t:i,i==-1/0||i==1/0?a=i:e.isPlainObject(i)&&n.isInteger(i.pick)?i=i.obj:e.isArray(i)?(i=new Date(i[0],i[1],i[2]),i=n.isDate(i)?i:r.create().obj):i=n.isInteger(i)||n.isDate(i)?r.normalize(new Date(i),o):r.now(t,i,o),{year:a||i.getFullYear(),month:a||i.getMonth(),date:a||i.getDate(),day:a||i.getDay(),obj:a||i,pick:a||i.getTime()}},i.prototype.createRange=function(t,i){var o=this,a=function(t){return!0===t||e.isArray(t)||n.isDate(t)?o.create(t):t};return n.isInteger(t)||(t=a(t)),n.isInteger(i)||(i=a(i)),n.isInteger(t)&&e.isPlainObject(i)?t=[i.year,i.month,i.date+t]:n.isInteger(i)&&e.isPlainObject(t)&&(i=[t.year,t.month,t.date+i]),{from:a(t),to:a(i)}},i.prototype.withinRange=function(t,e){return t=this.createRange(t.from,t.to),e.pick>=t.from.pick&&e.pick<=t.to.pick},i.prototype.overlapRanges=function(t,e){var i=this;return t=i.createRange(t.from,t.to),e=i.createRange(e.from,e.to),i.withinRange(t,e.from)||i.withinRange(t,e.to)||i.withinRange(e,t.from)||i.withinRange(e,t.to)},i.prototype.now=function(t,e,i){return e=new Date,i&&i.rel&&e.setDate(e.getDate()+i.rel),this.normalize(e,i)},i.prototype.navigate=function(t,i,n){var o,a,r,s,l=e.isArray(i),c=e.isPlainObject(i),u=this.item.view;if(l||c){for(c?(a=i.year,r=i.month,s=i.date):(a=+i[0],r=+i[1],s=+i[2]),n&&n.nav&&u&&u.month!==r&&(a=u.year,r=u.month),a=(o=new Date(a,r+(n&&n.nav?n.nav:0),1)).getFullYear(),r=o.getMonth();new Date(a,r,s).getMonth()!==r;)s-=1;i=[a,r,s]}return i},i.prototype.normalize=function(t){return t.setHours(0,0,0,0),t},i.prototype.measure=function(t,e){var i=this;return e?"string"==typeof e?e=i.parse(t,e):n.isInteger(e)&&(e=i.now(t,e,{rel:e})):e="min"==t?-1/0:1/0,e},i.prototype.viewset=function(t,e){return this.create([e.year,e.month,1])},i.prototype.validate=function(t,i,o){var a,r,s,l,c=this,u=i,d=o&&o.interval?o.interval:1,p=-1===c.item.enable,h=c.item.min,f=c.item.max,v=p&&c.item.disable.filter(function(t){if(e.isArray(t)){var o=c.create(t).pick;oi.pick&&(r=!0)}return n.isInteger(t)}).length;if((!o||!o.nav)&&(!p&&c.disabled(i)||p&&c.disabled(i)&&(v||a||r)||!p&&(i.pick<=h.pick||i.pick>=f.pick)))for(p&&!v&&(!r&&d>0||!a&&d<0)&&(d*=-1);c.disabled(i)&&(Math.abs(d)>1&&(i.monthu.month)&&(i=u,d=d>0?1:-1),i.pick<=h.pick?(s=!0,d=1,i=c.create([h.year,h.month,h.date+(i.pick===h.pick?0:-1)])):i.pick>=f.pick&&(l=!0,d=-1,i=c.create([f.year,f.month,f.date+(i.pick===f.pick?0:1)])),!s||!l);)i=c.create([i.year,i.month,i.date+d]);return i},i.prototype.disabled=function(t){var i=this,o=i.item.disable.filter(function(o){return n.isInteger(o)?t.day===(i.settings.firstDay?o:o-1)%7:e.isArray(o)||n.isDate(o)?t.pick===i.create(o).pick:e.isPlainObject(o)?i.withinRange(o,t):void 0});return o=o.length&&!o.filter(function(t){return e.isArray(t)&&"inverted"==t[3]||e.isPlainObject(t)&&t.inverted}).length,-1===i.item.enable?!o:o||t.picki.item.max.pick},i.prototype.parse=function(t,e,i){var o=this,a={};return e&&"string"==typeof e?(i&&i.format||((i=i||{}).format=o.settings.format),o.formats.toArray(i.format).map(function(t){var i=o.formats[t],r=i?n.trigger(i,o,[e,a]):t.replace(/^!/,"").length;i&&(a[t]=e.substr(0,r)),e=e.substr(r)}),[a.yyyy||a.yy,+(a.mm||a.m)-1,a.dd||a.d]):e},i.prototype.formats=function(){function t(t,e,i){var n=t.match(/\w+/)[0];return i.mm||i.m||(i.m=e.indexOf(n)+1),n.length}function e(t){return t.match(/\w+/)[0].length}return{d:function(t,e){return t?n.digits(t):e.date},dd:function(t,e){return t?2:n.lead(e.date)},ddd:function(t,i){return t?e(t):this.settings.weekdaysShort[i.day]},dddd:function(t,i){return t?e(t):this.settings.weekdaysFull[i.day]},m:function(t,e){return t?n.digits(t):e.month+1},mm:function(t,e){return t?2:n.lead(e.month+1)},mmm:function(e,i){var n=this.settings.monthsShort;return e?t(e,n,i):n[i.month]},mmmm:function(e,i){var n=this.settings.monthsFull;return e?t(e,n,i):n[i.month]},yy:function(t,e){return t?2:(""+e.year).slice(2)},yyyy:function(t,e){return t?4:e.year},toArray:function(t){return t.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g)},toString:function(t,e){var i=this;return i.formats.toArray(t).map(function(t){return n.trigger(i.formats[t],i,[0,e])||t.replace(/^!/,"")}).join("")}}}(),i.prototype.isDateExact=function(t,i){var o=this;return n.isInteger(t)&&n.isInteger(i)||"boolean"==typeof t&&"boolean"==typeof i?t===i:(n.isDate(t)||e.isArray(t))&&(n.isDate(i)||e.isArray(i))?o.create(t).pick===o.create(i).pick:!(!e.isPlainObject(t)||!e.isPlainObject(i))&&(o.isDateExact(t.from,i.from)&&o.isDateExact(t.to,i.to))},i.prototype.isDateOverlap=function(t,i){var o=this,a=o.settings.firstDay?1:0;return n.isInteger(t)&&(n.isDate(i)||e.isArray(i))?(t=t%7+a)===o.create(i).day+1:n.isInteger(i)&&(n.isDate(t)||e.isArray(t))?(i=i%7+a)===o.create(t).day+1:!(!e.isPlainObject(t)||!e.isPlainObject(i))&&o.overlapRanges(t,i)},i.prototype.flipEnable=function(t){var e=this.item;e.enable=t||(-1==e.enable?1:-1)},i.prototype.deactivate=function(t,i){var o=this,a=o.item.disable.slice(0);return"flip"==i?o.flipEnable():!1===i?(o.flipEnable(1),a=[]):!0===i?(o.flipEnable(-1),a=[]):i.map(function(t){for(var i,r=0;r=d.year&&l.month>=d.month||!t&&l.year<=u.year&&l.month<=u.month?" "+i.klass.navDisabled:""),"data-nav="+(t||-1)+" "+n.ariaAttr({role:"button",controls:e.$node[0].id+"_table"})+' title="'+(t?i.labelMonthNext:i.labelMonthPrev)+'"')},f=function(o){var a=i.showMonthsShort?i.monthsShort:i.monthsFull;return"short_months"==o&&(a=i.monthsShort),i.selectMonths&&void 0==o?n.node("select",n.group({min:0,max:11,i:1,node:"option",item:function(t){return[a[t],0,"value="+t+(l.month==t?" selected":"")+(l.year==u.year&&td.month?" disabled":"")]}}),i.klass.selectMonth+" browser-default",(t?"":"disabled")+" "+n.ariaAttr({controls:e.$node[0].id+"_table"})+' title="'+i.labelMonthSelect+'"'):"short_months"==o?null!=r?a[r.month]:a[l.month]:n.node("div",a[l.month],i.klass.month)},v=function(o){var a=l.year,s=!0===i.selectYears?5:~~(i.selectYears/2);if(s){var c=u.year,p=d.year,h=a-s,f=a+s;if(c>h&&(f+=c-h,h=c),pm?m:v,f=p}if(i.selectYears&&void 0==o)return n.node("select",n.group({min:h,max:f,i:1,node:"option",item:function(t){return[t,0,"value="+t+(a==t?" selected":"")]}}),i.klass.selectYear+" browser-default",(t?"":"disabled")+" "+n.ariaAttr({controls:e.$node[0].id+"_table"})+' title="'+i.labelYearSelect+'"')}return"raw"===o&&null!=r?n.node("div",r.year):n.node("div",a,i.klass.year)};return createDayLabel=function(){return null!=r?r.date:a.date},createWeekdayLabel=function(){var t;return t=null!=r?r.day:a.day,i.weekdaysShort[t]},n.node("div",n.node("div",v("raw"),i.klass.year_display)+n.node("span",createWeekdayLabel()+", ","picker__weekday-display")+n.node("span",f("short_months")+" ",i.klass.month_display)+n.node("span",createDayLabel(),i.klass.day_display),i.klass.date_display)+n.node("div",n.node("div",n.node("div",(i.selectYears,f()+v()+h()+h(1)),i.klass.header)+n.node("table",p+n.node("tbody",n.group({min:0,max:5,i:1,node:"tr",item:function(t){var o=i.firstDay&&0===e.create([l.year,l.month,1]).day?-7:0;return[n.group({min:7*t-l.day+o+1,max:function(){return this.min+7-1},i:1,node:"td",item:function(t){t=e.create([l.year,l.month,t+(i.firstDay?1:0)]);var o=r&&r.pick==t.pick,p=s&&s.pick==t.pick,h=c&&e.disabled(t)||t.pickd.pick,f=n.trigger(e.formats.toString,e,[i.format,t]);return[n.node("div",t.date,function(e){return e.push(l.month==t.month?i.klass.infocus:i.klass.outfocus),a.pick==t.pick&&e.push(i.klass.now),o&&e.push(i.klass.selected),p&&e.push(i.klass.highlighted),h&&e.push(i.klass.disabled),e.join(" ")}([i.klass.day]),"data-pick="+t.pick+" "+n.ariaAttr({role:"gridcell",label:f,selected:!(!o||e.$node.val()!==f)||null,activedescendant:!!p||null,disabled:!!h||null})+" "+(h?"":'tabindex="0"')),"",n.ariaAttr({role:"presentation"})]}})]}})),i.klass.table,'id="'+e.$node[0].id+'_table" '+n.ariaAttr({role:"grid",controls:e.$node[0].id,readonly:!0})),i.klass.calendar_container)+n.node("div",n.node("button",i.today,"btn-flat picker__today waves-effect","type=button data-pick="+a.pick+(t&&!e.disabled(a)?"":" disabled")+" "+n.ariaAttr({controls:e.$node[0].id}))+n.node("button",i.clear,"btn-flat picker__clear waves-effect","type=button data-clear=1"+(t?"":" disabled")+" "+n.ariaAttr({controls:e.$node[0].id}))+n.node("button",i.close,"btn-flat picker__close waves-effect","type=button data-close=true "+(t?"":" disabled")+" "+n.ariaAttr({controls:e.$node[0].id})),i.klass.footer),"picker__container__wrapper")},i.defaults=function(t){return{labelMonthNext:"Next month",labelMonthPrev:"Previous month",labelMonthSelect:"Select a month",labelYearSelect:"Select a year",monthsFull:["January","February","March","April","May","June","July","August","September","October","November","December"],monthsShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],weekdaysFull:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],weekdaysShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],weekdaysLetter:["S","M","T","W","T","F","S"],today:"Today",clear:"Clear",close:"Ok",closeOnSelect:!1,format:"d mmmm, yyyy",klass:{table:t+"table",header:t+"header",date_display:t+"date-display",day_display:t+"day-display",month_display:t+"month-display",year_display:t+"year-display",calendar_container:t+"calendar-container",navPrev:t+"nav--prev",navNext:t+"nav--next",navDisabled:t+"nav--disabled",month:t+"month",year:t+"year",selectMonth:t+"select--month",selectYear:t+"select--year",weekdays:t+"weekday",day:t+"day",disabled:t+"day--disabled",selected:t+"day--selected",highlighted:t+"day--highlighted",now:t+"day--today",infocus:t+"day--infocus",outfocus:t+"day--outfocus",footer:t+"footer",buttonClear:t+"button--clear",buttonToday:t+"button--today",buttonClose:t+"button--close"}}}(t.klasses().picker+"__"),t.extend("pickadate",i)}),function(t){function e(t){return document.createElementNS(l,t)}function i(t){return(t<10?"0":"")+t}function n(t){var e=++m+"";return t?t+e:e}function o(o,r){function l(t,e){var i=d.offset(),n=/^touch/.test(t.type),o=i.left+g,a=i.top+g,l=(n?t.originalEvent.touches[0]:t).pageX-o,c=(n?t.originalEvent.touches[0]:t).pageY-a,u=Math.sqrt(l*l+c*c),p=!1;if(!e||!(uy+w)){t.preventDefault();var v=setTimeout(function(){E.popover.addClass("clockpicker-moving")},200);E.setHand(l,c,!e,!0),s.off(h).on(h,function(t){t.preventDefault();var e=/^touch/.test(t.type),i=(e?t.originalEvent.touches[0]:t).pageX-o,n=(e?t.originalEvent.touches[0]:t).pageY-a;(p||i!==l||n!==c)&&(p=!0,E.setHand(i,n,!1,!0))}),s.off(f).on(f,function(t){s.off(f),t.preventDefault();var i=/^touch/.test(t.type),n=(i?t.originalEvent.changedTouches[0]:t).pageX-o,u=(i?t.originalEvent.changedTouches[0]:t).pageY-a;(e||p)&&n===l&&u===c&&E.setHand(n,u),"hours"===E.currentView?E.toggleView("minutes",x/2):r.autoclose&&(E.minutesView.addClass("clockpicker-dial-out"),setTimeout(function(){E.done()},x/2)),d.prepend(z),clearTimeout(v),E.popover.removeClass("clockpicker-moving"),s.off(h)})}}var u=t(C),d=u.find(".clockpicker-plate"),v=u.find(".picker__holder"),m=u.find(".clockpicker-hours"),T=u.find(".clockpicker-minutes"),S=u.find(".clockpicker-am-pm-block"),P="INPUT"===o.prop("tagName"),A=P?o:o.find("input"),O=t("label[for="+A.attr("id")+"]"),E=this;this.id=n("cp"),this.element=o,this.holder=v,this.options=r,this.isAppended=!1,this.isShown=!1,this.currentView="hours",this.isInput=P,this.input=A,this.label=O,this.popover=u,this.plate=d,this.hoursView=m,this.minutesView=T,this.amPmBlock=S,this.spanHours=u.find(".clockpicker-span-hours"),this.spanMinutes=u.find(".clockpicker-span-minutes"),this.spanAmPm=u.find(".clockpicker-span-am-pm"),this.footer=u.find(".picker__footer"),this.amOrPm="PM",r.twelvehour&&(r.ampmclickable?(this.spanAmPm.empty(),t('
          AM
          ').on("click",function(){E.spanAmPm.children("#click-am").addClass("text-primary"),E.spanAmPm.children("#click-pm").removeClass("text-primary"),E.amOrPm="AM"}).appendTo(this.spanAmPm),t('
          PM
          ').on("click",function(){E.spanAmPm.children("#click-pm").addClass("text-primary"),E.spanAmPm.children("#click-am").removeClass("text-primary"),E.amOrPm="PM"}).appendTo(this.spanAmPm)):(this.spanAmPm.empty(),t('
          AM
          ').appendTo(this.spanAmPm),t('
          PM
          ').appendTo(this.spanAmPm))),t('").click(t.proxy(this.clear,this)).appendTo(this.footer),t('").click(t.proxy(this.hide,this)).appendTo(this.footer),t('").click(t.proxy(this.done,this)).appendTo(this.footer),this.spanHours.click(t.proxy(this.toggleView,this,"hours")),this.spanMinutes.click(t.proxy(this.toggleView,this,"minutes")),A.on("focus.clockpicker click.clockpicker",t.proxy(this.show,this));var _,M,I,D,q=t('
          ');if(r.twelvehour)for(_=1;_<13;_+=1)M=q.clone(),I=_/6*Math.PI,D=y,M.css({left:g+Math.sin(I)*D-w,top:g-Math.cos(I)*D-w}),M.html(0===_?"00":_),m.append(M),M.on(p,l);else for(_=0;_<24;_+=1)M=q.clone(),I=_/6*Math.PI,D=_>0&&_<13?b:y,M.css({left:g+Math.sin(I)*D-w,top:g-Math.cos(I)*D-w}),M.html(0===_?"00":_),m.append(M),M.on(p,l);for(_=0;_<60;_+=5)M=q.clone(),I=_/30*Math.PI,M.css({left:g+Math.sin(I)*y-w,top:g-Math.cos(I)*y-w}),M.html(i(_)),T.append(M),M.on(p,l);if(d.on(p,function(e){0===t(e.target).closest(".clockpicker-tick").length&&l(e,!0)}),c){var z=u.find(".clockpicker-canvas"),V=e("svg");V.setAttribute("class","clockpicker-svg"),V.setAttribute("width",k),V.setAttribute("height",k);var H=e("g");H.setAttribute("transform","translate("+g+","+g+")");var L=e("circle");L.setAttribute("class","clockpicker-canvas-bearing"),L.setAttribute("cx",0),L.setAttribute("cy",0),L.setAttribute("r",4);var j=e("line");j.setAttribute("x1",0),j.setAttribute("y1",0);var $=e("circle");$.setAttribute("class","clockpicker-canvas-bg"),$.setAttribute("r",w),H.appendChild(j),H.appendChild($),H.appendChild(L),V.appendChild(H),z.append(V),this.hand=j,this.bg=$,this.bearing=L,this.g=H,this.canvas=z}a(this.options.init)}function a(t){t&&"function"==typeof t&&t()}var r=t(window),s=t(document),l="http://www.w3.org/2000/svg",c="SVGAngle"in window&&function(){var t,e=document.createElement("div");return e.innerHTML="",t=(e.firstChild&&e.firstChild.namespaceURI)==l,e.innerHTML="",t}(),u=function(){var t=document.createElement("div").style;return"transition"in t||"WebkitTransition"in t||"MozTransition"in t||"msTransition"in t||"OTransition"in t}(),d="ontouchstart"in window,p="mousedown"+(d?" touchstart":""),h="mousemove.clockpicker"+(d?" touchmove.clockpicker":""),f="mouseup.clockpicker"+(d?" touchend.clockpicker":""),v=navigator.vibrate?"vibrate":navigator.webkitVibrate?"webkitVibrate":null,m=0,g=135,y=105,b=70,w=20,k=2*g,x=u?350:1,C=['
          ','
          ','
          ','
          ','
          ','
          ','
          ','
          ','',":",'',"
          ",'
          ','
          ',"
          ","
          ","
          ",'
          ','
          ','
          ','
          ','
          ','
          ',"
          ",'
          ',"
          ","
          ",'","
          ","
          ","
          ","
          ","
          ","
          "].join("");o.DEFAULTS={default:"",fromnow:0,donetext:"Ok",cleartext:"Clear",canceltext:"Cancel",autoclose:!1,ampmclickable:!0,darktheme:!1,twelvehour:!0,vibrate:!0},o.prototype.toggle=function(){this[this.isShown?"hide":"show"]()},o.prototype.locate=function(){var t=this.element,e=this.popover;t.offset(),t.outerWidth(),t.outerHeight(),this.options.align;e.show()},o.prototype.show=function(e){if(!this.isShown){a(this.options.beforeShow),t(":input").each(function(){t(this).attr("tabindex",-1)});var n=this;this.input.blur(),this.popover.addClass("picker--opened"),this.input.addClass("picker__input picker__input--active"),t(document.body).css("overflow","hidden");var o=((this.input.prop("value")||this.options.default||"")+"").split(":");if(this.options.twelvehour&&void 0!==o[1]&&(o[1].indexOf("AM")>0?this.amOrPm="AM":this.amOrPm="PM",o[1]=o[1].replace("AM","").replace("PM","")),"now"===o[0]){var l=new Date(+new Date+this.options.fromnow);o=[l.getHours(),l.getMinutes()],this.options.twelvehour&&(this.amOrPm=o[0]>=12&&o[0]<24?"PM":"AM")}if(this.hours=+o[0]||0,this.minutes=+o[1]||0,this.spanHours.html(this.hours),this.spanMinutes.html(i(this.minutes)),!this.isAppended){var c=document.querySelector(this.options.container);this.options.container&&c?c.appendChild(this.popover[0]):this.popover.insertAfter(this.input),this.options.twelvehour&&("PM"===this.amOrPm?(this.spanAmPm.children("#click-pm").addClass("text-primary"),this.spanAmPm.children("#click-am").removeClass("text-primary")):(this.spanAmPm.children("#click-am").addClass("text-primary"),this.spanAmPm.children("#click-pm").removeClass("text-primary"))),r.on("resize.clockpicker"+this.id,function(){n.isShown&&n.locate()}),this.isAppended=!0}this.toggleView("hours"),this.locate(),this.isShown=!0,s.on("click.clockpicker."+this.id+" focusin.clockpicker."+this.id,function(e){var i=t(e.target);0===i.closest(n.popover.find(".picker__wrap")).length&&0===i.closest(n.input).length&&n.hide()}),s.on("keyup.clockpicker."+this.id,function(t){27===t.keyCode&&n.hide()}),a(this.options.afterShow)}},o.prototype.hide=function(){a(this.options.beforeHide),this.input.removeClass("picker__input picker__input--active"),this.popover.removeClass("picker--opened"),t(document.body).css("overflow","visible"),this.isShown=!1,t(":input").each(function(e){t(this).attr("tabindex",e+1)}),s.off("click.clockpicker."+this.id+" focusin.clockpicker."+this.id),s.off("keyup.clockpicker."+this.id),this.popover.hide(),a(this.options.afterHide)},o.prototype.toggleView=function(e,i){var n=!1;"minutes"===e&&"visible"===t(this.hoursView).css("visibility")&&(a(this.options.beforeHourSelect),n=!0);var o="hours"===e,r=o?this.hoursView:this.minutesView,s=o?this.minutesView:this.hoursView;this.currentView=e,this.spanHours.toggleClass("text-primary",o),this.spanMinutes.toggleClass("text-primary",!o),s.addClass("clockpicker-dial-out"),r.css("visibility","visible").removeClass("clockpicker-dial-out"),this.resetClock(i),clearTimeout(this.toggleViewTimer),this.toggleViewTimer=setTimeout(function(){s.css("visibility","hidden")},x),n&&a(this.options.afterHourSelect)},o.prototype.resetClock=function(t){var e=this.currentView,i=this[e],n="hours"===e,o=i*(Math.PI/(n?6:30)),a=n&&i>0&&i<13?b:y,r=Math.sin(o)*a,s=-Math.cos(o)*a,l=this;c&&t?(l.canvas.addClass("clockpicker-canvas-out"),setTimeout(function(){l.canvas.removeClass("clockpicker-canvas-out"),l.setHand(r,s)},t)):this.setHand(r,s)},o.prototype.setHand=function(e,n,o,a){var r,s=Math.atan2(e,-n),l="hours"===this.currentView,u=Math.PI/(l||o?6:30),d=Math.sqrt(e*e+n*n),p=this.options,h=l&&d<(y+b)/2,f=h?b:y;if(p.twelvehour&&(f=y),s<0&&(s=2*Math.PI+s),r=Math.round(s/u),s=r*u,p.twelvehour?l?0===r&&(r=12):(o&&(r*=5),60===r&&(r=0)):l?(12===r&&(r=0),r=h?0===r?12:r:0===r?0:r+12):(o&&(r*=5),60===r&&(r=0)),this[this.currentView]!==r&&v&&this.options.vibrate&&(this.vibrateTimer||(navigator[v](10),this.vibrateTimer=setTimeout(t.proxy(function(){this.vibrateTimer=null},this),100))),this[this.currentView]=r,l?this.spanHours.html(r):this.spanMinutes.html(i(r)),c){var m=Math.sin(s)*(f-w),g=-Math.cos(s)*(f-w),k=Math.sin(s)*f,x=-Math.cos(s)*f;this.hand.setAttribute("x2",m),this.hand.setAttribute("y2",g),this.bg.setAttribute("cx",k),this.bg.setAttribute("cy",x)}else this[l?"hoursView":"minutesView"].find(".clockpicker-tick").each(function(){var e=t(this);e.toggleClass("active",r===+e.html())})},o.prototype.done=function(){a(this.options.beforeDone),this.hide(),this.label.addClass("active");var t=this.input.prop("value"),e=i(this.hours)+":"+i(this.minutes);this.options.twelvehour&&(e+=this.amOrPm),this.input.prop("value",e),e!==t&&(this.input.triggerHandler("change"),this.isInput||this.element.trigger("change")),this.options.autoclose&&this.input.trigger("blur"),a(this.options.afterDone)},o.prototype.clear=function(){this.hide(),this.label.removeClass("active");var t=this.input.prop("value");this.input.prop("value",""),""!==t&&(this.input.triggerHandler("change"),this.isInput||this.element.trigger("change")),this.options.autoclose&&this.input.trigger("blur")},o.prototype.remove=function(){this.element.removeData("clockpicker"),this.input.off("focus.clockpicker click.clockpicker"),this.isShown&&this.hide(),this.isAppended&&(r.off("resize.clockpicker"+this.id),this.popover.remove())},t.fn.pickatime=function(e){var i=Array.prototype.slice.call(arguments,1);return this.each(function(){var n=t(this),a=n.data("clockpicker");if(a)"function"==typeof a[e]&&a[e].apply(a,i);else{var r=t.extend({},o.DEFAULTS,n.data(),"object"==typeof e&&e);n.data("clockpicker",new o(n,r))}})}}(jQuery),function(t){function e(){var e=+t(this).attr("data-length"),i=+t(this).val().length,n=i<=e;t(this).parent().find('span[class="character-counter"]').html(i+"/"+e),o(n,t(this))}function i(e){var i=e.parent().find('span[class="character-counter"]');i.length||(i=t("").addClass("character-counter").css("float","right").css("font-size","12px").css("height",1),e.parent().append(i))}function n(){t(this).parent().find('span[class="character-counter"]').html("")}function o(t,e){var i=e.hasClass("invalid");t&&i?e.removeClass("invalid"):t||i||(e.removeClass("valid"),e.addClass("invalid"))}t.fn.characterCounter=function(){return this.each(function(){var o=t(this);o.parent().find('span[class="character-counter"]').length||void 0!==o.attr("data-length")&&(o.on("input",e),o.on("focus",e),o.on("blur",n),i(o))})},t(document).ready(function(){t("input, textarea").characterCounter()})}(jQuery),function(t){var e={init:function(e){var i={duration:200,dist:-100,shift:0,padding:0,fullWidth:!1,indicators:!1,noWrap:!1,onCycleTo:null};e=t.extend(i,e);var n=Materialize.objectSelectorString(t(this));return this.each(function(i){function o(t){return t.targetTouches&&t.targetTouches.length>=1?t.targetTouches[0].clientX:t.clientX}function a(t){return t.targetTouches&&t.targetTouches.length>=1?t.targetTouches[0].clientY:t.clientY}function r(t){return t>=C?t%C:t<0?r(C+t%C):t}function s(i){E=!0,j.hasClass("scrolling")||j.addClass("scrolling"),null!=H&&window.clearTimeout(H),H=window.setTimeout(function(){E=!1,j.removeClass("scrolling")},e.duration);var n,o,a,s,l,c,u,d=w;if(b="number"==typeof i?i:b,w=Math.floor((b+x/2)/x),a=b-w*x,s=a<0?1:-1,l=-s*a*2/x,o=C>>1,e.fullWidth?u="translateX(0)":(u="translateX("+(j[0].clientWidth-m)/2+"px) ",u+="translateY("+(j[0].clientHeight-g)/2+"px)"),N){var p=w%C,h=V.find(".indicator-item.active");h.index()!==p&&(h.removeClass("active"),V.find(".indicator-item").eq(p).addClass("active"))}for((!W||w>=0&&w0?1-l:1):(zTranslation=e.dist*(2*n-l*s),tweenedOpacity=1-.2*(2*n-l*s)),(!W||w-n>=0)&&((c=v[r(w-n)]).style[_]=u+" translateX("+(-e.shift+(-x*n-a)/2)+"px) translateZ("+zTranslation+"px)",c.style.zIndex=-n,c.style.opacity=tweenedOpacity,c.style.display="block");if((!W||w>=0&&w2||i<-2?(s(A-i),requestAnimationFrame(c)):s(A))}function u(i){if(q)return i.preventDefault(),i.stopPropagation(),!1;if(!e.fullWidth){var n=t(i.target).closest(".carousel-item").index();0!==r(w)-n&&(i.preventDefault(),i.stopPropagation()),d(n)}}function d(t){var e=w%C-t;W||(e<0?Math.abs(e+C)0&&Math.abs(e-C)0&&j.trigger("carouselPrev",[e])}function p(e){"mousedown"===e.type&&t(e.target).is("img")&&e.preventDefault(),k=!0,q=!1,z=!1,T=o(e),S=a(e),O=P=0,M=b,I=Date.now(),clearInterval(D),D=setInterval(l,100)}function h(t){var e,i;if(k)if(e=o(t),y=a(t),i=T-e,Math.abs(S-y)<30&&!z)(i>2||i<-2)&&(q=!0,T=e,s(b+i));else{if(q)return t.preventDefault(),t.stopPropagation(),!1;z=!0}if(q)return t.preventDefault(),t.stopPropagation(),!1}function f(t){if(k)return k=!1,clearInterval(D),A=b,(O>10||O<-10)&&(A=b+(P=.9*O)),A=Math.round(A/x)*x,W&&(A>=x*(C-1)?A=x*(C-1):A<0&&(A=0)),P=A-b,I=Date.now(),requestAnimationFrame(c),q&&(t.preventDefault(),t.stopPropagation()),!1}var v,m,g,b,w,k,x,C,T,S,P,A,O,E,_,M,I,D,q,z,V=t('
            '),H=null,L=null,j=t(this),$=j.find(".carousel-item").length>1,N=(j.attr("data-indicators")||e.indicators)&&$,W=j.attr("data-no-wrap")||e.noWrap||!$,F=j.attr("data-namespace")||n+i;j.attr("data-namespace",F);var Q=function(e){var i=j.find(".carousel-item.active").length?j.find(".carousel-item.active").first():j.find(".carousel-item").first(),n=i.find("img").first();if(n.length)if(n[0].complete)if(n.height()>0)j.css("height",n.height());else{var o=n[0].naturalWidth,a=n[0].naturalHeight,r=j.width()/o*a;j.css("height",r)}else n.on("load",function(){j.css("height",t(this).height())});else if(!e){var s=i.height();j.css("height",s)}};if(e.fullWidth&&(e.dist=0,Q(),N&&j.find(".carousel-fixed-item").addClass("with-indicators")),j.hasClass("initialized"))return t(window).trigger("resize"),j.trigger("carouselNext",[1e-6]),!0;j.addClass("initialized"),k=!1,b=A=0,v=[],m=j.find(".carousel-item").first().innerWidth(),g=j.find(".carousel-item").first().innerHeight(),x=2*m+e.padding,j.find(".carousel-item").each(function(e){if(v.push(t(this)[0]),N){var i=t('
          • ');0===e&&i.addClass("active"),i.click(function(e){e.stopPropagation(),d(t(this).index())}),V.append(i)}}),N&&j.append(V),C=v.length,_="transform",["webkit","Moz","O","ms"].every(function(t){var e=t+"Transform";return void 0===document.body.style[e]||(_=e,!1)});var X=Materialize.throttle(function(){if(e.fullWidth){m=j.find(".carousel-item").first().innerWidth();j.find(".carousel-item.active").height();x=2*m+e.padding,A=b=2*w*m,Q(!0)}else s()},200);t(window).off("resize.carousel-"+F).on("resize.carousel-"+F,X),void 0!==window.ontouchstart&&(j.on("touchstart.carousel",p),j.on("touchmove.carousel",h),j.on("touchend.carousel",f)),j.on("mousedown.carousel",p),j.on("mousemove.carousel",h),j.on("mouseup.carousel",f),j.on("mouseleave.carousel",f),j.on("click.carousel",u),s(b),t(this).on("carouselNext",function(t,e,i){void 0===e&&(e=1),"function"==typeof i&&(L=i),A=x*Math.round(b/x)+x*e,b!==A&&(P=A-b,I=Date.now(),requestAnimationFrame(c))}),t(this).on("carouselPrev",function(t,e,i){void 0===e&&(e=1),"function"==typeof i&&(L=i),A=x*Math.round(b/x)-x*e,b!==A&&(P=A-b,I=Date.now(),requestAnimationFrame(c))}),t(this).on("carouselSet",function(t,e,i){void 0===e&&(e=0),"function"==typeof i&&(L=i),d(e)})})},next:function(e,i){t(this).trigger("carouselNext",[e,i])},prev:function(e,i){t(this).trigger("carouselPrev",[e,i])},set:function(e,i){t(this).trigger("carouselSet",[e,i])},destroy:function(){var e=t(this).attr("data-namespace");t(this).removeAttr("data-namespace"),t(this).removeClass("initialized"),t(this).find(".indicators").remove(),t(this).off("carouselNext carouselPrev carouselSet"),t(window).off("resize.carousel-"+e),void 0!==window.ontouchstart&&t(this).off("touchstart.carousel touchmove.carousel touchend.carousel"),t(this).off("mousedown.carousel mousemove.carousel mouseup.carousel mouseleave.carousel click.carousel")}};t.fn.carousel=function(i){return e[i]?e[i].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof i&&i?void t.error("Method "+i+" does not exist on jQuery.carousel"):e.init.apply(this,arguments)}}(jQuery),function(t){var e={init:function(e){return this.each(function(){var i=t("#"+t(this).attr("data-activates")),n=(t("body"),t(this)),o=n.parent(".tap-target-wrapper"),a=o.find(".tap-target-wave"),r=o.find(".tap-target-origin"),s=n.find(".tap-target-content");o.length||(o=n.wrap(t('
            ')).parent()),s.length||(s=t('
            '),n.append(s)),a.length||(a=t('
            '),r.length||((r=i.clone(!0,!0)).addClass("tap-target-origin"),r.removeAttr("id"),r.removeAttr("style"),a.append(r)),o.append(a));var l=function(){o.is(".open")&&(o.removeClass("open"),r.off("click.tapTarget"),t(document).off("click.tapTarget"),t(window).off("resize.tapTarget"))},c=function(){var e="fixed"===i.css("position");if(!e)for(var r=i.parents(),l=0;lv,b=d<=m,w=d>m,k=p>=.25*h&&p<=.75*h,x=n.outerWidth(),C=n.outerHeight(),T=d+u/2-C/2,S=p+c/2-x/2,P=e?"fixed":"absolute",A=k?x:x/2+c,O=C/2,E=b?C/2:0,_=g&&!k?x/2-c:0,M=c,I=w?"bottom":"top",D=2*c,q=D,z=C/2-q/2,V=x/2-D/2,H={};H.top=b?T:"",H.right=y?h-S-x:"",H.bottom=w?f-T-C:"",H.left=g?S:"",H.position=P,o.css(H),s.css({width:A,height:O,top:E,right:0,bottom:0,left:_,padding:M,verticalAlign:I}),a.css({top:z,left:V,width:D,height:q})};"open"==e&&(c(),o.is(".open")||(o.addClass("open"),setTimeout(function(){r.off("click.tapTarget").on("click.tapTarget",function(t){l(),r.off("click.tapTarget")}),t(document).off("click.tapTarget").on("click.tapTarget",function(e){l(),t(document).off("click.tapTarget")});var e=Materialize.throttle(function(){c()},200);t(window).off("resize.tapTarget").on("resize.tapTarget",e)},0))),"close"==e&&l()})},open:function(){},close:function(){}};t.fn.tapTarget=function(i){if(e[i]||"object"==typeof i)return e.init.apply(this,arguments);t.error("Method "+i+" does not exist on jQuery.tap-target")}}(jQuery); \ No newline at end of file